diff --git a/README.md b/README.md index ca421f4..158bf74 100644 --- a/README.md +++ b/README.md @@ -1,13 +1,13 @@ -# Codecov GitHub Action +# Codecov GitHub Action [![GitHub Marketplace](https://img.shields.io/badge/Marketplace-v1-undefined.svg?logo=github&logoColor=white&style=flat)](https://github.com/marketplace/actions/codecov) -### Easily upload coverage reports to Codecov from GitHub Actions +### Easily upload coverage reports to Codecov from GitHub Actions >The latest release of this Action adds support for tokenless uploads from GitHub Actions! ## Usage -To integrate Codecov with your Actions pipeline, specify the name of this repository with a tag number (`@v1` is recommended) as a `step` within your `workflow.yml` file. +To integrate Codecov with your Actions pipeline, specify the name of this repository with a tag number (`@v1` is recommended) as a `step` within your `workflow.yml` file. If you have a *private repository*, this Action also requires you to [provide an upload token](https://docs.codecov.io/docs/frequently-asked-questions#section-where-is-the-repository-upload-token-found-) from [codecov.io](https://www.codecov.io) (tip: in order to avoid exposing your token, store it as a `secret`). Optionally, you can choose to include up to four additional inputs to customize the upload context. **For public repositories, no token is needed** @@ -24,11 +24,11 @@ steps: name: codecov-umbrella # optional fail_ci_if_error: true # optional (default = false) ``` ->**Note**: This assumes that you've set your Codecov token inside *Settings > Secrets* as `CODECOV_TOKEN`. If not, you can [get an upload token](https://docs.codecov.io/docs/frequently-asked-questions#section-where-is-the-repository-upload-token-found-) for your specific repo on [codecov.io](https://www.codecov.io). Keep in mind that secrets are *not* available to forks of repositories. +>**Note**: This assumes that you've set your Codecov token inside *Settings > Secrets* as `CODECOV_TOKEN`. If not, you can [get an upload token](https://docs.codecov.io/docs/frequently-asked-questions#section-where-is-the-repository-upload-token-found-) for your specific repo on [codecov.io](https://www.codecov.io). Keep in mind that secrets are *not* available to forks of repositories. ## Arguments -Codecov's Action currently supports five inputs from the user: `token`, `file`, `flags`,`name`, and `fail_ci_if_error`. These inputs, along with their descriptions and usage contexts, are listed in the table below: +Codecov's Action currently supports five inputs from the user: `token`, `file`, `flags`,`name`, and `fail_ci_if_error`. These inputs, along with their descriptions and usage contexts, are listed in the table below: >**Update**: We've removed the `yml` parameter with the latest release of this action. Please put your custom codecov yaml file at the root of the repo because other locations will no longer be supported in the future. @@ -37,6 +37,7 @@ Codecov's Action currently supports five inputs from the user: `token`, `file`, | `token` | Used to authorize coverage report uploads | *Required for private repos* | | `file` | Path to the coverage report(s) | Optional | `flags` | Flag the upload to group coverage metrics (unittests, uitests, etc.). Multiple flags are separated by a comma (ui,chrome) | Optional +| `env_vars` | Environment variables to tag the upload with. Multiple env variables can be separated with commas (e.g. `OS,PYTHON`) | Optional | `name` | Custom defined name for the upload | Optional | `fail_ci_if_error` | Specify if CI pipeline should fail when Codecov runs into errors during upload. *Defaults to **false*** | Optional @@ -49,11 +50,14 @@ jobs: run: runs-on: ${{ matrix.os }} strategy: - matrix: + matrix: os: [ubuntu-latest, macos-latest, windows-latest] + env: + OS: ${{ matrix.os }} + PYTHON: '3.7' steps: - uses: actions/checkout@master - - name: Setup Python + - name: Setup Python uses: actions/setup-python@master with: python-version: 3.7 @@ -62,12 +66,13 @@ jobs: pip install pytest pip install pytest-cov pytest --cov=./ --cov-report=xml - - name: Upload coverage to Codecov + - name: Upload coverage to Codecov uses: codecov/codecov-action@v1 with: token: ${{ secrets.CODECOV_TOKEN }} file: ./coverage.xml flags: unittests + env_vars: OS,PYTHON name: codecov-umbrella fail_ci_if_error: true ``` @@ -75,6 +80,6 @@ jobs: Contributions are welcome! Check out the [Contribution Guide](CONTRIBUTING.md). -## License +## License The code in this project is released under the [MIT License](LICENSE). diff --git a/action.yml b/action.yml index 4175e38..6b28544 100644 --- a/action.yml +++ b/action.yml @@ -1,26 +1,28 @@ name: 'Codecov' description: 'GitHub Action that uploads coverage reports for your repository to codecov.io' author: 'Ibrahim Ali <@ibrahim0814> | Codecov' -inputs: +inputs: name: description: 'User defined upload name. Visible in Codecov UI' - required: false + required: false token: description: 'Repository upload token - get it from codecov.io. Required only for private repositories' - required: false + required: false file: description: 'Path to coverage file to upload' required: false flags: description: 'Flag upload to group coverage metrics (e.g. unittests | integration | ui,chrome)' required: false + env_vars: + description: 'Environment variables to tag the upload with (e.g. PYTHON | OS,PYTHON)' + required: false fail_ci_if_error: description: 'Specify whether or not CI build should fail if Codecov runs into an error during upload' required: false branding: - color: 'red' + color: 'red' icon: 'umbrella' runs: using: 'node12' main: 'dist/index.js' - diff --git a/dist/index.js b/dist/index.js index a841e5e..a40317e 100644 --- a/dist/index.js +++ b/dist/index.js @@ -34,7 +34,7 @@ module.exports = /******/ // the startup function /******/ function startup() { /******/ // Load entry module and return exports -/******/ return __webpack_require__(622); +/******/ return __webpack_require__(104); /******/ }; /******/ /******/ // run startup @@ -43,42 +43,1318 @@ module.exports = /************************************************************************/ /******/ ({ -/***/ 3: +/***/ 1: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +"use strict"; + +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +Object.defineProperty(exports, "__esModule", { value: true }); +const childProcess = __webpack_require__(129); +const path = __webpack_require__(622); +const util_1 = __webpack_require__(669); +const ioUtil = __webpack_require__(672); +const exec = util_1.promisify(childProcess.exec); +/** + * Copies a file or folder. + * Based off of shelljs - https://github.com/shelljs/shelljs/blob/9237f66c52e5daa40458f94f9565e18e8132f5a6/src/cp.js + * + * @param source source path + * @param dest destination path + * @param options optional. See CopyOptions. + */ +function cp(source, dest, options = {}) { + return __awaiter(this, void 0, void 0, function* () { + const { force, recursive } = readCopyOptions(options); + const destStat = (yield ioUtil.exists(dest)) ? yield ioUtil.stat(dest) : null; + // Dest is an existing file, but not forcing + if (destStat && destStat.isFile() && !force) { + return; + } + // If dest is an existing directory, should copy inside. + const newDest = destStat && destStat.isDirectory() + ? path.join(dest, path.basename(source)) + : dest; + if (!(yield ioUtil.exists(source))) { + throw new Error(`no such file or directory: ${source}`); + } + const sourceStat = yield ioUtil.stat(source); + if (sourceStat.isDirectory()) { + if (!recursive) { + throw new Error(`Failed to copy. ${source} is a directory, but tried to copy without recursive flag.`); + } + else { + yield cpDirRecursive(source, newDest, 0, force); + } + } + else { + if (path.relative(source, newDest) === '') { + // a file cannot be copied to itself + throw new Error(`'${newDest}' and '${source}' are the same file`); + } + yield copyFile(source, newDest, force); + } + }); +} +exports.cp = cp; +/** + * Moves a path. + * + * @param source source path + * @param dest destination path + * @param options optional. See MoveOptions. + */ +function mv(source, dest, options = {}) { + return __awaiter(this, void 0, void 0, function* () { + if (yield ioUtil.exists(dest)) { + let destExists = true; + if (yield ioUtil.isDirectory(dest)) { + // If dest is directory copy src into dest + dest = path.join(dest, path.basename(source)); + destExists = yield ioUtil.exists(dest); + } + if (destExists) { + if (options.force == null || options.force) { + yield rmRF(dest); + } + else { + throw new Error('Destination already exists'); + } + } + } + yield mkdirP(path.dirname(dest)); + yield ioUtil.rename(source, dest); + }); +} +exports.mv = mv; +/** + * Remove a path recursively with force + * + * @param inputPath path to remove + */ +function rmRF(inputPath) { + return __awaiter(this, void 0, void 0, function* () { + if (ioUtil.IS_WINDOWS) { + // Node doesn't provide a delete operation, only an unlink function. This means that if the file is being used by another + // program (e.g. antivirus), it won't be deleted. To address this, we shell out the work to rd/del. + try { + if (yield ioUtil.isDirectory(inputPath, true)) { + yield exec(`rd /s /q "${inputPath}"`); + } + else { + yield exec(`del /f /a "${inputPath}"`); + } + } + catch (err) { + // if you try to delete a file that doesn't exist, desired result is achieved + // other errors are valid + if (err.code !== 'ENOENT') + throw err; + } + // Shelling out fails to remove a symlink folder with missing source, this unlink catches that + try { + yield ioUtil.unlink(inputPath); + } + catch (err) { + // if you try to delete a file that doesn't exist, desired result is achieved + // other errors are valid + if (err.code !== 'ENOENT') + throw err; + } + } + else { + let isDir = false; + try { + isDir = yield ioUtil.isDirectory(inputPath); + } + catch (err) { + // if you try to delete a file that doesn't exist, desired result is achieved + // other errors are valid + if (err.code !== 'ENOENT') + throw err; + return; + } + if (isDir) { + yield exec(`rm -rf "${inputPath}"`); + } + else { + yield ioUtil.unlink(inputPath); + } + } + }); +} +exports.rmRF = rmRF; +/** + * Make a directory. Creates the full path with folders in between + * Will throw if it fails + * + * @param fsPath path to create + * @returns Promise + */ +function mkdirP(fsPath) { + return __awaiter(this, void 0, void 0, function* () { + yield ioUtil.mkdirP(fsPath); + }); +} +exports.mkdirP = mkdirP; +/** + * Returns path of a tool had the tool actually been invoked. Resolves via paths. + * If you check and the tool does not exist, it will throw. + * + * @param tool name of the tool + * @param check whether to check if tool exists + * @returns Promise path to tool + */ +function which(tool, check) { + return __awaiter(this, void 0, void 0, function* () { + if (!tool) { + throw new Error("parameter 'tool' is required"); + } + // recursive when check=true + if (check) { + const result = yield which(tool, false); + if (!result) { + if (ioUtil.IS_WINDOWS) { + throw new Error(`Unable to locate executable file: ${tool}. Please verify either the file path exists or the file can be found within a directory specified by the PATH environment variable. Also verify the file has a valid extension for an executable file.`); + } + else { + throw new Error(`Unable to locate executable file: ${tool}. Please verify either the file path exists or the file can be found within a directory specified by the PATH environment variable. Also check the file mode to verify the file is executable.`); + } + } + } + try { + // build the list of extensions to try + const extensions = []; + if (ioUtil.IS_WINDOWS && process.env.PATHEXT) { + for (const extension of process.env.PATHEXT.split(path.delimiter)) { + if (extension) { + extensions.push(extension); + } + } + } + // if it's rooted, return it if exists. otherwise return empty. + if (ioUtil.isRooted(tool)) { + const filePath = yield ioUtil.tryGetExecutablePath(tool, extensions); + if (filePath) { + return filePath; + } + return ''; + } + // if any path separators, return empty + if (tool.includes('/') || (ioUtil.IS_WINDOWS && tool.includes('\\'))) { + return ''; + } + // build the list of directories + // + // Note, technically "where" checks the current directory on Windows. From a toolkit perspective, + // it feels like we should not do this. Checking the current directory seems like more of a use + // case of a shell, and the which() function exposed by the toolkit should strive for consistency + // across platforms. + const directories = []; + if (process.env.PATH) { + for (const p of process.env.PATH.split(path.delimiter)) { + if (p) { + directories.push(p); + } + } + } + // return the first match + for (const directory of directories) { + const filePath = yield ioUtil.tryGetExecutablePath(directory + path.sep + tool, extensions); + if (filePath) { + return filePath; + } + } + return ''; + } + catch (err) { + throw new Error(`which failed with message ${err.message}`); + } + }); +} +exports.which = which; +function readCopyOptions(options) { + const force = options.force == null ? true : options.force; + const recursive = Boolean(options.recursive); + return { force, recursive }; +} +function cpDirRecursive(sourceDir, destDir, currentDepth, force) { + return __awaiter(this, void 0, void 0, function* () { + // Ensure there is not a run away recursive copy + if (currentDepth >= 255) + return; + currentDepth++; + yield mkdirP(destDir); + const files = yield ioUtil.readdir(sourceDir); + for (const fileName of files) { + const srcFile = `${sourceDir}/${fileName}`; + const destFile = `${destDir}/${fileName}`; + const srcFileStat = yield ioUtil.lstat(srcFile); + if (srcFileStat.isDirectory()) { + // Recurse + yield cpDirRecursive(srcFile, destFile, currentDepth, force); + } + else { + yield copyFile(srcFile, destFile, force); + } + } + // Change the mode for the newly created directory + yield ioUtil.chmod(destDir, (yield ioUtil.stat(sourceDir)).mode); + }); +} +// Buffered file copy +function copyFile(srcFile, destFile, force) { + return __awaiter(this, void 0, void 0, function* () { + if ((yield ioUtil.lstat(srcFile)).isSymbolicLink()) { + // unlink/re-link it + try { + yield ioUtil.lstat(destFile); + yield ioUtil.unlink(destFile); + } + catch (e) { + // Try to override file permission + if (e.code === 'EPERM') { + yield ioUtil.chmod(destFile, '0666'); + yield ioUtil.unlink(destFile); + } + // other errors = it doesn't exist, no work to do + } + // Copy over symlink + const symlinkFull = yield ioUtil.readlink(srcFile); + yield ioUtil.symlink(symlinkFull, destFile, ioUtil.IS_WINDOWS ? 'junction' : null); + } + else if (!(yield ioUtil.exists(destFile)) || force) { + yield ioUtil.copyFile(srcFile, destFile); + } + }); +} +//# sourceMappingURL=io.js.map + +/***/ }), + +/***/ 9: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +"use strict"; + +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +Object.defineProperty(exports, "__esModule", { value: true }); +const os = __webpack_require__(87); +const events = __webpack_require__(614); +const child = __webpack_require__(129); +const path = __webpack_require__(622); +const io = __webpack_require__(1); +const ioUtil = __webpack_require__(672); +/* eslint-disable @typescript-eslint/unbound-method */ +const IS_WINDOWS = process.platform === 'win32'; +/* + * Class for running command line tools. Handles quoting and arg parsing in a platform agnostic way. + */ +class ToolRunner extends events.EventEmitter { + constructor(toolPath, args, options) { + super(); + if (!toolPath) { + throw new Error("Parameter 'toolPath' cannot be null or empty."); + } + this.toolPath = toolPath; + this.args = args || []; + this.options = options || {}; + } + _debug(message) { + if (this.options.listeners && this.options.listeners.debug) { + this.options.listeners.debug(message); + } + } + _getCommandString(options, noPrefix) { + const toolPath = this._getSpawnFileName(); + const args = this._getSpawnArgs(options); + let cmd = noPrefix ? '' : '[command]'; // omit prefix when piped to a second tool + if (IS_WINDOWS) { + // Windows + cmd file + if (this._isCmdFile()) { + cmd += toolPath; + for (const a of args) { + cmd += ` ${a}`; + } + } + // Windows + verbatim + else if (options.windowsVerbatimArguments) { + cmd += `"${toolPath}"`; + for (const a of args) { + cmd += ` ${a}`; + } + } + // Windows (regular) + else { + cmd += this._windowsQuoteCmdArg(toolPath); + for (const a of args) { + cmd += ` ${this._windowsQuoteCmdArg(a)}`; + } + } + } + else { + // OSX/Linux - this can likely be improved with some form of quoting. + // creating processes on Unix is fundamentally different than Windows. + // on Unix, execvp() takes an arg array. + cmd += toolPath; + for (const a of args) { + cmd += ` ${a}`; + } + } + return cmd; + } + _processLineBuffer(data, strBuffer, onLine) { + try { + let s = strBuffer + data.toString(); + let n = s.indexOf(os.EOL); + while (n > -1) { + const line = s.substring(0, n); + onLine(line); + // the rest of the string ... + s = s.substring(n + os.EOL.length); + n = s.indexOf(os.EOL); + } + strBuffer = s; + } + catch (err) { + // streaming lines to console is best effort. Don't fail a build. + this._debug(`error processing line. Failed with error ${err}`); + } + } + _getSpawnFileName() { + if (IS_WINDOWS) { + if (this._isCmdFile()) { + return process.env['COMSPEC'] || 'cmd.exe'; + } + } + return this.toolPath; + } + _getSpawnArgs(options) { + if (IS_WINDOWS) { + if (this._isCmdFile()) { + let argline = `/D /S /C "${this._windowsQuoteCmdArg(this.toolPath)}`; + for (const a of this.args) { + argline += ' '; + argline += options.windowsVerbatimArguments + ? a + : this._windowsQuoteCmdArg(a); + } + argline += '"'; + return [argline]; + } + } + return this.args; + } + _endsWith(str, end) { + return str.endsWith(end); + } + _isCmdFile() { + const upperToolPath = this.toolPath.toUpperCase(); + return (this._endsWith(upperToolPath, '.CMD') || + this._endsWith(upperToolPath, '.BAT')); + } + _windowsQuoteCmdArg(arg) { + // for .exe, apply the normal quoting rules that libuv applies + if (!this._isCmdFile()) { + return this._uvQuoteCmdArg(arg); + } + // otherwise apply quoting rules specific to the cmd.exe command line parser. + // the libuv rules are generic and are not designed specifically for cmd.exe + // command line parser. + // + // for a detailed description of the cmd.exe command line parser, refer to + // http://stackoverflow.com/questions/4094699/how-does-the-windows-command-interpreter-cmd-exe-parse-scripts/7970912#7970912 + // need quotes for empty arg + if (!arg) { + return '""'; + } + // determine whether the arg needs to be quoted + const cmdSpecialChars = [ + ' ', + '\t', + '&', + '(', + ')', + '[', + ']', + '{', + '}', + '^', + '=', + ';', + '!', + "'", + '+', + ',', + '`', + '~', + '|', + '<', + '>', + '"' + ]; + let needsQuotes = false; + for (const char of arg) { + if (cmdSpecialChars.some(x => x === char)) { + needsQuotes = true; + break; + } + } + // short-circuit if quotes not needed + if (!needsQuotes) { + return arg; + } + // the following quoting rules are very similar to the rules that by libuv applies. + // + // 1) wrap the string in quotes + // + // 2) double-up quotes - i.e. " => "" + // + // this is different from the libuv quoting rules. libuv replaces " with \", which unfortunately + // doesn't work well with a cmd.exe command line. + // + // note, replacing " with "" also works well if the arg is passed to a downstream .NET console app. + // for example, the command line: + // foo.exe "myarg:""my val""" + // is parsed by a .NET console app into an arg array: + // [ "myarg:\"my val\"" ] + // which is the same end result when applying libuv quoting rules. although the actual + // command line from libuv quoting rules would look like: + // foo.exe "myarg:\"my val\"" + // + // 3) double-up slashes that precede a quote, + // e.g. hello \world => "hello \world" + // hello\"world => "hello\\""world" + // hello\\"world => "hello\\\\""world" + // hello world\ => "hello world\\" + // + // technically this is not required for a cmd.exe command line, or the batch argument parser. + // the reasons for including this as a .cmd quoting rule are: + // + // a) this is optimized for the scenario where the argument is passed from the .cmd file to an + // external program. many programs (e.g. .NET console apps) rely on the slash-doubling rule. + // + // b) it's what we've been doing previously (by deferring to node default behavior) and we + // haven't heard any complaints about that aspect. + // + // note, a weakness of the quoting rules chosen here, is that % is not escaped. in fact, % cannot be + // escaped when used on the command line directly - even though within a .cmd file % can be escaped + // by using %%. + // + // the saving grace is, on the command line, %var% is left as-is if var is not defined. this contrasts + // the line parsing rules within a .cmd file, where if var is not defined it is replaced with nothing. + // + // one option that was explored was replacing % with ^% - i.e. %var% => ^%var^%. this hack would + // often work, since it is unlikely that var^ would exist, and the ^ character is removed when the + // variable is used. the problem, however, is that ^ is not removed when %* is used to pass the args + // to an external program. + // + // an unexplored potential solution for the % escaping problem, is to create a wrapper .cmd file. + // % can be escaped within a .cmd file. + let reverse = '"'; + let quoteHit = true; + for (let i = arg.length; i > 0; i--) { + // walk the string in reverse + reverse += arg[i - 1]; + if (quoteHit && arg[i - 1] === '\\') { + reverse += '\\'; // double the slash + } + else if (arg[i - 1] === '"') { + quoteHit = true; + reverse += '"'; // double the quote + } + else { + quoteHit = false; + } + } + reverse += '"'; + return reverse + .split('') + .reverse() + .join(''); + } + _uvQuoteCmdArg(arg) { + // Tool runner wraps child_process.spawn() and needs to apply the same quoting as + // Node in certain cases where the undocumented spawn option windowsVerbatimArguments + // is used. + // + // Since this function is a port of quote_cmd_arg from Node 4.x (technically, lib UV, + // see https://github.com/nodejs/node/blob/v4.x/deps/uv/src/win/process.c for details), + // pasting copyright notice from Node within this function: + // + // Copyright Joyent, Inc. and other Node contributors. All rights reserved. + // + // Permission is hereby granted, free of charge, to any person obtaining a copy + // of this software and associated documentation files (the "Software"), to + // deal in the Software without restriction, including without limitation the + // rights to use, copy, modify, merge, publish, distribute, sublicense, and/or + // sell copies of the Software, and to permit persons to whom the Software is + // furnished to do so, subject to the following conditions: + // + // The above copyright notice and this permission notice shall be included in + // all copies or substantial portions of the Software. + // + // THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + // IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + // FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + // AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + // LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING + // FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS + // IN THE SOFTWARE. + if (!arg) { + // Need double quotation for empty argument + return '""'; + } + if (!arg.includes(' ') && !arg.includes('\t') && !arg.includes('"')) { + // No quotation needed + return arg; + } + if (!arg.includes('"') && !arg.includes('\\')) { + // No embedded double quotes or backslashes, so I can just wrap + // quote marks around the whole thing. + return `"${arg}"`; + } + // Expected input/output: + // input : hello"world + // output: "hello\"world" + // input : hello""world + // output: "hello\"\"world" + // input : hello\world + // output: hello\world + // input : hello\\world + // output: hello\\world + // input : hello\"world + // output: "hello\\\"world" + // input : hello\\"world + // output: "hello\\\\\"world" + // input : hello world\ + // output: "hello world\\" - note the comment in libuv actually reads "hello world\" + // but it appears the comment is wrong, it should be "hello world\\" + let reverse = '"'; + let quoteHit = true; + for (let i = arg.length; i > 0; i--) { + // walk the string in reverse + reverse += arg[i - 1]; + if (quoteHit && arg[i - 1] === '\\') { + reverse += '\\'; + } + else if (arg[i - 1] === '"') { + quoteHit = true; + reverse += '\\'; + } + else { + quoteHit = false; + } + } + reverse += '"'; + return reverse + .split('') + .reverse() + .join(''); + } + _cloneExecOptions(options) { + options = options || {}; + const result = { + cwd: options.cwd || process.cwd(), + env: options.env || process.env, + silent: options.silent || false, + windowsVerbatimArguments: options.windowsVerbatimArguments || false, + failOnStdErr: options.failOnStdErr || false, + ignoreReturnCode: options.ignoreReturnCode || false, + delay: options.delay || 10000 + }; + result.outStream = options.outStream || process.stdout; + result.errStream = options.errStream || process.stderr; + return result; + } + _getSpawnOptions(options, toolPath) { + options = options || {}; + const result = {}; + result.cwd = options.cwd; + result.env = options.env; + result['windowsVerbatimArguments'] = + options.windowsVerbatimArguments || this._isCmdFile(); + if (options.windowsVerbatimArguments) { + result.argv0 = `"${toolPath}"`; + } + return result; + } + /** + * Exec a tool. + * Output will be streamed to the live console. + * Returns promise with return code + * + * @param tool path to tool to exec + * @param options optional exec options. See ExecOptions + * @returns number + */ + exec() { + return __awaiter(this, void 0, void 0, function* () { + // root the tool path if it is unrooted and contains relative pathing + if (!ioUtil.isRooted(this.toolPath) && + (this.toolPath.includes('/') || + (IS_WINDOWS && this.toolPath.includes('\\')))) { + // prefer options.cwd if it is specified, however options.cwd may also need to be rooted + this.toolPath = path.resolve(process.cwd(), this.options.cwd || process.cwd(), this.toolPath); + } + // if the tool is only a file name, then resolve it from the PATH + // otherwise verify it exists (add extension on Windows if necessary) + this.toolPath = yield io.which(this.toolPath, true); + return new Promise((resolve, reject) => { + this._debug(`exec tool: ${this.toolPath}`); + this._debug('arguments:'); + for (const arg of this.args) { + this._debug(` ${arg}`); + } + const optionsNonNull = this._cloneExecOptions(this.options); + if (!optionsNonNull.silent && optionsNonNull.outStream) { + optionsNonNull.outStream.write(this._getCommandString(optionsNonNull) + os.EOL); + } + const state = new ExecState(optionsNonNull, this.toolPath); + state.on('debug', (message) => { + this._debug(message); + }); + const fileName = this._getSpawnFileName(); + const cp = child.spawn(fileName, this._getSpawnArgs(optionsNonNull), this._getSpawnOptions(this.options, fileName)); + const stdbuffer = ''; + if (cp.stdout) { + cp.stdout.on('data', (data) => { + if (this.options.listeners && this.options.listeners.stdout) { + this.options.listeners.stdout(data); + } + if (!optionsNonNull.silent && optionsNonNull.outStream) { + optionsNonNull.outStream.write(data); + } + this._processLineBuffer(data, stdbuffer, (line) => { + if (this.options.listeners && this.options.listeners.stdline) { + this.options.listeners.stdline(line); + } + }); + }); + } + const errbuffer = ''; + if (cp.stderr) { + cp.stderr.on('data', (data) => { + state.processStderr = true; + if (this.options.listeners && this.options.listeners.stderr) { + this.options.listeners.stderr(data); + } + if (!optionsNonNull.silent && + optionsNonNull.errStream && + optionsNonNull.outStream) { + const s = optionsNonNull.failOnStdErr + ? optionsNonNull.errStream + : optionsNonNull.outStream; + s.write(data); + } + this._processLineBuffer(data, errbuffer, (line) => { + if (this.options.listeners && this.options.listeners.errline) { + this.options.listeners.errline(line); + } + }); + }); + } + cp.on('error', (err) => { + state.processError = err.message; + state.processExited = true; + state.processClosed = true; + state.CheckComplete(); + }); + cp.on('exit', (code) => { + state.processExitCode = code; + state.processExited = true; + this._debug(`Exit code ${code} received from tool '${this.toolPath}'`); + state.CheckComplete(); + }); + cp.on('close', (code) => { + state.processExitCode = code; + state.processExited = true; + state.processClosed = true; + this._debug(`STDIO streams have closed for tool '${this.toolPath}'`); + state.CheckComplete(); + }); + state.on('done', (error, exitCode) => { + if (stdbuffer.length > 0) { + this.emit('stdline', stdbuffer); + } + if (errbuffer.length > 0) { + this.emit('errline', errbuffer); + } + cp.removeAllListeners(); + if (error) { + reject(error); + } + else { + resolve(exitCode); + } + }); + }); + }); + } +} +exports.ToolRunner = ToolRunner; +/** + * Convert an arg string to an array of args. Handles escaping + * + * @param argString string of arguments + * @returns string[] array of arguments + */ +function argStringToArray(argString) { + const args = []; + let inQuotes = false; + let escaped = false; + let arg = ''; + function append(c) { + // we only escape double quotes. + if (escaped && c !== '"') { + arg += '\\'; + } + arg += c; + escaped = false; + } + for (let i = 0; i < argString.length; i++) { + const c = argString.charAt(i); + if (c === '"') { + if (!escaped) { + inQuotes = !inQuotes; + } + else { + append(c); + } + continue; + } + if (c === '\\' && escaped) { + append(c); + continue; + } + if (c === '\\' && inQuotes) { + escaped = true; + continue; + } + if (c === ' ' && !inQuotes) { + if (arg.length > 0) { + args.push(arg); + arg = ''; + } + continue; + } + append(c); + } + if (arg.length > 0) { + args.push(arg.trim()); + } + return args; +} +exports.argStringToArray = argStringToArray; +class ExecState extends events.EventEmitter { + constructor(options, toolPath) { + super(); + this.processClosed = false; // tracks whether the process has exited and stdio is closed + this.processError = ''; + this.processExitCode = 0; + this.processExited = false; // tracks whether the process has exited + this.processStderr = false; // tracks whether stderr was written to + this.delay = 10000; // 10 seconds + this.done = false; + this.timeout = null; + if (!toolPath) { + throw new Error('toolPath must not be empty'); + } + this.options = options; + this.toolPath = toolPath; + if (options.delay) { + this.delay = options.delay; + } + } + CheckComplete() { + if (this.done) { + return; + } + if (this.processClosed) { + this._setResult(); + } + else if (this.processExited) { + this.timeout = setTimeout(ExecState.HandleTimeout, this.delay, this); + } + } + _debug(message) { + this.emit('debug', message); + } + _setResult() { + // determine whether there is an error + let error; + if (this.processExited) { + if (this.processError) { + error = new Error(`There was an error when attempting to execute the process '${this.toolPath}'. This may indicate the process failed to start. Error: ${this.processError}`); + } + else if (this.processExitCode !== 0 && !this.options.ignoreReturnCode) { + error = new Error(`The process '${this.toolPath}' failed with exit code ${this.processExitCode}`); + } + else if (this.processStderr && this.options.failOnStdErr) { + error = new Error(`The process '${this.toolPath}' failed because one or more lines were written to the STDERR stream`); + } + } + // clear the timeout + if (this.timeout) { + clearTimeout(this.timeout); + this.timeout = null; + } + this.done = true; + this.emit('done', error, this.processExitCode); + } + static HandleTimeout(state) { + if (state.done) { + return; + } + if (!state.processClosed && state.processExited) { + const message = `The STDIO streams did not close within ${state.delay / + 1000} seconds of the exit event from process '${state.toolPath}'. This may indicate a child process inherited the STDIO streams and has not yet exited.`; + state._debug(message); + } + state._setResult(); + } +} +//# sourceMappingURL=toolrunner.js.map + +/***/ }), + +/***/ 13: /***/ (function(module) { -function HARError (errors) { - var message = 'validation failed' +"use strict"; - this.name = 'HARError' - this.message = message - this.errors = errors - if (typeof Error.captureStackTrace === 'function') { - Error.captureStackTrace(this, this.constructor) - } else { - this.stack = (new Error(message)).stack - } -} +var replace = String.prototype.replace; +var percentTwenties = /%20/g; -HARError.prototype = Error.prototype - -module.exports = HARError +module.exports = { + 'default': 'RFC3986', + formatters: { + RFC1738: function (value) { + return replace.call(value, percentTwenties, '+'); + }, + RFC3986: function (value) { + return value; + } + }, + RFC1738: 'RFC1738', + RFC3986: 'RFC3986' +}; /***/ }), -/***/ 6: +/***/ 16: +/***/ (function(module) { + +module.exports = require("tls"); + +/***/ }), + +/***/ 28: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate_comment(it, $keyword, $ruleType) { + var out = ' '; + var $schema = it.schema[$keyword]; + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $comment = it.util.toQuotedString($schema); + if (it.opts.$comment === true) { + out += ' console.log(' + ($comment) + ');'; + } else if (typeof it.opts.$comment == 'function') { + out += ' self._opts.$comment(' + ($comment) + ', ' + (it.util.toQuotedString($errSchemaPath)) + ', validate.root.schema);'; + } + return out; +} + + +/***/ }), + +/***/ 35: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate_propertyNames(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + out += 'var ' + ($errs) + ' = errors;'; + if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + var $key = 'key' + $lvl, + $idx = 'idx' + $lvl, + $i = 'i' + $lvl, + $invalidName = '\' + ' + $key + ' + \'', + $dataNxt = $it.dataLevel = it.dataLevel + 1, + $nextData = 'data' + $dataNxt, + $dataProperties = 'dataProperties' + $lvl, + $ownProperties = it.opts.ownProperties, + $currentBaseId = it.baseId; + if ($ownProperties) { + out += ' var ' + ($dataProperties) + ' = undefined; '; + } + if ($ownProperties) { + out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; + } else { + out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; + } + out += ' var startErrs' + ($lvl) + ' = errors; '; + var $passData = $key; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' if (!' + ($nextValid) + ') { for (var ' + ($i) + '=startErrs' + ($lvl) + '; ' + ($i) + ' All rights reserved. + +// If you have no idea what ASN.1 or BER is, see this: +// ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc + +var Ber = __webpack_require__(249); + + + +// --- Exported API + +module.exports = { + + Ber: Ber, + + BerReader: Ber.Reader, + + BerWriter: Ber.Writer + +}; + + +/***/ }), + +/***/ 64: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2012 Joyent, Inc. All rights reserved. -var assert = __webpack_require__(283); +var assert = __webpack_require__(477); var crypto = __webpack_require__(417); var http = __webpack_require__(605); var util = __webpack_require__(669); -var sshpk = __webpack_require__(804); -var jsprim = __webpack_require__(442); -var utils = __webpack_require__(517); +var sshpk = __webpack_require__(650); +var jsprim = __webpack_require__(348); +var utils = __webpack_require__(909); var sprintf = __webpack_require__(669).format; @@ -475,2106 +1751,298 @@ module.exports = { /***/ }), -/***/ 13: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -var caseless = __webpack_require__(812) -var uuid = __webpack_require__(563) -var helpers = __webpack_require__(561) - -var md5 = helpers.md5 -var toBase64 = helpers.toBase64 - -function Auth (request) { - // define all public properties here - this.request = request - this.hasAuth = false - this.sentAuth = false - this.bearerToken = null - this.user = null - this.pass = null -} - -Auth.prototype.basic = function (user, pass, sendImmediately) { - var self = this - if (typeof user !== 'string' || (pass !== undefined && typeof pass !== 'string')) { - self.request.emit('error', new Error('auth() received invalid user or password')) - } - self.user = user - self.pass = pass - self.hasAuth = true - var header = user + ':' + (pass || '') - if (sendImmediately || typeof sendImmediately === 'undefined') { - var authHeader = 'Basic ' + toBase64(header) - self.sentAuth = true - return authHeader - } -} - -Auth.prototype.bearer = function (bearer, sendImmediately) { - var self = this - self.bearerToken = bearer - self.hasAuth = true - if (sendImmediately || typeof sendImmediately === 'undefined') { - if (typeof bearer === 'function') { - bearer = bearer() - } - var authHeader = 'Bearer ' + (bearer || '') - self.sentAuth = true - return authHeader - } -} - -Auth.prototype.digest = function (method, path, authHeader) { - // TODO: More complete implementation of RFC 2617. - // - handle challenge.domain - // - support qop="auth-int" only - // - handle Authentication-Info (not necessarily?) - // - check challenge.stale (not necessarily?) - // - increase nc (not necessarily?) - // For reference: - // http://tools.ietf.org/html/rfc2617#section-3 - // https://github.com/bagder/curl/blob/master/lib/http_digest.c - - var self = this - - var challenge = {} - var re = /([a-z0-9_-]+)=(?:"([^"]+)"|([a-z0-9_-]+))/gi - for (;;) { - var match = re.exec(authHeader) - if (!match) { - break - } - challenge[match[1]] = match[2] || match[3] - } - - /** - * RFC 2617: handle both MD5 and MD5-sess algorithms. - * - * If the algorithm directive's value is "MD5" or unspecified, then HA1 is - * HA1=MD5(username:realm:password) - * If the algorithm directive's value is "MD5-sess", then HA1 is - * HA1=MD5(MD5(username:realm:password):nonce:cnonce) - */ - var ha1Compute = function (algorithm, user, realm, pass, nonce, cnonce) { - var ha1 = md5(user + ':' + realm + ':' + pass) - if (algorithm && algorithm.toLowerCase() === 'md5-sess') { - return md5(ha1 + ':' + nonce + ':' + cnonce) - } else { - return ha1 - } - } - - var qop = /(^|,)\s*auth\s*($|,)/.test(challenge.qop) && 'auth' - var nc = qop && '00000001' - var cnonce = qop && uuid().replace(/-/g, '') - var ha1 = ha1Compute(challenge.algorithm, self.user, challenge.realm, self.pass, challenge.nonce, cnonce) - var ha2 = md5(method + ':' + path) - var digestResponse = qop - ? md5(ha1 + ':' + challenge.nonce + ':' + nc + ':' + cnonce + ':' + qop + ':' + ha2) - : md5(ha1 + ':' + challenge.nonce + ':' + ha2) - var authValues = { - username: self.user, - realm: challenge.realm, - nonce: challenge.nonce, - uri: path, - qop: qop, - response: digestResponse, - nc: nc, - cnonce: cnonce, - algorithm: challenge.algorithm, - opaque: challenge.opaque - } - - authHeader = [] - for (var k in authValues) { - if (authValues[k]) { - if (k === 'qop' || k === 'nc' || k === 'algorithm') { - authHeader.push(k + '=' + authValues[k]) - } else { - authHeader.push(k + '="' + authValues[k] + '"') - } - } - } - authHeader = 'Digest ' + authHeader.join(', ') - self.sentAuth = true - return authHeader -} - -Auth.prototype.onRequest = function (user, pass, sendImmediately, bearer) { - var self = this - var request = self.request - - var authHeader - if (bearer === undefined && user === undefined) { - self.request.emit('error', new Error('no auth mechanism defined')) - } else if (bearer !== undefined) { - authHeader = self.bearer(bearer, sendImmediately) - } else { - authHeader = self.basic(user, pass, sendImmediately) - } - if (authHeader) { - request.setHeader('authorization', authHeader) - } -} - -Auth.prototype.onResponse = function (response) { - var self = this - var request = self.request - - if (!self.hasAuth || self.sentAuth) { return null } - - var c = caseless(response.headers) - - var authHeader = c.get('www-authenticate') - var authVerb = authHeader && authHeader.split(' ')[0].toLowerCase() - request.debug('reauth', authVerb) - - switch (authVerb) { - case 'basic': - return self.basic(self.user, self.pass, true) - - case 'bearer': - return self.bearer(self.bearerToken, true) - - case 'digest': - return self.digest(request.method, request.path, authHeader) - } -} - -exports.Auth = Auth - - -/***/ }), - -/***/ 14: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -var qs = __webpack_require__(681) -var querystring = __webpack_require__(191) - -function Querystring (request) { - this.request = request - this.lib = null - this.useQuerystring = null - this.parseOptions = null - this.stringifyOptions = null -} - -Querystring.prototype.init = function (options) { - if (this.lib) { return } - - this.useQuerystring = options.useQuerystring - this.lib = (this.useQuerystring ? querystring : qs) - - this.parseOptions = options.qsParseOptions || {} - this.stringifyOptions = options.qsStringifyOptions || {} -} - -Querystring.prototype.stringify = function (obj) { - return (this.useQuerystring) - ? this.rfc3986(this.lib.stringify(obj, - this.stringifyOptions.sep || null, - this.stringifyOptions.eq || null, - this.stringifyOptions)) - : this.lib.stringify(obj, this.stringifyOptions) -} - -Querystring.prototype.parse = function (str) { - return (this.useQuerystring) - ? this.lib.parse(str, - this.parseOptions.sep || null, - this.parseOptions.eq || null, - this.parseOptions) - : this.lib.parse(str, this.parseOptions) -} - -Querystring.prototype.rfc3986 = function (str) { - return str.replace(/[!'()*]/g, function (c) { - return '%' + c.charCodeAt(0).toString(16).toUpperCase() - }) -} - -Querystring.prototype.unescape = querystring.unescape - -exports.Querystring = Querystring - - -/***/ }), - -/***/ 15: +/***/ 69: /***/ (function(module) { -module.exports = isTypedArray -isTypedArray.strict = isStrictTypedArray -isTypedArray.loose = isLooseTypedArray +// populates missing values +module.exports = function(dst, src) { -var toString = Object.prototype.toString -var names = { - '[object Int8Array]': true - , '[object Int16Array]': true - , '[object Int32Array]': true - , '[object Uint8Array]': true - , '[object Uint8ClampedArray]': true - , '[object Uint16Array]': true - , '[object Uint32Array]': true - , '[object Float32Array]': true - , '[object Float64Array]': true -} + Object.keys(src).forEach(function(prop) + { + dst[prop] = dst[prop] || src[prop]; + }); -function isTypedArray(arr) { - return ( - isStrictTypedArray(arr) - || isLooseTypedArray(arr) - ) -} - -function isStrictTypedArray(arr) { - return ( - arr instanceof Int8Array - || arr instanceof Int16Array - || arr instanceof Int32Array - || arr instanceof Uint8Array - || arr instanceof Uint8ClampedArray - || arr instanceof Uint16Array - || arr instanceof Uint32Array - || arr instanceof Float32Array - || arr instanceof Float64Array - ) -} - -function isLooseTypedArray(arr) { - return names[toString.call(arr)] -} + return dst; +}; /***/ }), -/***/ 16: -/***/ (function(module) { - -module.exports = require("tls"); - -/***/ }), - -/***/ 24: -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_validate(it, $keyword, $ruleType) { - var out = ''; - var $async = it.schema.$async === true, - $refKeywords = it.util.schemaHasRulesExcept(it.schema, it.RULES.all, '$ref'), - $id = it.self._getId(it.schema); - if (it.opts.strictKeywords) { - var $unknownKwd = it.util.schemaUnknownRules(it.schema, it.RULES.keywords); - if ($unknownKwd) { - var $keywordsMsg = 'unknown keyword: ' + $unknownKwd; - if (it.opts.strictKeywords === 'log') it.logger.warn($keywordsMsg); - else throw new Error($keywordsMsg); - } - } - if (it.isTop) { - out += ' var validate = '; - if ($async) { - it.async = true; - out += 'async '; - } - out += 'function(data, dataPath, parentData, parentDataProperty, rootData) { \'use strict\'; '; - if ($id && (it.opts.sourceCode || it.opts.processCode)) { - out += ' ' + ('/\*# sourceURL=' + $id + ' */') + ' '; - } - } - if (typeof it.schema == 'boolean' || !($refKeywords || it.schema.$ref)) { - var $keyword = 'false schema'; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $errorKeyword; - var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - if (it.schema === false) { - if (it.isTop) { - $breakOnError = true; - } else { - out += ' var ' + ($valid) + ' = false; '; - } - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || 'false schema') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; - if (it.opts.messages !== false) { - out += ' , message: \'boolean schema is false\' '; - } - if (it.opts.verbose) { - out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - } else { - if (it.isTop) { - if ($async) { - out += ' return data; '; - } else { - out += ' validate.errors = null; return true; '; - } - } else { - out += ' var ' + ($valid) + ' = true; '; - } - } - if (it.isTop) { - out += ' }; return validate; '; - } - return out; - } - if (it.isTop) { - var $top = it.isTop, - $lvl = it.level = 0, - $dataLvl = it.dataLevel = 0, - $data = 'data'; - it.rootId = it.resolve.fullPath(it.self._getId(it.root.schema)); - it.baseId = it.baseId || it.rootId; - delete it.isTop; - it.dataPathArr = [undefined]; - if (it.schema.default !== undefined && it.opts.useDefaults && it.opts.strictDefaults) { - var $defaultMsg = 'default is ignored in the schema root'; - if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); - else throw new Error($defaultMsg); - } - out += ' var vErrors = null; '; - out += ' var errors = 0; '; - out += ' if (rootData === undefined) rootData = data; '; - } else { - var $lvl = it.level, - $dataLvl = it.dataLevel, - $data = 'data' + ($dataLvl || ''); - if ($id) it.baseId = it.resolve.url(it.baseId, $id); - if ($async && !it.async) throw new Error('async schema in sync schema'); - out += ' var errs_' + ($lvl) + ' = errors;'; - } - var $valid = 'valid' + $lvl, - $breakOnError = !it.opts.allErrors, - $closingBraces1 = '', - $closingBraces2 = ''; - var $errorKeyword; - var $typeSchema = it.schema.type, - $typeIsArray = Array.isArray($typeSchema); - if ($typeSchema && it.opts.nullable && it.schema.nullable === true) { - if ($typeIsArray) { - if ($typeSchema.indexOf('null') == -1) $typeSchema = $typeSchema.concat('null'); - } else if ($typeSchema != 'null') { - $typeSchema = [$typeSchema, 'null']; - $typeIsArray = true; - } - } - if ($typeIsArray && $typeSchema.length == 1) { - $typeSchema = $typeSchema[0]; - $typeIsArray = false; - } - if (it.schema.$ref && $refKeywords) { - if (it.opts.extendRefs == 'fail') { - throw new Error('$ref: validation keywords used in schema at path "' + it.errSchemaPath + '" (see option extendRefs)'); - } else if (it.opts.extendRefs !== true) { - $refKeywords = false; - it.logger.warn('$ref: keywords ignored in schema at path "' + it.errSchemaPath + '"'); - } - } - if (it.schema.$comment && it.opts.$comment) { - out += ' ' + (it.RULES.all.$comment.code(it, '$comment')); - } - if ($typeSchema) { - if (it.opts.coerceTypes) { - var $coerceToTypes = it.util.coerceToTypes(it.opts.coerceTypes, $typeSchema); - } - var $rulesGroup = it.RULES.types[$typeSchema]; - if ($coerceToTypes || $typeIsArray || $rulesGroup === true || ($rulesGroup && !$shouldUseGroup($rulesGroup))) { - var $schemaPath = it.schemaPath + '.type', - $errSchemaPath = it.errSchemaPath + '/type'; - var $schemaPath = it.schemaPath + '.type', - $errSchemaPath = it.errSchemaPath + '/type', - $method = $typeIsArray ? 'checkDataTypes' : 'checkDataType'; - out += ' if (' + (it.util[$method]($typeSchema, $data, true)) + ') { '; - if ($coerceToTypes) { - var $dataType = 'dataType' + $lvl, - $coerced = 'coerced' + $lvl; - out += ' var ' + ($dataType) + ' = typeof ' + ($data) + '; '; - if (it.opts.coerceTypes == 'array') { - out += ' if (' + ($dataType) + ' == \'object\' && Array.isArray(' + ($data) + ')) ' + ($dataType) + ' = \'array\'; '; - } - out += ' var ' + ($coerced) + ' = undefined; '; - var $bracesCoercion = ''; - var arr1 = $coerceToTypes; - if (arr1) { - var $type, $i = -1, - l1 = arr1.length - 1; - while ($i < l1) { - $type = arr1[$i += 1]; - if ($i) { - out += ' if (' + ($coerced) + ' === undefined) { '; - $bracesCoercion += '}'; - } - if (it.opts.coerceTypes == 'array' && $type != 'array') { - out += ' if (' + ($dataType) + ' == \'array\' && ' + ($data) + '.length == 1) { ' + ($coerced) + ' = ' + ($data) + ' = ' + ($data) + '[0]; ' + ($dataType) + ' = typeof ' + ($data) + '; } '; - } - if ($type == 'string') { - out += ' if (' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\') ' + ($coerced) + ' = \'\' + ' + ($data) + '; else if (' + ($data) + ' === null) ' + ($coerced) + ' = \'\'; '; - } else if ($type == 'number' || $type == 'integer') { - out += ' if (' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' === null || (' + ($dataType) + ' == \'string\' && ' + ($data) + ' && ' + ($data) + ' == +' + ($data) + ' '; - if ($type == 'integer') { - out += ' && !(' + ($data) + ' % 1)'; - } - out += ')) ' + ($coerced) + ' = +' + ($data) + '; '; - } else if ($type == 'boolean') { - out += ' if (' + ($data) + ' === \'false\' || ' + ($data) + ' === 0 || ' + ($data) + ' === null) ' + ($coerced) + ' = false; else if (' + ($data) + ' === \'true\' || ' + ($data) + ' === 1) ' + ($coerced) + ' = true; '; - } else if ($type == 'null') { - out += ' if (' + ($data) + ' === \'\' || ' + ($data) + ' === 0 || ' + ($data) + ' === false) ' + ($coerced) + ' = null; '; - } else if (it.opts.coerceTypes == 'array' && $type == 'array') { - out += ' if (' + ($dataType) + ' == \'string\' || ' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' == null) ' + ($coerced) + ' = [' + ($data) + ']; '; - } - } - } - out += ' ' + ($bracesCoercion) + ' if (' + ($coerced) + ' === undefined) { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; - if ($typeIsArray) { - out += '' + ($typeSchema.join(",")); - } else { - out += '' + ($typeSchema); - } - out += '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should be '; - if ($typeIsArray) { - out += '' + ($typeSchema.join(",")); - } else { - out += '' + ($typeSchema); - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } else { '; - var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', - $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; - out += ' ' + ($data) + ' = ' + ($coerced) + '; '; - if (!$dataLvl) { - out += 'if (' + ($parentData) + ' !== undefined)'; - } - out += ' ' + ($parentData) + '[' + ($parentDataProperty) + '] = ' + ($coerced) + '; } '; - } else { - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; - if ($typeIsArray) { - out += '' + ($typeSchema.join(",")); - } else { - out += '' + ($typeSchema); - } - out += '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should be '; - if ($typeIsArray) { - out += '' + ($typeSchema.join(",")); - } else { - out += '' + ($typeSchema); - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - } - out += ' } '; - } - } - if (it.schema.$ref && !$refKeywords) { - out += ' ' + (it.RULES.all.$ref.code(it, '$ref')) + ' '; - if ($breakOnError) { - out += ' } if (errors === '; - if ($top) { - out += '0'; - } else { - out += 'errs_' + ($lvl); - } - out += ') { '; - $closingBraces2 += '}'; - } - } else { - var arr2 = it.RULES; - if (arr2) { - var $rulesGroup, i2 = -1, - l2 = arr2.length - 1; - while (i2 < l2) { - $rulesGroup = arr2[i2 += 1]; - if ($shouldUseGroup($rulesGroup)) { - if ($rulesGroup.type) { - out += ' if (' + (it.util.checkDataType($rulesGroup.type, $data)) + ') { '; - } - if (it.opts.useDefaults) { - if ($rulesGroup.type == 'object' && it.schema.properties) { - var $schema = it.schema.properties, - $schemaKeys = Object.keys($schema); - var arr3 = $schemaKeys; - if (arr3) { - var $propertyKey, i3 = -1, - l3 = arr3.length - 1; - while (i3 < l3) { - $propertyKey = arr3[i3 += 1]; - var $sch = $schema[$propertyKey]; - if ($sch.default !== undefined) { - var $passData = $data + it.util.getProperty($propertyKey); - if (it.compositeRule) { - if (it.opts.strictDefaults) { - var $defaultMsg = 'default is ignored for: ' + $passData; - if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); - else throw new Error($defaultMsg); - } - } else { - out += ' if (' + ($passData) + ' === undefined '; - if (it.opts.useDefaults == 'empty') { - out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' '; - } - out += ' ) ' + ($passData) + ' = '; - if (it.opts.useDefaults == 'shared') { - out += ' ' + (it.useDefault($sch.default)) + ' '; - } else { - out += ' ' + (JSON.stringify($sch.default)) + ' '; - } - out += '; '; - } - } - } - } - } else if ($rulesGroup.type == 'array' && Array.isArray(it.schema.items)) { - var arr4 = it.schema.items; - if (arr4) { - var $sch, $i = -1, - l4 = arr4.length - 1; - while ($i < l4) { - $sch = arr4[$i += 1]; - if ($sch.default !== undefined) { - var $passData = $data + '[' + $i + ']'; - if (it.compositeRule) { - if (it.opts.strictDefaults) { - var $defaultMsg = 'default is ignored for: ' + $passData; - if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); - else throw new Error($defaultMsg); - } - } else { - out += ' if (' + ($passData) + ' === undefined '; - if (it.opts.useDefaults == 'empty') { - out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' '; - } - out += ' ) ' + ($passData) + ' = '; - if (it.opts.useDefaults == 'shared') { - out += ' ' + (it.useDefault($sch.default)) + ' '; - } else { - out += ' ' + (JSON.stringify($sch.default)) + ' '; - } - out += '; '; - } - } - } - } - } - } - var arr5 = $rulesGroup.rules; - if (arr5) { - var $rule, i5 = -1, - l5 = arr5.length - 1; - while (i5 < l5) { - $rule = arr5[i5 += 1]; - if ($shouldUseRule($rule)) { - var $code = $rule.code(it, $rule.keyword, $rulesGroup.type); - if ($code) { - out += ' ' + ($code) + ' '; - if ($breakOnError) { - $closingBraces1 += '}'; - } - } - } - } - } - if ($breakOnError) { - out += ' ' + ($closingBraces1) + ' '; - $closingBraces1 = ''; - } - if ($rulesGroup.type) { - out += ' } '; - if ($typeSchema && $typeSchema === $rulesGroup.type && !$coerceToTypes) { - out += ' else { '; - var $schemaPath = it.schemaPath + '.type', - $errSchemaPath = it.errSchemaPath + '/type'; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; - if ($typeIsArray) { - out += '' + ($typeSchema.join(",")); - } else { - out += '' + ($typeSchema); - } - out += '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should be '; - if ($typeIsArray) { - out += '' + ($typeSchema.join(",")); - } else { - out += '' + ($typeSchema); - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } '; - } - } - if ($breakOnError) { - out += ' if (errors === '; - if ($top) { - out += '0'; - } else { - out += 'errs_' + ($lvl); - } - out += ') { '; - $closingBraces2 += '}'; - } - } - } - } - } - if ($breakOnError) { - out += ' ' + ($closingBraces2) + ' '; - } - if ($top) { - if ($async) { - out += ' if (errors === 0) return data; '; - out += ' else throw new ValidationError(vErrors); '; - } else { - out += ' validate.errors = vErrors; '; - out += ' return errors === 0; '; - } - out += ' }; return validate;'; - } else { - out += ' var ' + ($valid) + ' = errors === errs_' + ($lvl) + ';'; - } - out = it.util.cleanUpCode(out); - if ($top) { - out = it.util.finalCleanUpCode(out, $async); - } - - function $shouldUseGroup($rulesGroup) { - var rules = $rulesGroup.rules; - for (var i = 0; i < rules.length; i++) - if ($shouldUseRule(rules[i])) return true; - } - - function $shouldUseRule($rule) { - return it.schema[$rule.keyword] !== undefined || ($rule.implements && $ruleImplementsSomeKeyword($rule)); - } - - function $ruleImplementsSomeKeyword($rule) { - var impl = $rule.implements; - for (var i = 0; i < impl.length; i++) - if (it.schema[impl[i]] !== undefined) return true; - } - return out; -} - - -/***/ }), - -/***/ 28: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -var aws4 = exports, - url = __webpack_require__(835), - querystring = __webpack_require__(191), - crypto = __webpack_require__(417), - lru = __webpack_require__(130), - credentialsCache = lru(1000) - -// http://docs.amazonwebservices.com/general/latest/gr/signature-version-4.html - -function hmac(key, string, encoding) { - return crypto.createHmac('sha256', key).update(string, 'utf8').digest(encoding) -} - -function hash(string, encoding) { - return crypto.createHash('sha256').update(string, 'utf8').digest(encoding) -} - -// This function assumes the string has already been percent encoded -function encodeRfc3986(urlEncodedString) { - return urlEncodedString.replace(/[!'()*]/g, function(c) { - return '%' + c.charCodeAt(0).toString(16).toUpperCase() - }) -} - -// request: { path | body, [host], [method], [headers], [service], [region] } -// credentials: { accessKeyId, secretAccessKey, [sessionToken] } -function RequestSigner(request, credentials) { - - if (typeof request === 'string') request = url.parse(request) - - var headers = request.headers = (request.headers || {}), - hostParts = this.matchHost(request.hostname || request.host || headers.Host || headers.host) - - this.request = request - this.credentials = credentials || this.defaultCredentials() - - this.service = request.service || hostParts[0] || '' - this.region = request.region || hostParts[1] || 'us-east-1' - - // SES uses a different domain from the service name - if (this.service === 'email') this.service = 'ses' - - if (!request.method && request.body) - request.method = 'POST' - - if (!headers.Host && !headers.host) { - headers.Host = request.hostname || request.host || this.createHost() - - // If a port is specified explicitly, use it as is - if (request.port) - headers.Host += ':' + request.port - } - if (!request.hostname && !request.host) - request.hostname = headers.Host || headers.host - - this.isCodeCommitGit = this.service === 'codecommit' && request.method === 'GIT' -} - -RequestSigner.prototype.matchHost = function(host) { - var match = (host || '').match(/([^\.]+)\.(?:([^\.]*)\.)?amazonaws\.com(\.cn)?$/) - var hostParts = (match || []).slice(1, 3) - - // ES's hostParts are sometimes the other way round, if the value that is expected - // to be region equals ‘es’ switch them back - // e.g. search-cluster-name-aaaa00aaaa0aaa0aaaaaaa0aaa.us-east-1.es.amazonaws.com - if (hostParts[1] === 'es') - hostParts = hostParts.reverse() - - return hostParts -} - -// http://docs.aws.amazon.com/general/latest/gr/rande.html -RequestSigner.prototype.isSingleRegion = function() { - // Special case for S3 and SimpleDB in us-east-1 - if (['s3', 'sdb'].indexOf(this.service) >= 0 && this.region === 'us-east-1') return true - - return ['cloudfront', 'ls', 'route53', 'iam', 'importexport', 'sts'] - .indexOf(this.service) >= 0 -} - -RequestSigner.prototype.createHost = function() { - var region = this.isSingleRegion() ? '' : - (this.service === 's3' && this.region !== 'us-east-1' ? '-' : '.') + this.region, - service = this.service === 'ses' ? 'email' : this.service - return service + region + '.amazonaws.com' -} - -RequestSigner.prototype.prepareRequest = function() { - this.parsePath() - - var request = this.request, headers = request.headers, query - - if (request.signQuery) { - - this.parsedPath.query = query = this.parsedPath.query || {} - - if (this.credentials.sessionToken) - query['X-Amz-Security-Token'] = this.credentials.sessionToken - - if (this.service === 's3' && !query['X-Amz-Expires']) - query['X-Amz-Expires'] = 86400 - - if (query['X-Amz-Date']) - this.datetime = query['X-Amz-Date'] - else - query['X-Amz-Date'] = this.getDateTime() - - query['X-Amz-Algorithm'] = 'AWS4-HMAC-SHA256' - query['X-Amz-Credential'] = this.credentials.accessKeyId + '/' + this.credentialString() - query['X-Amz-SignedHeaders'] = this.signedHeaders() - - } else { - - if (!request.doNotModifyHeaders && !this.isCodeCommitGit) { - if (request.body && !headers['Content-Type'] && !headers['content-type']) - headers['Content-Type'] = 'application/x-www-form-urlencoded; charset=utf-8' - - if (request.body && !headers['Content-Length'] && !headers['content-length']) - headers['Content-Length'] = Buffer.byteLength(request.body) - - if (this.credentials.sessionToken && !headers['X-Amz-Security-Token'] && !headers['x-amz-security-token']) - headers['X-Amz-Security-Token'] = this.credentials.sessionToken - - if (this.service === 's3' && !headers['X-Amz-Content-Sha256'] && !headers['x-amz-content-sha256']) - headers['X-Amz-Content-Sha256'] = hash(this.request.body || '', 'hex') - - if (headers['X-Amz-Date'] || headers['x-amz-date']) - this.datetime = headers['X-Amz-Date'] || headers['x-amz-date'] - else - headers['X-Amz-Date'] = this.getDateTime() - } - - delete headers.Authorization - delete headers.authorization - } -} - -RequestSigner.prototype.sign = function() { - if (!this.parsedPath) this.prepareRequest() - - if (this.request.signQuery) { - this.parsedPath.query['X-Amz-Signature'] = this.signature() - } else { - this.request.headers.Authorization = this.authHeader() - } - - this.request.path = this.formatPath() - - return this.request -} - -RequestSigner.prototype.getDateTime = function() { - if (!this.datetime) { - var headers = this.request.headers, - date = new Date(headers.Date || headers.date || new Date) - - this.datetime = date.toISOString().replace(/[:\-]|\.\d{3}/g, '') - - // Remove the trailing 'Z' on the timestamp string for CodeCommit git access - if (this.isCodeCommitGit) this.datetime = this.datetime.slice(0, -1) - } - return this.datetime -} - -RequestSigner.prototype.getDate = function() { - return this.getDateTime().substr(0, 8) -} - -RequestSigner.prototype.authHeader = function() { - return [ - 'AWS4-HMAC-SHA256 Credential=' + this.credentials.accessKeyId + '/' + this.credentialString(), - 'SignedHeaders=' + this.signedHeaders(), - 'Signature=' + this.signature(), - ].join(', ') -} - -RequestSigner.prototype.signature = function() { - var date = this.getDate(), - cacheKey = [this.credentials.secretAccessKey, date, this.region, this.service].join(), - kDate, kRegion, kService, kCredentials = credentialsCache.get(cacheKey) - if (!kCredentials) { - kDate = hmac('AWS4' + this.credentials.secretAccessKey, date) - kRegion = hmac(kDate, this.region) - kService = hmac(kRegion, this.service) - kCredentials = hmac(kService, 'aws4_request') - credentialsCache.set(cacheKey, kCredentials) - } - return hmac(kCredentials, this.stringToSign(), 'hex') -} - -RequestSigner.prototype.stringToSign = function() { - return [ - 'AWS4-HMAC-SHA256', - this.getDateTime(), - this.credentialString(), - hash(this.canonicalString(), 'hex'), - ].join('\n') -} - -RequestSigner.prototype.canonicalString = function() { - if (!this.parsedPath) this.prepareRequest() - - var pathStr = this.parsedPath.path, - query = this.parsedPath.query, - headers = this.request.headers, - queryStr = '', - normalizePath = this.service !== 's3', - decodePath = this.service === 's3' || this.request.doNotEncodePath, - decodeSlashesInPath = this.service === 's3', - firstValOnly = this.service === 's3', - bodyHash - - if (this.service === 's3' && this.request.signQuery) { - bodyHash = 'UNSIGNED-PAYLOAD' - } else if (this.isCodeCommitGit) { - bodyHash = '' - } else { - bodyHash = headers['X-Amz-Content-Sha256'] || headers['x-amz-content-sha256'] || - hash(this.request.body || '', 'hex') - } - - if (query) { - queryStr = encodeRfc3986(querystring.stringify(Object.keys(query).sort().reduce(function(obj, key) { - if (!key) return obj - obj[key] = !Array.isArray(query[key]) ? query[key] : - (firstValOnly ? query[key][0] : query[key].slice().sort()) - return obj - }, {}))) - } - if (pathStr !== '/') { - if (normalizePath) pathStr = pathStr.replace(/\/{2,}/g, '/') - pathStr = pathStr.split('/').reduce(function(path, piece) { - if (normalizePath && piece === '..') { - path.pop() - } else if (!normalizePath || piece !== '.') { - if (decodePath) piece = decodeURIComponent(piece) - path.push(encodeRfc3986(encodeURIComponent(piece))) - } - return path - }, []).join('/') - if (pathStr[0] !== '/') pathStr = '/' + pathStr - if (decodeSlashesInPath) pathStr = pathStr.replace(/%2F/g, '/') - } - - return [ - this.request.method || 'GET', - pathStr, - queryStr, - this.canonicalHeaders() + '\n', - this.signedHeaders(), - bodyHash, - ].join('\n') -} - -RequestSigner.prototype.canonicalHeaders = function() { - var headers = this.request.headers - function trimAll(header) { - return header.toString().trim().replace(/\s+/g, ' ') - } - return Object.keys(headers) - .sort(function(a, b) { return a.toLowerCase() < b.toLowerCase() ? -1 : 1 }) - .map(function(key) { return key.toLowerCase() + ':' + trimAll(headers[key]) }) - .join('\n') -} - -RequestSigner.prototype.signedHeaders = function() { - return Object.keys(this.request.headers) - .map(function(key) { return key.toLowerCase() }) - .sort() - .join(';') -} - -RequestSigner.prototype.credentialString = function() { - return [ - this.getDate(), - this.region, - this.service, - 'aws4_request', - ].join('/') -} - -RequestSigner.prototype.defaultCredentials = function() { - var env = process.env - return { - accessKeyId: env.AWS_ACCESS_KEY_ID || env.AWS_ACCESS_KEY, - secretAccessKey: env.AWS_SECRET_ACCESS_KEY || env.AWS_SECRET_KEY, - sessionToken: env.AWS_SESSION_TOKEN, - } -} - -RequestSigner.prototype.parsePath = function() { - var path = this.request.path || '/', - queryIx = path.indexOf('?'), - query = null - - if (queryIx >= 0) { - query = querystring.parse(path.slice(queryIx + 1)) - path = path.slice(0, queryIx) - } - - // S3 doesn't always encode characters > 127 correctly and - // all services don't encode characters > 255 correctly - // So if there are non-reserved chars (and it's not already all % encoded), just encode them all - if (/[^0-9A-Za-z!'()*\-._~%/]/.test(path)) { - path = path.split('/').map(function(piece) { - return encodeURIComponent(decodeURIComponent(piece)) - }).join('/') - } - - this.parsedPath = { - path: path, - query: query, - } -} - -RequestSigner.prototype.formatPath = function() { - var path = this.parsedPath.path, - query = this.parsedPath.query - - if (!query) return path - - // Services don't support empty query string keys - if (query[''] != null) delete query[''] - - return path + '?' + encodeRfc3986(querystring.stringify(query)) -} - -aws4.RequestSigner = RequestSigner - -aws4.sign = function(request, credentials) { - return new RequestSigner(request, credentials).sign() -} - - -/***/ }), - -/***/ 32: -/***/ (function(module) { - -module.exports = {"$id":"request.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["method","url","httpVersion","cookies","headers","queryString","headersSize","bodySize"],"properties":{"method":{"type":"string"},"url":{"type":"string","format":"uri"},"httpVersion":{"type":"string"},"cookies":{"type":"array","items":{"$ref":"cookie.json#"}},"headers":{"type":"array","items":{"$ref":"header.json#"}},"queryString":{"type":"array","items":{"$ref":"query.json#"}},"postData":{"$ref":"postData.json#"},"headersSize":{"type":"integer"},"bodySize":{"type":"integer"},"comment":{"type":"string"}}}; - -/***/ }), - -/***/ 33: +/***/ 78: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { read: read, + readSSHPrivate: readSSHPrivate, write: write }; -var assert = __webpack_require__(283); -var Buffer = __webpack_require__(375).Buffer; -var rfc4253 = __webpack_require__(533); -var utils = __webpack_require__(757); -var Key = __webpack_require__(820); -var PrivateKey = __webpack_require__(463); +var assert = __webpack_require__(477); +var asn1 = __webpack_require__(62); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var utils = __webpack_require__(270); +var crypto = __webpack_require__(417); -var sshpriv = __webpack_require__(269); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var pem = __webpack_require__(268); +var rfc4253 = __webpack_require__(538); +var SSHBuffer = __webpack_require__(940); +var errors = __webpack_require__(753); -/*JSSTYLED*/ -var SSHKEY_RE = /^([a-z0-9-]+)[ \t]+([a-zA-Z0-9+\/]+[=]*)([ \t]+([^ \t][^\n]*[\n]*)?)?$/; -/*JSSTYLED*/ -var SSHKEY_RE2 = /^([a-z0-9-]+)[ \t\n]+([a-zA-Z0-9+\/][a-zA-Z0-9+\/ \t\n=]*)([^a-zA-Z0-9+\/ \t\n=].*)?$/; +var bcrypt; function read(buf, options) { - if (typeof (buf) !== 'string') { - assert.buffer(buf, 'buf'); - buf = buf.toString('ascii'); + return (pem.read(buf, options)); +} + +var MAGIC = 'openssh-key-v1'; + +function readSSHPrivate(type, buf, options) { + buf = new SSHBuffer({buffer: buf}); + + var magic = buf.readCString(); + assert.strictEqual(magic, MAGIC, 'bad magic string'); + + var cipher = buf.readString(); + var kdf = buf.readString(); + var kdfOpts = buf.readBuffer(); + + var nkeys = buf.readInt(); + if (nkeys !== 1) { + throw (new Error('OpenSSH-format key file contains ' + + 'multiple keys: this is unsupported.')); } - var trimmed = buf.trim().replace(/[\\\r]/g, ''); - var m = trimmed.match(SSHKEY_RE); - if (!m) - m = trimmed.match(SSHKEY_RE2); - assert.ok(m, 'key must match regex'); + var pubKey = buf.readBuffer(); - var type = rfc4253.algToKeyType(m[1]); - var kbuf = Buffer.from(m[2], 'base64'); + if (type === 'public') { + assert.ok(buf.atEnd(), 'excess bytes left after key'); + return (rfc4253.read(pubKey)); + } - /* - * This is a bit tricky. If we managed to parse the key and locate the - * key comment with the regex, then do a non-partial read and assert - * that we have consumed all bytes. If we couldn't locate the key - * comment, though, there may be whitespace shenanigans going on that - * have conjoined the comment to the rest of the key. We do a partial - * read in this case to try to make the best out of a sorry situation. - */ - var key; - var ret = {}; - if (m[4]) { - try { - key = rfc4253.read(kbuf); + var privKeyBlob = buf.readBuffer(); + assert.ok(buf.atEnd(), 'excess bytes left after key'); - } catch (e) { - m = trimmed.match(SSHKEY_RE2); - assert.ok(m, 'key must match regex'); - kbuf = Buffer.from(m[2], 'base64'); - key = rfc4253.readInternal(ret, 'public', kbuf); + var kdfOptsBuf = new SSHBuffer({ buffer: kdfOpts }); + switch (kdf) { + case 'none': + if (cipher !== 'none') { + throw (new Error('OpenSSH-format key uses KDF "none" ' + + 'but specifies a cipher other than "none"')); } - } else { - key = rfc4253.readInternal(ret, 'public', kbuf); + break; + case 'bcrypt': + var salt = kdfOptsBuf.readBuffer(); + var rounds = kdfOptsBuf.readInt(); + var cinf = utils.opensshCipherInfo(cipher); + if (bcrypt === undefined) { + bcrypt = __webpack_require__(641); + } + + if (typeof (options.passphrase) === 'string') { + options.passphrase = Buffer.from(options.passphrase, + 'utf-8'); + } + if (!Buffer.isBuffer(options.passphrase)) { + throw (new errors.KeyEncryptedError( + options.filename, 'OpenSSH')); + } + + var pass = new Uint8Array(options.passphrase); + var salti = new Uint8Array(salt); + /* Use the pbkdf to derive both the key and the IV. */ + var out = new Uint8Array(cinf.keySize + cinf.blockSize); + var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, + out, out.length, rounds); + if (res !== 0) { + throw (new Error('bcrypt_pbkdf function returned ' + + 'failure, parameters invalid')); + } + out = Buffer.from(out); + var ckey = out.slice(0, cinf.keySize); + var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); + var cipherStream = crypto.createDecipheriv(cinf.opensslName, + ckey, iv); + cipherStream.setAutoPadding(false); + var chunk, chunks = []; + cipherStream.once('error', function (e) { + if (e.toString().indexOf('bad decrypt') !== -1) { + throw (new Error('Incorrect passphrase ' + + 'supplied, could not decrypt key')); + } + throw (e); + }); + cipherStream.write(privKeyBlob); + cipherStream.end(); + while ((chunk = cipherStream.read()) !== null) + chunks.push(chunk); + privKeyBlob = Buffer.concat(chunks); + break; + default: + throw (new Error( + 'OpenSSH-format key uses unknown KDF "' + kdf + '"')); } - assert.strictEqual(type, key.type); + buf = new SSHBuffer({buffer: privKeyBlob}); - if (m[4] && m[4].length > 0) { - key.comment = m[4]; - - } else if (ret.consumed) { - /* - * Now the magic: trying to recover the key comment when it's - * gotten conjoined to the key or otherwise shenanigan'd. - * - * Work out how much base64 we used, then drop all non-base64 - * chars from the beginning up to this point in the the string. - * Then offset in this and try to make up for missing = chars. - */ - var data = m[2] + (m[3] ? m[3] : ''); - var realOffset = Math.ceil(ret.consumed / 3) * 4; - data = data.slice(0, realOffset - 2). /*JSSTYLED*/ - replace(/[^a-zA-Z0-9+\/=]/g, '') + - data.slice(realOffset - 2); - - var padding = ret.consumed % 3; - if (padding > 0 && - data.slice(realOffset - 1, realOffset) !== '=') - realOffset--; - while (data.slice(realOffset, realOffset + 1) === '=') - realOffset++; - - /* Finally, grab what we think is the comment & clean it up. */ - var trailer = data.slice(realOffset); - trailer = trailer.replace(/[\r\n]/g, ' '). - replace(/^\s+/, ''); - if (trailer.match(/^[a-zA-Z0-9]/)) - key.comment = trailer; + var checkInt1 = buf.readInt(); + var checkInt2 = buf.readInt(); + if (checkInt1 !== checkInt2) { + throw (new Error('Incorrect passphrase supplied, could not ' + + 'decrypt key')); } + var ret = {}; + var key = rfc4253.readInternal(ret, 'private', buf.remainder()); + + buf.skip(ret.consumed); + + var comment = buf.readString(); + key.comment = comment; + return (key); } function write(key, options) { - assert.object(key); - if (!Key.isKey(key)) - throw (new Error('Must be a public key')); + var pubKey; + if (PrivateKey.isPrivateKey(key)) + pubKey = key.toPublic(); + else + pubKey = key; - var parts = []; - var alg = rfc4253.keyTypeToAlg(key); - parts.push(alg); - - var buf = rfc4253.write(key); - parts.push(buf.toString('base64')); - - if (key.comment) - parts.push(key.comment); - - return (Buffer.from(parts.join(' '))); -} - - -/***/ }), - -/***/ 39: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = { - read: read, - readPkcs1: readPkcs1, - write: write, - writePkcs1: writePkcs1 -}; - -var assert = __webpack_require__(283); -var asn1 = __webpack_require__(214); -var Buffer = __webpack_require__(375).Buffer; -var algs = __webpack_require__(936); -var utils = __webpack_require__(757); - -var Key = __webpack_require__(820); -var PrivateKey = __webpack_require__(463); -var pem = __webpack_require__(502); - -var pkcs8 = __webpack_require__(274); -var readECDSACurve = pkcs8.readECDSACurve; - -function read(buf, options) { - return (pem.read(buf, options, 'pkcs1')); -} - -function write(key, options) { - return (pem.write(key, options, 'pkcs1')); -} - -/* Helper to read in a single mpint */ -function readMPInt(der, nm) { - assert.strictEqual(der.peek(), asn1.Ber.Integer, - nm + ' is not an Integer'); - return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); -} - -function readPkcs1(alg, type, der) { - switch (alg) { - case 'RSA': - if (type === 'public') - return (readPkcs1RSAPublic(der)); - else if (type === 'private') - return (readPkcs1RSAPrivate(der)); - throw (new Error('Unknown key type: ' + type)); - case 'DSA': - if (type === 'public') - return (readPkcs1DSAPublic(der)); - else if (type === 'private') - return (readPkcs1DSAPrivate(der)); - throw (new Error('Unknown key type: ' + type)); - case 'EC': - case 'ECDSA': - if (type === 'private') - return (readPkcs1ECDSAPrivate(der)); - else if (type === 'public') - return (readPkcs1ECDSAPublic(der)); - throw (new Error('Unknown key type: ' + type)); - case 'EDDSA': - case 'EdDSA': - if (type === 'private') - return (readPkcs1EdDSAPrivate(der)); - throw (new Error(type + ' keys not supported with EdDSA')); - default: - throw (new Error('Unknown key algo: ' + alg)); - } -} - -function readPkcs1RSAPublic(der) { - // modulus and exponent - var n = readMPInt(der, 'modulus'); - var e = readMPInt(der, 'exponent'); - - // now, make the key - var key = { - type: 'rsa', - parts: [ - { name: 'e', data: e }, - { name: 'n', data: n } - ] - }; - - return (new Key(key)); -} - -function readPkcs1RSAPrivate(der) { - var version = readMPInt(der, 'version'); - assert.strictEqual(version[0], 0); - - // modulus then public exponent - var n = readMPInt(der, 'modulus'); - var e = readMPInt(der, 'public exponent'); - var d = readMPInt(der, 'private exponent'); - var p = readMPInt(der, 'prime1'); - var q = readMPInt(der, 'prime2'); - var dmodp = readMPInt(der, 'exponent1'); - var dmodq = readMPInt(der, 'exponent2'); - var iqmp = readMPInt(der, 'iqmp'); - - // now, make the key - var key = { - type: 'rsa', - parts: [ - { name: 'n', data: n }, - { name: 'e', data: e }, - { name: 'd', data: d }, - { name: 'iqmp', data: iqmp }, - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'dmodp', data: dmodp }, - { name: 'dmodq', data: dmodq } - ] - }; - - return (new PrivateKey(key)); -} - -function readPkcs1DSAPrivate(der) { - var version = readMPInt(der, 'version'); - assert.strictEqual(version.readUInt8(0), 0); - - var p = readMPInt(der, 'p'); - var q = readMPInt(der, 'q'); - var g = readMPInt(der, 'g'); - var y = readMPInt(der, 'y'); - var x = readMPInt(der, 'x'); - - // now, make the key - var key = { - type: 'dsa', - parts: [ - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'g', data: g }, - { name: 'y', data: y }, - { name: 'x', data: x } - ] - }; - - return (new PrivateKey(key)); -} - -function readPkcs1EdDSAPrivate(der) { - var version = readMPInt(der, 'version'); - assert.strictEqual(version.readUInt8(0), 1); - - // private key - var k = der.readString(asn1.Ber.OctetString, true); - - der.readSequence(0xa0); - var oid = der.readOID(); - assert.strictEqual(oid, '1.3.101.112', 'the ed25519 curve identifier'); - - der.readSequence(0xa1); - var A = utils.readBitString(der); - - var key = { - type: 'ed25519', - parts: [ - { name: 'A', data: utils.zeroPadToLength(A, 32) }, - { name: 'k', data: k } - ] - }; - - return (new PrivateKey(key)); -} - -function readPkcs1DSAPublic(der) { - var y = readMPInt(der, 'y'); - var p = readMPInt(der, 'p'); - var q = readMPInt(der, 'q'); - var g = readMPInt(der, 'g'); - - var key = { - type: 'dsa', - parts: [ - { name: 'y', data: y }, - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'g', data: g } - ] - }; - - return (new Key(key)); -} - -function readPkcs1ECDSAPublic(der) { - der.readSequence(); - - var oid = der.readOID(); - assert.strictEqual(oid, '1.2.840.10045.2.1', 'must be ecPublicKey'); - - var curveOid = der.readOID(); - - var curve; - var curves = Object.keys(algs.curves); - for (var j = 0; j < curves.length; ++j) { - var c = curves[j]; - var cd = algs.curves[c]; - if (cd.pkcs8oid === curveOid) { - curve = c; - break; + var cipher = 'none'; + var kdf = 'none'; + var kdfopts = Buffer.alloc(0); + var cinf = { blockSize: 8 }; + var passphrase; + if (options !== undefined) { + passphrase = options.passphrase; + if (typeof (passphrase) === 'string') + passphrase = Buffer.from(passphrase, 'utf-8'); + if (passphrase !== undefined) { + assert.buffer(passphrase, 'options.passphrase'); + assert.optionalString(options.cipher, 'options.cipher'); + cipher = options.cipher; + if (cipher === undefined) + cipher = 'aes128-ctr'; + cinf = utils.opensshCipherInfo(cipher); + kdf = 'bcrypt'; } } - assert.string(curve, 'a known ECDSA named curve'); - var Q = der.readString(asn1.Ber.BitString, true); - Q = utils.ecNormalize(Q); + var privBuf; + if (PrivateKey.isPrivateKey(key)) { + privBuf = new SSHBuffer({}); + var checkInt = crypto.randomBytes(4).readUInt32BE(0); + privBuf.writeInt(checkInt); + privBuf.writeInt(checkInt); + privBuf.write(key.toBuffer('rfc4253')); + privBuf.writeString(key.comment || ''); - var key = { - type: 'ecdsa', - parts: [ - { name: 'curve', data: Buffer.from(curve) }, - { name: 'Q', data: Q } - ] - }; - - return (new Key(key)); -} - -function readPkcs1ECDSAPrivate(der) { - var version = readMPInt(der, 'version'); - assert.strictEqual(version.readUInt8(0), 1); - - // private key - var d = der.readString(asn1.Ber.OctetString, true); - - der.readSequence(0xa0); - var curve = readECDSACurve(der); - assert.string(curve, 'a known elliptic curve'); - - der.readSequence(0xa1); - var Q = der.readString(asn1.Ber.BitString, true); - Q = utils.ecNormalize(Q); - - var key = { - type: 'ecdsa', - parts: [ - { name: 'curve', data: Buffer.from(curve) }, - { name: 'Q', data: Q }, - { name: 'd', data: d } - ] - }; - - return (new PrivateKey(key)); -} - -function writePkcs1(der, key) { - der.startSequence(); - - switch (key.type) { - case 'rsa': - if (PrivateKey.isPrivateKey(key)) - writePkcs1RSAPrivate(der, key); - else - writePkcs1RSAPublic(der, key); - break; - case 'dsa': - if (PrivateKey.isPrivateKey(key)) - writePkcs1DSAPrivate(der, key); - else - writePkcs1DSAPublic(der, key); - break; - case 'ecdsa': - if (PrivateKey.isPrivateKey(key)) - writePkcs1ECDSAPrivate(der, key); - else - writePkcs1ECDSAPublic(der, key); - break; - case 'ed25519': - if (PrivateKey.isPrivateKey(key)) - writePkcs1EdDSAPrivate(der, key); - else - writePkcs1EdDSAPublic(der, key); - break; - default: - throw (new Error('Unknown key algo: ' + key.type)); + var n = 1; + while (privBuf._offset % cinf.blockSize !== 0) + privBuf.writeChar(n++); + privBuf = privBuf.toBuffer(); } - der.endSequence(); -} + switch (kdf) { + case 'none': + break; + case 'bcrypt': + var salt = crypto.randomBytes(16); + var rounds = 16; + var kdfssh = new SSHBuffer({}); + kdfssh.writeBuffer(salt); + kdfssh.writeInt(rounds); + kdfopts = kdfssh.toBuffer(); -function writePkcs1RSAPublic(der, key) { - der.writeBuffer(key.part.n.data, asn1.Ber.Integer); - der.writeBuffer(key.part.e.data, asn1.Ber.Integer); -} + if (bcrypt === undefined) { + bcrypt = __webpack_require__(641); + } + var pass = new Uint8Array(passphrase); + var salti = new Uint8Array(salt); + /* Use the pbkdf to derive both the key and the IV. */ + var out = new Uint8Array(cinf.keySize + cinf.blockSize); + var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, + out, out.length, rounds); + if (res !== 0) { + throw (new Error('bcrypt_pbkdf function returned ' + + 'failure, parameters invalid')); + } + out = Buffer.from(out); + var ckey = out.slice(0, cinf.keySize); + var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); -function writePkcs1RSAPrivate(der, key) { - var ver = Buffer.from([0]); - der.writeBuffer(ver, asn1.Ber.Integer); + var cipherStream = crypto.createCipheriv(cinf.opensslName, + ckey, iv); + cipherStream.setAutoPadding(false); + var chunk, chunks = []; + cipherStream.once('error', function (e) { + throw (e); + }); + cipherStream.write(privBuf); + cipherStream.end(); + while ((chunk = cipherStream.read()) !== null) + chunks.push(chunk); + privBuf = Buffer.concat(chunks); + break; + default: + throw (new Error('Unsupported kdf ' + kdf)); + } - der.writeBuffer(key.part.n.data, asn1.Ber.Integer); - der.writeBuffer(key.part.e.data, asn1.Ber.Integer); - der.writeBuffer(key.part.d.data, asn1.Ber.Integer); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - if (!key.part.dmodp || !key.part.dmodq) - utils.addRSAMissing(key); - der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); - der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); - der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); -} + var buf = new SSHBuffer({}); -function writePkcs1DSAPrivate(der, key) { - var ver = Buffer.from([0]); - der.writeBuffer(ver, asn1.Ber.Integer); + buf.writeCString(MAGIC); + buf.writeString(cipher); /* cipher */ + buf.writeString(kdf); /* kdf */ + buf.writeBuffer(kdfopts); /* kdfoptions */ - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - der.writeBuffer(key.part.g.data, asn1.Ber.Integer); - der.writeBuffer(key.part.y.data, asn1.Ber.Integer); - der.writeBuffer(key.part.x.data, asn1.Ber.Integer); -} + buf.writeInt(1); /* nkeys */ + buf.writeBuffer(pubKey.toBuffer('rfc4253')); -function writePkcs1DSAPublic(der, key) { - der.writeBuffer(key.part.y.data, asn1.Ber.Integer); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - der.writeBuffer(key.part.g.data, asn1.Ber.Integer); -} + if (privBuf) + buf.writeBuffer(privBuf); -function writePkcs1ECDSAPublic(der, key) { - der.startSequence(); + buf = buf.toBuffer(); - der.writeOID('1.2.840.10045.2.1'); /* ecPublicKey */ - var curve = key.part.curve.data.toString(); - var curveOid = algs.curves[curve].pkcs8oid; - assert.string(curveOid, 'a known ECDSA named curve'); - der.writeOID(curveOid); + var header; + if (PrivateKey.isPrivateKey(key)) + header = 'OPENSSH PRIVATE KEY'; + else + header = 'OPENSSH PUBLIC KEY'; - der.endSequence(); + var tmp = buf.toString('base64'); + var len = tmp.length + (tmp.length / 70) + + 18 + 16 + header.length*2 + 10; + buf = Buffer.alloc(len); + var o = 0; + o += buf.write('-----BEGIN ' + header + '-----\n', o); + for (var i = 0; i < tmp.length; ) { + var limit = i + 70; + if (limit > tmp.length) + limit = tmp.length; + o += buf.write(tmp.slice(i, limit), o); + buf[o++] = 10; + i = limit; + } + o += buf.write('-----END ' + header + '-----\n', o); - var Q = utils.ecNormalize(key.part.Q.data, true); - der.writeBuffer(Q, asn1.Ber.BitString); -} - -function writePkcs1ECDSAPrivate(der, key) { - var ver = Buffer.from([1]); - der.writeBuffer(ver, asn1.Ber.Integer); - - der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); - - der.startSequence(0xa0); - var curve = key.part.curve.data.toString(); - var curveOid = algs.curves[curve].pkcs8oid; - assert.string(curveOid, 'a known ECDSA named curve'); - der.writeOID(curveOid); - der.endSequence(); - - der.startSequence(0xa1); - var Q = utils.ecNormalize(key.part.Q.data, true); - der.writeBuffer(Q, asn1.Ber.BitString); - der.endSequence(); -} - -function writePkcs1EdDSAPrivate(der, key) { - var ver = Buffer.from([1]); - der.writeBuffer(ver, asn1.Ber.Integer); - - der.writeBuffer(key.part.k.data, asn1.Ber.OctetString); - - der.startSequence(0xa0); - der.writeOID('1.3.101.112'); - der.endSequence(); - - der.startSequence(0xa1); - utils.writeBitString(der, key.part.A.data); - der.endSequence(); -} - -function writePkcs1EdDSAPublic(der, key) { - throw (new Error('Public keys are not supported for EdDSA PKCS#1')); + return (buf.slice(0, o)); } /***/ }), -/***/ 47: -/***/ (function(__unusedmodule, exports) { - -"use strict"; -/*! - * Copyright (c) 2015, Salesforce.com, Inc. - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * - * 1. Redistributions of source code must retain the above copyright notice, - * this list of conditions and the following disclaimer. - * - * 2. Redistributions in binary form must reproduce the above copyright notice, - * this list of conditions and the following disclaimer in the documentation - * and/or other materials provided with the distribution. - * - * 3. Neither the name of Salesforce.com nor the names of its contributors may - * be used to endorse or promote products derived from this software without - * specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE - * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR - * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF - * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS - * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN - * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) - * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE - * POSSIBILITY OF SUCH DAMAGE. - */ - -/* - * "A request-path path-matches a given cookie-path if at least one of the - * following conditions holds:" - */ -function pathMatch (reqPath, cookiePath) { - // "o The cookie-path and the request-path are identical." - if (cookiePath === reqPath) { - return true; - } - - var idx = reqPath.indexOf(cookiePath); - if (idx === 0) { - // "o The cookie-path is a prefix of the request-path, and the last - // character of the cookie-path is %x2F ("/")." - if (cookiePath.substr(-1) === "/") { - return true; - } - - // " o The cookie-path is a prefix of the request-path, and the first - // character of the request-path that is not included in the cookie- path - // is a %x2F ("/") character." - if (reqPath.substr(cookiePath.length, 1) === "/") { - return true; - } - } - - return false; -} - -exports.pathMatch = pathMatch; - - -/***/ }), - -/***/ 53: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2011 Mark Cavage All rights reserved. - -var assert = __webpack_require__(357); -var Buffer = __webpack_require__(375).Buffer; -var ASN1 = __webpack_require__(616); -var errors = __webpack_require__(690); - - -// --- Globals - -var newInvalidAsn1Error = errors.newInvalidAsn1Error; - -var DEFAULT_OPTS = { - size: 1024, - growthFactor: 8 -}; - - -// --- Helpers - -function merge(from, to) { - assert.ok(from); - assert.equal(typeof (from), 'object'); - assert.ok(to); - assert.equal(typeof (to), 'object'); - - var keys = Object.getOwnPropertyNames(from); - keys.forEach(function (key) { - if (to[key]) - return; - - var value = Object.getOwnPropertyDescriptor(from, key); - Object.defineProperty(to, key, value); - }); - - return to; -} - - - -// --- API - -function Writer(options) { - options = merge(DEFAULT_OPTS, options || {}); - - this._buf = Buffer.alloc(options.size || 1024); - this._size = this._buf.length; - this._offset = 0; - this._options = options; - - // A list of offsets in the buffer where we need to insert - // sequence tag/len pairs. - this._seq = []; -} - -Object.defineProperty(Writer.prototype, 'buffer', { - get: function () { - if (this._seq.length) - throw newInvalidAsn1Error(this._seq.length + ' unended sequence(s)'); - - return (this._buf.slice(0, this._offset)); - } -}); - -Writer.prototype.writeByte = function (b) { - if (typeof (b) !== 'number') - throw new TypeError('argument must be a Number'); - - this._ensure(1); - this._buf[this._offset++] = b; -}; - - -Writer.prototype.writeInt = function (i, tag) { - if (typeof (i) !== 'number') - throw new TypeError('argument must be a Number'); - if (typeof (tag) !== 'number') - tag = ASN1.Integer; - - var sz = 4; - - while ((((i & 0xff800000) === 0) || ((i & 0xff800000) === 0xff800000 >> 0)) && - (sz > 1)) { - sz--; - i <<= 8; - } - - if (sz > 4) - throw newInvalidAsn1Error('BER ints cannot be > 0xffffffff'); - - this._ensure(2 + sz); - this._buf[this._offset++] = tag; - this._buf[this._offset++] = sz; - - while (sz-- > 0) { - this._buf[this._offset++] = ((i & 0xff000000) >>> 24); - i <<= 8; - } - -}; - - -Writer.prototype.writeNull = function () { - this.writeByte(ASN1.Null); - this.writeByte(0x00); -}; - - -Writer.prototype.writeEnumeration = function (i, tag) { - if (typeof (i) !== 'number') - throw new TypeError('argument must be a Number'); - if (typeof (tag) !== 'number') - tag = ASN1.Enumeration; - - return this.writeInt(i, tag); -}; - - -Writer.prototype.writeBoolean = function (b, tag) { - if (typeof (b) !== 'boolean') - throw new TypeError('argument must be a Boolean'); - if (typeof (tag) !== 'number') - tag = ASN1.Boolean; - - this._ensure(3); - this._buf[this._offset++] = tag; - this._buf[this._offset++] = 0x01; - this._buf[this._offset++] = b ? 0xff : 0x00; -}; - - -Writer.prototype.writeString = function (s, tag) { - if (typeof (s) !== 'string') - throw new TypeError('argument must be a string (was: ' + typeof (s) + ')'); - if (typeof (tag) !== 'number') - tag = ASN1.OctetString; - - var len = Buffer.byteLength(s); - this.writeByte(tag); - this.writeLength(len); - if (len) { - this._ensure(len); - this._buf.write(s, this._offset); - this._offset += len; - } -}; - - -Writer.prototype.writeBuffer = function (buf, tag) { - if (typeof (tag) !== 'number') - throw new TypeError('tag must be a number'); - if (!Buffer.isBuffer(buf)) - throw new TypeError('argument must be a buffer'); - - this.writeByte(tag); - this.writeLength(buf.length); - this._ensure(buf.length); - buf.copy(this._buf, this._offset, 0, buf.length); - this._offset += buf.length; -}; - - -Writer.prototype.writeStringArray = function (strings) { - if ((!strings instanceof Array)) - throw new TypeError('argument must be an Array[String]'); - - var self = this; - strings.forEach(function (s) { - self.writeString(s); - }); -}; - -// This is really to solve DER cases, but whatever for now -Writer.prototype.writeOID = function (s, tag) { - if (typeof (s) !== 'string') - throw new TypeError('argument must be a string'); - if (typeof (tag) !== 'number') - tag = ASN1.OID; - - if (!/^([0-9]+\.){3,}[0-9]+$/.test(s)) - throw new Error('argument is not a valid OID string'); - - function encodeOctet(bytes, octet) { - if (octet < 128) { - bytes.push(octet); - } else if (octet < 16384) { - bytes.push((octet >>> 7) | 0x80); - bytes.push(octet & 0x7F); - } else if (octet < 2097152) { - bytes.push((octet >>> 14) | 0x80); - bytes.push(((octet >>> 7) | 0x80) & 0xFF); - bytes.push(octet & 0x7F); - } else if (octet < 268435456) { - bytes.push((octet >>> 21) | 0x80); - bytes.push(((octet >>> 14) | 0x80) & 0xFF); - bytes.push(((octet >>> 7) | 0x80) & 0xFF); - bytes.push(octet & 0x7F); - } else { - bytes.push(((octet >>> 28) | 0x80) & 0xFF); - bytes.push(((octet >>> 21) | 0x80) & 0xFF); - bytes.push(((octet >>> 14) | 0x80) & 0xFF); - bytes.push(((octet >>> 7) | 0x80) & 0xFF); - bytes.push(octet & 0x7F); - } - } - - var tmp = s.split('.'); - var bytes = []; - bytes.push(parseInt(tmp[0], 10) * 40 + parseInt(tmp[1], 10)); - tmp.slice(2).forEach(function (b) { - encodeOctet(bytes, parseInt(b, 10)); - }); - - var self = this; - this._ensure(2 + bytes.length); - this.writeByte(tag); - this.writeLength(bytes.length); - bytes.forEach(function (b) { - self.writeByte(b); - }); -}; - - -Writer.prototype.writeLength = function (len) { - if (typeof (len) !== 'number') - throw new TypeError('argument must be a Number'); - - this._ensure(4); - - if (len <= 0x7f) { - this._buf[this._offset++] = len; - } else if (len <= 0xff) { - this._buf[this._offset++] = 0x81; - this._buf[this._offset++] = len; - } else if (len <= 0xffff) { - this._buf[this._offset++] = 0x82; - this._buf[this._offset++] = len >> 8; - this._buf[this._offset++] = len; - } else if (len <= 0xffffff) { - this._buf[this._offset++] = 0x83; - this._buf[this._offset++] = len >> 16; - this._buf[this._offset++] = len >> 8; - this._buf[this._offset++] = len; - } else { - throw newInvalidAsn1Error('Length too long (> 4 bytes)'); - } -}; - -Writer.prototype.startSequence = function (tag) { - if (typeof (tag) !== 'number') - tag = ASN1.Sequence | ASN1.Constructor; - - this.writeByte(tag); - this._seq.push(this._offset); - this._ensure(3); - this._offset += 3; -}; - - -Writer.prototype.endSequence = function () { - var seq = this._seq.pop(); - var start = seq + 3; - var len = this._offset - start; - - if (len <= 0x7f) { - this._shift(start, len, -2); - this._buf[seq] = len; - } else if (len <= 0xff) { - this._shift(start, len, -1); - this._buf[seq] = 0x81; - this._buf[seq + 1] = len; - } else if (len <= 0xffff) { - this._buf[seq] = 0x82; - this._buf[seq + 1] = len >> 8; - this._buf[seq + 2] = len; - } else if (len <= 0xffffff) { - this._shift(start, len, 1); - this._buf[seq] = 0x83; - this._buf[seq + 1] = len >> 16; - this._buf[seq + 2] = len >> 8; - this._buf[seq + 3] = len; - } else { - throw newInvalidAsn1Error('Sequence too long'); - } -}; - - -Writer.prototype._shift = function (start, len, shift) { - assert.ok(start !== undefined); - assert.ok(len !== undefined); - assert.ok(shift); - - this._buf.copy(this._buf, start + shift, start, start + len); - this._offset += shift; -}; - -Writer.prototype._ensure = function (len) { - assert.ok(len); - - if (this._size - this._offset < len) { - var sz = this._size * this._options.growthFactor; - if (sz - this._offset < len) - sz += len; - - var buf = Buffer.alloc(sz); - - this._buf.copy(buf, 0, 0, this._offset); - this._buf = buf; - this._size = sz; - } -}; - - - -// --- Exported API - -module.exports = Writer; - - -/***/ }), - -/***/ 58: +/***/ 85: /***/ (function(module) { "use strict"; - -var isArray = Array.isArray; -var keyList = Object.keys; -var hasProp = Object.prototype.hasOwnProperty; - -module.exports = function equal(a, b) { - if (a === b) return true; - - if (a && b && typeof a == 'object' && typeof b == 'object') { - var arrA = isArray(a) - , arrB = isArray(b) - , i - , length - , key; - - if (arrA && arrB) { - length = a.length; - if (length != b.length) return false; - for (i = length; i-- !== 0;) - if (!equal(a[i], b[i])) return false; - return true; - } - - if (arrA != arrB) return false; - - var dateA = a instanceof Date - , dateB = b instanceof Date; - if (dateA != dateB) return false; - if (dateA && dateB) return a.getTime() == b.getTime(); - - var regexpA = a instanceof RegExp - , regexpB = b instanceof RegExp; - if (regexpA != regexpB) return false; - if (regexpA && regexpB) return a.toString() == b.toString(); - - var keys = keyList(a); - length = keys.length; - - if (length !== keyList(b).length) - return false; - - for (i = length; i-- !== 0;) - if (!hasProp.call(b, keys[i])) return false; - - for (i = length; i-- !== 0;) { - key = keys[i]; - if (!equal(a[key], b[key])) return false; - } - - return true; - } - - return a!==a && b!==b; -}; - - -/***/ }), - -/***/ 68: -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_format(it, $keyword, $ruleType) { +module.exports = function generate__limitItems(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; @@ -2582,13 +2050,8 @@ module.exports = function generate_format(it, $keyword, $ruleType) { var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; + var $errorKeyword; var $data = 'data' + ($dataLvl || ''); - if (it.opts.format === false) { - if ($breakOnError) { - out += ' if (true) { '; - } - return out; - } var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { @@ -2597,107 +2060,39 @@ module.exports = function generate_format(it, $keyword, $ruleType) { } else { $schemaValue = $schema; } - var $unknownFormats = it.opts.unknownFormats, - $allowUnknown = Array.isArray($unknownFormats); + var $op = $keyword == 'maxItems' ? '>' : '<'; + out += 'if ( '; if ($isData) { - var $format = 'format' + $lvl, - $isObject = 'isObject' + $lvl, - $formatType = 'formatType' + $lvl; - out += ' var ' + ($format) + ' = formats[' + ($schemaValue) + ']; var ' + ($isObject) + ' = typeof ' + ($format) + ' == \'object\' && !(' + ($format) + ' instanceof RegExp) && ' + ($format) + '.validate; var ' + ($formatType) + ' = ' + ($isObject) + ' && ' + ($format) + '.type || \'string\'; if (' + ($isObject) + ') { '; - if (it.async) { - out += ' var async' + ($lvl) + ' = ' + ($format) + '.async; '; - } - out += ' ' + ($format) + ' = ' + ($format) + '.validate; } if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || '; - } - out += ' ('; - if ($unknownFormats != 'ignore') { - out += ' (' + ($schemaValue) + ' && !' + ($format) + ' '; - if ($allowUnknown) { - out += ' && self._opts.unknownFormats.indexOf(' + ($schemaValue) + ') == -1 '; - } - out += ') || '; - } - out += ' (' + ($format) + ' && ' + ($formatType) + ' == \'' + ($ruleType) + '\' && !(typeof ' + ($format) + ' == \'function\' ? '; - if (it.async) { - out += ' (async' + ($lvl) + ' ? await ' + ($format) + '(' + ($data) + ') : ' + ($format) + '(' + ($data) + ')) '; - } else { - out += ' ' + ($format) + '(' + ($data) + ') '; - } - out += ' : ' + ($format) + '.test(' + ($data) + '))))) {'; - } else { - var $format = it.formats[$schema]; - if (!$format) { - if ($unknownFormats == 'ignore') { - it.logger.warn('unknown format "' + $schema + '" ignored in schema at path "' + it.errSchemaPath + '"'); - if ($breakOnError) { - out += ' if (true) { '; - } - return out; - } else if ($allowUnknown && $unknownFormats.indexOf($schema) >= 0) { - if ($breakOnError) { - out += ' if (true) { '; - } - return out; - } else { - throw new Error('unknown format "' + $schema + '" is used in schema at path "' + it.errSchemaPath + '"'); - } - } - var $isObject = typeof $format == 'object' && !($format instanceof RegExp) && $format.validate; - var $formatType = $isObject && $format.type || 'string'; - if ($isObject) { - var $async = $format.async === true; - $format = $format.validate; - } - if ($formatType != $ruleType) { - if ($breakOnError) { - out += ' if (true) { '; - } - return out; - } - if ($async) { - if (!it.async) throw new Error('async format in sync schema'); - var $formatRef = 'formats' + it.util.getProperty($schema) + '.validate'; - out += ' if (!(await ' + ($formatRef) + '(' + ($data) + '))) { '; - } else { - out += ' if (! '; - var $formatRef = 'formats' + it.util.getProperty($schema); - if ($isObject) $formatRef += '.validate'; - if (typeof $format == 'function') { - out += ' ' + ($formatRef) + '(' + ($data) + ') '; - } else { - out += ' ' + ($formatRef) + '.test(' + ($data) + ') '; - } - out += ') { '; - } + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; } + out += ' ' + ($data) + '.length ' + ($op) + ' ' + ($schemaValue) + ') { '; + var $errorKeyword = $keyword; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { - out += ' { keyword: \'' + ('format') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { format: '; - if ($isData) { - out += '' + ($schemaValue); - } else { - out += '' + (it.util.toQuotedString($schema)); - } - out += ' } '; + out += ' { keyword: \'' + ($errorKeyword || '_limitItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; if (it.opts.messages !== false) { - out += ' , message: \'should match format "'; + out += ' , message: \'should NOT have '; + if ($keyword == 'maxItems') { + out += 'more'; + } else { + out += 'fewer'; + } + out += ' than '; if ($isData) { out += '\' + ' + ($schemaValue) + ' + \''; } else { - out += '' + (it.util.escapeQuotes($schema)); + out += '' + ($schema); } - out += '"\' '; + out += ' items\' '; } if (it.opts.verbose) { out += ' , schema: '; if ($isData) { out += 'validate.schema' + ($schemaPath); } else { - out += '' + (it.util.toQuotedString($schema)); + out += '' + ($schema); } out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } @@ -2717,7 +2112,7 @@ module.exports = function generate_format(it, $keyword, $ruleType) { } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } - out += ' } '; + out += '} '; if ($breakOnError) { out += ' else { '; } @@ -2727,1471 +2122,905 @@ module.exports = function generate_format(it, $keyword, $ruleType) { /***/ }), -/***/ 71: -/***/ (function(module, exports) { +/***/ 87: +/***/ (function(module) { -(function(){ +module.exports = require("os"); - // Copyright (c) 2005 Tom Wu - // All Rights Reserved. - // See "LICENSE" for details. +/***/ }), - // Basic JavaScript BN library - subset useful for RSA encryption. +/***/ 91: +/***/ (function(module, __unusedexports, __webpack_require__) { - // Bits per digit - var dbits; +var serialOrdered = __webpack_require__(892); - // JavaScript engine analysis - var canary = 0xdeadbeefcafe; - var j_lm = ((canary&0xffffff)==0xefcafe); +// Public API +module.exports = serial; - // (public) Constructor - function BigInteger(a,b,c) { - if(a != null) - if("number" == typeof a) this.fromNumber(a,b,c); - else if(b == null && "string" != typeof a) this.fromString(a,256); - else this.fromString(a,b); - } - - // return new, unset BigInteger - function nbi() { return new BigInteger(null); } - - // am: Compute w_j += (x*this_i), propagate carries, - // c is initial carry, returns final carry. - // c < 3*dvalue, x < 2*dvalue, this_i < dvalue - // We need to select the fastest one that works in this environment. - - // am1: use a single mult and divide to get the high bits, - // max digit bits should be 26 because - // max internal value = 2*dvalue^2-2*dvalue (< 2^53) - function am1(i,x,w,j,c,n) { - while(--n >= 0) { - var v = x*this[i++]+w[j]+c; - c = Math.floor(v/0x4000000); - w[j++] = v&0x3ffffff; - } - return c; - } - // am2 avoids a big mult-and-extract completely. - // Max digit bits should be <= 30 because we do bitwise ops - // on values up to 2*hdvalue^2-hdvalue-1 (< 2^31) - function am2(i,x,w,j,c,n) { - var xl = x&0x7fff, xh = x>>15; - while(--n >= 0) { - var l = this[i]&0x7fff; - var h = this[i++]>>15; - var m = xh*l+h*xl; - l = xl*l+((m&0x7fff)<<15)+w[j]+(c&0x3fffffff); - c = (l>>>30)+(m>>>15)+xh*h+(c>>>30); - w[j++] = l&0x3fffffff; - } - return c; - } - // Alternately, set max digit bits to 28 since some - // browsers slow down when dealing with 32-bit numbers. - function am3(i,x,w,j,c,n) { - var xl = x&0x3fff, xh = x>>14; - while(--n >= 0) { - var l = this[i]&0x3fff; - var h = this[i++]>>14; - var m = xh*l+h*xl; - l = xl*l+((m&0x3fff)<<14)+w[j]+c; - c = (l>>28)+(m>>14)+xh*h; - w[j++] = l&0xfffffff; - } - return c; - } - var inBrowser = typeof navigator !== "undefined"; - if(inBrowser && j_lm && (navigator.appName == "Microsoft Internet Explorer")) { - BigInteger.prototype.am = am2; - dbits = 30; - } - else if(inBrowser && j_lm && (navigator.appName != "Netscape")) { - BigInteger.prototype.am = am1; - dbits = 26; - } - else { // Mozilla/Netscape seems to prefer am3 - BigInteger.prototype.am = am3; - dbits = 28; - } - - BigInteger.prototype.DB = dbits; - BigInteger.prototype.DM = ((1<= 0; --i) r[i] = this[i]; - r.t = this.t; - r.s = this.s; - } - - // (protected) set from integer value x, -DV <= x < DV - function bnpFromInt(x) { - this.t = 1; - this.s = (x<0)?-1:0; - if(x > 0) this[0] = x; - else if(x < -1) this[0] = x+this.DV; - else this.t = 0; - } - - // return bigint initialized to value - function nbv(i) { var r = nbi(); r.fromInt(i); return r; } - - // (protected) set from string and radix - function bnpFromString(s,b) { - var k; - if(b == 16) k = 4; - else if(b == 8) k = 3; - else if(b == 256) k = 8; // byte array - else if(b == 2) k = 1; - else if(b == 32) k = 5; - else if(b == 4) k = 2; - else { this.fromRadix(s,b); return; } - this.t = 0; - this.s = 0; - var i = s.length, mi = false, sh = 0; - while(--i >= 0) { - var x = (k==8)?s[i]&0xff:intAt(s,i); - if(x < 0) { - if(s.charAt(i) == "-") mi = true; - continue; - } - mi = false; - if(sh == 0) - this[this.t++] = x; - else if(sh+k > this.DB) { - this[this.t-1] |= (x&((1<<(this.DB-sh))-1))<>(this.DB-sh)); - } - else - this[this.t-1] |= x<= this.DB) sh -= this.DB; - } - if(k == 8 && (s[0]&0x80) != 0) { - this.s = -1; - if(sh > 0) this[this.t-1] |= ((1<<(this.DB-sh))-1)< 0 && this[this.t-1] == c) --this.t; - } - - // (public) return string representation in given radix - function bnToString(b) { - if(this.s < 0) return "-"+this.negate().toString(b); - var k; - if(b == 16) k = 4; - else if(b == 8) k = 3; - else if(b == 2) k = 1; - else if(b == 32) k = 5; - else if(b == 4) k = 2; - else return this.toRadix(b); - var km = (1< 0) { - if(p < this.DB && (d = this[i]>>p) > 0) { m = true; r = int2char(d); } - while(i >= 0) { - if(p < k) { - d = (this[i]&((1<>(p+=this.DB-k); - } - else { - d = (this[i]>>(p-=k))&km; - if(p <= 0) { p += this.DB; --i; } - } - if(d > 0) m = true; - if(m) r += int2char(d); - } - } - return m?r:"0"; - } - - // (public) -this - function bnNegate() { var r = nbi(); BigInteger.ZERO.subTo(this,r); return r; } - - // (public) |this| - function bnAbs() { return (this.s<0)?this.negate():this; } - - // (public) return + if this > a, - if this < a, 0 if equal - function bnCompareTo(a) { - var r = this.s-a.s; - if(r != 0) return r; - var i = this.t; - r = i-a.t; - if(r != 0) return (this.s<0)?-r:r; - while(--i >= 0) if((r=this[i]-a[i]) != 0) return r; - return 0; - } - - // returns bit length of the integer x - function nbits(x) { - var r = 1, t; - if((t=x>>>16) != 0) { x = t; r += 16; } - if((t=x>>8) != 0) { x = t; r += 8; } - if((t=x>>4) != 0) { x = t; r += 4; } - if((t=x>>2) != 0) { x = t; r += 2; } - if((t=x>>1) != 0) { x = t; r += 1; } - return r; - } - - // (public) return the number of bits in "this" - function bnBitLength() { - if(this.t <= 0) return 0; - return this.DB*(this.t-1)+nbits(this[this.t-1]^(this.s&this.DM)); - } - - // (protected) r = this << n*DB - function bnpDLShiftTo(n,r) { - var i; - for(i = this.t-1; i >= 0; --i) r[i+n] = this[i]; - for(i = n-1; i >= 0; --i) r[i] = 0; - r.t = this.t+n; - r.s = this.s; - } - - // (protected) r = this >> n*DB - function bnpDRShiftTo(n,r) { - for(var i = n; i < this.t; ++i) r[i-n] = this[i]; - r.t = Math.max(this.t-n,0); - r.s = this.s; - } - - // (protected) r = this << n - function bnpLShiftTo(n,r) { - var bs = n%this.DB; - var cbs = this.DB-bs; - var bm = (1<= 0; --i) { - r[i+ds+1] = (this[i]>>cbs)|c; - c = (this[i]&bm)<= 0; --i) r[i] = 0; - r[ds] = c; - r.t = this.t+ds+1; - r.s = this.s; - r.clamp(); - } - - // (protected) r = this >> n - function bnpRShiftTo(n,r) { - r.s = this.s; - var ds = Math.floor(n/this.DB); - if(ds >= this.t) { r.t = 0; return; } - var bs = n%this.DB; - var cbs = this.DB-bs; - var bm = (1<>bs; - for(var i = ds+1; i < this.t; ++i) { - r[i-ds-1] |= (this[i]&bm)<>bs; - } - if(bs > 0) r[this.t-ds-1] |= (this.s&bm)<>= this.DB; - } - if(a.t < this.t) { - c -= a.s; - while(i < this.t) { - c += this[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c += this.s; - } - else { - c += this.s; - while(i < a.t) { - c -= a[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c -= a.s; - } - r.s = (c<0)?-1:0; - if(c < -1) r[i++] = this.DV+c; - else if(c > 0) r[i++] = c; - r.t = i; - r.clamp(); - } - - // (protected) r = this * a, r != this,a (HAC 14.12) - // "this" should be the larger one if appropriate. - function bnpMultiplyTo(a,r) { - var x = this.abs(), y = a.abs(); - var i = x.t; - r.t = i+y.t; - while(--i >= 0) r[i] = 0; - for(i = 0; i < y.t; ++i) r[i+x.t] = x.am(0,y[i],r,i,0,x.t); - r.s = 0; - r.clamp(); - if(this.s != a.s) BigInteger.ZERO.subTo(r,r); - } - - // (protected) r = this^2, r != this (HAC 14.16) - function bnpSquareTo(r) { - var x = this.abs(); - var i = r.t = 2*x.t; - while(--i >= 0) r[i] = 0; - for(i = 0; i < x.t-1; ++i) { - var c = x.am(i,x[i],r,2*i,0,1); - if((r[i+x.t]+=x.am(i+1,2*x[i],r,2*i+1,c,x.t-i-1)) >= x.DV) { - r[i+x.t] -= x.DV; - r[i+x.t+1] = 1; - } - } - if(r.t > 0) r[r.t-1] += x.am(i,x[i],r,2*i,0,1); - r.s = 0; - r.clamp(); - } - - // (protected) divide this by m, quotient and remainder to q, r (HAC 14.20) - // r != q, this != m. q or r may be null. - function bnpDivRemTo(m,q,r) { - var pm = m.abs(); - if(pm.t <= 0) return; - var pt = this.abs(); - if(pt.t < pm.t) { - if(q != null) q.fromInt(0); - if(r != null) this.copyTo(r); - return; - } - if(r == null) r = nbi(); - var y = nbi(), ts = this.s, ms = m.s; - var nsh = this.DB-nbits(pm[pm.t-1]); // normalize modulus - if(nsh > 0) { pm.lShiftTo(nsh,y); pt.lShiftTo(nsh,r); } - else { pm.copyTo(y); pt.copyTo(r); } - var ys = y.t; - var y0 = y[ys-1]; - if(y0 == 0) return; - var yt = y0*(1<1)?y[ys-2]>>this.F2:0); - var d1 = this.FV/yt, d2 = (1<= 0) { - r[r.t++] = 1; - r.subTo(t,r); - } - BigInteger.ONE.dlShiftTo(ys,t); - t.subTo(y,y); // "negative" y so we can replace sub with am later - while(y.t < ys) y[y.t++] = 0; - while(--j >= 0) { - // Estimate quotient digit - var qd = (r[--i]==y0)?this.DM:Math.floor(r[i]*d1+(r[i-1]+e)*d2); - if((r[i]+=y.am(0,qd,r,j,0,ys)) < qd) { // Try it out - y.dlShiftTo(j,t); - r.subTo(t,r); - while(r[i] < --qd) r.subTo(t,r); - } - } - if(q != null) { - r.drShiftTo(ys,q); - if(ts != ms) BigInteger.ZERO.subTo(q,q); - } - r.t = ys; - r.clamp(); - if(nsh > 0) r.rShiftTo(nsh,r); // Denormalize remainder - if(ts < 0) BigInteger.ZERO.subTo(r,r); - } - - // (public) this mod a - function bnMod(a) { - var r = nbi(); - this.abs().divRemTo(a,null,r); - if(this.s < 0 && r.compareTo(BigInteger.ZERO) > 0) a.subTo(r,r); - return r; - } - - // Modular reduction using "classic" algorithm - function Classic(m) { this.m = m; } - function cConvert(x) { - if(x.s < 0 || x.compareTo(this.m) >= 0) return x.mod(this.m); - else return x; - } - function cRevert(x) { return x; } - function cReduce(x) { x.divRemTo(this.m,null,x); } - function cMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } - function cSqrTo(x,r) { x.squareTo(r); this.reduce(r); } - - Classic.prototype.convert = cConvert; - Classic.prototype.revert = cRevert; - Classic.prototype.reduce = cReduce; - Classic.prototype.mulTo = cMulTo; - Classic.prototype.sqrTo = cSqrTo; - - // (protected) return "-1/this % 2^DB"; useful for Mont. reduction - // justification: - // xy == 1 (mod m) - // xy = 1+km - // xy(2-xy) = (1+km)(1-km) - // x[y(2-xy)] = 1-k^2m^2 - // x[y(2-xy)] == 1 (mod m^2) - // if y is 1/x mod m, then y(2-xy) is 1/x mod m^2 - // should reduce x and y(2-xy) by m^2 at each step to keep size bounded. - // JS multiply "overflows" differently from C/C++, so care is needed here. - function bnpInvDigit() { - if(this.t < 1) return 0; - var x = this[0]; - if((x&1) == 0) return 0; - var y = x&3; // y == 1/x mod 2^2 - y = (y*(2-(x&0xf)*y))&0xf; // y == 1/x mod 2^4 - y = (y*(2-(x&0xff)*y))&0xff; // y == 1/x mod 2^8 - y = (y*(2-(((x&0xffff)*y)&0xffff)))&0xffff; // y == 1/x mod 2^16 - // last step - calculate inverse mod DV directly; - // assumes 16 < DB <= 32 and assumes ability to handle 48-bit ints - y = (y*(2-x*y%this.DV))%this.DV; // y == 1/x mod 2^dbits - // we really want the negative inverse, and -DV < y < DV - return (y>0)?this.DV-y:-y; - } - - // Montgomery reduction - function Montgomery(m) { - this.m = m; - this.mp = m.invDigit(); - this.mpl = this.mp&0x7fff; - this.mph = this.mp>>15; - this.um = (1<<(m.DB-15))-1; - this.mt2 = 2*m.t; - } - - // xR mod m - function montConvert(x) { - var r = nbi(); - x.abs().dlShiftTo(this.m.t,r); - r.divRemTo(this.m,null,r); - if(x.s < 0 && r.compareTo(BigInteger.ZERO) > 0) this.m.subTo(r,r); - return r; - } - - // x/R mod m - function montRevert(x) { - var r = nbi(); - x.copyTo(r); - this.reduce(r); - return r; - } - - // x = x/R mod m (HAC 14.32) - function montReduce(x) { - while(x.t <= this.mt2) // pad x so am has enough room later - x[x.t++] = 0; - for(var i = 0; i < this.m.t; ++i) { - // faster way of calculating u0 = x[i]*mp mod DV - var j = x[i]&0x7fff; - var u0 = (j*this.mpl+(((j*this.mph+(x[i]>>15)*this.mpl)&this.um)<<15))&x.DM; - // use am to combine the multiply-shift-add into one call - j = i+this.m.t; - x[j] += this.m.am(0,u0,x,i,0,this.m.t); - // propagate carry - while(x[j] >= x.DV) { x[j] -= x.DV; x[++j]++; } - } - x.clamp(); - x.drShiftTo(this.m.t,x); - if(x.compareTo(this.m) >= 0) x.subTo(this.m,x); - } - - // r = "x^2/R mod m"; x != r - function montSqrTo(x,r) { x.squareTo(r); this.reduce(r); } - - // r = "xy/R mod m"; x,y != r - function montMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } - - Montgomery.prototype.convert = montConvert; - Montgomery.prototype.revert = montRevert; - Montgomery.prototype.reduce = montReduce; - Montgomery.prototype.mulTo = montMulTo; - Montgomery.prototype.sqrTo = montSqrTo; - - // (protected) true iff this is even - function bnpIsEven() { return ((this.t>0)?(this[0]&1):this.s) == 0; } - - // (protected) this^e, e < 2^32, doing sqr and mul with "r" (HAC 14.79) - function bnpExp(e,z) { - if(e > 0xffffffff || e < 1) return BigInteger.ONE; - var r = nbi(), r2 = nbi(), g = z.convert(this), i = nbits(e)-1; - g.copyTo(r); - while(--i >= 0) { - z.sqrTo(r,r2); - if((e&(1< 0) z.mulTo(r2,g,r); - else { var t = r; r = r2; r2 = t; } - } - return z.revert(r); - } - - // (public) this^e % m, 0 <= e < 2^32 - function bnModPowInt(e,m) { - var z; - if(e < 256 || m.isEven()) z = new Classic(m); else z = new Montgomery(m); - return this.exp(e,z); - } - - // protected - BigInteger.prototype.copyTo = bnpCopyTo; - BigInteger.prototype.fromInt = bnpFromInt; - BigInteger.prototype.fromString = bnpFromString; - BigInteger.prototype.clamp = bnpClamp; - BigInteger.prototype.dlShiftTo = bnpDLShiftTo; - BigInteger.prototype.drShiftTo = bnpDRShiftTo; - BigInteger.prototype.lShiftTo = bnpLShiftTo; - BigInteger.prototype.rShiftTo = bnpRShiftTo; - BigInteger.prototype.subTo = bnpSubTo; - BigInteger.prototype.multiplyTo = bnpMultiplyTo; - BigInteger.prototype.squareTo = bnpSquareTo; - BigInteger.prototype.divRemTo = bnpDivRemTo; - BigInteger.prototype.invDigit = bnpInvDigit; - BigInteger.prototype.isEven = bnpIsEven; - BigInteger.prototype.exp = bnpExp; - - // public - BigInteger.prototype.toString = bnToString; - BigInteger.prototype.negate = bnNegate; - BigInteger.prototype.abs = bnAbs; - BigInteger.prototype.compareTo = bnCompareTo; - BigInteger.prototype.bitLength = bnBitLength; - BigInteger.prototype.mod = bnMod; - BigInteger.prototype.modPowInt = bnModPowInt; - - // "constants" - BigInteger.ZERO = nbv(0); - BigInteger.ONE = nbv(1); - - // Copyright (c) 2005-2009 Tom Wu - // All Rights Reserved. - // See "LICENSE" for details. - - // Extended JavaScript BN functions, required for RSA private ops. - - // Version 1.1: new BigInteger("0", 10) returns "proper" zero - // Version 1.2: square() API, isProbablePrime fix - - // (public) - function bnClone() { var r = nbi(); this.copyTo(r); return r; } - - // (public) return value as integer - function bnIntValue() { - if(this.s < 0) { - if(this.t == 1) return this[0]-this.DV; - else if(this.t == 0) return -1; - } - else if(this.t == 1) return this[0]; - else if(this.t == 0) return 0; - // assumes 16 < DB < 32 - return ((this[1]&((1<<(32-this.DB))-1))<>24; } - - // (public) return value as short (assumes DB>=16) - function bnShortValue() { return (this.t==0)?this.s:(this[0]<<16)>>16; } - - // (protected) return x s.t. r^x < DV - function bnpChunkSize(r) { return Math.floor(Math.LN2*this.DB/Math.log(r)); } - - // (public) 0 if this == 0, 1 if this > 0 - function bnSigNum() { - if(this.s < 0) return -1; - else if(this.t <= 0 || (this.t == 1 && this[0] <= 0)) return 0; - else return 1; - } - - // (protected) convert to radix string - function bnpToRadix(b) { - if(b == null) b = 10; - if(this.signum() == 0 || b < 2 || b > 36) return "0"; - var cs = this.chunkSize(b); - var a = Math.pow(b,cs); - var d = nbv(a), y = nbi(), z = nbi(), r = ""; - this.divRemTo(d,y,z); - while(y.signum() > 0) { - r = (a+z.intValue()).toString(b).substr(1) + r; - y.divRemTo(d,y,z); - } - return z.intValue().toString(b) + r; - } - - // (protected) convert from radix string - function bnpFromRadix(s,b) { - this.fromInt(0); - if(b == null) b = 10; - var cs = this.chunkSize(b); - var d = Math.pow(b,cs), mi = false, j = 0, w = 0; - for(var i = 0; i < s.length; ++i) { - var x = intAt(s,i); - if(x < 0) { - if(s.charAt(i) == "-" && this.signum() == 0) mi = true; - continue; - } - w = b*w+x; - if(++j >= cs) { - this.dMultiply(d); - this.dAddOffset(w,0); - j = 0; - w = 0; - } - } - if(j > 0) { - this.dMultiply(Math.pow(b,j)); - this.dAddOffset(w,0); - } - if(mi) BigInteger.ZERO.subTo(this,this); - } - - // (protected) alternate constructor - function bnpFromNumber(a,b,c) { - if("number" == typeof b) { - // new BigInteger(int,int,RNG) - if(a < 2) this.fromInt(1); - else { - this.fromNumber(a,c); - if(!this.testBit(a-1)) // force MSB set - this.bitwiseTo(BigInteger.ONE.shiftLeft(a-1),op_or,this); - if(this.isEven()) this.dAddOffset(1,0); // force odd - while(!this.isProbablePrime(b)) { - this.dAddOffset(2,0); - if(this.bitLength() > a) this.subTo(BigInteger.ONE.shiftLeft(a-1),this); - } - } - } - else { - // new BigInteger(int,RNG) - var x = new Array(), t = a&7; - x.length = (a>>3)+1; - b.nextBytes(x); - if(t > 0) x[0] &= ((1< 0) { - if(p < this.DB && (d = this[i]>>p) != (this.s&this.DM)>>p) - r[k++] = d|(this.s<<(this.DB-p)); - while(i >= 0) { - if(p < 8) { - d = (this[i]&((1<>(p+=this.DB-8); - } - else { - d = (this[i]>>(p-=8))&0xff; - if(p <= 0) { p += this.DB; --i; } - } - if((d&0x80) != 0) d |= -256; - if(k == 0 && (this.s&0x80) != (d&0x80)) ++k; - if(k > 0 || d != this.s) r[k++] = d; - } - } - return r; - } - - function bnEquals(a) { return(this.compareTo(a)==0); } - function bnMin(a) { return(this.compareTo(a)<0)?this:a; } - function bnMax(a) { return(this.compareTo(a)>0)?this:a; } - - // (protected) r = this op a (bitwise) - function bnpBitwiseTo(a,op,r) { - var i, f, m = Math.min(a.t,this.t); - for(i = 0; i < m; ++i) r[i] = op(this[i],a[i]); - if(a.t < this.t) { - f = a.s&this.DM; - for(i = m; i < this.t; ++i) r[i] = op(this[i],f); - r.t = this.t; - } - else { - f = this.s&this.DM; - for(i = m; i < a.t; ++i) r[i] = op(f,a[i]); - r.t = a.t; - } - r.s = op(this.s,a.s); - r.clamp(); - } - - // (public) this & a - function op_and(x,y) { return x&y; } - function bnAnd(a) { var r = nbi(); this.bitwiseTo(a,op_and,r); return r; } - - // (public) this | a - function op_or(x,y) { return x|y; } - function bnOr(a) { var r = nbi(); this.bitwiseTo(a,op_or,r); return r; } - - // (public) this ^ a - function op_xor(x,y) { return x^y; } - function bnXor(a) { var r = nbi(); this.bitwiseTo(a,op_xor,r); return r; } - - // (public) this & ~a - function op_andnot(x,y) { return x&~y; } - function bnAndNot(a) { var r = nbi(); this.bitwiseTo(a,op_andnot,r); return r; } - - // (public) ~this - function bnNot() { - var r = nbi(); - for(var i = 0; i < this.t; ++i) r[i] = this.DM&~this[i]; - r.t = this.t; - r.s = ~this.s; - return r; - } - - // (public) this << n - function bnShiftLeft(n) { - var r = nbi(); - if(n < 0) this.rShiftTo(-n,r); else this.lShiftTo(n,r); - return r; - } - - // (public) this >> n - function bnShiftRight(n) { - var r = nbi(); - if(n < 0) this.lShiftTo(-n,r); else this.rShiftTo(n,r); - return r; - } - - // return index of lowest 1-bit in x, x < 2^31 - function lbit(x) { - if(x == 0) return -1; - var r = 0; - if((x&0xffff) == 0) { x >>= 16; r += 16; } - if((x&0xff) == 0) { x >>= 8; r += 8; } - if((x&0xf) == 0) { x >>= 4; r += 4; } - if((x&3) == 0) { x >>= 2; r += 2; } - if((x&1) == 0) ++r; - return r; - } - - // (public) returns index of lowest 1-bit (or -1 if none) - function bnGetLowestSetBit() { - for(var i = 0; i < this.t; ++i) - if(this[i] != 0) return i*this.DB+lbit(this[i]); - if(this.s < 0) return this.t*this.DB; - return -1; - } - - // return number of 1 bits in x - function cbit(x) { - var r = 0; - while(x != 0) { x &= x-1; ++r; } - return r; - } - - // (public) return number of set bits - function bnBitCount() { - var r = 0, x = this.s&this.DM; - for(var i = 0; i < this.t; ++i) r += cbit(this[i]^x); - return r; - } - - // (public) true iff nth bit is set - function bnTestBit(n) { - var j = Math.floor(n/this.DB); - if(j >= this.t) return(this.s!=0); - return((this[j]&(1<<(n%this.DB)))!=0); - } - - // (protected) this op (1<>= this.DB; - } - if(a.t < this.t) { - c += a.s; - while(i < this.t) { - c += this[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c += this.s; - } - else { - c += this.s; - while(i < a.t) { - c += a[i]; - r[i++] = c&this.DM; - c >>= this.DB; - } - c += a.s; - } - r.s = (c<0)?-1:0; - if(c > 0) r[i++] = c; - else if(c < -1) r[i++] = this.DV+c; - r.t = i; - r.clamp(); - } - - // (public) this + a - function bnAdd(a) { var r = nbi(); this.addTo(a,r); return r; } - - // (public) this - a - function bnSubtract(a) { var r = nbi(); this.subTo(a,r); return r; } - - // (public) this * a - function bnMultiply(a) { var r = nbi(); this.multiplyTo(a,r); return r; } - - // (public) this^2 - function bnSquare() { var r = nbi(); this.squareTo(r); return r; } - - // (public) this / a - function bnDivide(a) { var r = nbi(); this.divRemTo(a,r,null); return r; } - - // (public) this % a - function bnRemainder(a) { var r = nbi(); this.divRemTo(a,null,r); return r; } - - // (public) [this/a,this%a] - function bnDivideAndRemainder(a) { - var q = nbi(), r = nbi(); - this.divRemTo(a,q,r); - return new Array(q,r); - } - - // (protected) this *= n, this >= 0, 1 < n < DV - function bnpDMultiply(n) { - this[this.t] = this.am(0,n-1,this,0,0,this.t); - ++this.t; - this.clamp(); - } - - // (protected) this += n << w words, this >= 0 - function bnpDAddOffset(n,w) { - if(n == 0) return; - while(this.t <= w) this[this.t++] = 0; - this[w] += n; - while(this[w] >= this.DV) { - this[w] -= this.DV; - if(++w >= this.t) this[this.t++] = 0; - ++this[w]; - } - } - - // A "null" reducer - function NullExp() {} - function nNop(x) { return x; } - function nMulTo(x,y,r) { x.multiplyTo(y,r); } - function nSqrTo(x,r) { x.squareTo(r); } - - NullExp.prototype.convert = nNop; - NullExp.prototype.revert = nNop; - NullExp.prototype.mulTo = nMulTo; - NullExp.prototype.sqrTo = nSqrTo; - - // (public) this^e - function bnPow(e) { return this.exp(e,new NullExp()); } - - // (protected) r = lower n words of "this * a", a.t <= n - // "this" should be the larger one if appropriate. - function bnpMultiplyLowerTo(a,n,r) { - var i = Math.min(this.t+a.t,n); - r.s = 0; // assumes a,this >= 0 - r.t = i; - while(i > 0) r[--i] = 0; - var j; - for(j = r.t-this.t; i < j; ++i) r[i+this.t] = this.am(0,a[i],r,i,0,this.t); - for(j = Math.min(a.t,n); i < j; ++i) this.am(0,a[i],r,i,0,n-i); - r.clamp(); - } - - // (protected) r = "this * a" without lower n words, n > 0 - // "this" should be the larger one if appropriate. - function bnpMultiplyUpperTo(a,n,r) { - --n; - var i = r.t = this.t+a.t-n; - r.s = 0; // assumes a,this >= 0 - while(--i >= 0) r[i] = 0; - for(i = Math.max(n-this.t,0); i < a.t; ++i) - r[this.t+i-n] = this.am(n-i,a[i],r,0,0,this.t+i-n); - r.clamp(); - r.drShiftTo(1,r); - } - - // Barrett modular reduction - function Barrett(m) { - // setup Barrett - this.r2 = nbi(); - this.q3 = nbi(); - BigInteger.ONE.dlShiftTo(2*m.t,this.r2); - this.mu = this.r2.divide(m); - this.m = m; - } - - function barrettConvert(x) { - if(x.s < 0 || x.t > 2*this.m.t) return x.mod(this.m); - else if(x.compareTo(this.m) < 0) return x; - else { var r = nbi(); x.copyTo(r); this.reduce(r); return r; } - } - - function barrettRevert(x) { return x; } - - // x = x mod m (HAC 14.42) - function barrettReduce(x) { - x.drShiftTo(this.m.t-1,this.r2); - if(x.t > this.m.t+1) { x.t = this.m.t+1; x.clamp(); } - this.mu.multiplyUpperTo(this.r2,this.m.t+1,this.q3); - this.m.multiplyLowerTo(this.q3,this.m.t+1,this.r2); - while(x.compareTo(this.r2) < 0) x.dAddOffset(1,this.m.t+1); - x.subTo(this.r2,x); - while(x.compareTo(this.m) >= 0) x.subTo(this.m,x); - } - - // r = x^2 mod m; x != r - function barrettSqrTo(x,r) { x.squareTo(r); this.reduce(r); } - - // r = x*y mod m; x,y != r - function barrettMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } - - Barrett.prototype.convert = barrettConvert; - Barrett.prototype.revert = barrettRevert; - Barrett.prototype.reduce = barrettReduce; - Barrett.prototype.mulTo = barrettMulTo; - Barrett.prototype.sqrTo = barrettSqrTo; - - // (public) this^e % m (HAC 14.85) - function bnModPow(e,m) { - var i = e.bitLength(), k, r = nbv(1), z; - if(i <= 0) return r; - else if(i < 18) k = 1; - else if(i < 48) k = 3; - else if(i < 144) k = 4; - else if(i < 768) k = 5; - else k = 6; - if(i < 8) - z = new Classic(m); - else if(m.isEven()) - z = new Barrett(m); - else - z = new Montgomery(m); - - // precomputation - var g = new Array(), n = 3, k1 = k-1, km = (1< 1) { - var g2 = nbi(); - z.sqrTo(g[1],g2); - while(n <= km) { - g[n] = nbi(); - z.mulTo(g2,g[n-2],g[n]); - n += 2; - } - } - - var j = e.t-1, w, is1 = true, r2 = nbi(), t; - i = nbits(e[j])-1; - while(j >= 0) { - if(i >= k1) w = (e[j]>>(i-k1))&km; - else { - w = (e[j]&((1<<(i+1))-1))<<(k1-i); - if(j > 0) w |= e[j-1]>>(this.DB+i-k1); - } - - n = k; - while((w&1) == 0) { w >>= 1; --n; } - if((i -= n) < 0) { i += this.DB; --j; } - if(is1) { // ret == 1, don't bother squaring or multiplying it - g[w].copyTo(r); - is1 = false; - } - else { - while(n > 1) { z.sqrTo(r,r2); z.sqrTo(r2,r); n -= 2; } - if(n > 0) z.sqrTo(r,r2); else { t = r; r = r2; r2 = t; } - z.mulTo(r2,g[w],r); - } - - while(j >= 0 && (e[j]&(1< 0) { - x.rShiftTo(g,x); - y.rShiftTo(g,y); - } - while(x.signum() > 0) { - if((i = x.getLowestSetBit()) > 0) x.rShiftTo(i,x); - if((i = y.getLowestSetBit()) > 0) y.rShiftTo(i,y); - if(x.compareTo(y) >= 0) { - x.subTo(y,x); - x.rShiftTo(1,x); - } - else { - y.subTo(x,y); - y.rShiftTo(1,y); - } - } - if(g > 0) y.lShiftTo(g,y); - return y; - } - - // (protected) this % n, n < 2^26 - function bnpModInt(n) { - if(n <= 0) return 0; - var d = this.DV%n, r = (this.s<0)?n-1:0; - if(this.t > 0) - if(d == 0) r = this[0]%n; - else for(var i = this.t-1; i >= 0; --i) r = (d*r+this[i])%n; - return r; - } - - // (public) 1/this % m (HAC 14.61) - function bnModInverse(m) { - var ac = m.isEven(); - if((this.isEven() && ac) || m.signum() == 0) return BigInteger.ZERO; - var u = m.clone(), v = this.clone(); - var a = nbv(1), b = nbv(0), c = nbv(0), d = nbv(1); - while(u.signum() != 0) { - while(u.isEven()) { - u.rShiftTo(1,u); - if(ac) { - if(!a.isEven() || !b.isEven()) { a.addTo(this,a); b.subTo(m,b); } - a.rShiftTo(1,a); - } - else if(!b.isEven()) b.subTo(m,b); - b.rShiftTo(1,b); - } - while(v.isEven()) { - v.rShiftTo(1,v); - if(ac) { - if(!c.isEven() || !d.isEven()) { c.addTo(this,c); d.subTo(m,d); } - c.rShiftTo(1,c); - } - else if(!d.isEven()) d.subTo(m,d); - d.rShiftTo(1,d); - } - if(u.compareTo(v) >= 0) { - u.subTo(v,u); - if(ac) a.subTo(c,a); - b.subTo(d,b); - } - else { - v.subTo(u,v); - if(ac) c.subTo(a,c); - d.subTo(b,d); - } - } - if(v.compareTo(BigInteger.ONE) != 0) return BigInteger.ZERO; - if(d.compareTo(m) >= 0) return d.subtract(m); - if(d.signum() < 0) d.addTo(m,d); else return d; - if(d.signum() < 0) return d.add(m); else return d; - } - - var lowprimes = [2,3,5,7,11,13,17,19,23,29,31,37,41,43,47,53,59,61,67,71,73,79,83,89,97,101,103,107,109,113,127,131,137,139,149,151,157,163,167,173,179,181,191,193,197,199,211,223,227,229,233,239,241,251,257,263,269,271,277,281,283,293,307,311,313,317,331,337,347,349,353,359,367,373,379,383,389,397,401,409,419,421,431,433,439,443,449,457,461,463,467,479,487,491,499,503,509,521,523,541,547,557,563,569,571,577,587,593,599,601,607,613,617,619,631,641,643,647,653,659,661,673,677,683,691,701,709,719,727,733,739,743,751,757,761,769,773,787,797,809,811,821,823,827,829,839,853,857,859,863,877,881,883,887,907,911,919,929,937,941,947,953,967,971,977,983,991,997]; - var lplim = (1<<26)/lowprimes[lowprimes.length-1]; - - // (public) test primality with certainty >= 1-.5^t - function bnIsProbablePrime(t) { - var i, x = this.abs(); - if(x.t == 1 && x[0] <= lowprimes[lowprimes.length-1]) { - for(i = 0; i < lowprimes.length; ++i) - if(x[0] == lowprimes[i]) return true; - return false; - } - if(x.isEven()) return false; - i = 1; - while(i < lowprimes.length) { - var m = lowprimes[i], j = i+1; - while(j < lowprimes.length && m < lplim) m *= lowprimes[j++]; - m = x.modInt(m); - while(i < j) if(m%lowprimes[i++] == 0) return false; - } - return x.millerRabin(t); - } - - // (protected) true if probably prime (HAC 4.24, Miller-Rabin) - function bnpMillerRabin(t) { - var n1 = this.subtract(BigInteger.ONE); - var k = n1.getLowestSetBit(); - if(k <= 0) return false; - var r = n1.shiftRight(k); - t = (t+1)>>1; - if(t > lowprimes.length) t = lowprimes.length; - var a = nbi(); - for(var i = 0; i < t; ++i) { - //Pick bases at random, instead of starting at 2 - a.fromInt(lowprimes[Math.floor(Math.random()*lowprimes.length)]); - var y = a.modPow(r,this); - if(y.compareTo(BigInteger.ONE) != 0 && y.compareTo(n1) != 0) { - var j = 1; - while(j++ < k && y.compareTo(n1) != 0) { - y = y.modPowInt(2,this); - if(y.compareTo(BigInteger.ONE) == 0) return false; - } - if(y.compareTo(n1) != 0) return false; - } - } - return true; - } - - // protected - BigInteger.prototype.chunkSize = bnpChunkSize; - BigInteger.prototype.toRadix = bnpToRadix; - BigInteger.prototype.fromRadix = bnpFromRadix; - BigInteger.prototype.fromNumber = bnpFromNumber; - BigInteger.prototype.bitwiseTo = bnpBitwiseTo; - BigInteger.prototype.changeBit = bnpChangeBit; - BigInteger.prototype.addTo = bnpAddTo; - BigInteger.prototype.dMultiply = bnpDMultiply; - BigInteger.prototype.dAddOffset = bnpDAddOffset; - BigInteger.prototype.multiplyLowerTo = bnpMultiplyLowerTo; - BigInteger.prototype.multiplyUpperTo = bnpMultiplyUpperTo; - BigInteger.prototype.modInt = bnpModInt; - BigInteger.prototype.millerRabin = bnpMillerRabin; - - // public - BigInteger.prototype.clone = bnClone; - BigInteger.prototype.intValue = bnIntValue; - BigInteger.prototype.byteValue = bnByteValue; - BigInteger.prototype.shortValue = bnShortValue; - BigInteger.prototype.signum = bnSigNum; - BigInteger.prototype.toByteArray = bnToByteArray; - BigInteger.prototype.equals = bnEquals; - BigInteger.prototype.min = bnMin; - BigInteger.prototype.max = bnMax; - BigInteger.prototype.and = bnAnd; - BigInteger.prototype.or = bnOr; - BigInteger.prototype.xor = bnXor; - BigInteger.prototype.andNot = bnAndNot; - BigInteger.prototype.not = bnNot; - BigInteger.prototype.shiftLeft = bnShiftLeft; - BigInteger.prototype.shiftRight = bnShiftRight; - BigInteger.prototype.getLowestSetBit = bnGetLowestSetBit; - BigInteger.prototype.bitCount = bnBitCount; - BigInteger.prototype.testBit = bnTestBit; - BigInteger.prototype.setBit = bnSetBit; - BigInteger.prototype.clearBit = bnClearBit; - BigInteger.prototype.flipBit = bnFlipBit; - BigInteger.prototype.add = bnAdd; - BigInteger.prototype.subtract = bnSubtract; - BigInteger.prototype.multiply = bnMultiply; - BigInteger.prototype.divide = bnDivide; - BigInteger.prototype.remainder = bnRemainder; - BigInteger.prototype.divideAndRemainder = bnDivideAndRemainder; - BigInteger.prototype.modPow = bnModPow; - BigInteger.prototype.modInverse = bnModInverse; - BigInteger.prototype.pow = bnPow; - BigInteger.prototype.gcd = bnGCD; - BigInteger.prototype.isProbablePrime = bnIsProbablePrime; - - // JSBN-specific extension - BigInteger.prototype.square = bnSquare; - - // Expose the Barrett function - BigInteger.prototype.Barrett = Barrett - - // BigInteger interfaces not implemented in jsbn: - - // BigInteger(int signum, byte[] magnitude) - // double doubleValue() - // float floatValue() - // int hashCode() - // long longValue() - // static BigInteger valueOf(long val) - - // Random number generator - requires a PRNG backend, e.g. prng4.js - - // For best results, put code like - // - // in your main HTML document. - - var rng_state; - var rng_pool; - var rng_pptr; - - // Mix in a 32-bit integer into the pool - function rng_seed_int(x) { - rng_pool[rng_pptr++] ^= x & 255; - rng_pool[rng_pptr++] ^= (x >> 8) & 255; - rng_pool[rng_pptr++] ^= (x >> 16) & 255; - rng_pool[rng_pptr++] ^= (x >> 24) & 255; - if(rng_pptr >= rng_psize) rng_pptr -= rng_psize; - } - - // Mix in the current time (w/milliseconds) into the pool - function rng_seed_time() { - rng_seed_int(new Date().getTime()); - } - - // Initialize the pool with junk if needed. - if(rng_pool == null) { - rng_pool = new Array(); - rng_pptr = 0; - var t; - if(typeof window !== "undefined" && window.crypto) { - if (window.crypto.getRandomValues) { - // Use webcrypto if available - var ua = new Uint8Array(32); - window.crypto.getRandomValues(ua); - for(t = 0; t < 32; ++t) - rng_pool[rng_pptr++] = ua[t]; - } - else if(navigator.appName == "Netscape" && navigator.appVersion < "5") { - // Extract entropy (256 bits) from NS4 RNG if available - var z = window.crypto.random(32); - for(t = 0; t < z.length; ++t) - rng_pool[rng_pptr++] = z.charCodeAt(t) & 255; - } - } - while(rng_pptr < rng_psize) { // extract some randomness from Math.random() - t = Math.floor(65536 * Math.random()); - rng_pool[rng_pptr++] = t >>> 8; - rng_pool[rng_pptr++] = t & 255; - } - rng_pptr = 0; - rng_seed_time(); - //rng_seed_int(window.screenX); - //rng_seed_int(window.screenY); - } - - function rng_get_byte() { - if(rng_state == null) { - rng_seed_time(); - rng_state = prng_newstate(); - rng_state.init(rng_pool); - for(rng_pptr = 0; rng_pptr < rng_pool.length; ++rng_pptr) - rng_pool[rng_pptr] = 0; - rng_pptr = 0; - //rng_pool = null; - } - // TODO: allow reseeding after first request - return rng_state.next(); - } - - function rng_get_bytes(ba) { - var i; - for(i = 0; i < ba.length; ++i) ba[i] = rng_get_byte(); - } - - function SecureRandom() {} - - SecureRandom.prototype.nextBytes = rng_get_bytes; - - // prng4.js - uses Arcfour as a PRNG - - function Arcfour() { - this.i = 0; - this.j = 0; - this.S = new Array(); - } - - // Initialize arcfour context from key, an array of ints, each from [0..255] - function ARC4init(key) { - var i, j, t; - for(i = 0; i < 256; ++i) - this.S[i] = i; - j = 0; - for(i = 0; i < 256; ++i) { - j = (j + this.S[i] + key[i % key.length]) & 255; - t = this.S[i]; - this.S[i] = this.S[j]; - this.S[j] = t; - } - this.i = 0; - this.j = 0; - } - - function ARC4next() { - var t; - this.i = (this.i + 1) & 255; - this.j = (this.j + this.S[this.i]) & 255; - t = this.S[this.i]; - this.S[this.i] = this.S[this.j]; - this.S[this.j] = t; - return this.S[(t + this.S[this.i]) & 255]; - } - - Arcfour.prototype.init = ARC4init; - Arcfour.prototype.next = ARC4next; - - // Plug in your RNG constructor here - function prng_newstate() { - return new Arcfour(); - } - - // Pool size must be a multiple of 4 and greater than 32. - // An array of bytes the size of the pool will be passed to init() - var rng_psize = 256; - - BigInteger.SecureRandom = SecureRandom; - BigInteger.BigInteger = BigInteger; - if (true) { - exports = module.exports = BigInteger; - } else {} - -}).call(this); +/** + * Runs iterator over provided array elements in series + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {function} - jobs terminator + */ +function serial(list, iterator, callback) +{ + return serialOrdered(list, iterator, null, callback); +} /***/ }), -/***/ 73: +/***/ 98: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. -module.exports = { - Verifier: Verifier, - Signer: Signer -}; +var Buffer = __webpack_require__(215).Buffer; -var nacl = __webpack_require__(199); -var stream = __webpack_require__(413); -var util = __webpack_require__(669); -var assert = __webpack_require__(283); -var Buffer = __webpack_require__(375).Buffer; -var Signature = __webpack_require__(719); - -function Verifier(key, hashAlgo) { - if (hashAlgo.toLowerCase() !== 'sha512') - throw (new Error('ED25519 only supports the use of ' + - 'SHA-512 hashes')); - - this.key = key; - this.chunks = []; - - stream.Writable.call(this, {}); -} -util.inherits(Verifier, stream.Writable); - -Verifier.prototype._write = function (chunk, enc, cb) { - this.chunks.push(chunk); - cb(); -}; - -Verifier.prototype.update = function (chunk) { - if (typeof (chunk) === 'string') - chunk = Buffer.from(chunk, 'binary'); - this.chunks.push(chunk); -}; - -Verifier.prototype.verify = function (signature, fmt) { - var sig; - if (Signature.isSignature(signature, [2, 0])) { - if (signature.type !== 'ed25519') - return (false); - sig = signature.toBuffer('raw'); - - } else if (typeof (signature) === 'string') { - sig = Buffer.from(signature, 'base64'); - - } else if (Signature.isSignature(signature, [1, 0])) { - throw (new Error('signature was created by too old ' + - 'a version of sshpk and cannot be verified')); +var algInfo = { + 'dsa': { + parts: ['p', 'q', 'g', 'y'], + sizePart: 'p' + }, + 'rsa': { + parts: ['e', 'n'], + sizePart: 'n' + }, + 'ecdsa': { + parts: ['curve', 'Q'], + sizePart: 'Q' + }, + 'ed25519': { + parts: ['A'], + sizePart: 'A' } +}; +algInfo['curve25519'] = algInfo['ed25519']; - assert.buffer(sig); - return (nacl.sign.detached.verify( - new Uint8Array(Buffer.concat(this.chunks)), - new Uint8Array(sig), - new Uint8Array(this.key.part.A.data))); +var algPrivInfo = { + 'dsa': { + parts: ['p', 'q', 'g', 'y', 'x'] + }, + 'rsa': { + parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] + }, + 'ecdsa': { + parts: ['curve', 'Q', 'd'] + }, + 'ed25519': { + parts: ['A', 'k'] + } +}; +algPrivInfo['curve25519'] = algPrivInfo['ed25519']; + +var hashAlgs = { + 'md5': true, + 'sha1': true, + 'sha256': true, + 'sha384': true, + 'sha512': true }; -function Signer(key, hashAlgo) { - if (hashAlgo.toLowerCase() !== 'sha512') - throw (new Error('ED25519 only supports the use of ' + - 'SHA-512 hashes')); - - this.key = key; - this.chunks = []; - - stream.Writable.call(this, {}); -} -util.inherits(Signer, stream.Writable); - -Signer.prototype._write = function (chunk, enc, cb) { - this.chunks.push(chunk); - cb(); +/* + * Taken from + * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf + */ +var curves = { + 'nistp256': { + size: 256, + pkcs8oid: '1.2.840.10045.3.1.7', + p: Buffer.from(('00' + + 'ffffffff 00000001 00000000 00000000' + + '00000000 ffffffff ffffffff ffffffff'). + replace(/ /g, ''), 'hex'), + a: Buffer.from(('00' + + 'FFFFFFFF 00000001 00000000 00000000' + + '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: Buffer.from(( + '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + + '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). + replace(/ /g, ''), 'hex'), + s: Buffer.from(('00' + + 'c49d3608 86e70493 6a6678e1 139d26b7' + + '819f7e90'). + replace(/ /g, ''), 'hex'), + n: Buffer.from(('00' + + 'ffffffff 00000000 ffffffff ffffffff' + + 'bce6faad a7179e84 f3b9cac2 fc632551'). + replace(/ /g, ''), 'hex'), + G: Buffer.from(('04' + + '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + + '77037d81 2deb33a0 f4a13945 d898c296' + + '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + + '2bce3357 6b315ece cbb64068 37bf51f5'). + replace(/ /g, ''), 'hex') + }, + 'nistp384': { + size: 384, + pkcs8oid: '1.3.132.0.34', + p: Buffer.from(('00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffe' + + 'ffffffff 00000000 00000000 ffffffff'). + replace(/ /g, ''), 'hex'), + a: Buffer.from(('00' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + + 'FFFFFFFF 00000000 00000000 FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: Buffer.from(( + 'b3312fa7 e23ee7e4 988e056b e3f82d19' + + '181d9c6e fe814112 0314088f 5013875a' + + 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). + replace(/ /g, ''), 'hex'), + s: Buffer.from(('00' + + 'a335926a a319a27a 1d00896a 6773a482' + + '7acdac73'). + replace(/ /g, ''), 'hex'), + n: Buffer.from(('00' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff c7634d81 f4372ddf' + + '581a0db2 48b0a77a ecec196a ccc52973'). + replace(/ /g, ''), 'hex'), + G: Buffer.from(('04' + + 'aa87ca22 be8b0537 8eb1c71e f320ad74' + + '6e1d3b62 8ba79b98 59f741e0 82542a38' + + '5502f25d bf55296c 3a545e38 72760ab7' + + '3617de4a 96262c6f 5d9e98bf 9292dc29' + + 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + + '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). + replace(/ /g, ''), 'hex') + }, + 'nistp521': { + size: 521, + pkcs8oid: '1.3.132.0.35', + p: Buffer.from(( + '01ffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffff').replace(/ /g, ''), 'hex'), + a: Buffer.from(('01FF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + + 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). + replace(/ /g, ''), 'hex'), + b: Buffer.from(('51' + + '953eb961 8e1c9a1f 929a21a0 b68540ee' + + 'a2da725b 99b315f3 b8b48991 8ef109e1' + + '56193951 ec7e937b 1652c0bd 3bb1bf07' + + '3573df88 3d2c34f1 ef451fd4 6b503f00'). + replace(/ /g, ''), 'hex'), + s: Buffer.from(('00' + + 'd09e8800 291cb853 96cc6717 393284aa' + + 'a0da64ba').replace(/ /g, ''), 'hex'), + n: Buffer.from(('01ff' + + 'ffffffff ffffffff ffffffff ffffffff' + + 'ffffffff ffffffff ffffffff fffffffa' + + '51868783 bf2f966b 7fcc0148 f709a5d0' + + '3bb5c9b8 899c47ae bb6fb71e 91386409'). + replace(/ /g, ''), 'hex'), + G: Buffer.from(('04' + + '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + + '9c648139 053fb521 f828af60 6b4d3dba' + + 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + + '3348b3c1 856a429b f97e7e31 c2e5bd66' + + '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + + '98f54449 579b4468 17afbd17 273e662c' + + '97ee7299 5ef42640 c550b901 3fad0761' + + '353c7086 a272c240 88be9476 9fd16650'). + replace(/ /g, ''), 'hex') + } }; -Signer.prototype.update = function (chunk) { - if (typeof (chunk) === 'string') - chunk = Buffer.from(chunk, 'binary'); - this.chunks.push(chunk); -}; - -Signer.prototype.sign = function () { - var sig = nacl.sign.detached( - new Uint8Array(Buffer.concat(this.chunks)), - new Uint8Array(Buffer.concat([ - this.key.part.k.data, this.key.part.A.data]))); - var sigBuf = Buffer.from(sig); - var sigObj = Signature.parse(sigBuf, 'ed25519', 'raw'); - sigObj.hashAlgorithm = 'sha512'; - return (sigObj); +module.exports = { + info: algInfo, + privInfo: algPrivInfo, + hashAlgs: hashAlgs, + curves: curves }; /***/ }), -/***/ 82: +/***/ 104: +/***/ (function(__unusedmodule, __unusedexports, __webpack_require__) { + +const core = __webpack_require__(470); +const exec = __webpack_require__(986); +const request = __webpack_require__(830); +const fs = __webpack_require__(747); + +let fail_ci; +try { + const name = core.getInput("name"); + const token = core.getInput("token"); + const flags = core.getInput("flags"); + const file = core.getInput("file"); + const env_vars = core.getInput("env_vars"); + fail_ci = core.getInput("fail_ci_if_error").toLowerCase(); + + if ( + fail_ci === "yes" || + fail_ci === "y" || + fail_ci === "true" || + fail_ci === "t" || + fail_ci === "1" + ) { + fail_ci = true; + } else { + fail_ci = false; + } + + request("https://codecov.io/bash", (error, response, body) => { + if (error && fail_ci) { + throw error; + } else if (error) { + core.warning(`Codecov warning: ${error.message}`); + } + + fs.writeFile("codecov.sh", body, err => { + if (err && fail_ci) { + throw err; + } else if (err) { + core.warning(`Codecov warning: ${err.message}`); + } + + let output = ""; + let execError = ""; + const options = {}; + options.listeners = { + stdout: data => { + output += data.toString(); + }, + stderr: data => { + execError += data.toString(); + } + }; + + options.env = { + GITHUB_ACTION: process.env.GITHUB_ACTION, + GITHUB_RUN_ID: process.env.GITHUB_RUN_ID, + GITHUB_REF: process.env.GITHUB_REF, + GITHUB_REPOSITORY: process.env.GITHUB_REPOSITORY, + GITHUB_SHA: process.env.GITHUB_SHA, + GITHUB_HEAD_REF: process.env.GITHUB_HEAD_REF || '' + }; + + if(token){ + options.env.CODECOV_TOKEN = token + } + + const env_vars_arg = [] + for (let env_var of env_vars.split(",")) { + let env_var_clean = env_var.trim(); + if (env_var_clean) { + options.env[env_var_clean] = process.env[env_var_clean]; + env_vars_arg.push(env_var_clean) + } + } + + const execArgs = ["codecov.sh"]; + if (file) { + execArgs.push( + "-f", `${file}` + ); + } + + execArgs.push( + "-n", `${name}`, + "-F", `${flags}` + ); + + if (fail_ci) { + execArgs.push( + "-Z" + ); + } + + if (env_vars_arg.length) { + execArgs.push( + "-e", env_vars_arg.join(",") + ); + } + + exec.exec("bash", execArgs, options) + .catch(err => { + if (fail_ci) { + core.setFailed( + `Codecov failed with the following error: ${err.message}` + ); + } else { + core.warning(`Codecov warning: ${err.message}`); + } + }) + .then(() => { + unlinkFile(); + }); + + const unlinkFile = () => { + fs.unlink("codecov.sh", err => { + if (err && fail_ci) { + throw err; + } else if (err) { + core.warning(`Codecov warning: ${err.message}`); + } + }); + }; + }); + }); +} catch (error) { + if (fail_ci) { + core.setFailed(`Codecov failed with the following error: ${error.message}`); + } else { + core.warning(`Codecov warning: ${error.message}`); + } +} + + +/***/ }), + +/***/ 107: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate_allOf(it, $keyword, $ruleType) { + var out = ' '; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $currentBaseId = $it.baseId, + $allSchemasEmpty = true; + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { + $allSchemasEmpty = false; + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + } + if ($breakOnError) { + if ($allSchemasEmpty) { + out += ' if (true) { '; + } else { + out += ' ' + ($closingBraces.slice(0, -1)) + ' '; + } + } + out = it.util.cleanUpCode(out); + return out; +} + + +/***/ }), + +/***/ 113: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +var crypto = __webpack_require__(417) + +function sha (key, body, algorithm) { + return crypto.createHmac(algorithm, key).update(body).digest('base64') +} + +function rsa (key, body) { + return crypto.createSign('RSA-SHA1').update(body).sign(key, 'base64') +} + +function rfc3986 (str) { + return encodeURIComponent(str) + .replace(/!/g,'%21') + .replace(/\*/g,'%2A') + .replace(/\(/g,'%28') + .replace(/\)/g,'%29') + .replace(/'/g,'%27') +} + +// Maps object to bi-dimensional array +// Converts { foo: 'A', bar: [ 'b', 'B' ]} to +// [ ['foo', 'A'], ['bar', 'b'], ['bar', 'B'] ] +function map (obj) { + var key, val, arr = [] + for (key in obj) { + val = obj[key] + if (Array.isArray(val)) + for (var i = 0; i < val.length; i++) + arr.push([key, val[i]]) + else if (typeof val === 'object') + for (var prop in val) + arr.push([key + '[' + prop + ']', val[prop]]) + else + arr.push([key, val]) + } + return arr +} + +// Compare function for sort +function compare (a, b) { + return a > b ? 1 : a < b ? -1 : 0 +} + +function generateBase (httpMethod, base_uri, params) { + // adapted from https://dev.twitter.com/docs/auth/oauth and + // https://dev.twitter.com/docs/auth/creating-signature + + // Parameter normalization + // http://tools.ietf.org/html/rfc5849#section-3.4.1.3.2 + var normalized = map(params) + // 1. First, the name and value of each parameter are encoded + .map(function (p) { + return [ rfc3986(p[0]), rfc3986(p[1] || '') ] + }) + // 2. The parameters are sorted by name, using ascending byte value + // ordering. If two or more parameters share the same name, they + // are sorted by their value. + .sort(function (a, b) { + return compare(a[0], b[0]) || compare(a[1], b[1]) + }) + // 3. The name of each parameter is concatenated to its corresponding + // value using an "=" character (ASCII code 61) as a separator, even + // if the value is empty. + .map(function (p) { return p.join('=') }) + // 4. The sorted name/value pairs are concatenated together into a + // single string by using an "&" character (ASCII code 38) as + // separator. + .join('&') + + var base = [ + rfc3986(httpMethod ? httpMethod.toUpperCase() : 'GET'), + rfc3986(base_uri), + rfc3986(normalized) + ].join('&') + + return base +} + +function hmacsign (httpMethod, base_uri, params, consumer_secret, token_secret) { + var base = generateBase(httpMethod, base_uri, params) + var key = [ + consumer_secret || '', + token_secret || '' + ].map(rfc3986).join('&') + + return sha(key, base, 'sha1') +} + +function hmacsign256 (httpMethod, base_uri, params, consumer_secret, token_secret) { + var base = generateBase(httpMethod, base_uri, params) + var key = [ + consumer_secret || '', + token_secret || '' + ].map(rfc3986).join('&') + + return sha(key, base, 'sha256') +} + +function rsasign (httpMethod, base_uri, params, private_key, token_secret) { + var base = generateBase(httpMethod, base_uri, params) + var key = private_key || '' + + return rsa(key, base) +} + +function plaintext (consumer_secret, token_secret) { + var key = [ + consumer_secret || '', + token_secret || '' + ].map(rfc3986).join('&') + + return key +} + +function sign (signMethod, httpMethod, base_uri, params, consumer_secret, token_secret) { + var method + var skipArgs = 1 + + switch (signMethod) { + case 'RSA-SHA1': + method = rsasign + break + case 'HMAC-SHA1': + method = hmacsign + break + case 'HMAC-SHA256': + method = hmacsign256 + break + case 'PLAINTEXT': + method = plaintext + skipArgs = 4 + break + default: + throw new Error('Signature method not supported: ' + signMethod) + } + + return method.apply(null, [].slice.call(arguments, skipArgs)) +} + +exports.hmacsign = hmacsign +exports.hmacsign256 = hmacsign256 +exports.rsasign = rsasign +exports.plaintext = plaintext +exports.sign = sign +exports.rfc3986 = rfc3986 +exports.generateBase = generateBase + +/***/ }), + +/***/ 129: +/***/ (function(module) { + +module.exports = require("child_process"); + +/***/ }), + +/***/ 139: /***/ (function(module, __unusedexports, __webpack_require__) { -var async = __webpack_require__(401) - , abort = __webpack_require__(696) +// Unique ID creation requires a high quality random # generator. In node.js +// this is pretty straight-forward - we use the crypto API. + +var crypto = __webpack_require__(417); + +module.exports = function nodeRNG() { + return crypto.randomBytes(16); +}; + + +/***/ }), + +/***/ 140: +/***/ (function(module) { + +module.exports = {"$id":"afterRequest.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["lastAccess","eTag","hitCount"],"properties":{"expires":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"lastAccess":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"eTag":{"type":"string"},"hitCount":{"type":"integer"},"comment":{"type":"string"}}}; + +/***/ }), + +/***/ 147: +/***/ (function(module) { + +// API +module.exports = state; + +/** + * Creates initial state object + * for iteration over list + * + * @param {array|object} list - list to iterate over + * @param {function|null} sortMethod - function to use for keys sort, + * or `null` to keep them as is + * @returns {object} - initial state object + */ +function state(list, sortMethod) +{ + var isNamedList = !Array.isArray(list) + , initState = + { + index : 0, + keyedList: isNamedList || sortMethod ? Object.keys(list) : null, + jobs : {}, + results : isNamedList ? {} : [], + size : isNamedList ? Object.keys(list).length : list.length + } + ; + + if (sortMethod) + { + // sort array keys based on it's values + // sort object's keys just on own merit + initState.keyedList.sort(isNamedList ? sortMethod : function(a, b) + { + return sortMethod(list[a], list[b]); + }); + } + + return initState; +} + + +/***/ }), + +/***/ 149: +/***/ (function(module, exports, __webpack_require__) { + +/* eslint-disable node/no-deprecated-api */ +var buffer = __webpack_require__(293) +var Buffer = buffer.Buffer + +// alternative to using Object.keys for old browsers +function copyProps (src, dst) { + for (var key in src) { + dst[key] = src[key] + } +} +if (Buffer.from && Buffer.alloc && Buffer.allocUnsafe && Buffer.allocUnsafeSlow) { + module.exports = buffer +} else { + // Copy properties from require('buffer') + copyProps(buffer, exports) + exports.Buffer = SafeBuffer +} + +function SafeBuffer (arg, encodingOrOffset, length) { + return Buffer(arg, encodingOrOffset, length) +} + +SafeBuffer.prototype = Object.create(Buffer.prototype) + +// Copy static methods from Buffer +copyProps(Buffer, SafeBuffer) + +SafeBuffer.from = function (arg, encodingOrOffset, length) { + if (typeof arg === 'number') { + throw new TypeError('Argument must not be a number') + } + return Buffer(arg, encodingOrOffset, length) +} + +SafeBuffer.alloc = function (size, fill, encoding) { + if (typeof size !== 'number') { + throw new TypeError('Argument must be a number') + } + var buf = Buffer(size) + if (fill !== undefined) { + if (typeof encoding === 'string') { + buf.fill(fill, encoding) + } else { + buf.fill(fill) + } + } else { + buf.fill(0) + } + return buf +} + +SafeBuffer.allocUnsafe = function (size) { + if (typeof size !== 'number') { + throw new TypeError('Argument must be a number') + } + return Buffer(size) +} + +SafeBuffer.allocUnsafeSlow = function (size) { + if (typeof size !== 'number') { + throw new TypeError('Argument must be a number') + } + return buffer.SlowBuffer(size) +} + + +/***/ }), + +/***/ 152: +/***/ (function(module, __unusedexports, __webpack_require__) { + +var Stream = __webpack_require__(413).Stream; +var util = __webpack_require__(669); + +module.exports = DelayedStream; +function DelayedStream() { + this.source = null; + this.dataSize = 0; + this.maxDataSize = 1024 * 1024; + this.pauseStream = true; + + this._maxDataSizeExceeded = false; + this._released = false; + this._bufferedEvents = []; +} +util.inherits(DelayedStream, Stream); + +DelayedStream.create = function(source, options) { + var delayedStream = new this(); + + options = options || {}; + for (var option in options) { + delayedStream[option] = options[option]; + } + + delayedStream.source = source; + + var realEmit = source.emit; + source.emit = function() { + delayedStream._handleEmit(arguments); + return realEmit.apply(source, arguments); + }; + + source.on('error', function() {}); + if (delayedStream.pauseStream) { + source.pause(); + } + + return delayedStream; +}; + +Object.defineProperty(DelayedStream.prototype, 'readable', { + configurable: true, + enumerable: true, + get: function() { + return this.source.readable; + } +}); + +DelayedStream.prototype.setEncoding = function() { + return this.source.setEncoding.apply(this.source, arguments); +}; + +DelayedStream.prototype.resume = function() { + if (!this._released) { + this.release(); + } + + this.source.resume(); +}; + +DelayedStream.prototype.pause = function() { + this.source.pause(); +}; + +DelayedStream.prototype.release = function() { + this._released = true; + + this._bufferedEvents.forEach(function(args) { + this.emit.apply(this, args); + }.bind(this)); + this._bufferedEvents = []; +}; + +DelayedStream.prototype.pipe = function() { + var r = Stream.prototype.pipe.apply(this, arguments); + this.resume(); + return r; +}; + +DelayedStream.prototype._handleEmit = function(args) { + if (this._released) { + this.emit.apply(this, args); + return; + } + + if (args[0] === 'data') { + this.dataSize += args[1].length; + this._checkIfMaxDataSizeExceeded(); + } + + this._bufferedEvents.push(args); +}; + +DelayedStream.prototype._checkIfMaxDataSizeExceeded = function() { + if (this._maxDataSizeExceeded) { + return; + } + + if (this.dataSize <= this.maxDataSize) { + return; + } + + this._maxDataSizeExceeded = true; + var message = + 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.' + this.emit('error', new Error(message)); +}; + + +/***/ }), + +/***/ 154: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate_contains(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $idx = 'i' + $lvl, + $dataNxt = $it.dataLevel = it.dataLevel + 1, + $nextData = 'data' + $dataNxt, + $currentBaseId = it.baseId, + $nonEmptySchema = (it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all)); + out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; + if ($nonEmptySchema) { + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + out += ' var ' + ($nextValid) + ' = false; for (var ' + ($idx) + ' = 0; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; + $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); + var $passData = $data + '[' + $idx + ']'; + $it.dataPathArr[$dataNxt] = $idx; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + out += ' if (' + ($nextValid) + ') break; } '; + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' ' + ($closingBraces) + ' if (!' + ($nextValid) + ') {'; + } else { + out += ' if (' + ($data) + '.length == 0) {'; + } + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('contains') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'should contain a valid item\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { '; + if ($nonEmptySchema) { + out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; + } + if (it.opts.allErrors) { + out += ' } '; + } + out = it.util.cleanUpCode(out); + return out; +} + + +/***/ }), + +/***/ 157: +/***/ (function(module, __unusedexports, __webpack_require__) { + +var async = __webpack_require__(751) + , abort = __webpack_require__(566) ; // API @@ -4269,2381 +3098,17 @@ function runJob(iterator, key, item, callback) /***/ }), -/***/ 87: +/***/ 162: /***/ (function(module) { -module.exports = require("os"); +module.exports = {"$id":"content.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["size","mimeType"],"properties":{"size":{"type":"integer"},"compression":{"type":"integer"},"mimeType":{"type":"string"},"text":{"type":"string"},"encoding":{"type":"string"},"comment":{"type":"string"}}}; /***/ }), -/***/ 88: -/***/ (function(module, exports) { - -exports = module.exports = stringify -exports.getSerialize = serializer - -function stringify(obj, replacer, spaces, cycleReplacer) { - return JSON.stringify(obj, serializer(replacer, cycleReplacer), spaces) -} - -function serializer(replacer, cycleReplacer) { - var stack = [], keys = [] - - if (cycleReplacer == null) cycleReplacer = function(key, value) { - if (stack[0] === value) return "[Circular ~]" - return "[Circular ~." + keys.slice(0, stack.indexOf(value)).join(".") + "]" - } - - return function(key, value) { - if (stack.length > 0) { - var thisPos = stack.indexOf(this) - ~thisPos ? stack.splice(thisPos + 1) : stack.push(this) - ~thisPos ? keys.splice(thisPos, Infinity, key) : keys.push(key) - if (~stack.indexOf(value)) value = cycleReplacer.call(this, key, value) - } - else stack.push(value) - - return replacer == null ? value : replacer.call(this, key, value) - } -} - - -/***/ }), - -/***/ 93: +/***/ 181: /***/ (function(module) { -module.exports = {"$id":"log.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["version","creator","entries"],"properties":{"version":{"type":"string"},"creator":{"$ref":"creator.json#"},"browser":{"$ref":"browser.json#"},"pages":{"type":"array","items":{"$ref":"page.json#"}},"entries":{"type":"array","items":{"$ref":"entry.json#"}},"comment":{"type":"string"}}}; - -/***/ }), - -/***/ 95: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -var assert = __webpack_require__(283); -var crypto = __webpack_require__(417); -var sshpk = __webpack_require__(804); -var utils = __webpack_require__(517); - -var HASH_ALGOS = utils.HASH_ALGOS; -var PK_ALGOS = utils.PK_ALGOS; -var InvalidAlgorithmError = utils.InvalidAlgorithmError; -var HttpSignatureError = utils.HttpSignatureError; -var validateAlgorithm = utils.validateAlgorithm; - -///--- Exported API - -module.exports = { - /** - * Verify RSA/DSA signature against public key. You are expected to pass in - * an object that was returned from `parse()`. - * - * @param {Object} parsedSignature the object you got from `parse`. - * @param {String} pubkey RSA/DSA private key PEM. - * @return {Boolean} true if valid, false otherwise. - * @throws {TypeError} if you pass in bad arguments. - * @throws {InvalidAlgorithmError} - */ - verifySignature: function verifySignature(parsedSignature, pubkey) { - assert.object(parsedSignature, 'parsedSignature'); - if (typeof (pubkey) === 'string' || Buffer.isBuffer(pubkey)) - pubkey = sshpk.parseKey(pubkey); - assert.ok(sshpk.Key.isKey(pubkey, [1, 1]), 'pubkey must be a sshpk.Key'); - - var alg = validateAlgorithm(parsedSignature.algorithm); - if (alg[0] === 'hmac' || alg[0] !== pubkey.type) - return (false); - - var v = pubkey.createVerify(alg[1]); - v.update(parsedSignature.signingString); - return (v.verify(parsedSignature.params.signature, 'base64')); - }, - - /** - * Verify HMAC against shared secret. You are expected to pass in an object - * that was returned from `parse()`. - * - * @param {Object} parsedSignature the object you got from `parse`. - * @param {String} secret HMAC shared secret. - * @return {Boolean} true if valid, false otherwise. - * @throws {TypeError} if you pass in bad arguments. - * @throws {InvalidAlgorithmError} - */ - verifyHMAC: function verifyHMAC(parsedSignature, secret) { - assert.object(parsedSignature, 'parsedHMAC'); - assert.string(secret, 'secret'); - - var alg = validateAlgorithm(parsedSignature.algorithm); - if (alg[0] !== 'hmac') - return (false); - - var hashAlg = alg[1].toUpperCase(); - - var hmac = crypto.createHmac(hashAlg, secret); - hmac.update(parsedSignature.signingString); - - /* - * Now double-hash to avoid leaking timing information - there's - * no easy constant-time compare in JS, so we use this approach - * instead. See for more info: - * https://www.isecpartners.com/blog/2011/february/double-hmac- - * verification.aspx - */ - var h1 = crypto.createHmac(hashAlg, secret); - h1.update(hmac.digest()); - h1 = h1.digest(); - var h2 = crypto.createHmac(hashAlg, secret); - h2.update(new Buffer(parsedSignature.params.signature, 'base64')); - h2 = h2.digest(); - - /* Node 0.8 returns strings from .digest(). */ - if (typeof (h1) === 'string') - return (h1 === h2); - /* And node 0.10 lacks the .equals() method on Buffers. */ - if (Buffer.isBuffer(h1) && !h1.equals) - return (h1.toString('binary') === h2.toString('binary')); - - return (h1.equals(h2)); - } -}; - - -/***/ }), - -/***/ 104: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; -/*! - * mime-types - * Copyright(c) 2014 Jonathan Ong - * Copyright(c) 2015 Douglas Christopher Wilson - * MIT Licensed - */ - - - -/** - * Module dependencies. - * @private - */ - -var db = __webpack_require__(853) -var extname = __webpack_require__(277).extname - -/** - * Module variables. - * @private - */ - -var EXTRACT_TYPE_REGEXP = /^\s*([^;\s]*)(?:;|\s|$)/ -var TEXT_TYPE_REGEXP = /^text\//i - -/** - * Module exports. - * @public - */ - -exports.charset = charset -exports.charsets = { lookup: charset } -exports.contentType = contentType -exports.extension = extension -exports.extensions = Object.create(null) -exports.lookup = lookup -exports.types = Object.create(null) - -// Populate the extensions/types maps -populateMaps(exports.extensions, exports.types) - -/** - * Get the default charset for a MIME type. - * - * @param {string} type - * @return {boolean|string} - */ - -function charset (type) { - if (!type || typeof type !== 'string') { - return false - } - - // TODO: use media-typer - var match = EXTRACT_TYPE_REGEXP.exec(type) - var mime = match && db[match[1].toLowerCase()] - - if (mime && mime.charset) { - return mime.charset - } - - // default text/* to utf-8 - if (match && TEXT_TYPE_REGEXP.test(match[1])) { - return 'UTF-8' - } - - return false -} - -/** - * Create a full Content-Type header given a MIME type or extension. - * - * @param {string} str - * @return {boolean|string} - */ - -function contentType (str) { - // TODO: should this even be in this module? - if (!str || typeof str !== 'string') { - return false - } - - var mime = str.indexOf('/') === -1 - ? exports.lookup(str) - : str - - if (!mime) { - return false - } - - // TODO: use content-type or other module - if (mime.indexOf('charset') === -1) { - var charset = exports.charset(mime) - if (charset) mime += '; charset=' + charset.toLowerCase() - } - - return mime -} - -/** - * Get the default extension for a MIME type. - * - * @param {string} type - * @return {boolean|string} - */ - -function extension (type) { - if (!type || typeof type !== 'string') { - return false - } - - // TODO: use media-typer - var match = EXTRACT_TYPE_REGEXP.exec(type) - - // get extensions - var exts = match && exports.extensions[match[1].toLowerCase()] - - if (!exts || !exts.length) { - return false - } - - return exts[0] -} - -/** - * Lookup the MIME type for a file path/extension. - * - * @param {string} path - * @return {boolean|string} - */ - -function lookup (path) { - if (!path || typeof path !== 'string') { - return false - } - - // get the extension ("ext" or ".ext" or full path) - var extension = extname('x.' + path) - .toLowerCase() - .substr(1) - - if (!extension) { - return false - } - - return exports.types[extension] || false -} - -/** - * Populate the extensions and types maps. - * @private - */ - -function populateMaps (extensions, types) { - // source preference (least -> most) - var preference = ['nginx', 'apache', undefined, 'iana'] - - Object.keys(db).forEach(function forEachMimeType (type) { - var mime = db[type] - var exts = mime.extensions - - if (!exts || !exts.length) { - return - } - - // mime -> extensions - extensions[type] = exts - - // extension -> mime - for (var i = 0; i < exts.length; i++) { - var extension = exts[i] - - if (types[extension]) { - var from = preference.indexOf(db[types[extension]].source) - var to = preference.indexOf(mime.source) - - if (types[extension] !== 'application/octet-stream' && - (from > to || (from === to && types[extension].substr(0, 12) === 'application/'))) { - // skip the remapping - continue - } - } - - // set the extension -> mime - types[extension] = type - } - }) -} - - -/***/ }), - -/***/ 115: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -var Ajv = __webpack_require__(487) -var HARError = __webpack_require__(3) -var schemas = __webpack_require__(711) - -var ajv - -function createAjvInstance () { - var ajv = new Ajv({ - allErrors: true - }) - ajv.addMetaSchema(__webpack_require__(923)) - ajv.addSchema(schemas) - - return ajv -} - -function validate (name, data) { - data = data || {} - - // validator config - ajv = ajv || createAjvInstance() - - var validate = ajv.getSchema(name + '.json') - - return new Promise(function (resolve, reject) { - var valid = validate(data) - - !valid ? reject(new HARError(validate.errors)) : resolve(data) - }) -} - -exports.afterRequest = function (data) { - return validate('afterRequest', data) -} - -exports.beforeRequest = function (data) { - return validate('beforeRequest', data) -} - -exports.browser = function (data) { - return validate('browser', data) -} - -exports.cache = function (data) { - return validate('cache', data) -} - -exports.content = function (data) { - return validate('content', data) -} - -exports.cookie = function (data) { - return validate('cookie', data) -} - -exports.creator = function (data) { - return validate('creator', data) -} - -exports.entry = function (data) { - return validate('entry', data) -} - -exports.har = function (data) { - return validate('har', data) -} - -exports.header = function (data) { - return validate('header', data) -} - -exports.log = function (data) { - return validate('log', data) -} - -exports.page = function (data) { - return validate('page', data) -} - -exports.pageTimings = function (data) { - return validate('pageTimings', data) -} - -exports.postData = function (data) { - return validate('postData', data) -} - -exports.query = function (data) { - return validate('query', data) -} - -exports.request = function (data) { - return validate('request', data) -} - -exports.response = function (data) { - return validate('response', data) -} - -exports.timings = function (data) { - return validate('timings', data) -} - - -/***/ }), - -/***/ 116: -/***/ (function(module) { - -module.exports = {"$id":"timings.json#","$schema":"http://json-schema.org/draft-06/schema#","required":["send","wait","receive"],"properties":{"dns":{"type":"number","min":-1},"connect":{"type":"number","min":-1},"blocked":{"type":"number","min":-1},"send":{"type":"number","min":-1},"wait":{"type":"number","min":-1},"receive":{"type":"number","min":-1},"ssl":{"type":"number","min":-1},"comment":{"type":"string"}}}; - -/***/ }), - -/***/ 117: -/***/ (function(module) { - -// Generated by CoffeeScript 1.12.2 -(function() { - var getNanoSeconds, hrtime, loadTime, moduleLoadTime, nodeLoadTime, upTime; - - if ((typeof performance !== "undefined" && performance !== null) && performance.now) { - module.exports = function() { - return performance.now(); - }; - } else if ((typeof process !== "undefined" && process !== null) && process.hrtime) { - module.exports = function() { - return (getNanoSeconds() - nodeLoadTime) / 1e6; - }; - hrtime = process.hrtime; - getNanoSeconds = function() { - var hr; - hr = hrtime(); - return hr[0] * 1e9 + hr[1]; - }; - moduleLoadTime = getNanoSeconds(); - upTime = process.uptime() * 1e9; - nodeLoadTime = moduleLoadTime - upTime; - } else if (Date.now) { - module.exports = function() { - return Date.now() - loadTime; - }; - loadTime = Date.now(); - } else { - module.exports = function() { - return new Date().getTime() - loadTime; - }; - loadTime = new Date().getTime(); - } - -}).call(this); - -//# sourceMappingURL=performance-now.js.map - - -/***/ }), - -/***/ 120: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - -var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { - function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } - return new (P || (P = Promise))(function (resolve, reject) { - function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } - function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } - function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } - step((generator = generator.apply(thisArg, _arguments || [])).next()); - }); -}; -Object.defineProperty(exports, "__esModule", { value: true }); -const tr = __webpack_require__(860); -/** - * Exec a command. - * Output will be streamed to the live console. - * Returns promise with return code - * - * @param commandLine command to execute (can include additional args). Must be correctly escaped. - * @param args optional arguments for tool. Escaping is handled by the lib. - * @param options optional exec options. See ExecOptions - * @returns Promise exit code - */ -function exec(commandLine, args, options) { - return __awaiter(this, void 0, void 0, function* () { - const commandArgs = tr.argStringToArray(commandLine); - if (commandArgs.length === 0) { - throw new Error(`Parameter 'commandLine' cannot be null or empty.`); - } - // Path to tool to execute should be first arg - const toolPath = commandArgs[0]; - args = commandArgs.slice(1).concat(args || []); - const runner = new tr.ToolRunner(toolPath, args, options); - return runner.exec(); - }); -} -exports.exec = exec; -//# sourceMappingURL=exec.js.map - -/***/ }), - -/***/ 129: -/***/ (function(module) { - -module.exports = require("child_process"); - -/***/ }), - -/***/ 130: -/***/ (function(module) { - -module.exports = function(size) { - return new LruCache(size) -} - -function LruCache(size) { - this.capacity = size | 0 - this.map = Object.create(null) - this.list = new DoublyLinkedList() -} - -LruCache.prototype.get = function(key) { - var node = this.map[key] - if (node == null) return undefined - this.used(node) - return node.val -} - -LruCache.prototype.set = function(key, val) { - var node = this.map[key] - if (node != null) { - node.val = val - } else { - if (!this.capacity) this.prune() - if (!this.capacity) return false - node = new DoublyLinkedNode(key, val) - this.map[key] = node - this.capacity-- - } - this.used(node) - return true -} - -LruCache.prototype.used = function(node) { - this.list.moveToFront(node) -} - -LruCache.prototype.prune = function() { - var node = this.list.pop() - if (node != null) { - delete this.map[node.key] - this.capacity++ - } -} - - -function DoublyLinkedList() { - this.firstNode = null - this.lastNode = null -} - -DoublyLinkedList.prototype.moveToFront = function(node) { - if (this.firstNode == node) return - - this.remove(node) - - if (this.firstNode == null) { - this.firstNode = node - this.lastNode = node - node.prev = null - node.next = null - } else { - node.prev = null - node.next = this.firstNode - node.next.prev = node - this.firstNode = node - } -} - -DoublyLinkedList.prototype.pop = function() { - var lastNode = this.lastNode - if (lastNode != null) { - this.remove(lastNode) - } - return lastNode -} - -DoublyLinkedList.prototype.remove = function(node) { - if (this.firstNode == node) { - this.firstNode = node.next - } else if (node.prev != null) { - node.prev.next = node.next - } - if (this.lastNode == node) { - this.lastNode = node.prev - } else if (node.next != null) { - node.next.prev = node.prev - } -} - - -function DoublyLinkedNode(key, val) { - this.key = key - this.val = val - this.prev = null - this.next = null -} - - -/***/ }), - -/***/ 137: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; -/*! - * Copyright (c) 2018, Salesforce.com, Inc. - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * - * 1. Redistributions of source code must retain the above copyright notice, - * this list of conditions and the following disclaimer. - * - * 2. Redistributions in binary form must reproduce the above copyright notice, - * this list of conditions and the following disclaimer in the documentation - * and/or other materials provided with the distribution. - * - * 3. Neither the name of Salesforce.com nor the names of its contributors may - * be used to endorse or promote products derived from this software without - * specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE - * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR - * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF - * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS - * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN - * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) - * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE - * POSSIBILITY OF SUCH DAMAGE. - */ - -var psl = __webpack_require__(786); - -function getPublicSuffix(domain) { - return psl.get(domain); -} - -exports.getPublicSuffix = getPublicSuffix; - - -/***/ }), - -/***/ 141: -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -var crypto_hash_sha512 = __webpack_require__(199).lowlevel.crypto_hash; - -/* - * This file is a 1:1 port from the OpenBSD blowfish.c and bcrypt_pbkdf.c. As a - * result, it retains the original copyright and license. The two files are - * under slightly different (but compatible) licenses, and are here combined in - * one file. - * - * Credit for the actual porting work goes to: - * Devi Mandiri - */ - -/* - * The Blowfish portions are under the following license: - * - * Blowfish block cipher for OpenBSD - * Copyright 1997 Niels Provos - * All rights reserved. - * - * Implementation advice by David Mazieres . - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions - * are met: - * 1. Redistributions of source code must retain the above copyright - * notice, this list of conditions and the following disclaimer. - * 2. Redistributions in binary form must reproduce the above copyright - * notice, this list of conditions and the following disclaimer in the - * documentation and/or other materials provided with the distribution. - * 3. The name of the author may not be used to endorse or promote products - * derived from this software without specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR - * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES - * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. - * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, - * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT - * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, - * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY - * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT - * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF - * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. - */ - -/* - * The bcrypt_pbkdf portions are under the following license: - * - * Copyright (c) 2013 Ted Unangst - * - * Permission to use, copy, modify, and distribute this software for any - * purpose with or without fee is hereby granted, provided that the above - * copyright notice and this permission notice appear in all copies. - * - * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES - * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR - * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES - * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN - * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF - * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - */ - -/* - * Performance improvements (Javascript-specific): - * - * Copyright 2016, Joyent Inc - * Author: Alex Wilson - * - * Permission to use, copy, modify, and distribute this software for any - * purpose with or without fee is hereby granted, provided that the above - * copyright notice and this permission notice appear in all copies. - * - * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES - * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF - * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR - * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES - * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN - * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF - * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. - */ - -// Ported from OpenBSD bcrypt_pbkdf.c v1.9 - -var BLF_J = 0; - -var Blowfish = function() { - this.S = [ - new Uint32Array([ - 0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7, - 0xb8e1afed, 0x6a267e96, 0xba7c9045, 0xf12c7f99, - 0x24a19947, 0xb3916cf7, 0x0801f2e2, 0x858efc16, - 0x636920d8, 0x71574e69, 0xa458fea3, 0xf4933d7e, - 0x0d95748f, 0x728eb658, 0x718bcd58, 0x82154aee, - 0x7b54a41d, 0xc25a59b5, 0x9c30d539, 0x2af26013, - 0xc5d1b023, 0x286085f0, 0xca417918, 0xb8db38ef, - 0x8e79dcb0, 0x603a180e, 0x6c9e0e8b, 0xb01e8a3e, - 0xd71577c1, 0xbd314b27, 0x78af2fda, 0x55605c60, - 0xe65525f3, 0xaa55ab94, 0x57489862, 0x63e81440, - 0x55ca396a, 0x2aab10b6, 0xb4cc5c34, 0x1141e8ce, - 0xa15486af, 0x7c72e993, 0xb3ee1411, 0x636fbc2a, - 0x2ba9c55d, 0x741831f6, 0xce5c3e16, 0x9b87931e, - 0xafd6ba33, 0x6c24cf5c, 0x7a325381, 0x28958677, - 0x3b8f4898, 0x6b4bb9af, 0xc4bfe81b, 0x66282193, - 0x61d809cc, 0xfb21a991, 0x487cac60, 0x5dec8032, - 0xef845d5d, 0xe98575b1, 0xdc262302, 0xeb651b88, - 0x23893e81, 0xd396acc5, 0x0f6d6ff3, 0x83f44239, - 0x2e0b4482, 0xa4842004, 0x69c8f04a, 0x9e1f9b5e, - 0x21c66842, 0xf6e96c9a, 0x670c9c61, 0xabd388f0, - 0x6a51a0d2, 0xd8542f68, 0x960fa728, 0xab5133a3, - 0x6eef0b6c, 0x137a3be4, 0xba3bf050, 0x7efb2a98, - 0xa1f1651d, 0x39af0176, 0x66ca593e, 0x82430e88, - 0x8cee8619, 0x456f9fb4, 0x7d84a5c3, 0x3b8b5ebe, - 0xe06f75d8, 0x85c12073, 0x401a449f, 0x56c16aa6, - 0x4ed3aa62, 0x363f7706, 0x1bfedf72, 0x429b023d, - 0x37d0d724, 0xd00a1248, 0xdb0fead3, 0x49f1c09b, - 0x075372c9, 0x80991b7b, 0x25d479d8, 0xf6e8def7, - 0xe3fe501a, 0xb6794c3b, 0x976ce0bd, 0x04c006ba, - 0xc1a94fb6, 0x409f60c4, 0x5e5c9ec2, 0x196a2463, - 0x68fb6faf, 0x3e6c53b5, 0x1339b2eb, 0x3b52ec6f, - 0x6dfc511f, 0x9b30952c, 0xcc814544, 0xaf5ebd09, - 0xbee3d004, 0xde334afd, 0x660f2807, 0x192e4bb3, - 0xc0cba857, 0x45c8740f, 0xd20b5f39, 0xb9d3fbdb, - 0x5579c0bd, 0x1a60320a, 0xd6a100c6, 0x402c7279, - 0x679f25fe, 0xfb1fa3cc, 0x8ea5e9f8, 0xdb3222f8, - 0x3c7516df, 0xfd616b15, 0x2f501ec8, 0xad0552ab, - 0x323db5fa, 0xfd238760, 0x53317b48, 0x3e00df82, - 0x9e5c57bb, 0xca6f8ca0, 0x1a87562e, 0xdf1769db, - 0xd542a8f6, 0x287effc3, 0xac6732c6, 0x8c4f5573, - 0x695b27b0, 0xbbca58c8, 0xe1ffa35d, 0xb8f011a0, - 0x10fa3d98, 0xfd2183b8, 0x4afcb56c, 0x2dd1d35b, - 0x9a53e479, 0xb6f84565, 0xd28e49bc, 0x4bfb9790, - 0xe1ddf2da, 0xa4cb7e33, 0x62fb1341, 0xcee4c6e8, - 0xef20cada, 0x36774c01, 0xd07e9efe, 0x2bf11fb4, - 0x95dbda4d, 0xae909198, 0xeaad8e71, 0x6b93d5a0, - 0xd08ed1d0, 0xafc725e0, 0x8e3c5b2f, 0x8e7594b7, - 0x8ff6e2fb, 0xf2122b64, 0x8888b812, 0x900df01c, - 0x4fad5ea0, 0x688fc31c, 0xd1cff191, 0xb3a8c1ad, - 0x2f2f2218, 0xbe0e1777, 0xea752dfe, 0x8b021fa1, - 0xe5a0cc0f, 0xb56f74e8, 0x18acf3d6, 0xce89e299, - 0xb4a84fe0, 0xfd13e0b7, 0x7cc43b81, 0xd2ada8d9, - 0x165fa266, 0x80957705, 0x93cc7314, 0x211a1477, - 0xe6ad2065, 0x77b5fa86, 0xc75442f5, 0xfb9d35cf, - 0xebcdaf0c, 0x7b3e89a0, 0xd6411bd3, 0xae1e7e49, - 0x00250e2d, 0x2071b35e, 0x226800bb, 0x57b8e0af, - 0x2464369b, 0xf009b91e, 0x5563911d, 0x59dfa6aa, - 0x78c14389, 0xd95a537f, 0x207d5ba2, 0x02e5b9c5, - 0x83260376, 0x6295cfa9, 0x11c81968, 0x4e734a41, - 0xb3472dca, 0x7b14a94a, 0x1b510052, 0x9a532915, - 0xd60f573f, 0xbc9bc6e4, 0x2b60a476, 0x81e67400, - 0x08ba6fb5, 0x571be91f, 0xf296ec6b, 0x2a0dd915, - 0xb6636521, 0xe7b9f9b6, 0xff34052e, 0xc5855664, - 0x53b02d5d, 0xa99f8fa1, 0x08ba4799, 0x6e85076a]), - new Uint32Array([ - 0x4b7a70e9, 0xb5b32944, 0xdb75092e, 0xc4192623, - 0xad6ea6b0, 0x49a7df7d, 0x9cee60b8, 0x8fedb266, - 0xecaa8c71, 0x699a17ff, 0x5664526c, 0xc2b19ee1, - 0x193602a5, 0x75094c29, 0xa0591340, 0xe4183a3e, - 0x3f54989a, 0x5b429d65, 0x6b8fe4d6, 0x99f73fd6, - 0xa1d29c07, 0xefe830f5, 0x4d2d38e6, 0xf0255dc1, - 0x4cdd2086, 0x8470eb26, 0x6382e9c6, 0x021ecc5e, - 0x09686b3f, 0x3ebaefc9, 0x3c971814, 0x6b6a70a1, - 0x687f3584, 0x52a0e286, 0xb79c5305, 0xaa500737, - 0x3e07841c, 0x7fdeae5c, 0x8e7d44ec, 0x5716f2b8, - 0xb03ada37, 0xf0500c0d, 0xf01c1f04, 0x0200b3ff, - 0xae0cf51a, 0x3cb574b2, 0x25837a58, 0xdc0921bd, - 0xd19113f9, 0x7ca92ff6, 0x94324773, 0x22f54701, - 0x3ae5e581, 0x37c2dadc, 0xc8b57634, 0x9af3dda7, - 0xa9446146, 0x0fd0030e, 0xecc8c73e, 0xa4751e41, - 0xe238cd99, 0x3bea0e2f, 0x3280bba1, 0x183eb331, - 0x4e548b38, 0x4f6db908, 0x6f420d03, 0xf60a04bf, - 0x2cb81290, 0x24977c79, 0x5679b072, 0xbcaf89af, - 0xde9a771f, 0xd9930810, 0xb38bae12, 0xdccf3f2e, - 0x5512721f, 0x2e6b7124, 0x501adde6, 0x9f84cd87, - 0x7a584718, 0x7408da17, 0xbc9f9abc, 0xe94b7d8c, - 0xec7aec3a, 0xdb851dfa, 0x63094366, 0xc464c3d2, - 0xef1c1847, 0x3215d908, 0xdd433b37, 0x24c2ba16, - 0x12a14d43, 0x2a65c451, 0x50940002, 0x133ae4dd, - 0x71dff89e, 0x10314e55, 0x81ac77d6, 0x5f11199b, - 0x043556f1, 0xd7a3c76b, 0x3c11183b, 0x5924a509, - 0xf28fe6ed, 0x97f1fbfa, 0x9ebabf2c, 0x1e153c6e, - 0x86e34570, 0xeae96fb1, 0x860e5e0a, 0x5a3e2ab3, - 0x771fe71c, 0x4e3d06fa, 0x2965dcb9, 0x99e71d0f, - 0x803e89d6, 0x5266c825, 0x2e4cc978, 0x9c10b36a, - 0xc6150eba, 0x94e2ea78, 0xa5fc3c53, 0x1e0a2df4, - 0xf2f74ea7, 0x361d2b3d, 0x1939260f, 0x19c27960, - 0x5223a708, 0xf71312b6, 0xebadfe6e, 0xeac31f66, - 0xe3bc4595, 0xa67bc883, 0xb17f37d1, 0x018cff28, - 0xc332ddef, 0xbe6c5aa5, 0x65582185, 0x68ab9802, - 0xeecea50f, 0xdb2f953b, 0x2aef7dad, 0x5b6e2f84, - 0x1521b628, 0x29076170, 0xecdd4775, 0x619f1510, - 0x13cca830, 0xeb61bd96, 0x0334fe1e, 0xaa0363cf, - 0xb5735c90, 0x4c70a239, 0xd59e9e0b, 0xcbaade14, - 0xeecc86bc, 0x60622ca7, 0x9cab5cab, 0xb2f3846e, - 0x648b1eaf, 0x19bdf0ca, 0xa02369b9, 0x655abb50, - 0x40685a32, 0x3c2ab4b3, 0x319ee9d5, 0xc021b8f7, - 0x9b540b19, 0x875fa099, 0x95f7997e, 0x623d7da8, - 0xf837889a, 0x97e32d77, 0x11ed935f, 0x16681281, - 0x0e358829, 0xc7e61fd6, 0x96dedfa1, 0x7858ba99, - 0x57f584a5, 0x1b227263, 0x9b83c3ff, 0x1ac24696, - 0xcdb30aeb, 0x532e3054, 0x8fd948e4, 0x6dbc3128, - 0x58ebf2ef, 0x34c6ffea, 0xfe28ed61, 0xee7c3c73, - 0x5d4a14d9, 0xe864b7e3, 0x42105d14, 0x203e13e0, - 0x45eee2b6, 0xa3aaabea, 0xdb6c4f15, 0xfacb4fd0, - 0xc742f442, 0xef6abbb5, 0x654f3b1d, 0x41cd2105, - 0xd81e799e, 0x86854dc7, 0xe44b476a, 0x3d816250, - 0xcf62a1f2, 0x5b8d2646, 0xfc8883a0, 0xc1c7b6a3, - 0x7f1524c3, 0x69cb7492, 0x47848a0b, 0x5692b285, - 0x095bbf00, 0xad19489d, 0x1462b174, 0x23820e00, - 0x58428d2a, 0x0c55f5ea, 0x1dadf43e, 0x233f7061, - 0x3372f092, 0x8d937e41, 0xd65fecf1, 0x6c223bdb, - 0x7cde3759, 0xcbee7460, 0x4085f2a7, 0xce77326e, - 0xa6078084, 0x19f8509e, 0xe8efd855, 0x61d99735, - 0xa969a7aa, 0xc50c06c2, 0x5a04abfc, 0x800bcadc, - 0x9e447a2e, 0xc3453484, 0xfdd56705, 0x0e1e9ec9, - 0xdb73dbd3, 0x105588cd, 0x675fda79, 0xe3674340, - 0xc5c43465, 0x713e38d8, 0x3d28f89e, 0xf16dff20, - 0x153e21e7, 0x8fb03d4a, 0xe6e39f2b, 0xdb83adf7]), - new Uint32Array([ - 0xe93d5a68, 0x948140f7, 0xf64c261c, 0x94692934, - 0x411520f7, 0x7602d4f7, 0xbcf46b2e, 0xd4a20068, - 0xd4082471, 0x3320f46a, 0x43b7d4b7, 0x500061af, - 0x1e39f62e, 0x97244546, 0x14214f74, 0xbf8b8840, - 0x4d95fc1d, 0x96b591af, 0x70f4ddd3, 0x66a02f45, - 0xbfbc09ec, 0x03bd9785, 0x7fac6dd0, 0x31cb8504, - 0x96eb27b3, 0x55fd3941, 0xda2547e6, 0xabca0a9a, - 0x28507825, 0x530429f4, 0x0a2c86da, 0xe9b66dfb, - 0x68dc1462, 0xd7486900, 0x680ec0a4, 0x27a18dee, - 0x4f3ffea2, 0xe887ad8c, 0xb58ce006, 0x7af4d6b6, - 0xaace1e7c, 0xd3375fec, 0xce78a399, 0x406b2a42, - 0x20fe9e35, 0xd9f385b9, 0xee39d7ab, 0x3b124e8b, - 0x1dc9faf7, 0x4b6d1856, 0x26a36631, 0xeae397b2, - 0x3a6efa74, 0xdd5b4332, 0x6841e7f7, 0xca7820fb, - 0xfb0af54e, 0xd8feb397, 0x454056ac, 0xba489527, - 0x55533a3a, 0x20838d87, 0xfe6ba9b7, 0xd096954b, - 0x55a867bc, 0xa1159a58, 0xcca92963, 0x99e1db33, - 0xa62a4a56, 0x3f3125f9, 0x5ef47e1c, 0x9029317c, - 0xfdf8e802, 0x04272f70, 0x80bb155c, 0x05282ce3, - 0x95c11548, 0xe4c66d22, 0x48c1133f, 0xc70f86dc, - 0x07f9c9ee, 0x41041f0f, 0x404779a4, 0x5d886e17, - 0x325f51eb, 0xd59bc0d1, 0xf2bcc18f, 0x41113564, - 0x257b7834, 0x602a9c60, 0xdff8e8a3, 0x1f636c1b, - 0x0e12b4c2, 0x02e1329e, 0xaf664fd1, 0xcad18115, - 0x6b2395e0, 0x333e92e1, 0x3b240b62, 0xeebeb922, - 0x85b2a20e, 0xe6ba0d99, 0xde720c8c, 0x2da2f728, - 0xd0127845, 0x95b794fd, 0x647d0862, 0xe7ccf5f0, - 0x5449a36f, 0x877d48fa, 0xc39dfd27, 0xf33e8d1e, - 0x0a476341, 0x992eff74, 0x3a6f6eab, 0xf4f8fd37, - 0xa812dc60, 0xa1ebddf8, 0x991be14c, 0xdb6e6b0d, - 0xc67b5510, 0x6d672c37, 0x2765d43b, 0xdcd0e804, - 0xf1290dc7, 0xcc00ffa3, 0xb5390f92, 0x690fed0b, - 0x667b9ffb, 0xcedb7d9c, 0xa091cf0b, 0xd9155ea3, - 0xbb132f88, 0x515bad24, 0x7b9479bf, 0x763bd6eb, - 0x37392eb3, 0xcc115979, 0x8026e297, 0xf42e312d, - 0x6842ada7, 0xc66a2b3b, 0x12754ccc, 0x782ef11c, - 0x6a124237, 0xb79251e7, 0x06a1bbe6, 0x4bfb6350, - 0x1a6b1018, 0x11caedfa, 0x3d25bdd8, 0xe2e1c3c9, - 0x44421659, 0x0a121386, 0xd90cec6e, 0xd5abea2a, - 0x64af674e, 0xda86a85f, 0xbebfe988, 0x64e4c3fe, - 0x9dbc8057, 0xf0f7c086, 0x60787bf8, 0x6003604d, - 0xd1fd8346, 0xf6381fb0, 0x7745ae04, 0xd736fccc, - 0x83426b33, 0xf01eab71, 0xb0804187, 0x3c005e5f, - 0x77a057be, 0xbde8ae24, 0x55464299, 0xbf582e61, - 0x4e58f48f, 0xf2ddfda2, 0xf474ef38, 0x8789bdc2, - 0x5366f9c3, 0xc8b38e74, 0xb475f255, 0x46fcd9b9, - 0x7aeb2661, 0x8b1ddf84, 0x846a0e79, 0x915f95e2, - 0x466e598e, 0x20b45770, 0x8cd55591, 0xc902de4c, - 0xb90bace1, 0xbb8205d0, 0x11a86248, 0x7574a99e, - 0xb77f19b6, 0xe0a9dc09, 0x662d09a1, 0xc4324633, - 0xe85a1f02, 0x09f0be8c, 0x4a99a025, 0x1d6efe10, - 0x1ab93d1d, 0x0ba5a4df, 0xa186f20f, 0x2868f169, - 0xdcb7da83, 0x573906fe, 0xa1e2ce9b, 0x4fcd7f52, - 0x50115e01, 0xa70683fa, 0xa002b5c4, 0x0de6d027, - 0x9af88c27, 0x773f8641, 0xc3604c06, 0x61a806b5, - 0xf0177a28, 0xc0f586e0, 0x006058aa, 0x30dc7d62, - 0x11e69ed7, 0x2338ea63, 0x53c2dd94, 0xc2c21634, - 0xbbcbee56, 0x90bcb6de, 0xebfc7da1, 0xce591d76, - 0x6f05e409, 0x4b7c0188, 0x39720a3d, 0x7c927c24, - 0x86e3725f, 0x724d9db9, 0x1ac15bb4, 0xd39eb8fc, - 0xed545578, 0x08fca5b5, 0xd83d7cd3, 0x4dad0fc4, - 0x1e50ef5e, 0xb161e6f8, 0xa28514d9, 0x6c51133c, - 0x6fd5c7e7, 0x56e14ec4, 0x362abfce, 0xddc6c837, - 0xd79a3234, 0x92638212, 0x670efa8e, 0x406000e0]), - new Uint32Array([ - 0x3a39ce37, 0xd3faf5cf, 0xabc27737, 0x5ac52d1b, - 0x5cb0679e, 0x4fa33742, 0xd3822740, 0x99bc9bbe, - 0xd5118e9d, 0xbf0f7315, 0xd62d1c7e, 0xc700c47b, - 0xb78c1b6b, 0x21a19045, 0xb26eb1be, 0x6a366eb4, - 0x5748ab2f, 0xbc946e79, 0xc6a376d2, 0x6549c2c8, - 0x530ff8ee, 0x468dde7d, 0xd5730a1d, 0x4cd04dc6, - 0x2939bbdb, 0xa9ba4650, 0xac9526e8, 0xbe5ee304, - 0xa1fad5f0, 0x6a2d519a, 0x63ef8ce2, 0x9a86ee22, - 0xc089c2b8, 0x43242ef6, 0xa51e03aa, 0x9cf2d0a4, - 0x83c061ba, 0x9be96a4d, 0x8fe51550, 0xba645bd6, - 0x2826a2f9, 0xa73a3ae1, 0x4ba99586, 0xef5562e9, - 0xc72fefd3, 0xf752f7da, 0x3f046f69, 0x77fa0a59, - 0x80e4a915, 0x87b08601, 0x9b09e6ad, 0x3b3ee593, - 0xe990fd5a, 0x9e34d797, 0x2cf0b7d9, 0x022b8b51, - 0x96d5ac3a, 0x017da67d, 0xd1cf3ed6, 0x7c7d2d28, - 0x1f9f25cf, 0xadf2b89b, 0x5ad6b472, 0x5a88f54c, - 0xe029ac71, 0xe019a5e6, 0x47b0acfd, 0xed93fa9b, - 0xe8d3c48d, 0x283b57cc, 0xf8d56629, 0x79132e28, - 0x785f0191, 0xed756055, 0xf7960e44, 0xe3d35e8c, - 0x15056dd4, 0x88f46dba, 0x03a16125, 0x0564f0bd, - 0xc3eb9e15, 0x3c9057a2, 0x97271aec, 0xa93a072a, - 0x1b3f6d9b, 0x1e6321f5, 0xf59c66fb, 0x26dcf319, - 0x7533d928, 0xb155fdf5, 0x03563482, 0x8aba3cbb, - 0x28517711, 0xc20ad9f8, 0xabcc5167, 0xccad925f, - 0x4de81751, 0x3830dc8e, 0x379d5862, 0x9320f991, - 0xea7a90c2, 0xfb3e7bce, 0x5121ce64, 0x774fbe32, - 0xa8b6e37e, 0xc3293d46, 0x48de5369, 0x6413e680, - 0xa2ae0810, 0xdd6db224, 0x69852dfd, 0x09072166, - 0xb39a460a, 0x6445c0dd, 0x586cdecf, 0x1c20c8ae, - 0x5bbef7dd, 0x1b588d40, 0xccd2017f, 0x6bb4e3bb, - 0xdda26a7e, 0x3a59ff45, 0x3e350a44, 0xbcb4cdd5, - 0x72eacea8, 0xfa6484bb, 0x8d6612ae, 0xbf3c6f47, - 0xd29be463, 0x542f5d9e, 0xaec2771b, 0xf64e6370, - 0x740e0d8d, 0xe75b1357, 0xf8721671, 0xaf537d5d, - 0x4040cb08, 0x4eb4e2cc, 0x34d2466a, 0x0115af84, - 0xe1b00428, 0x95983a1d, 0x06b89fb4, 0xce6ea048, - 0x6f3f3b82, 0x3520ab82, 0x011a1d4b, 0x277227f8, - 0x611560b1, 0xe7933fdc, 0xbb3a792b, 0x344525bd, - 0xa08839e1, 0x51ce794b, 0x2f32c9b7, 0xa01fbac9, - 0xe01cc87e, 0xbcc7d1f6, 0xcf0111c3, 0xa1e8aac7, - 0x1a908749, 0xd44fbd9a, 0xd0dadecb, 0xd50ada38, - 0x0339c32a, 0xc6913667, 0x8df9317c, 0xe0b12b4f, - 0xf79e59b7, 0x43f5bb3a, 0xf2d519ff, 0x27d9459c, - 0xbf97222c, 0x15e6fc2a, 0x0f91fc71, 0x9b941525, - 0xfae59361, 0xceb69ceb, 0xc2a86459, 0x12baa8d1, - 0xb6c1075e, 0xe3056a0c, 0x10d25065, 0xcb03a442, - 0xe0ec6e0e, 0x1698db3b, 0x4c98a0be, 0x3278e964, - 0x9f1f9532, 0xe0d392df, 0xd3a0342b, 0x8971f21e, - 0x1b0a7441, 0x4ba3348c, 0xc5be7120, 0xc37632d8, - 0xdf359f8d, 0x9b992f2e, 0xe60b6f47, 0x0fe3f11d, - 0xe54cda54, 0x1edad891, 0xce6279cf, 0xcd3e7e6f, - 0x1618b166, 0xfd2c1d05, 0x848fd2c5, 0xf6fb2299, - 0xf523f357, 0xa6327623, 0x93a83531, 0x56cccd02, - 0xacf08162, 0x5a75ebb5, 0x6e163697, 0x88d273cc, - 0xde966292, 0x81b949d0, 0x4c50901b, 0x71c65614, - 0xe6c6c7bd, 0x327a140a, 0x45e1d006, 0xc3f27b9a, - 0xc9aa53fd, 0x62a80f00, 0xbb25bfe2, 0x35bdd2f6, - 0x71126905, 0xb2040222, 0xb6cbcf7c, 0xcd769c2b, - 0x53113ec0, 0x1640e3d3, 0x38abbd60, 0x2547adf0, - 0xba38209c, 0xf746ce76, 0x77afa1c5, 0x20756060, - 0x85cbfe4e, 0x8ae88dd8, 0x7aaaf9b0, 0x4cf9aa7e, - 0x1948c25c, 0x02fb8a8c, 0x01c36ae4, 0xd6ebe1f9, - 0x90d4f869, 0xa65cdea0, 0x3f09252d, 0xc208e69f, - 0xb74e6132, 0xce77e25b, 0x578fdfe3, 0x3ac372e6]) - ]; - this.P = new Uint32Array([ - 0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344, - 0xa4093822, 0x299f31d0, 0x082efa98, 0xec4e6c89, - 0x452821e6, 0x38d01377, 0xbe5466cf, 0x34e90c6c, - 0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5, 0xb5470917, - 0x9216d5d9, 0x8979fb1b]); -}; - -function F(S, x8, i) { - return (((S[0][x8[i+3]] + - S[1][x8[i+2]]) ^ - S[2][x8[i+1]]) + - S[3][x8[i]]); -}; - -Blowfish.prototype.encipher = function(x, x8) { - if (x8 === undefined) { - x8 = new Uint8Array(x.buffer); - if (x.byteOffset !== 0) - x8 = x8.subarray(x.byteOffset); - } - x[0] ^= this.P[0]; - for (var i = 1; i < 16; i += 2) { - x[1] ^= F(this.S, x8, 0) ^ this.P[i]; - x[0] ^= F(this.S, x8, 4) ^ this.P[i+1]; - } - var t = x[0]; - x[0] = x[1] ^ this.P[17]; - x[1] = t; -}; - -Blowfish.prototype.decipher = function(x) { - var x8 = new Uint8Array(x.buffer); - if (x.byteOffset !== 0) - x8 = x8.subarray(x.byteOffset); - x[0] ^= this.P[17]; - for (var i = 16; i > 0; i -= 2) { - x[1] ^= F(this.S, x8, 0) ^ this.P[i]; - x[0] ^= F(this.S, x8, 4) ^ this.P[i-1]; - } - var t = x[0]; - x[0] = x[1] ^ this.P[0]; - x[1] = t; -}; - -function stream2word(data, databytes){ - var i, temp = 0; - for (i = 0; i < 4; i++, BLF_J++) { - if (BLF_J >= databytes) BLF_J = 0; - temp = (temp << 8) | data[BLF_J]; - } - return temp; -}; - -Blowfish.prototype.expand0state = function(key, keybytes) { - var d = new Uint32Array(2), i, k; - var d8 = new Uint8Array(d.buffer); - - for (i = 0, BLF_J = 0; i < 18; i++) { - this.P[i] ^= stream2word(key, keybytes); - } - BLF_J = 0; - - for (i = 0; i < 18; i += 2) { - this.encipher(d, d8); - this.P[i] = d[0]; - this.P[i+1] = d[1]; - } - - for (i = 0; i < 4; i++) { - for (k = 0; k < 256; k += 2) { - this.encipher(d, d8); - this.S[i][k] = d[0]; - this.S[i][k+1] = d[1]; - } - } -}; - -Blowfish.prototype.expandstate = function(data, databytes, key, keybytes) { - var d = new Uint32Array(2), i, k; - - for (i = 0, BLF_J = 0; i < 18; i++) { - this.P[i] ^= stream2word(key, keybytes); - } - - for (i = 0, BLF_J = 0; i < 18; i += 2) { - d[0] ^= stream2word(data, databytes); - d[1] ^= stream2word(data, databytes); - this.encipher(d); - this.P[i] = d[0]; - this.P[i+1] = d[1]; - } - - for (i = 0; i < 4; i++) { - for (k = 0; k < 256; k += 2) { - d[0] ^= stream2word(data, databytes); - d[1] ^= stream2word(data, databytes); - this.encipher(d); - this.S[i][k] = d[0]; - this.S[i][k+1] = d[1]; - } - } - BLF_J = 0; -}; - -Blowfish.prototype.enc = function(data, blocks) { - for (var i = 0; i < blocks; i++) { - this.encipher(data.subarray(i*2)); - } -}; - -Blowfish.prototype.dec = function(data, blocks) { - for (var i = 0; i < blocks; i++) { - this.decipher(data.subarray(i*2)); - } -}; - -var BCRYPT_BLOCKS = 8, - BCRYPT_HASHSIZE = 32; - -function bcrypt_hash(sha2pass, sha2salt, out) { - var state = new Blowfish(), - cdata = new Uint32Array(BCRYPT_BLOCKS), i, - ciphertext = new Uint8Array([79,120,121,99,104,114,111,109,97,116,105, - 99,66,108,111,119,102,105,115,104,83,119,97,116,68,121,110,97,109, - 105,116,101]); //"OxychromaticBlowfishSwatDynamite" - - state.expandstate(sha2salt, 64, sha2pass, 64); - for (i = 0; i < 64; i++) { - state.expand0state(sha2salt, 64); - state.expand0state(sha2pass, 64); - } - - for (i = 0; i < BCRYPT_BLOCKS; i++) - cdata[i] = stream2word(ciphertext, ciphertext.byteLength); - for (i = 0; i < 64; i++) - state.enc(cdata, cdata.byteLength / 8); - - for (i = 0; i < BCRYPT_BLOCKS; i++) { - out[4*i+3] = cdata[i] >>> 24; - out[4*i+2] = cdata[i] >>> 16; - out[4*i+1] = cdata[i] >>> 8; - out[4*i+0] = cdata[i]; - } -}; - -function bcrypt_pbkdf(pass, passlen, salt, saltlen, key, keylen, rounds) { - var sha2pass = new Uint8Array(64), - sha2salt = new Uint8Array(64), - out = new Uint8Array(BCRYPT_HASHSIZE), - tmpout = new Uint8Array(BCRYPT_HASHSIZE), - countsalt = new Uint8Array(saltlen+4), - i, j, amt, stride, dest, count, - origkeylen = keylen; - - if (rounds < 1) - return -1; - if (passlen === 0 || saltlen === 0 || keylen === 0 || - keylen > (out.byteLength * out.byteLength) || saltlen > (1<<20)) - return -1; - - stride = Math.floor((keylen + out.byteLength - 1) / out.byteLength); - amt = Math.floor((keylen + stride - 1) / stride); - - for (i = 0; i < saltlen; i++) - countsalt[i] = salt[i]; - - crypto_hash_sha512(sha2pass, pass, passlen); - - for (count = 1; keylen > 0; count++) { - countsalt[saltlen+0] = count >>> 24; - countsalt[saltlen+1] = count >>> 16; - countsalt[saltlen+2] = count >>> 8; - countsalt[saltlen+3] = count; - - crypto_hash_sha512(sha2salt, countsalt, saltlen + 4); - bcrypt_hash(sha2pass, sha2salt, tmpout); - for (i = out.byteLength; i--;) - out[i] = tmpout[i]; - - for (i = 1; i < rounds; i++) { - crypto_hash_sha512(sha2salt, tmpout, tmpout.byteLength); - bcrypt_hash(sha2pass, sha2salt, tmpout); - for (j = 0; j < out.byteLength; j++) - out[j] ^= tmpout[j]; - } - - amt = Math.min(amt, keylen); - for (i = 0; i < amt; i++) { - dest = i * stride + (count - 1); - if (dest >= origkeylen) - break; - key[dest] = out[i]; - } - keylen -= i; - } - - return 0; -}; - -module.exports = { - BLOCKS: BCRYPT_BLOCKS, - HASHSIZE: BCRYPT_HASHSIZE, - hash: bcrypt_hash, - pbkdf: bcrypt_pbkdf -}; - - -/***/ }), - -/***/ 143: -/***/ (function(module) { - -module.exports = defer; - -/** - * Runs provided function on next iteration of the event loop - * - * @param {function} fn - function to run - */ -function defer(fn) -{ - var nextTick = typeof setImmediate == 'function' - ? setImmediate - : ( - typeof process == 'object' && typeof process.nextTick == 'function' - ? process.nextTick - : null - ); - - if (nextTick) - { - nextTick(fn); - } - else - { - setTimeout(fn, 0); - } -} - - -/***/ }), - -/***/ 146: -/***/ (function(module) { - -"use strict"; - - -function formatHostname (hostname) { - // canonicalize the hostname, so that 'oogle.com' won't match 'google.com' - return hostname.replace(/^\.*/, '.').toLowerCase() -} - -function parseNoProxyZone (zone) { - zone = zone.trim().toLowerCase() - - var zoneParts = zone.split(':', 2) - var zoneHost = formatHostname(zoneParts[0]) - var zonePort = zoneParts[1] - var hasPort = zone.indexOf(':') > -1 - - return {hostname: zoneHost, port: zonePort, hasPort: hasPort} -} - -function uriInNoProxy (uri, noProxy) { - var port = uri.port || (uri.protocol === 'https:' ? '443' : '80') - var hostname = formatHostname(uri.hostname) - var noProxyList = noProxy.split(',') - - // iterate through the noProxyList until it finds a match. - return noProxyList.map(parseNoProxyZone).some(function (noProxyZone) { - var isMatchedAt = hostname.indexOf(noProxyZone.hostname) - var hostnameMatched = ( - isMatchedAt > -1 && - (isMatchedAt === hostname.length - noProxyZone.hostname.length) - ) - - if (noProxyZone.hasPort) { - return (port === noProxyZone.port) && hostnameMatched - } - - return hostnameMatched - }) -} - -function getProxyFromURI (uri) { - // Decide the proper request proxy to use based on the request URI object and the - // environmental variables (NO_PROXY, HTTP_PROXY, etc.) - // respect NO_PROXY environment variables (see: http://lynx.isc.org/current/breakout/lynx_help/keystrokes/environments.html) - - var noProxy = process.env.NO_PROXY || process.env.no_proxy || '' - - // if the noProxy is a wildcard then return null - - if (noProxy === '*') { - return null - } - - // if the noProxy is not empty and the uri is found return null - - if (noProxy !== '' && uriInNoProxy(uri, noProxy)) { - return null - } - - // Check for HTTP or HTTPS Proxy in environment Else default to null - - if (uri.protocol === 'http:') { - return process.env.HTTP_PROXY || - process.env.http_proxy || null - } - - if (uri.protocol === 'https:') { - return process.env.HTTPS_PROXY || - process.env.https_proxy || - process.env.HTTP_PROXY || - process.env.http_proxy || null - } - - // if none of that works, return null - // (What uri protocol are you using then?) - - return null -} - -module.exports = getProxyFromURI - - -/***/ }), - -/***/ 147: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -var fs = __webpack_require__(747) -var qs = __webpack_require__(191) -var validate = __webpack_require__(115) -var extend = __webpack_require__(922) - -function Har (request) { - this.request = request -} - -Har.prototype.reducer = function (obj, pair) { - // new property ? - if (obj[pair.name] === undefined) { - obj[pair.name] = pair.value - return obj - } - - // existing? convert to array - var arr = [ - obj[pair.name], - pair.value - ] - - obj[pair.name] = arr - - return obj -} - -Har.prototype.prep = function (data) { - // construct utility properties - data.queryObj = {} - data.headersObj = {} - data.postData.jsonObj = false - data.postData.paramsObj = false - - // construct query objects - if (data.queryString && data.queryString.length) { - data.queryObj = data.queryString.reduce(this.reducer, {}) - } - - // construct headers objects - if (data.headers && data.headers.length) { - // loweCase header keys - data.headersObj = data.headers.reduceRight(function (headers, header) { - headers[header.name] = header.value - return headers - }, {}) - } - - // construct Cookie header - if (data.cookies && data.cookies.length) { - var cookies = data.cookies.map(function (cookie) { - return cookie.name + '=' + cookie.value - }) - - if (cookies.length) { - data.headersObj.cookie = cookies.join('; ') - } - } - - // prep body - function some (arr) { - return arr.some(function (type) { - return data.postData.mimeType.indexOf(type) === 0 - }) - } - - if (some([ - 'multipart/mixed', - 'multipart/related', - 'multipart/form-data', - 'multipart/alternative'])) { - // reset values - data.postData.mimeType = 'multipart/form-data' - } else if (some([ - 'application/x-www-form-urlencoded'])) { - if (!data.postData.params) { - data.postData.text = '' - } else { - data.postData.paramsObj = data.postData.params.reduce(this.reducer, {}) - - // always overwrite - data.postData.text = qs.stringify(data.postData.paramsObj) - } - } else if (some([ - 'text/json', - 'text/x-json', - 'application/json', - 'application/x-json'])) { - data.postData.mimeType = 'application/json' - - if (data.postData.text) { - try { - data.postData.jsonObj = JSON.parse(data.postData.text) - } catch (e) { - this.request.debug(e) - - // force back to text/plain - data.postData.mimeType = 'text/plain' - } - } - } - - return data -} - -Har.prototype.options = function (options) { - // skip if no har property defined - if (!options.har) { - return options - } - - var har = {} - extend(har, options.har) - - // only process the first entry - if (har.log && har.log.entries) { - har = har.log.entries[0] - } - - // add optional properties to make validation successful - har.url = har.url || options.url || options.uri || options.baseUrl || '/' - har.httpVersion = har.httpVersion || 'HTTP/1.1' - har.queryString = har.queryString || [] - har.headers = har.headers || [] - har.cookies = har.cookies || [] - har.postData = har.postData || {} - har.postData.mimeType = har.postData.mimeType || 'application/octet-stream' - - har.bodySize = 0 - har.headersSize = 0 - har.postData.size = 0 - - if (!validate.request(har)) { - return options - } - - // clean up and get some utility properties - var req = this.prep(har) - - // construct new options - if (req.url) { - options.url = req.url - } - - if (req.method) { - options.method = req.method - } - - if (Object.keys(req.queryObj).length) { - options.qs = req.queryObj - } - - if (Object.keys(req.headersObj).length) { - options.headers = req.headersObj - } - - function test (type) { - return req.postData.mimeType.indexOf(type) === 0 - } - if (test('application/x-www-form-urlencoded')) { - options.form = req.postData.paramsObj - } else if (test('application/json')) { - if (req.postData.jsonObj) { - options.body = req.postData.jsonObj - options.json = true - } - } else if (test('multipart/form-data')) { - options.formData = {} - - req.postData.params.forEach(function (param) { - var attachment = {} - - if (!param.fileName && !param.fileName && !param.contentType) { - options.formData[param.name] = param.value - return - } - - // attempt to read from disk! - if (param.fileName && !param.value) { - attachment.value = fs.createReadStream(param.fileName) - } else if (param.value) { - attachment.value = param.value - } - - if (param.fileName) { - attachment.options = { - filename: param.fileName, - contentType: param.contentType ? param.contentType : null - } - } - - options.formData[param.name] = attachment - }) - } else { - if (req.postData.text) { - options.body = req.postData.text - } - } - - return options -} - -exports.Har = Har - - -/***/ }), - -/***/ 151: -/***/ (function(module) { - -/** - * Convert array of 16 byte values to UUID string format of the form: - * XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX - */ -var byteToHex = []; -for (var i = 0; i < 256; ++i) { - byteToHex[i] = (i + 0x100).toString(16).substr(1); -} - -function bytesToUuid(buf, offset) { - var i = offset || 0; - var bth = byteToHex; - // join used to fix memory issue caused by concatenation: https://bugs.chromium.org/p/v8/issues/detail?id=3175#c4 - return ([bth[buf[i++]], bth[buf[i++]], - bth[buf[i++]], bth[buf[i++]], '-', - bth[buf[i++]], bth[buf[i++]], '-', - bth[buf[i++]], bth[buf[i++]], '-', - bth[buf[i++]], bth[buf[i++]], '-', - bth[buf[i++]], bth[buf[i++]], - bth[buf[i++]], bth[buf[i++]], - bth[buf[i++]], bth[buf[i++]]]).join(''); -} - -module.exports = bytesToUuid; - - -/***/ }), - -/***/ 152: -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -var IDENTIFIER = /^[a-z_$][a-z0-9_$-]*$/i; -var customRuleCode = __webpack_require__(635); -var definitionSchema = __webpack_require__(970); - -module.exports = { - add: addKeyword, - get: getKeyword, - remove: removeKeyword, - validate: validateKeyword -}; - - -/** - * Define custom keyword - * @this Ajv - * @param {String} keyword custom keyword, should be unique (including different from all standard, custom and macro keywords). - * @param {Object} definition keyword definition object with properties `type` (type(s) which the keyword applies to), `validate` or `compile`. - * @return {Ajv} this for method chaining - */ -function addKeyword(keyword, definition) { - /* jshint validthis: true */ - /* eslint no-shadow: 0 */ - var RULES = this.RULES; - if (RULES.keywords[keyword]) - throw new Error('Keyword ' + keyword + ' is already defined'); - - if (!IDENTIFIER.test(keyword)) - throw new Error('Keyword ' + keyword + ' is not a valid identifier'); - - if (definition) { - this.validateKeyword(definition, true); - - var dataType = definition.type; - if (Array.isArray(dataType)) { - for (var i=0; i', - $notOp = $isMax ? '>' : '<', - $errorKeyword = undefined; - if ($isDataExcl) { - var $schemaValueExcl = it.util.getData($schemaExcl.$data, $dataLvl, it.dataPathArr), - $exclusive = 'exclusive' + $lvl, - $exclType = 'exclType' + $lvl, - $exclIsNumber = 'exclIsNumber' + $lvl, - $opExpr = 'op' + $lvl, - $opStr = '\' + ' + $opExpr + ' + \''; - out += ' var schemaExcl' + ($lvl) + ' = ' + ($schemaValueExcl) + '; '; - $schemaValueExcl = 'schemaExcl' + $lvl; - out += ' var ' + ($exclusive) + '; var ' + ($exclType) + ' = typeof ' + ($schemaValueExcl) + '; if (' + ($exclType) + ' != \'boolean\' && ' + ($exclType) + ' != \'undefined\' && ' + ($exclType) + ' != \'number\') { '; - var $errorKeyword = $exclusiveKeyword; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || '_exclusiveLimit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; - if (it.opts.messages !== false) { - out += ' , message: \'' + ($exclusiveKeyword) + ' should be boolean\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } else if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; - } - out += ' ' + ($exclType) + ' == \'number\' ? ( (' + ($exclusive) + ' = ' + ($schemaValue) + ' === undefined || ' + ($schemaValueExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ') ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValueExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) : ( (' + ($exclusive) + ' = ' + ($schemaValueExcl) + ' === true) ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValue) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { var op' + ($lvl) + ' = ' + ($exclusive) + ' ? \'' + ($op) + '\' : \'' + ($op) + '=\'; '; - if ($schema === undefined) { - $errorKeyword = $exclusiveKeyword; - $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; - $schemaValue = $schemaValueExcl; - $isData = $isDataExcl; - } - } else { - var $exclIsNumber = typeof $schemaExcl == 'number', - $opStr = $op; - if ($exclIsNumber && $isData) { - var $opExpr = '\'' + $opStr + '\''; - out += ' if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; - } - out += ' ( ' + ($schemaValue) + ' === undefined || ' + ($schemaExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ' ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { '; - } else { - if ($exclIsNumber && $schema === undefined) { - $exclusive = true; - $errorKeyword = $exclusiveKeyword; - $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; - $schemaValue = $schemaExcl; - $notOp += '='; - } else { - if ($exclIsNumber) $schemaValue = Math[$isMax ? 'min' : 'max']($schemaExcl, $schema); - if ($schemaExcl === ($exclIsNumber ? $schemaValue : true)) { - $exclusive = true; - $errorKeyword = $exclusiveKeyword; - $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; - $notOp += '='; - } else { - $exclusive = false; - $opStr += '='; - } - } - var $opExpr = '\'' + $opStr + '\''; - out += ' if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; - } - out += ' ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' || ' + ($data) + ' !== ' + ($data) + ') { '; - } - } - $errorKeyword = $errorKeyword || $keyword; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || '_limit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { comparison: ' + ($opExpr) + ', limit: ' + ($schemaValue) + ', exclusive: ' + ($exclusive) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should be ' + ($opStr) + ' '; - if ($isData) { - out += '\' + ' + ($schemaValue); - } else { - out += '' + ($schemaValue) + '\''; - } - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + ($schema); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } '; - if ($breakOnError) { - out += ' else { '; - } - return out; -} - - -/***/ }), - -/***/ 189: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -var uuid = __webpack_require__(563) -var CombinedStream = __webpack_require__(753) -var isstream = __webpack_require__(854) -var Buffer = __webpack_require__(674).Buffer - -function Multipart (request) { - this.request = request - this.boundary = uuid() - this.chunked = false - this.body = null -} - -Multipart.prototype.isChunked = function (options) { - var self = this - var chunked = false - var parts = options.data || options - - if (!parts.forEach) { - self.request.emit('error', new Error('Argument error, options.multipart.')) - } - - if (options.chunked !== undefined) { - chunked = options.chunked - } - - if (self.request.getHeader('transfer-encoding') === 'chunked') { - chunked = true - } - - if (!chunked) { - parts.forEach(function (part) { - if (typeof part.body === 'undefined') { - self.request.emit('error', new Error('Body attribute missing in multipart.')) - } - if (isstream(part.body)) { - chunked = true - } - }) - } - - return chunked -} - -Multipart.prototype.setHeaders = function (chunked) { - var self = this - - if (chunked && !self.request.hasHeader('transfer-encoding')) { - self.request.setHeader('transfer-encoding', 'chunked') - } - - var header = self.request.getHeader('content-type') - - if (!header || header.indexOf('multipart') === -1) { - self.request.setHeader('content-type', 'multipart/related; boundary=' + self.boundary) - } else { - if (header.indexOf('boundary') !== -1) { - self.boundary = header.replace(/.*boundary=([^\s;]+).*/, '$1') - } else { - self.request.setHeader('content-type', header + '; boundary=' + self.boundary) - } - } -} - -Multipart.prototype.build = function (parts, chunked) { - var self = this - var body = chunked ? new CombinedStream() : [] - - function add (part) { - if (typeof part === 'number') { - part = part.toString() - } - return chunked ? body.append(part) : body.push(Buffer.from(part)) - } - - if (self.request.preambleCRLF) { - add('\r\n') - } - - parts.forEach(function (part) { - var preamble = '--' + self.boundary + '\r\n' - Object.keys(part).forEach(function (key) { - if (key === 'body') { return } - preamble += key + ': ' + part[key] + '\r\n' - }) - preamble += '\r\n' - add(preamble) - add(part.body) - add('\r\n') - }) - add('--' + self.boundary + '--') - - if (self.request.postambleCRLF) { - add('\r\n') - } - - return body -} - -Multipart.prototype.onRequest = function (options) { - var self = this - - var chunked = self.isChunked(options) - var parts = options.data || options - - self.setHeaders(chunked) - self.chunked = chunked - self.body = self.build(parts, chunked) -} - -exports.Multipart = Multipart - +module.exports = {"$id":"pageTimings.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","properties":{"onContentLoad":{"type":"number","min":-1},"onLoad":{"type":"number","min":-1},"comment":{"type":"string"}}}; /***/ }), @@ -6654,7 +3119,7 @@ module.exports = require("querystring"); /***/ }), -/***/ 199: +/***/ 196: /***/ (function(module, __unusedexports, __webpack_require__) { (function(nacl) { @@ -9061,3806 +5526,108 @@ module.exports = require("https"); module.exports = require("punycode"); -/***/ }), - -/***/ 214: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2011 Mark Cavage All rights reserved. - -// If you have no idea what ASN.1 or BER is, see this: -// ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc - -var Ber = __webpack_require__(482); - - - -// --- Exported API - -module.exports = { - - Ber: Ber, - - BerReader: Ber.Reader, - - BerWriter: Ber.Writer - -}; - - /***/ }), /***/ 215: -/***/ (function(__unusedmodule, exports, __webpack_require__) { +/***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; +/* eslint-disable node/no-deprecated-api */ -Object.defineProperty(exports, "__esModule", { value: true }); -const os = __webpack_require__(87); -/** - * Commands - * - * Command Format: - * ##[name key=value;key=value]message - * - * Examples: - * ##[warning]This is the user warning message - * ##[set-secret name=mypassword]definitelyNotAPassword! - */ -function issueCommand(command, properties, message) { - const cmd = new Command(command, properties, message); - process.stdout.write(cmd.toString() + os.EOL); + + +var buffer = __webpack_require__(293) +var Buffer = buffer.Buffer + +var safer = {} + +var key + +for (key in buffer) { + if (!buffer.hasOwnProperty(key)) continue + if (key === 'SlowBuffer' || key === 'Buffer') continue + safer[key] = buffer[key] } -exports.issueCommand = issueCommand; -function issue(name, message = '') { - issueCommand(name, {}, message); + +var Safer = safer.Buffer = {} +for (key in Buffer) { + if (!Buffer.hasOwnProperty(key)) continue + if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue + Safer[key] = Buffer[key] } -exports.issue = issue; -const CMD_STRING = '::'; -class Command { - constructor(command, properties, message) { - if (!command) { - command = 'missing.command'; - } - this.command = command; - this.properties = properties; - this.message = message; + +safer.Buffer.prototype = Buffer.prototype + +if (!Safer.from || Safer.from === Uint8Array.from) { + Safer.from = function (value, encodingOrOffset, length) { + if (typeof value === 'number') { + throw new TypeError('The "value" argument must not be of type number. Received type ' + typeof value) } - toString() { - let cmdStr = CMD_STRING + this.command; - if (this.properties && Object.keys(this.properties).length > 0) { - cmdStr += ' '; - for (const key in this.properties) { - if (this.properties.hasOwnProperty(key)) { - const val = this.properties[key]; - if (val) { - // safely append the val - avoid blowing up when attempting to - // call .replace() if message is not a string for some reason - cmdStr += `${key}=${escape(`${val || ''}`)},`; - } - } - } - } - cmdStr += CMD_STRING; - // safely append the message - avoid blowing up when attempting to - // call .replace() if message is not a string for some reason - const message = `${this.message || ''}`; - cmdStr += escapeData(message); - return cmdStr; + if (value && typeof value.length === 'undefined') { + throw new TypeError('The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + typeof value) } + return Buffer(value, encodingOrOffset, length) + } } -function escapeData(s) { - return s.replace(/\r/g, '%0D').replace(/\n/g, '%0A'); + +if (!Safer.alloc) { + Safer.alloc = function (size, fill, encoding) { + if (typeof size !== 'number') { + throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size) + } + if (size < 0 || size >= 2 * (1 << 30)) { + throw new RangeError('The value "' + size + '" is invalid for option "size"') + } + var buf = Buffer(size) + if (!fill || fill.length === 0) { + buf.fill(0) + } else if (typeof encoding === 'string') { + buf.fill(fill, encoding) + } else { + buf.fill(fill) + } + return buf + } } -function escape(s) { - return s - .replace(/\r/g, '%0D') - .replace(/\n/g, '%0A') - .replace(/]/g, '%5D') - .replace(/;/g, '%3B'); + +if (!safer.kStringMaxLength) { + try { + safer.kStringMaxLength = process.binding('buffer').kStringMaxLength + } catch (e) { + // we can't determine kStringMaxLength in environments where process.binding + // is unsupported, so let's not set it + } } -//# sourceMappingURL=command.js.map + +if (!safer.constants) { + safer.constants = { + MAX_LENGTH: safer.kMaxLength + } + if (safer.kStringMaxLength) { + safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength + } +} + +module.exports = safer + /***/ }), -/***/ 219: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2016 Joyent, Inc. - -module.exports = Certificate; - -var assert = __webpack_require__(283); -var Buffer = __webpack_require__(375).Buffer; -var algs = __webpack_require__(936); -var crypto = __webpack_require__(417); -var Fingerprint = __webpack_require__(658); -var Signature = __webpack_require__(719); -var errs = __webpack_require__(266); -var util = __webpack_require__(669); -var utils = __webpack_require__(757); -var Key = __webpack_require__(820); -var PrivateKey = __webpack_require__(463); -var Identity = __webpack_require__(905); - -var formats = {}; -formats['openssh'] = __webpack_require__(264); -formats['x509'] = __webpack_require__(327); -formats['pem'] = __webpack_require__(444); - -var CertificateParseError = errs.CertificateParseError; -var InvalidAlgorithmError = errs.InvalidAlgorithmError; - -function Certificate(opts) { - assert.object(opts, 'options'); - assert.arrayOfObject(opts.subjects, 'options.subjects'); - utils.assertCompatible(opts.subjects[0], Identity, [1, 0], - 'options.subjects'); - utils.assertCompatible(opts.subjectKey, Key, [1, 0], - 'options.subjectKey'); - utils.assertCompatible(opts.issuer, Identity, [1, 0], 'options.issuer'); - if (opts.issuerKey !== undefined) { - utils.assertCompatible(opts.issuerKey, Key, [1, 0], - 'options.issuerKey'); - } - assert.object(opts.signatures, 'options.signatures'); - assert.buffer(opts.serial, 'options.serial'); - assert.date(opts.validFrom, 'options.validFrom'); - assert.date(opts.validUntil, 'optons.validUntil'); - - assert.optionalArrayOfString(opts.purposes, 'options.purposes'); - - this._hashCache = {}; - - this.subjects = opts.subjects; - this.issuer = opts.issuer; - this.subjectKey = opts.subjectKey; - this.issuerKey = opts.issuerKey; - this.signatures = opts.signatures; - this.serial = opts.serial; - this.validFrom = opts.validFrom; - this.validUntil = opts.validUntil; - this.purposes = opts.purposes; -} - -Certificate.formats = formats; - -Certificate.prototype.toBuffer = function (format, options) { - if (format === undefined) - format = 'x509'; - assert.string(format, 'format'); - assert.object(formats[format], 'formats[format]'); - assert.optionalObject(options, 'options'); - - return (formats[format].write(this, options)); -}; - -Certificate.prototype.toString = function (format, options) { - if (format === undefined) - format = 'pem'; - return (this.toBuffer(format, options).toString()); -}; - -Certificate.prototype.fingerprint = function (algo) { - if (algo === undefined) - algo = 'sha256'; - assert.string(algo, 'algorithm'); - var opts = { - type: 'certificate', - hash: this.hash(algo), - algorithm: algo - }; - return (new Fingerprint(opts)); -}; - -Certificate.prototype.hash = function (algo) { - assert.string(algo, 'algorithm'); - algo = algo.toLowerCase(); - if (algs.hashAlgs[algo] === undefined) - throw (new InvalidAlgorithmError(algo)); - - if (this._hashCache[algo]) - return (this._hashCache[algo]); - - var hash = crypto.createHash(algo). - update(this.toBuffer('x509')).digest(); - this._hashCache[algo] = hash; - return (hash); -}; - -Certificate.prototype.isExpired = function (when) { - if (when === undefined) - when = new Date(); - return (!((when.getTime() >= this.validFrom.getTime()) && - (when.getTime() < this.validUntil.getTime()))); -}; - -Certificate.prototype.isSignedBy = function (issuerCert) { - utils.assertCompatible(issuerCert, Certificate, [1, 0], 'issuer'); - - if (!this.issuer.equals(issuerCert.subjects[0])) - return (false); - if (this.issuer.purposes && this.issuer.purposes.length > 0 && - this.issuer.purposes.indexOf('ca') === -1) { - return (false); - } - - return (this.isSignedByKey(issuerCert.subjectKey)); -}; - -Certificate.prototype.getExtension = function (keyOrOid) { - assert.string(keyOrOid, 'keyOrOid'); - var ext = this.getExtensions().filter(function (maybeExt) { - if (maybeExt.format === 'x509') - return (maybeExt.oid === keyOrOid); - if (maybeExt.format === 'openssh') - return (maybeExt.name === keyOrOid); - return (false); - })[0]; - return (ext); -}; - -Certificate.prototype.getExtensions = function () { - var exts = []; - var x509 = this.signatures.x509; - if (x509 && x509.extras && x509.extras.exts) { - x509.extras.exts.forEach(function (ext) { - ext.format = 'x509'; - exts.push(ext); - }); - } - var openssh = this.signatures.openssh; - if (openssh && openssh.exts) { - openssh.exts.forEach(function (ext) { - ext.format = 'openssh'; - exts.push(ext); - }); - } - return (exts); -}; - -Certificate.prototype.isSignedByKey = function (issuerKey) { - utils.assertCompatible(issuerKey, Key, [1, 2], 'issuerKey'); - - if (this.issuerKey !== undefined) { - return (this.issuerKey. - fingerprint('sha512').matches(issuerKey)); - } - - var fmt = Object.keys(this.signatures)[0]; - var valid = formats[fmt].verify(this, issuerKey); - if (valid) - this.issuerKey = issuerKey; - return (valid); -}; - -Certificate.prototype.signWith = function (key) { - utils.assertCompatible(key, PrivateKey, [1, 2], 'key'); - var fmts = Object.keys(formats); - var didOne = false; - for (var i = 0; i < fmts.length; ++i) { - if (fmts[i] !== 'pem') { - var ret = formats[fmts[i]].sign(this, key); - if (ret === true) - didOne = true; - } - } - if (!didOne) { - throw (new Error('Failed to sign the certificate for any ' + - 'available certificate formats')); - } -}; - -Certificate.createSelfSigned = function (subjectOrSubjects, key, options) { - var subjects; - if (Array.isArray(subjectOrSubjects)) - subjects = subjectOrSubjects; - else - subjects = [subjectOrSubjects]; - - assert.arrayOfObject(subjects); - subjects.forEach(function (subject) { - utils.assertCompatible(subject, Identity, [1, 0], 'subject'); - }); - - utils.assertCompatible(key, PrivateKey, [1, 2], 'private key'); - - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalObject(options.validFrom, 'options.validFrom'); - assert.optionalObject(options.validUntil, 'options.validUntil'); - var validFrom = options.validFrom; - var validUntil = options.validUntil; - if (validFrom === undefined) - validFrom = new Date(); - if (validUntil === undefined) { - assert.optionalNumber(options.lifetime, 'options.lifetime'); - var lifetime = options.lifetime; - if (lifetime === undefined) - lifetime = 10*365*24*3600; - validUntil = new Date(); - validUntil.setTime(validUntil.getTime() + lifetime*1000); - } - assert.optionalBuffer(options.serial, 'options.serial'); - var serial = options.serial; - if (serial === undefined) - serial = Buffer.from('0000000000000001', 'hex'); - - var purposes = options.purposes; - if (purposes === undefined) - purposes = []; - - if (purposes.indexOf('signature') === -1) - purposes.push('signature'); - - /* Self-signed certs are always CAs. */ - if (purposes.indexOf('ca') === -1) - purposes.push('ca'); - if (purposes.indexOf('crl') === -1) - purposes.push('crl'); - - /* - * If we weren't explicitly given any other purposes, do the sensible - * thing and add some basic ones depending on the subject type. - */ - if (purposes.length <= 3) { - var hostSubjects = subjects.filter(function (subject) { - return (subject.type === 'host'); - }); - var userSubjects = subjects.filter(function (subject) { - return (subject.type === 'user'); - }); - if (hostSubjects.length > 0) { - if (purposes.indexOf('serverAuth') === -1) - purposes.push('serverAuth'); - } - if (userSubjects.length > 0) { - if (purposes.indexOf('clientAuth') === -1) - purposes.push('clientAuth'); - } - if (userSubjects.length > 0 || hostSubjects.length > 0) { - if (purposes.indexOf('keyAgreement') === -1) - purposes.push('keyAgreement'); - if (key.type === 'rsa' && - purposes.indexOf('encryption') === -1) - purposes.push('encryption'); - } - } - - var cert = new Certificate({ - subjects: subjects, - issuer: subjects[0], - subjectKey: key.toPublic(), - issuerKey: key.toPublic(), - signatures: {}, - serial: serial, - validFrom: validFrom, - validUntil: validUntil, - purposes: purposes - }); - cert.signWith(key); - - return (cert); -}; - -Certificate.create = - function (subjectOrSubjects, key, issuer, issuerKey, options) { - var subjects; - if (Array.isArray(subjectOrSubjects)) - subjects = subjectOrSubjects; - else - subjects = [subjectOrSubjects]; - - assert.arrayOfObject(subjects); - subjects.forEach(function (subject) { - utils.assertCompatible(subject, Identity, [1, 0], 'subject'); - }); - - utils.assertCompatible(key, Key, [1, 0], 'key'); - if (PrivateKey.isPrivateKey(key)) - key = key.toPublic(); - utils.assertCompatible(issuer, Identity, [1, 0], 'issuer'); - utils.assertCompatible(issuerKey, PrivateKey, [1, 2], 'issuer key'); - - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalObject(options.validFrom, 'options.validFrom'); - assert.optionalObject(options.validUntil, 'options.validUntil'); - var validFrom = options.validFrom; - var validUntil = options.validUntil; - if (validFrom === undefined) - validFrom = new Date(); - if (validUntil === undefined) { - assert.optionalNumber(options.lifetime, 'options.lifetime'); - var lifetime = options.lifetime; - if (lifetime === undefined) - lifetime = 10*365*24*3600; - validUntil = new Date(); - validUntil.setTime(validUntil.getTime() + lifetime*1000); - } - assert.optionalBuffer(options.serial, 'options.serial'); - var serial = options.serial; - if (serial === undefined) - serial = Buffer.from('0000000000000001', 'hex'); - - var purposes = options.purposes; - if (purposes === undefined) - purposes = []; - - if (purposes.indexOf('signature') === -1) - purposes.push('signature'); - - if (options.ca === true) { - if (purposes.indexOf('ca') === -1) - purposes.push('ca'); - if (purposes.indexOf('crl') === -1) - purposes.push('crl'); - } - - var hostSubjects = subjects.filter(function (subject) { - return (subject.type === 'host'); - }); - var userSubjects = subjects.filter(function (subject) { - return (subject.type === 'user'); - }); - if (hostSubjects.length > 0) { - if (purposes.indexOf('serverAuth') === -1) - purposes.push('serverAuth'); - } - if (userSubjects.length > 0) { - if (purposes.indexOf('clientAuth') === -1) - purposes.push('clientAuth'); - } - if (userSubjects.length > 0 || hostSubjects.length > 0) { - if (purposes.indexOf('keyAgreement') === -1) - purposes.push('keyAgreement'); - if (key.type === 'rsa' && - purposes.indexOf('encryption') === -1) - purposes.push('encryption'); - } - - var cert = new Certificate({ - subjects: subjects, - issuer: issuer, - subjectKey: key, - issuerKey: issuerKey.toPublic(), - signatures: {}, - serial: serial, - validFrom: validFrom, - validUntil: validUntil, - purposes: purposes - }); - cert.signWith(issuerKey); - - return (cert); -}; - -Certificate.parse = function (data, format, options) { - if (typeof (data) !== 'string') - assert.buffer(data, 'data'); - if (format === undefined) - format = 'auto'; - assert.string(format, 'format'); - if (typeof (options) === 'string') - options = { filename: options }; - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalString(options.filename, 'options.filename'); - if (options.filename === undefined) - options.filename = '(unnamed)'; - - assert.object(formats[format], 'formats[format]'); - - try { - var k = formats[format].read(data, options); - return (k); - } catch (e) { - throw (new CertificateParseError(options.filename, format, e)); - } -}; - -Certificate.isCertificate = function (obj, ver) { - return (utils.isCompatible(obj, Certificate, ver)); -}; - -/* - * API versions for Certificate: - * [1,0] -- initial ver - * [1,1] -- openssh format now unpacks extensions - */ -Certificate.prototype._sshpkApiVersion = [1, 1]; - -Certificate._oldVersionDetect = function (obj) { - return ([1, 0]); -}; +/***/ 222: +/***/ (function(module) { +module.exports = {"$id":"browser.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","version"],"properties":{"name":{"type":"string"},"version":{"type":"string"},"comment":{"type":"string"}}}; /***/ }), /***/ 226: /***/ (function(module) { -"use strict"; - -module.exports = function generate_allOf(it, $keyword, $ruleType) { - var out = ' '; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - var $currentBaseId = $it.baseId, - $allSchemasEmpty = true; - var arr1 = $schema; - if (arr1) { - var $sch, $i = -1, - l1 = arr1.length - 1; - while ($i < l1) { - $sch = arr1[$i += 1]; - if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { - $allSchemasEmpty = false; - $it.schema = $sch; - $it.schemaPath = $schemaPath + '[' + $i + ']'; - $it.errSchemaPath = $errSchemaPath + '/' + $i; - out += ' ' + (it.validate($it)) + ' '; - $it.baseId = $currentBaseId; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; - } - } - } - } - if ($breakOnError) { - if ($allSchemasEmpty) { - out += ' if (true) { '; - } else { - out += ' ' + ($closingBraces.slice(0, -1)) + ' '; - } - } - out = it.util.cleanUpCode(out); - return out; -} - +module.exports = {"$id":"response.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["status","statusText","httpVersion","cookies","headers","content","redirectURL","headersSize","bodySize"],"properties":{"status":{"type":"integer"},"statusText":{"type":"string"},"httpVersion":{"type":"string"},"cookies":{"type":"array","items":{"$ref":"cookie.json#"}},"headers":{"type":"array","items":{"$ref":"header.json#"}},"content":{"$ref":"content.json#"},"redirectURL":{"type":"string"},"headersSize":{"type":"integer"},"bodySize":{"type":"integer"},"comment":{"type":"string"}}}; /***/ }), -/***/ 235: -/***/ (function(module, __unusedexports, __webpack_require__) { - -var iterate = __webpack_require__(82) - , initState = __webpack_require__(947) - , terminator = __webpack_require__(725) - ; - -// Public API -module.exports = serialOrdered; -// sorting helpers -module.exports.ascending = ascending; -module.exports.descending = descending; - -/** - * Runs iterator over provided sorted array elements in series - * - * @param {array|object} list - array or object (named list) to iterate over - * @param {function} iterator - iterator to run - * @param {function} sortMethod - custom sort function - * @param {function} callback - invoked when all elements processed - * @returns {function} - jobs terminator - */ -function serialOrdered(list, iterator, sortMethod, callback) -{ - var state = initState(list, sortMethod); - - iterate(list, iterator, state, function iteratorHandler(error, result) - { - if (error) - { - callback(error, result); - return; - } - - state.index++; - - // are we there yet? - if (state.index < (state['keyedList'] || list).length) - { - iterate(list, iterator, state, iteratorHandler); - return; - } - - // done here - callback(null, state.results); - }); - - return terminator.bind(state, callback); -} - -/* - * -- Sort methods - */ - -/** - * sort helper to sort array elements in ascending order - * - * @param {mixed} a - an item to compare - * @param {mixed} b - an item to compare - * @returns {number} - comparison result - */ -function ascending(a, b) -{ - return a < b ? -1 : a > b ? 1 : 0; -} - -/** - * sort helper to sort array elements in descending order - * - * @param {mixed} a - an item to compare - * @param {mixed} b - an item to compare - * @returns {number} - comparison result - */ -function descending(a, b) -{ - return -1 * ascending(a, b); -} - - -/***/ }), - -/***/ 252: -/***/ (function(module) { - -module.exports = {"$id":"pageTimings.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","properties":{"onContentLoad":{"type":"number","min":-1},"onLoad":{"type":"number","min":-1},"comment":{"type":"string"}}}; - -/***/ }), - -/***/ 264: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. - -module.exports = { - read: read, - verify: verify, - sign: sign, - signAsync: signAsync, - write: write, - - /* Internal private API */ - fromBuffer: fromBuffer, - toBuffer: toBuffer -}; - -var assert = __webpack_require__(283); -var SSHBuffer = __webpack_require__(907); -var crypto = __webpack_require__(417); -var Buffer = __webpack_require__(375).Buffer; -var algs = __webpack_require__(936); -var Key = __webpack_require__(820); -var PrivateKey = __webpack_require__(463); -var Identity = __webpack_require__(905); -var rfc4253 = __webpack_require__(533); -var Signature = __webpack_require__(719); -var utils = __webpack_require__(757); -var Certificate = __webpack_require__(219); - -function verify(cert, key) { - /* - * We always give an issuerKey, so if our verify() is being called then - * there was no signature. Return false. - */ - return (false); -} - -var TYPES = { - 'user': 1, - 'host': 2 -}; -Object.keys(TYPES).forEach(function (k) { TYPES[TYPES[k]] = k; }); - -var ECDSA_ALGO = /^ecdsa-sha2-([^@-]+)-cert-v01@openssh.com$/; - -function read(buf, options) { - if (Buffer.isBuffer(buf)) - buf = buf.toString('ascii'); - var parts = buf.trim().split(/[ \t\n]+/g); - if (parts.length < 2 || parts.length > 3) - throw (new Error('Not a valid SSH certificate line')); - - var algo = parts[0]; - var data = parts[1]; - - data = Buffer.from(data, 'base64'); - return (fromBuffer(data, algo)); -} - -function fromBuffer(data, algo, partial) { - var sshbuf = new SSHBuffer({ buffer: data }); - var innerAlgo = sshbuf.readString(); - if (algo !== undefined && innerAlgo !== algo) - throw (new Error('SSH certificate algorithm mismatch')); - if (algo === undefined) - algo = innerAlgo; - - var cert = {}; - cert.signatures = {}; - cert.signatures.openssh = {}; - - cert.signatures.openssh.nonce = sshbuf.readBuffer(); - - var key = {}; - var parts = (key.parts = []); - key.type = getAlg(algo); - - var partCount = algs.info[key.type].parts.length; - while (parts.length < partCount) - parts.push(sshbuf.readPart()); - assert.ok(parts.length >= 1, 'key must have at least one part'); - - var algInfo = algs.info[key.type]; - if (key.type === 'ecdsa') { - var res = ECDSA_ALGO.exec(algo); - assert.ok(res !== null); - assert.strictEqual(res[1], parts[0].data.toString()); - } - - for (var i = 0; i < algInfo.parts.length; ++i) { - parts[i].name = algInfo.parts[i]; - if (parts[i].name !== 'curve' && - algInfo.normalize !== false) { - var p = parts[i]; - p.data = utils.mpNormalize(p.data); - } - } - - cert.subjectKey = new Key(key); - - cert.serial = sshbuf.readInt64(); - - var type = TYPES[sshbuf.readInt()]; - assert.string(type, 'valid cert type'); - - cert.signatures.openssh.keyId = sshbuf.readString(); - - var principals = []; - var pbuf = sshbuf.readBuffer(); - var psshbuf = new SSHBuffer({ buffer: pbuf }); - while (!psshbuf.atEnd()) - principals.push(psshbuf.readString()); - if (principals.length === 0) - principals = ['*']; - - cert.subjects = principals.map(function (pr) { - if (type === 'user') - return (Identity.forUser(pr)); - else if (type === 'host') - return (Identity.forHost(pr)); - throw (new Error('Unknown identity type ' + type)); - }); - - cert.validFrom = int64ToDate(sshbuf.readInt64()); - cert.validUntil = int64ToDate(sshbuf.readInt64()); - - var exts = []; - var extbuf = new SSHBuffer({ buffer: sshbuf.readBuffer() }); - var ext; - while (!extbuf.atEnd()) { - ext = { critical: true }; - ext.name = extbuf.readString(); - ext.data = extbuf.readBuffer(); - exts.push(ext); - } - extbuf = new SSHBuffer({ buffer: sshbuf.readBuffer() }); - while (!extbuf.atEnd()) { - ext = { critical: false }; - ext.name = extbuf.readString(); - ext.data = extbuf.readBuffer(); - exts.push(ext); - } - cert.signatures.openssh.exts = exts; - - /* reserved */ - sshbuf.readBuffer(); - - var signingKeyBuf = sshbuf.readBuffer(); - cert.issuerKey = rfc4253.read(signingKeyBuf); - - /* - * OpenSSH certs don't give the identity of the issuer, just their - * public key. So, we use an Identity that matches anything. The - * isSignedBy() function will later tell you if the key matches. - */ - cert.issuer = Identity.forHost('**'); - - var sigBuf = sshbuf.readBuffer(); - cert.signatures.openssh.signature = - Signature.parse(sigBuf, cert.issuerKey.type, 'ssh'); - - if (partial !== undefined) { - partial.remainder = sshbuf.remainder(); - partial.consumed = sshbuf._offset; - } - - return (new Certificate(cert)); -} - -function int64ToDate(buf) { - var i = buf.readUInt32BE(0) * 4294967296; - i += buf.readUInt32BE(4); - var d = new Date(); - d.setTime(i * 1000); - d.sourceInt64 = buf; - return (d); -} - -function dateToInt64(date) { - if (date.sourceInt64 !== undefined) - return (date.sourceInt64); - var i = Math.round(date.getTime() / 1000); - var upper = Math.floor(i / 4294967296); - var lower = Math.floor(i % 4294967296); - var buf = Buffer.alloc(8); - buf.writeUInt32BE(upper, 0); - buf.writeUInt32BE(lower, 4); - return (buf); -} - -function sign(cert, key) { - if (cert.signatures.openssh === undefined) - cert.signatures.openssh = {}; - try { - var blob = toBuffer(cert, true); - } catch (e) { - delete (cert.signatures.openssh); - return (false); - } - var sig = cert.signatures.openssh; - var hashAlgo = undefined; - if (key.type === 'rsa' || key.type === 'dsa') - hashAlgo = 'sha1'; - var signer = key.createSign(hashAlgo); - signer.write(blob); - sig.signature = signer.sign(); - return (true); -} - -function signAsync(cert, signer, done) { - if (cert.signatures.openssh === undefined) - cert.signatures.openssh = {}; - try { - var blob = toBuffer(cert, true); - } catch (e) { - delete (cert.signatures.openssh); - done(e); - return; - } - var sig = cert.signatures.openssh; - - signer(blob, function (err, signature) { - if (err) { - done(err); - return; - } - try { - /* - * This will throw if the signature isn't of a - * type/algo that can be used for SSH. - */ - signature.toBuffer('ssh'); - } catch (e) { - done(e); - return; - } - sig.signature = signature; - done(); - }); -} - -function write(cert, options) { - if (options === undefined) - options = {}; - - var blob = toBuffer(cert); - var out = getCertType(cert.subjectKey) + ' ' + blob.toString('base64'); - if (options.comment) - out = out + ' ' + options.comment; - return (out); -} - - -function toBuffer(cert, noSig) { - assert.object(cert.signatures.openssh, 'signature for openssh format'); - var sig = cert.signatures.openssh; - - if (sig.nonce === undefined) - sig.nonce = crypto.randomBytes(16); - var buf = new SSHBuffer({}); - buf.writeString(getCertType(cert.subjectKey)); - buf.writeBuffer(sig.nonce); - - var key = cert.subjectKey; - var algInfo = algs.info[key.type]; - algInfo.parts.forEach(function (part) { - buf.writePart(key.part[part]); - }); - - buf.writeInt64(cert.serial); - - var type = cert.subjects[0].type; - assert.notStrictEqual(type, 'unknown'); - cert.subjects.forEach(function (id) { - assert.strictEqual(id.type, type); - }); - type = TYPES[type]; - buf.writeInt(type); - - if (sig.keyId === undefined) { - sig.keyId = cert.subjects[0].type + '_' + - (cert.subjects[0].uid || cert.subjects[0].hostname); - } - buf.writeString(sig.keyId); - - var sub = new SSHBuffer({}); - cert.subjects.forEach(function (id) { - if (type === TYPES.host) - sub.writeString(id.hostname); - else if (type === TYPES.user) - sub.writeString(id.uid); - }); - buf.writeBuffer(sub.toBuffer()); - - buf.writeInt64(dateToInt64(cert.validFrom)); - buf.writeInt64(dateToInt64(cert.validUntil)); - - var exts = sig.exts; - if (exts === undefined) - exts = []; - - var extbuf = new SSHBuffer({}); - exts.forEach(function (ext) { - if (ext.critical !== true) - return; - extbuf.writeString(ext.name); - extbuf.writeBuffer(ext.data); - }); - buf.writeBuffer(extbuf.toBuffer()); - - extbuf = new SSHBuffer({}); - exts.forEach(function (ext) { - if (ext.critical === true) - return; - extbuf.writeString(ext.name); - extbuf.writeBuffer(ext.data); - }); - buf.writeBuffer(extbuf.toBuffer()); - - /* reserved */ - buf.writeBuffer(Buffer.alloc(0)); - - sub = rfc4253.write(cert.issuerKey); - buf.writeBuffer(sub); - - if (!noSig) - buf.writeBuffer(sig.signature.toBuffer('ssh')); - - return (buf.toBuffer()); -} - -function getAlg(certType) { - if (certType === 'ssh-rsa-cert-v01@openssh.com') - return ('rsa'); - if (certType === 'ssh-dss-cert-v01@openssh.com') - return ('dsa'); - if (certType.match(ECDSA_ALGO)) - return ('ecdsa'); - if (certType === 'ssh-ed25519-cert-v01@openssh.com') - return ('ed25519'); - throw (new Error('Unsupported cert type ' + certType)); -} - -function getCertType(key) { - if (key.type === 'rsa') - return ('ssh-rsa-cert-v01@openssh.com'); - if (key.type === 'dsa') - return ('ssh-dss-cert-v01@openssh.com'); - if (key.type === 'ecdsa') - return ('ecdsa-sha2-' + key.curve + '-cert-v01@openssh.com'); - if (key.type === 'ed25519') - return ('ssh-ed25519-cert-v01@openssh.com'); - throw (new Error('Unsupported key type ' + key.type)); -} - - -/***/ }), - -/***/ 266: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -var assert = __webpack_require__(283); -var util = __webpack_require__(669); - -function FingerprintFormatError(fp, format) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, FingerprintFormatError); - this.name = 'FingerprintFormatError'; - this.fingerprint = fp; - this.format = format; - this.message = 'Fingerprint format is not supported, or is invalid: '; - if (fp !== undefined) - this.message += ' fingerprint = ' + fp; - if (format !== undefined) - this.message += ' format = ' + format; -} -util.inherits(FingerprintFormatError, Error); - -function InvalidAlgorithmError(alg) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, InvalidAlgorithmError); - this.name = 'InvalidAlgorithmError'; - this.algorithm = alg; - this.message = 'Algorithm "' + alg + '" is not supported'; -} -util.inherits(InvalidAlgorithmError, Error); - -function KeyParseError(name, format, innerErr) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, KeyParseError); - this.name = 'KeyParseError'; - this.format = format; - this.keyName = name; - this.innerErr = innerErr; - this.message = 'Failed to parse ' + name + ' as a valid ' + format + - ' format key: ' + innerErr.message; -} -util.inherits(KeyParseError, Error); - -function SignatureParseError(type, format, innerErr) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, SignatureParseError); - this.name = 'SignatureParseError'; - this.type = type; - this.format = format; - this.innerErr = innerErr; - this.message = 'Failed to parse the given data as a ' + type + - ' signature in ' + format + ' format: ' + innerErr.message; -} -util.inherits(SignatureParseError, Error); - -function CertificateParseError(name, format, innerErr) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, CertificateParseError); - this.name = 'CertificateParseError'; - this.format = format; - this.certName = name; - this.innerErr = innerErr; - this.message = 'Failed to parse ' + name + ' as a valid ' + format + - ' format certificate: ' + innerErr.message; -} -util.inherits(CertificateParseError, Error); - -function KeyEncryptedError(name, format) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, KeyEncryptedError); - this.name = 'KeyEncryptedError'; - this.format = format; - this.keyName = name; - this.message = 'The ' + format + ' format key ' + name + ' is ' + - 'encrypted (password-protected), and no passphrase was ' + - 'provided in `options`'; -} -util.inherits(KeyEncryptedError, Error); - -module.exports = { - FingerprintFormatError: FingerprintFormatError, - InvalidAlgorithmError: InvalidAlgorithmError, - KeyParseError: KeyParseError, - SignatureParseError: SignatureParseError, - KeyEncryptedError: KeyEncryptedError, - CertificateParseError: CertificateParseError -}; - - -/***/ }), - -/***/ 269: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = { - read: read, - readSSHPrivate: readSSHPrivate, - write: write -}; - -var assert = __webpack_require__(283); -var asn1 = __webpack_require__(214); -var Buffer = __webpack_require__(375).Buffer; -var algs = __webpack_require__(936); -var utils = __webpack_require__(757); -var crypto = __webpack_require__(417); - -var Key = __webpack_require__(820); -var PrivateKey = __webpack_require__(463); -var pem = __webpack_require__(502); -var rfc4253 = __webpack_require__(533); -var SSHBuffer = __webpack_require__(907); -var errors = __webpack_require__(266); - -var bcrypt; - -function read(buf, options) { - return (pem.read(buf, options)); -} - -var MAGIC = 'openssh-key-v1'; - -function readSSHPrivate(type, buf, options) { - buf = new SSHBuffer({buffer: buf}); - - var magic = buf.readCString(); - assert.strictEqual(magic, MAGIC, 'bad magic string'); - - var cipher = buf.readString(); - var kdf = buf.readString(); - var kdfOpts = buf.readBuffer(); - - var nkeys = buf.readInt(); - if (nkeys !== 1) { - throw (new Error('OpenSSH-format key file contains ' + - 'multiple keys: this is unsupported.')); - } - - var pubKey = buf.readBuffer(); - - if (type === 'public') { - assert.ok(buf.atEnd(), 'excess bytes left after key'); - return (rfc4253.read(pubKey)); - } - - var privKeyBlob = buf.readBuffer(); - assert.ok(buf.atEnd(), 'excess bytes left after key'); - - var kdfOptsBuf = new SSHBuffer({ buffer: kdfOpts }); - switch (kdf) { - case 'none': - if (cipher !== 'none') { - throw (new Error('OpenSSH-format key uses KDF "none" ' + - 'but specifies a cipher other than "none"')); - } - break; - case 'bcrypt': - var salt = kdfOptsBuf.readBuffer(); - var rounds = kdfOptsBuf.readInt(); - var cinf = utils.opensshCipherInfo(cipher); - if (bcrypt === undefined) { - bcrypt = __webpack_require__(141); - } - - if (typeof (options.passphrase) === 'string') { - options.passphrase = Buffer.from(options.passphrase, - 'utf-8'); - } - if (!Buffer.isBuffer(options.passphrase)) { - throw (new errors.KeyEncryptedError( - options.filename, 'OpenSSH')); - } - - var pass = new Uint8Array(options.passphrase); - var salti = new Uint8Array(salt); - /* Use the pbkdf to derive both the key and the IV. */ - var out = new Uint8Array(cinf.keySize + cinf.blockSize); - var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, - out, out.length, rounds); - if (res !== 0) { - throw (new Error('bcrypt_pbkdf function returned ' + - 'failure, parameters invalid')); - } - out = Buffer.from(out); - var ckey = out.slice(0, cinf.keySize); - var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); - var cipherStream = crypto.createDecipheriv(cinf.opensslName, - ckey, iv); - cipherStream.setAutoPadding(false); - var chunk, chunks = []; - cipherStream.once('error', function (e) { - if (e.toString().indexOf('bad decrypt') !== -1) { - throw (new Error('Incorrect passphrase ' + - 'supplied, could not decrypt key')); - } - throw (e); - }); - cipherStream.write(privKeyBlob); - cipherStream.end(); - while ((chunk = cipherStream.read()) !== null) - chunks.push(chunk); - privKeyBlob = Buffer.concat(chunks); - break; - default: - throw (new Error( - 'OpenSSH-format key uses unknown KDF "' + kdf + '"')); - } - - buf = new SSHBuffer({buffer: privKeyBlob}); - - var checkInt1 = buf.readInt(); - var checkInt2 = buf.readInt(); - if (checkInt1 !== checkInt2) { - throw (new Error('Incorrect passphrase supplied, could not ' + - 'decrypt key')); - } - - var ret = {}; - var key = rfc4253.readInternal(ret, 'private', buf.remainder()); - - buf.skip(ret.consumed); - - var comment = buf.readString(); - key.comment = comment; - - return (key); -} - -function write(key, options) { - var pubKey; - if (PrivateKey.isPrivateKey(key)) - pubKey = key.toPublic(); - else - pubKey = key; - - var cipher = 'none'; - var kdf = 'none'; - var kdfopts = Buffer.alloc(0); - var cinf = { blockSize: 8 }; - var passphrase; - if (options !== undefined) { - passphrase = options.passphrase; - if (typeof (passphrase) === 'string') - passphrase = Buffer.from(passphrase, 'utf-8'); - if (passphrase !== undefined) { - assert.buffer(passphrase, 'options.passphrase'); - assert.optionalString(options.cipher, 'options.cipher'); - cipher = options.cipher; - if (cipher === undefined) - cipher = 'aes128-ctr'; - cinf = utils.opensshCipherInfo(cipher); - kdf = 'bcrypt'; - } - } - - var privBuf; - if (PrivateKey.isPrivateKey(key)) { - privBuf = new SSHBuffer({}); - var checkInt = crypto.randomBytes(4).readUInt32BE(0); - privBuf.writeInt(checkInt); - privBuf.writeInt(checkInt); - privBuf.write(key.toBuffer('rfc4253')); - privBuf.writeString(key.comment || ''); - - var n = 1; - while (privBuf._offset % cinf.blockSize !== 0) - privBuf.writeChar(n++); - privBuf = privBuf.toBuffer(); - } - - switch (kdf) { - case 'none': - break; - case 'bcrypt': - var salt = crypto.randomBytes(16); - var rounds = 16; - var kdfssh = new SSHBuffer({}); - kdfssh.writeBuffer(salt); - kdfssh.writeInt(rounds); - kdfopts = kdfssh.toBuffer(); - - if (bcrypt === undefined) { - bcrypt = __webpack_require__(141); - } - var pass = new Uint8Array(passphrase); - var salti = new Uint8Array(salt); - /* Use the pbkdf to derive both the key and the IV. */ - var out = new Uint8Array(cinf.keySize + cinf.blockSize); - var res = bcrypt.pbkdf(pass, pass.length, salti, salti.length, - out, out.length, rounds); - if (res !== 0) { - throw (new Error('bcrypt_pbkdf function returned ' + - 'failure, parameters invalid')); - } - out = Buffer.from(out); - var ckey = out.slice(0, cinf.keySize); - var iv = out.slice(cinf.keySize, cinf.keySize + cinf.blockSize); - - var cipherStream = crypto.createCipheriv(cinf.opensslName, - ckey, iv); - cipherStream.setAutoPadding(false); - var chunk, chunks = []; - cipherStream.once('error', function (e) { - throw (e); - }); - cipherStream.write(privBuf); - cipherStream.end(); - while ((chunk = cipherStream.read()) !== null) - chunks.push(chunk); - privBuf = Buffer.concat(chunks); - break; - default: - throw (new Error('Unsupported kdf ' + kdf)); - } - - var buf = new SSHBuffer({}); - - buf.writeCString(MAGIC); - buf.writeString(cipher); /* cipher */ - buf.writeString(kdf); /* kdf */ - buf.writeBuffer(kdfopts); /* kdfoptions */ - - buf.writeInt(1); /* nkeys */ - buf.writeBuffer(pubKey.toBuffer('rfc4253')); - - if (privBuf) - buf.writeBuffer(privBuf); - - buf = buf.toBuffer(); - - var header; - if (PrivateKey.isPrivateKey(key)) - header = 'OPENSSH PRIVATE KEY'; - else - header = 'OPENSSH PUBLIC KEY'; - - var tmp = buf.toString('base64'); - var len = tmp.length + (tmp.length / 70) + - 18 + 16 + header.length*2 + 10; - buf = Buffer.alloc(len); - var o = 0; - o += buf.write('-----BEGIN ' + header + '-----\n', o); - for (var i = 0; i < tmp.length; ) { - var limit = i + 70; - if (limit > tmp.length) - limit = tmp.length; - o += buf.write(tmp.slice(i, limit), o); - buf[o++] = 10; - i = limit; - } - o += buf.write('-----END ' + header + '-----\n', o); - - return (buf.slice(0, o)); -} - - -/***/ }), - -/***/ 272: -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_required(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - var $vSchema = 'schema' + $lvl; - if (!$isData) { - if ($schema.length < it.opts.loopRequired && it.schema.properties && Object.keys(it.schema.properties).length) { - var $required = []; - var arr1 = $schema; - if (arr1) { - var $property, i1 = -1, - l1 = arr1.length - 1; - while (i1 < l1) { - $property = arr1[i1 += 1]; - var $propertySch = it.schema.properties[$property]; - if (!($propertySch && (it.opts.strictKeywords ? typeof $propertySch == 'object' && Object.keys($propertySch).length > 0 : it.util.schemaHasRules($propertySch, it.RULES.all)))) { - $required[$required.length] = $property; - } - } - } - } else { - var $required = $schema; - } - } - if ($isData || $required.length) { - var $currentErrorPath = it.errorPath, - $loopRequired = $isData || $required.length >= it.opts.loopRequired, - $ownProperties = it.opts.ownProperties; - if ($breakOnError) { - out += ' var missing' + ($lvl) + '; '; - if ($loopRequired) { - if (!$isData) { - out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; '; - } - var $i = 'i' + $lvl, - $propertyPath = 'schema' + $lvl + '[' + $i + ']', - $missingProperty = '\' + ' + $propertyPath + ' + \''; - if (it.opts._errorDataPathProperty) { - it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers); - } - out += ' var ' + ($valid) + ' = true; '; - if ($isData) { - out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {'; - } - out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { ' + ($valid) + ' = ' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] !== undefined '; - if ($ownProperties) { - out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) '; - } - out += '; if (!' + ($valid) + ') break; } '; - if ($isData) { - out += ' } '; - } - out += ' if (!' + ($valid) + ') { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is a required property'; - } else { - out += 'should have required property \\\'' + ($missingProperty) + '\\\''; - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } else { '; - } else { - out += ' if ( '; - var arr2 = $required; - if (arr2) { - var $propertyKey, $i = -1, - l2 = arr2.length - 1; - while ($i < l2) { - $propertyKey = arr2[$i += 1]; - if ($i) { - out += ' || '; - } - var $prop = it.util.getProperty($propertyKey), - $useData = $data + $prop; - out += ' ( ( ' + ($useData) + ' === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ') && (missing' + ($lvl) + ' = ' + (it.util.toQuotedString(it.opts.jsonPointers ? $propertyKey : $prop)) + ') ) '; - } - } - out += ') { '; - var $propertyPath = 'missing' + $lvl, - $missingProperty = '\' + ' + $propertyPath + ' + \''; - if (it.opts._errorDataPathProperty) { - it.errorPath = it.opts.jsonPointers ? it.util.getPathExpr($currentErrorPath, $propertyPath, true) : $currentErrorPath + ' + ' + $propertyPath; - } - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is a required property'; - } else { - out += 'should have required property \\\'' + ($missingProperty) + '\\\''; - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } else { '; - } - } else { - if ($loopRequired) { - if (!$isData) { - out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; '; - } - var $i = 'i' + $lvl, - $propertyPath = 'schema' + $lvl + '[' + $i + ']', - $missingProperty = '\' + ' + $propertyPath + ' + \''; - if (it.opts._errorDataPathProperty) { - it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers); - } - if ($isData) { - out += ' if (' + ($vSchema) + ' && !Array.isArray(' + ($vSchema) + ')) { var err = '; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is a required property'; - } else { - out += 'should have required property \\\'' + ($missingProperty) + '\\\''; - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } else if (' + ($vSchema) + ' !== undefined) { '; - } - out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { if (' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) '; - } - out += ') { var err = '; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is a required property'; - } else { - out += 'should have required property \\\'' + ($missingProperty) + '\\\''; - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } } '; - if ($isData) { - out += ' } '; - } - } else { - var arr3 = $required; - if (arr3) { - var $propertyKey, i3 = -1, - l3 = arr3.length - 1; - while (i3 < l3) { - $propertyKey = arr3[i3 += 1]; - var $prop = it.util.getProperty($propertyKey), - $missingProperty = it.util.escapeQuotes($propertyKey), - $useData = $data + $prop; - if (it.opts._errorDataPathProperty) { - it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); - } - out += ' if ( ' + ($useData) + ' === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ') { var err = '; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is a required property'; - } else { - out += 'should have required property \\\'' + ($missingProperty) + '\\\''; - } - out += '\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } '; - } - } - } - } - it.errorPath = $currentErrorPath; - } else if ($breakOnError) { - out += ' if (true) {'; - } - return out; -} - - -/***/ }), - -/***/ 273: -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_anyOf(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - var $noEmptySchema = $schema.every(function($sch) { - return (it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all)); - }); - if ($noEmptySchema) { - var $currentBaseId = $it.baseId; - out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = false; '; - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - var arr1 = $schema; - if (arr1) { - var $sch, $i = -1, - l1 = arr1.length - 1; - while ($i < l1) { - $sch = arr1[$i += 1]; - $it.schema = $sch; - $it.schemaPath = $schemaPath + '[' + $i + ']'; - $it.errSchemaPath = $errSchemaPath + '/' + $i; - out += ' ' + (it.validate($it)) + ' '; - $it.baseId = $currentBaseId; - out += ' ' + ($valid) + ' = ' + ($valid) + ' || ' + ($nextValid) + '; if (!' + ($valid) + ') { '; - $closingBraces += '}'; - } - } - it.compositeRule = $it.compositeRule = $wasComposite; - out += ' ' + ($closingBraces) + ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('anyOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; - if (it.opts.messages !== false) { - out += ' , message: \'should match some schema in anyOf\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError(vErrors); '; - } else { - out += ' validate.errors = vErrors; return false; '; - } - } - out += ' } else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; - if (it.opts.allErrors) { - out += ' } '; - } - out = it.util.cleanUpCode(out); - } else { - if ($breakOnError) { - out += ' if (true) { '; - } - } - return out; -} - - -/***/ }), - -/***/ 274: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2018 Joyent, Inc. - -module.exports = { - read: read, - readPkcs8: readPkcs8, - write: write, - writePkcs8: writePkcs8, - pkcs8ToBuffer: pkcs8ToBuffer, - - readECDSACurve: readECDSACurve, - writeECDSACurve: writeECDSACurve -}; - -var assert = __webpack_require__(283); -var asn1 = __webpack_require__(214); -var Buffer = __webpack_require__(375).Buffer; -var algs = __webpack_require__(936); -var utils = __webpack_require__(757); -var Key = __webpack_require__(820); -var PrivateKey = __webpack_require__(463); -var pem = __webpack_require__(502); - -function read(buf, options) { - return (pem.read(buf, options, 'pkcs8')); -} - -function write(key, options) { - return (pem.write(key, options, 'pkcs8')); -} - -/* Helper to read in a single mpint */ -function readMPInt(der, nm) { - assert.strictEqual(der.peek(), asn1.Ber.Integer, - nm + ' is not an Integer'); - return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); -} - -function readPkcs8(alg, type, der) { - /* Private keys in pkcs#8 format have a weird extra int */ - if (der.peek() === asn1.Ber.Integer) { - assert.strictEqual(type, 'private', - 'unexpected Integer at start of public key'); - der.readString(asn1.Ber.Integer, true); - } - - der.readSequence(); - var next = der.offset + der.length; - - var oid = der.readOID(); - switch (oid) { - case '1.2.840.113549.1.1.1': - der._offset = next; - if (type === 'public') - return (readPkcs8RSAPublic(der)); - else - return (readPkcs8RSAPrivate(der)); - case '1.2.840.10040.4.1': - if (type === 'public') - return (readPkcs8DSAPublic(der)); - else - return (readPkcs8DSAPrivate(der)); - case '1.2.840.10045.2.1': - if (type === 'public') - return (readPkcs8ECDSAPublic(der)); - else - return (readPkcs8ECDSAPrivate(der)); - case '1.3.101.112': - if (type === 'public') { - return (readPkcs8EdDSAPublic(der)); - } else { - return (readPkcs8EdDSAPrivate(der)); - } - case '1.3.101.110': - if (type === 'public') { - return (readPkcs8X25519Public(der)); - } else { - return (readPkcs8X25519Private(der)); - } - default: - throw (new Error('Unknown key type OID ' + oid)); - } -} - -function readPkcs8RSAPublic(der) { - // bit string sequence - der.readSequence(asn1.Ber.BitString); - der.readByte(); - der.readSequence(); - - // modulus - var n = readMPInt(der, 'modulus'); - var e = readMPInt(der, 'exponent'); - - // now, make the key - var key = { - type: 'rsa', - source: der.originalInput, - parts: [ - { name: 'e', data: e }, - { name: 'n', data: n } - ] - }; - - return (new Key(key)); -} - -function readPkcs8RSAPrivate(der) { - der.readSequence(asn1.Ber.OctetString); - der.readSequence(); - - var ver = readMPInt(der, 'version'); - assert.equal(ver[0], 0x0, 'unknown RSA private key version'); - - // modulus then public exponent - var n = readMPInt(der, 'modulus'); - var e = readMPInt(der, 'public exponent'); - var d = readMPInt(der, 'private exponent'); - var p = readMPInt(der, 'prime1'); - var q = readMPInt(der, 'prime2'); - var dmodp = readMPInt(der, 'exponent1'); - var dmodq = readMPInt(der, 'exponent2'); - var iqmp = readMPInt(der, 'iqmp'); - - // now, make the key - var key = { - type: 'rsa', - parts: [ - { name: 'n', data: n }, - { name: 'e', data: e }, - { name: 'd', data: d }, - { name: 'iqmp', data: iqmp }, - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'dmodp', data: dmodp }, - { name: 'dmodq', data: dmodq } - ] - }; - - return (new PrivateKey(key)); -} - -function readPkcs8DSAPublic(der) { - der.readSequence(); - - var p = readMPInt(der, 'p'); - var q = readMPInt(der, 'q'); - var g = readMPInt(der, 'g'); - - // bit string sequence - der.readSequence(asn1.Ber.BitString); - der.readByte(); - - var y = readMPInt(der, 'y'); - - // now, make the key - var key = { - type: 'dsa', - parts: [ - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'g', data: g }, - { name: 'y', data: y } - ] - }; - - return (new Key(key)); -} - -function readPkcs8DSAPrivate(der) { - der.readSequence(); - - var p = readMPInt(der, 'p'); - var q = readMPInt(der, 'q'); - var g = readMPInt(der, 'g'); - - der.readSequence(asn1.Ber.OctetString); - var x = readMPInt(der, 'x'); - - /* The pkcs#8 format does not include the public key */ - var y = utils.calculateDSAPublic(g, p, x); - - var key = { - type: 'dsa', - parts: [ - { name: 'p', data: p }, - { name: 'q', data: q }, - { name: 'g', data: g }, - { name: 'y', data: y }, - { name: 'x', data: x } - ] - }; - - return (new PrivateKey(key)); -} - -function readECDSACurve(der) { - var curveName, curveNames; - var j, c, cd; - - if (der.peek() === asn1.Ber.OID) { - var oid = der.readOID(); - - curveNames = Object.keys(algs.curves); - for (j = 0; j < curveNames.length; ++j) { - c = curveNames[j]; - cd = algs.curves[c]; - if (cd.pkcs8oid === oid) { - curveName = c; - break; - } - } - - } else { - // ECParameters sequence - der.readSequence(); - var version = der.readString(asn1.Ber.Integer, true); - assert.strictEqual(version[0], 1, 'ECDSA key not version 1'); - - var curve = {}; - - // FieldID sequence - der.readSequence(); - var fieldTypeOid = der.readOID(); - assert.strictEqual(fieldTypeOid, '1.2.840.10045.1.1', - 'ECDSA key is not from a prime-field'); - var p = curve.p = utils.mpNormalize( - der.readString(asn1.Ber.Integer, true)); - /* - * p always starts with a 1 bit, so count the zeros to get its - * real size. - */ - curve.size = p.length * 8 - utils.countZeros(p); - - // Curve sequence - der.readSequence(); - curve.a = utils.mpNormalize( - der.readString(asn1.Ber.OctetString, true)); - curve.b = utils.mpNormalize( - der.readString(asn1.Ber.OctetString, true)); - if (der.peek() === asn1.Ber.BitString) - curve.s = der.readString(asn1.Ber.BitString, true); - - // Combined Gx and Gy - curve.G = der.readString(asn1.Ber.OctetString, true); - assert.strictEqual(curve.G[0], 0x4, - 'uncompressed G is required'); - - curve.n = utils.mpNormalize( - der.readString(asn1.Ber.Integer, true)); - curve.h = utils.mpNormalize( - der.readString(asn1.Ber.Integer, true)); - assert.strictEqual(curve.h[0], 0x1, 'a cofactor=1 curve is ' + - 'required'); - - curveNames = Object.keys(algs.curves); - var ks = Object.keys(curve); - for (j = 0; j < curveNames.length; ++j) { - c = curveNames[j]; - cd = algs.curves[c]; - var equal = true; - for (var i = 0; i < ks.length; ++i) { - var k = ks[i]; - if (cd[k] === undefined) - continue; - if (typeof (cd[k]) === 'object' && - cd[k].equals !== undefined) { - if (!cd[k].equals(curve[k])) { - equal = false; - break; - } - } else if (Buffer.isBuffer(cd[k])) { - if (cd[k].toString('binary') - !== curve[k].toString('binary')) { - equal = false; - break; - } - } else { - if (cd[k] !== curve[k]) { - equal = false; - break; - } - } - } - if (equal) { - curveName = c; - break; - } - } - } - return (curveName); -} - -function readPkcs8ECDSAPrivate(der) { - var curveName = readECDSACurve(der); - assert.string(curveName, 'a known elliptic curve'); - - der.readSequence(asn1.Ber.OctetString); - der.readSequence(); - - var version = readMPInt(der, 'version'); - assert.equal(version[0], 1, 'unknown version of ECDSA key'); - - var d = der.readString(asn1.Ber.OctetString, true); - var Q; - - if (der.peek() == 0xa0) { - der.readSequence(0xa0); - der._offset += der.length; - } - if (der.peek() == 0xa1) { - der.readSequence(0xa1); - Q = der.readString(asn1.Ber.BitString, true); - Q = utils.ecNormalize(Q); - } - - if (Q === undefined) { - var pub = utils.publicFromPrivateECDSA(curveName, d); - Q = pub.part.Q.data; - } - - var key = { - type: 'ecdsa', - parts: [ - { name: 'curve', data: Buffer.from(curveName) }, - { name: 'Q', data: Q }, - { name: 'd', data: d } - ] - }; - - return (new PrivateKey(key)); -} - -function readPkcs8ECDSAPublic(der) { - var curveName = readECDSACurve(der); - assert.string(curveName, 'a known elliptic curve'); - - var Q = der.readString(asn1.Ber.BitString, true); - Q = utils.ecNormalize(Q); - - var key = { - type: 'ecdsa', - parts: [ - { name: 'curve', data: Buffer.from(curveName) }, - { name: 'Q', data: Q } - ] - }; - - return (new Key(key)); -} - -function readPkcs8EdDSAPublic(der) { - if (der.peek() === 0x00) - der.readByte(); - - var A = utils.readBitString(der); - - var key = { - type: 'ed25519', - parts: [ - { name: 'A', data: utils.zeroPadToLength(A, 32) } - ] - }; - - return (new Key(key)); -} - -function readPkcs8X25519Public(der) { - var A = utils.readBitString(der); - - var key = { - type: 'curve25519', - parts: [ - { name: 'A', data: utils.zeroPadToLength(A, 32) } - ] - }; - - return (new Key(key)); -} - -function readPkcs8EdDSAPrivate(der) { - if (der.peek() === 0x00) - der.readByte(); - - der.readSequence(asn1.Ber.OctetString); - var k = der.readString(asn1.Ber.OctetString, true); - k = utils.zeroPadToLength(k, 32); - - var A; - if (der.peek() === asn1.Ber.BitString) { - A = utils.readBitString(der); - A = utils.zeroPadToLength(A, 32); - } else { - A = utils.calculateED25519Public(k); - } - - var key = { - type: 'ed25519', - parts: [ - { name: 'A', data: utils.zeroPadToLength(A, 32) }, - { name: 'k', data: utils.zeroPadToLength(k, 32) } - ] - }; - - return (new PrivateKey(key)); -} - -function readPkcs8X25519Private(der) { - if (der.peek() === 0x00) - der.readByte(); - - der.readSequence(asn1.Ber.OctetString); - var k = der.readString(asn1.Ber.OctetString, true); - k = utils.zeroPadToLength(k, 32); - - var A = utils.calculateX25519Public(k); - - var key = { - type: 'curve25519', - parts: [ - { name: 'A', data: utils.zeroPadToLength(A, 32) }, - { name: 'k', data: utils.zeroPadToLength(k, 32) } - ] - }; - - return (new PrivateKey(key)); -} - -function pkcs8ToBuffer(key) { - var der = new asn1.BerWriter(); - writePkcs8(der, key); - return (der.buffer); -} - -function writePkcs8(der, key) { - der.startSequence(); - - if (PrivateKey.isPrivateKey(key)) { - var sillyInt = Buffer.from([0]); - der.writeBuffer(sillyInt, asn1.Ber.Integer); - } - - der.startSequence(); - switch (key.type) { - case 'rsa': - der.writeOID('1.2.840.113549.1.1.1'); - if (PrivateKey.isPrivateKey(key)) - writePkcs8RSAPrivate(key, der); - else - writePkcs8RSAPublic(key, der); - break; - case 'dsa': - der.writeOID('1.2.840.10040.4.1'); - if (PrivateKey.isPrivateKey(key)) - writePkcs8DSAPrivate(key, der); - else - writePkcs8DSAPublic(key, der); - break; - case 'ecdsa': - der.writeOID('1.2.840.10045.2.1'); - if (PrivateKey.isPrivateKey(key)) - writePkcs8ECDSAPrivate(key, der); - else - writePkcs8ECDSAPublic(key, der); - break; - case 'ed25519': - der.writeOID('1.3.101.112'); - if (PrivateKey.isPrivateKey(key)) - throw (new Error('Ed25519 private keys in pkcs8 ' + - 'format are not supported')); - writePkcs8EdDSAPublic(key, der); - break; - default: - throw (new Error('Unsupported key type: ' + key.type)); - } - - der.endSequence(); -} - -function writePkcs8RSAPrivate(key, der) { - der.writeNull(); - der.endSequence(); - - der.startSequence(asn1.Ber.OctetString); - der.startSequence(); - - var version = Buffer.from([0]); - der.writeBuffer(version, asn1.Ber.Integer); - - der.writeBuffer(key.part.n.data, asn1.Ber.Integer); - der.writeBuffer(key.part.e.data, asn1.Ber.Integer); - der.writeBuffer(key.part.d.data, asn1.Ber.Integer); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - if (!key.part.dmodp || !key.part.dmodq) - utils.addRSAMissing(key); - der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); - der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); - der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); - - der.endSequence(); - der.endSequence(); -} - -function writePkcs8RSAPublic(key, der) { - der.writeNull(); - der.endSequence(); - - der.startSequence(asn1.Ber.BitString); - der.writeByte(0x00); - - der.startSequence(); - der.writeBuffer(key.part.n.data, asn1.Ber.Integer); - der.writeBuffer(key.part.e.data, asn1.Ber.Integer); - der.endSequence(); - - der.endSequence(); -} - -function writePkcs8DSAPrivate(key, der) { - der.startSequence(); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - der.writeBuffer(key.part.g.data, asn1.Ber.Integer); - der.endSequence(); - - der.endSequence(); - - der.startSequence(asn1.Ber.OctetString); - der.writeBuffer(key.part.x.data, asn1.Ber.Integer); - der.endSequence(); -} - -function writePkcs8DSAPublic(key, der) { - der.startSequence(); - der.writeBuffer(key.part.p.data, asn1.Ber.Integer); - der.writeBuffer(key.part.q.data, asn1.Ber.Integer); - der.writeBuffer(key.part.g.data, asn1.Ber.Integer); - der.endSequence(); - der.endSequence(); - - der.startSequence(asn1.Ber.BitString); - der.writeByte(0x00); - der.writeBuffer(key.part.y.data, asn1.Ber.Integer); - der.endSequence(); -} - -function writeECDSACurve(key, der) { - var curve = algs.curves[key.curve]; - if (curve.pkcs8oid) { - /* This one has a name in pkcs#8, so just write the oid */ - der.writeOID(curve.pkcs8oid); - - } else { - // ECParameters sequence - der.startSequence(); - - var version = Buffer.from([1]); - der.writeBuffer(version, asn1.Ber.Integer); - - // FieldID sequence - der.startSequence(); - der.writeOID('1.2.840.10045.1.1'); // prime-field - der.writeBuffer(curve.p, asn1.Ber.Integer); - der.endSequence(); - - // Curve sequence - der.startSequence(); - var a = curve.p; - if (a[0] === 0x0) - a = a.slice(1); - der.writeBuffer(a, asn1.Ber.OctetString); - der.writeBuffer(curve.b, asn1.Ber.OctetString); - der.writeBuffer(curve.s, asn1.Ber.BitString); - der.endSequence(); - - der.writeBuffer(curve.G, asn1.Ber.OctetString); - der.writeBuffer(curve.n, asn1.Ber.Integer); - var h = curve.h; - if (!h) { - h = Buffer.from([1]); - } - der.writeBuffer(h, asn1.Ber.Integer); - - // ECParameters - der.endSequence(); - } -} - -function writePkcs8ECDSAPublic(key, der) { - writeECDSACurve(key, der); - der.endSequence(); - - var Q = utils.ecNormalize(key.part.Q.data, true); - der.writeBuffer(Q, asn1.Ber.BitString); -} - -function writePkcs8ECDSAPrivate(key, der) { - writeECDSACurve(key, der); - der.endSequence(); - - der.startSequence(asn1.Ber.OctetString); - der.startSequence(); - - var version = Buffer.from([1]); - der.writeBuffer(version, asn1.Ber.Integer); - - der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); - - der.startSequence(0xa1); - var Q = utils.ecNormalize(key.part.Q.data, true); - der.writeBuffer(Q, asn1.Ber.BitString); - der.endSequence(); - - der.endSequence(); - der.endSequence(); -} - -function writePkcs8EdDSAPublic(key, der) { - der.endSequence(); - - utils.writeBitString(der, key.part.A.data); -} - -function writePkcs8EdDSAPrivate(key, der) { - der.endSequence(); - - var k = utils.mpNormalize(key.part.k.data, true); - der.startSequence(asn1.Ber.OctetString); - der.writeBuffer(k, asn1.Ber.OctetString); - der.endSequence(); -} - - -/***/ }), - -/***/ 277: -/***/ (function(module) { - -module.exports = require("path"); - -/***/ }), - -/***/ 283: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright (c) 2012, Mark Cavage. All rights reserved. -// Copyright 2015 Joyent, Inc. - -var assert = __webpack_require__(357); -var Stream = __webpack_require__(413).Stream; -var util = __webpack_require__(669); - - -///--- Globals - -/* JSSTYLED */ -var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; - - -///--- Internal - -function _capitalize(str) { - return (str.charAt(0).toUpperCase() + str.slice(1)); -} - -function _toss(name, expected, oper, arg, actual) { - throw new assert.AssertionError({ - message: util.format('%s (%s) is required', name, expected), - actual: (actual === undefined) ? typeof (arg) : actual(arg), - expected: expected, - operator: oper || '===', - stackStartFunction: _toss.caller - }); -} - -function _getClass(arg) { - return (Object.prototype.toString.call(arg).slice(8, -1)); -} - -function noop() { - // Why even bother with asserts? -} - - -///--- Exports - -var types = { - bool: { - check: function (arg) { return typeof (arg) === 'boolean'; } - }, - func: { - check: function (arg) { return typeof (arg) === 'function'; } - }, - string: { - check: function (arg) { return typeof (arg) === 'string'; } - }, - object: { - check: function (arg) { - return typeof (arg) === 'object' && arg !== null; - } - }, - number: { - check: function (arg) { - return typeof (arg) === 'number' && !isNaN(arg); - } - }, - finite: { - check: function (arg) { - return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); - } - }, - buffer: { - check: function (arg) { return Buffer.isBuffer(arg); }, - operator: 'Buffer.isBuffer' - }, - array: { - check: function (arg) { return Array.isArray(arg); }, - operator: 'Array.isArray' - }, - stream: { - check: function (arg) { return arg instanceof Stream; }, - operator: 'instanceof', - actual: _getClass - }, - date: { - check: function (arg) { return arg instanceof Date; }, - operator: 'instanceof', - actual: _getClass - }, - regexp: { - check: function (arg) { return arg instanceof RegExp; }, - operator: 'instanceof', - actual: _getClass - }, - uuid: { - check: function (arg) { - return typeof (arg) === 'string' && UUID_REGEXP.test(arg); - }, - operator: 'isUUID' - } -}; - -function _setExports(ndebug) { - var keys = Object.keys(types); - var out; - - /* re-export standard assert */ - if (process.env.NODE_NDEBUG) { - out = noop; - } else { - out = function (arg, msg) { - if (!arg) { - _toss(msg, 'true', arg); - } - }; - } - - /* standard checks */ - keys.forEach(function (k) { - if (ndebug) { - out[k] = noop; - return; - } - var type = types[k]; - out[k] = function (arg, msg) { - if (!type.check(arg)) { - _toss(msg, k, type.operator, arg, type.actual); - } - }; - }); - - /* optional checks */ - keys.forEach(function (k) { - var name = 'optional' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - out[name] = function (arg, msg) { - if (arg === undefined || arg === null) { - return; - } - if (!type.check(arg)) { - _toss(msg, k, type.operator, arg, type.actual); - } - }; - }); - - /* arrayOf checks */ - keys.forEach(function (k) { - var name = 'arrayOf' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - var expected = '[' + k + ']'; - out[name] = function (arg, msg) { - if (!Array.isArray(arg)) { - _toss(msg, expected, type.operator, arg, type.actual); - } - var i; - for (i = 0; i < arg.length; i++) { - if (!type.check(arg[i])) { - _toss(msg, expected, type.operator, arg, type.actual); - } - } - }; - }); - - /* optionalArrayOf checks */ - keys.forEach(function (k) { - var name = 'optionalArrayOf' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - var expected = '[' + k + ']'; - out[name] = function (arg, msg) { - if (arg === undefined || arg === null) { - return; - } - if (!Array.isArray(arg)) { - _toss(msg, expected, type.operator, arg, type.actual); - } - var i; - for (i = 0; i < arg.length; i++) { - if (!type.check(arg[i])) { - _toss(msg, expected, type.operator, arg, type.actual); - } - } - }; - }); - - /* re-export built-in assertions */ - Object.keys(assert).forEach(function (k) { - if (k === 'AssertionError') { - out[k] = assert[k]; - return; - } - if (ndebug) { - out[k] = noop; - return; - } - out[k] = assert[k]; - }); - - /* export ourselves (for unit tests _only_) */ - out._setExports = _setExports; - - return out; -} - -module.exports = _setExports(process.env.NODE_NDEBUG); - - -/***/ }), - -/***/ 289: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -var url = __webpack_require__(835) -var qs = __webpack_require__(681) -var caseless = __webpack_require__(812) -var uuid = __webpack_require__(563) -var oauth = __webpack_require__(512) -var crypto = __webpack_require__(417) -var Buffer = __webpack_require__(674).Buffer - -function OAuth (request) { - this.request = request - this.params = null -} - -OAuth.prototype.buildParams = function (_oauth, uri, method, query, form, qsLib) { - var oa = {} - for (var i in _oauth) { - oa['oauth_' + i] = _oauth[i] - } - if (!oa.oauth_version) { - oa.oauth_version = '1.0' - } - if (!oa.oauth_timestamp) { - oa.oauth_timestamp = Math.floor(Date.now() / 1000).toString() - } - if (!oa.oauth_nonce) { - oa.oauth_nonce = uuid().replace(/-/g, '') - } - if (!oa.oauth_signature_method) { - oa.oauth_signature_method = 'HMAC-SHA1' - } - - var consumer_secret_or_private_key = oa.oauth_consumer_secret || oa.oauth_private_key // eslint-disable-line camelcase - delete oa.oauth_consumer_secret - delete oa.oauth_private_key - - var token_secret = oa.oauth_token_secret // eslint-disable-line camelcase - delete oa.oauth_token_secret - - var realm = oa.oauth_realm - delete oa.oauth_realm - delete oa.oauth_transport_method - - var baseurl = uri.protocol + '//' + uri.host + uri.pathname - var params = qsLib.parse([].concat(query, form, qsLib.stringify(oa)).join('&')) - - oa.oauth_signature = oauth.sign( - oa.oauth_signature_method, - method, - baseurl, - params, - consumer_secret_or_private_key, // eslint-disable-line camelcase - token_secret // eslint-disable-line camelcase - ) - - if (realm) { - oa.realm = realm - } - - return oa -} - -OAuth.prototype.buildBodyHash = function (_oauth, body) { - if (['HMAC-SHA1', 'RSA-SHA1'].indexOf(_oauth.signature_method || 'HMAC-SHA1') < 0) { - this.request.emit('error', new Error('oauth: ' + _oauth.signature_method + - ' signature_method not supported with body_hash signing.')) - } - - var shasum = crypto.createHash('sha1') - shasum.update(body || '') - var sha1 = shasum.digest('hex') - - return Buffer.from(sha1, 'hex').toString('base64') -} - -OAuth.prototype.concatParams = function (oa, sep, wrap) { - wrap = wrap || '' - - var params = Object.keys(oa).filter(function (i) { - return i !== 'realm' && i !== 'oauth_signature' - }).sort() - - if (oa.realm) { - params.splice(0, 0, 'realm') - } - params.push('oauth_signature') - - return params.map(function (i) { - return i + '=' + wrap + oauth.rfc3986(oa[i]) + wrap - }).join(sep) -} - -OAuth.prototype.onRequest = function (_oauth) { - var self = this - self.params = _oauth - - var uri = self.request.uri || {} - var method = self.request.method || '' - var headers = caseless(self.request.headers) - var body = self.request.body || '' - var qsLib = self.request.qsLib || qs - - var form - var query - var contentType = headers.get('content-type') || '' - var formContentType = 'application/x-www-form-urlencoded' - var transport = _oauth.transport_method || 'header' - - if (contentType.slice(0, formContentType.length) === formContentType) { - contentType = formContentType - form = body - } - if (uri.query) { - query = uri.query - } - if (transport === 'body' && (method !== 'POST' || contentType !== formContentType)) { - self.request.emit('error', new Error('oauth: transport_method of body requires POST ' + - 'and content-type ' + formContentType)) - } - - if (!form && typeof _oauth.body_hash === 'boolean') { - _oauth.body_hash = self.buildBodyHash(_oauth, self.request.body.toString()) - } - - var oa = self.buildParams(_oauth, uri, method, query, form, qsLib) - - switch (transport) { - case 'header': - self.request.setHeader('Authorization', 'OAuth ' + self.concatParams(oa, ',', '"')) - break - - case 'query': - var href = self.request.uri.href += (query ? '&' : '?') + self.concatParams(oa, '&') - self.request.uri = url.parse(href) - self.request.path = self.request.uri.path - break - - case 'body': - self.request.body = (form ? form + '&' : '') + self.concatParams(oa, '&') - break - - default: - self.request.emit('error', new Error('oauth: transport_method invalid')) - } -} - -exports.OAuth = OAuth - - -/***/ }), - -/***/ 293: -/***/ (function(module) { - -module.exports = require("buffer"); - -/***/ }), - -/***/ 307: -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_multipleOf(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - out += 'var division' + ($lvl) + ';if ('; - if ($isData) { - out += ' ' + ($schemaValue) + ' !== undefined && ( typeof ' + ($schemaValue) + ' != \'number\' || '; - } - out += ' (division' + ($lvl) + ' = ' + ($data) + ' / ' + ($schemaValue) + ', '; - if (it.opts.multipleOfPrecision) { - out += ' Math.abs(Math.round(division' + ($lvl) + ') - division' + ($lvl) + ') > 1e-' + (it.opts.multipleOfPrecision) + ' '; - } else { - out += ' division' + ($lvl) + ' !== parseInt(division' + ($lvl) + ') '; - } - out += ' ) '; - if ($isData) { - out += ' ) '; - } - out += ' ) { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('multipleOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { multipleOf: ' + ($schemaValue) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should be multiple of '; - if ($isData) { - out += '\' + ' + ($schemaValue); - } else { - out += '' + ($schemaValue) + '\''; - } - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + ($schema); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += '} '; - if ($breakOnError) { - out += ' else { '; - } - return out; -} - - -/***/ }), - -/***/ 327: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. - -module.exports = { - read: read, - verify: verify, - sign: sign, - signAsync: signAsync, - write: write -}; - -var assert = __webpack_require__(283); -var asn1 = __webpack_require__(214); -var Buffer = __webpack_require__(375).Buffer; -var algs = __webpack_require__(936); -var utils = __webpack_require__(757); -var Key = __webpack_require__(820); -var PrivateKey = __webpack_require__(463); -var pem = __webpack_require__(502); -var Identity = __webpack_require__(905); -var Signature = __webpack_require__(719); -var Certificate = __webpack_require__(219); -var pkcs8 = __webpack_require__(274); - -/* - * This file is based on RFC5280 (X.509). - */ - -/* Helper to read in a single mpint */ -function readMPInt(der, nm) { - assert.strictEqual(der.peek(), asn1.Ber.Integer, - nm + ' is not an Integer'); - return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); -} - -function verify(cert, key) { - var sig = cert.signatures.x509; - assert.object(sig, 'x509 signature'); - - var algParts = sig.algo.split('-'); - if (algParts[0] !== key.type) - return (false); - - var blob = sig.cache; - if (blob === undefined) { - var der = new asn1.BerWriter(); - writeTBSCert(cert, der); - blob = der.buffer; - } - - var verifier = key.createVerify(algParts[1]); - verifier.write(blob); - return (verifier.verify(sig.signature)); -} - -function Local(i) { - return (asn1.Ber.Context | asn1.Ber.Constructor | i); -} - -function Context(i) { - return (asn1.Ber.Context | i); -} - -var SIGN_ALGS = { - 'rsa-md5': '1.2.840.113549.1.1.4', - 'rsa-sha1': '1.2.840.113549.1.1.5', - 'rsa-sha256': '1.2.840.113549.1.1.11', - 'rsa-sha384': '1.2.840.113549.1.1.12', - 'rsa-sha512': '1.2.840.113549.1.1.13', - 'dsa-sha1': '1.2.840.10040.4.3', - 'dsa-sha256': '2.16.840.1.101.3.4.3.2', - 'ecdsa-sha1': '1.2.840.10045.4.1', - 'ecdsa-sha256': '1.2.840.10045.4.3.2', - 'ecdsa-sha384': '1.2.840.10045.4.3.3', - 'ecdsa-sha512': '1.2.840.10045.4.3.4', - 'ed25519-sha512': '1.3.101.112' -}; -Object.keys(SIGN_ALGS).forEach(function (k) { - SIGN_ALGS[SIGN_ALGS[k]] = k; -}); -SIGN_ALGS['1.3.14.3.2.3'] = 'rsa-md5'; -SIGN_ALGS['1.3.14.3.2.29'] = 'rsa-sha1'; - -var EXTS = { - 'issuerKeyId': '2.5.29.35', - 'altName': '2.5.29.17', - 'basicConstraints': '2.5.29.19', - 'keyUsage': '2.5.29.15', - 'extKeyUsage': '2.5.29.37' -}; - -function read(buf, options) { - if (typeof (buf) === 'string') { - buf = Buffer.from(buf, 'binary'); - } - assert.buffer(buf, 'buf'); - - var der = new asn1.BerReader(buf); - - der.readSequence(); - if (Math.abs(der.length - der.remain) > 1) { - throw (new Error('DER sequence does not contain whole byte ' + - 'stream')); - } - - var tbsStart = der.offset; - der.readSequence(); - var sigOffset = der.offset + der.length; - var tbsEnd = sigOffset; - - if (der.peek() === Local(0)) { - der.readSequence(Local(0)); - var version = der.readInt(); - assert.ok(version <= 3, - 'only x.509 versions up to v3 supported'); - } - - var cert = {}; - cert.signatures = {}; - var sig = (cert.signatures.x509 = {}); - sig.extras = {}; - - cert.serial = readMPInt(der, 'serial'); - - der.readSequence(); - var after = der.offset + der.length; - var certAlgOid = der.readOID(); - var certAlg = SIGN_ALGS[certAlgOid]; - if (certAlg === undefined) - throw (new Error('unknown signature algorithm ' + certAlgOid)); - - der._offset = after; - cert.issuer = Identity.parseAsn1(der); - - der.readSequence(); - cert.validFrom = readDate(der); - cert.validUntil = readDate(der); - - cert.subjects = [Identity.parseAsn1(der)]; - - der.readSequence(); - after = der.offset + der.length; - cert.subjectKey = pkcs8.readPkcs8(undefined, 'public', der); - der._offset = after; - - /* issuerUniqueID */ - if (der.peek() === Local(1)) { - der.readSequence(Local(1)); - sig.extras.issuerUniqueID = - buf.slice(der.offset, der.offset + der.length); - der._offset += der.length; - } - - /* subjectUniqueID */ - if (der.peek() === Local(2)) { - der.readSequence(Local(2)); - sig.extras.subjectUniqueID = - buf.slice(der.offset, der.offset + der.length); - der._offset += der.length; - } - - /* extensions */ - if (der.peek() === Local(3)) { - der.readSequence(Local(3)); - var extEnd = der.offset + der.length; - der.readSequence(); - - while (der.offset < extEnd) - readExtension(cert, buf, der); - - assert.strictEqual(der.offset, extEnd); - } - - assert.strictEqual(der.offset, sigOffset); - - der.readSequence(); - after = der.offset + der.length; - var sigAlgOid = der.readOID(); - var sigAlg = SIGN_ALGS[sigAlgOid]; - if (sigAlg === undefined) - throw (new Error('unknown signature algorithm ' + sigAlgOid)); - der._offset = after; - - var sigData = der.readString(asn1.Ber.BitString, true); - if (sigData[0] === 0) - sigData = sigData.slice(1); - var algParts = sigAlg.split('-'); - - sig.signature = Signature.parse(sigData, algParts[0], 'asn1'); - sig.signature.hashAlgorithm = algParts[1]; - sig.algo = sigAlg; - sig.cache = buf.slice(tbsStart, tbsEnd); - - return (new Certificate(cert)); -} - -function readDate(der) { - if (der.peek() === asn1.Ber.UTCTime) { - return (utcTimeToDate(der.readString(asn1.Ber.UTCTime))); - } else if (der.peek() === asn1.Ber.GeneralizedTime) { - return (gTimeToDate(der.readString(asn1.Ber.GeneralizedTime))); - } else { - throw (new Error('Unsupported date format')); - } -} - -function writeDate(der, date) { - if (date.getUTCFullYear() >= 2050 || date.getUTCFullYear() < 1950) { - der.writeString(dateToGTime(date), asn1.Ber.GeneralizedTime); - } else { - der.writeString(dateToUTCTime(date), asn1.Ber.UTCTime); - } -} - -/* RFC5280, section 4.2.1.6 (GeneralName type) */ -var ALTNAME = { - OtherName: Local(0), - RFC822Name: Context(1), - DNSName: Context(2), - X400Address: Local(3), - DirectoryName: Local(4), - EDIPartyName: Local(5), - URI: Context(6), - IPAddress: Context(7), - OID: Context(8) -}; - -/* RFC5280, section 4.2.1.12 (KeyPurposeId) */ -var EXTPURPOSE = { - 'serverAuth': '1.3.6.1.5.5.7.3.1', - 'clientAuth': '1.3.6.1.5.5.7.3.2', - 'codeSigning': '1.3.6.1.5.5.7.3.3', - - /* See https://github.com/joyent/oid-docs/blob/master/root.md */ - 'joyentDocker': '1.3.6.1.4.1.38678.1.4.1', - 'joyentCmon': '1.3.6.1.4.1.38678.1.4.2' -}; -var EXTPURPOSE_REV = {}; -Object.keys(EXTPURPOSE).forEach(function (k) { - EXTPURPOSE_REV[EXTPURPOSE[k]] = k; -}); - -var KEYUSEBITS = [ - 'signature', 'identity', 'keyEncryption', - 'encryption', 'keyAgreement', 'ca', 'crl' -]; - -function readExtension(cert, buf, der) { - der.readSequence(); - var after = der.offset + der.length; - var extId = der.readOID(); - var id; - var sig = cert.signatures.x509; - if (!sig.extras.exts) - sig.extras.exts = []; - - var critical; - if (der.peek() === asn1.Ber.Boolean) - critical = der.readBoolean(); - - switch (extId) { - case (EXTS.basicConstraints): - der.readSequence(asn1.Ber.OctetString); - der.readSequence(); - var bcEnd = der.offset + der.length; - var ca = false; - if (der.peek() === asn1.Ber.Boolean) - ca = der.readBoolean(); - if (cert.purposes === undefined) - cert.purposes = []; - if (ca === true) - cert.purposes.push('ca'); - var bc = { oid: extId, critical: critical }; - if (der.offset < bcEnd && der.peek() === asn1.Ber.Integer) - bc.pathLen = der.readInt(); - sig.extras.exts.push(bc); - break; - case (EXTS.extKeyUsage): - der.readSequence(asn1.Ber.OctetString); - der.readSequence(); - if (cert.purposes === undefined) - cert.purposes = []; - var ekEnd = der.offset + der.length; - while (der.offset < ekEnd) { - var oid = der.readOID(); - cert.purposes.push(EXTPURPOSE_REV[oid] || oid); - } - /* - * This is a bit of a hack: in the case where we have a cert - * that's only allowed to do serverAuth or clientAuth (and not - * the other), we want to make sure all our Subjects are of - * the right type. But we already parsed our Subjects and - * decided if they were hosts or users earlier (since it appears - * first in the cert). - * - * So we go through and mutate them into the right kind here if - * it doesn't match. This might not be hugely beneficial, as it - * seems that single-purpose certs are not often seen in the - * wild. - */ - if (cert.purposes.indexOf('serverAuth') !== -1 && - cert.purposes.indexOf('clientAuth') === -1) { - cert.subjects.forEach(function (ide) { - if (ide.type !== 'host') { - ide.type = 'host'; - ide.hostname = ide.uid || - ide.email || - ide.components[0].value; - } - }); - } else if (cert.purposes.indexOf('clientAuth') !== -1 && - cert.purposes.indexOf('serverAuth') === -1) { - cert.subjects.forEach(function (ide) { - if (ide.type !== 'user') { - ide.type = 'user'; - ide.uid = ide.hostname || - ide.email || - ide.components[0].value; - } - }); - } - sig.extras.exts.push({ oid: extId, critical: critical }); - break; - case (EXTS.keyUsage): - der.readSequence(asn1.Ber.OctetString); - var bits = der.readString(asn1.Ber.BitString, true); - var setBits = readBitField(bits, KEYUSEBITS); - setBits.forEach(function (bit) { - if (cert.purposes === undefined) - cert.purposes = []; - if (cert.purposes.indexOf(bit) === -1) - cert.purposes.push(bit); - }); - sig.extras.exts.push({ oid: extId, critical: critical, - bits: bits }); - break; - case (EXTS.altName): - der.readSequence(asn1.Ber.OctetString); - der.readSequence(); - var aeEnd = der.offset + der.length; - while (der.offset < aeEnd) { - switch (der.peek()) { - case ALTNAME.OtherName: - case ALTNAME.EDIPartyName: - der.readSequence(); - der._offset += der.length; - break; - case ALTNAME.OID: - der.readOID(ALTNAME.OID); - break; - case ALTNAME.RFC822Name: - /* RFC822 specifies email addresses */ - var email = der.readString(ALTNAME.RFC822Name); - id = Identity.forEmail(email); - if (!cert.subjects[0].equals(id)) - cert.subjects.push(id); - break; - case ALTNAME.DirectoryName: - der.readSequence(ALTNAME.DirectoryName); - id = Identity.parseAsn1(der); - if (!cert.subjects[0].equals(id)) - cert.subjects.push(id); - break; - case ALTNAME.DNSName: - var host = der.readString( - ALTNAME.DNSName); - id = Identity.forHost(host); - if (!cert.subjects[0].equals(id)) - cert.subjects.push(id); - break; - default: - der.readString(der.peek()); - break; - } - } - sig.extras.exts.push({ oid: extId, critical: critical }); - break; - default: - sig.extras.exts.push({ - oid: extId, - critical: critical, - data: der.readString(asn1.Ber.OctetString, true) - }); - break; - } - - der._offset = after; -} - -var UTCTIME_RE = - /^([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; -function utcTimeToDate(t) { - var m = t.match(UTCTIME_RE); - assert.ok(m, 'timestamps must be in UTC'); - var d = new Date(); - - var thisYear = d.getUTCFullYear(); - var century = Math.floor(thisYear / 100) * 100; - - var year = parseInt(m[1], 10); - if (thisYear % 100 < 50 && year >= 60) - year += (century - 1); - else - year += century; - d.setUTCFullYear(year, parseInt(m[2], 10) - 1, parseInt(m[3], 10)); - d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); - if (m[6] && m[6].length > 0) - d.setUTCSeconds(parseInt(m[6], 10)); - return (d); -} - -var GTIME_RE = - /^([0-9]{4})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; -function gTimeToDate(t) { - var m = t.match(GTIME_RE); - assert.ok(m); - var d = new Date(); - - d.setUTCFullYear(parseInt(m[1], 10), parseInt(m[2], 10) - 1, - parseInt(m[3], 10)); - d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); - if (m[6] && m[6].length > 0) - d.setUTCSeconds(parseInt(m[6], 10)); - return (d); -} - -function zeroPad(n, m) { - if (m === undefined) - m = 2; - var s = '' + n; - while (s.length < m) - s = '0' + s; - return (s); -} - -function dateToUTCTime(d) { - var s = ''; - s += zeroPad(d.getUTCFullYear() % 100); - s += zeroPad(d.getUTCMonth() + 1); - s += zeroPad(d.getUTCDate()); - s += zeroPad(d.getUTCHours()); - s += zeroPad(d.getUTCMinutes()); - s += zeroPad(d.getUTCSeconds()); - s += 'Z'; - return (s); -} - -function dateToGTime(d) { - var s = ''; - s += zeroPad(d.getUTCFullYear(), 4); - s += zeroPad(d.getUTCMonth() + 1); - s += zeroPad(d.getUTCDate()); - s += zeroPad(d.getUTCHours()); - s += zeroPad(d.getUTCMinutes()); - s += zeroPad(d.getUTCSeconds()); - s += 'Z'; - return (s); -} - -function sign(cert, key) { - if (cert.signatures.x509 === undefined) - cert.signatures.x509 = {}; - var sig = cert.signatures.x509; - - sig.algo = key.type + '-' + key.defaultHashAlgorithm(); - if (SIGN_ALGS[sig.algo] === undefined) - return (false); - - var der = new asn1.BerWriter(); - writeTBSCert(cert, der); - var blob = der.buffer; - sig.cache = blob; - - var signer = key.createSign(); - signer.write(blob); - cert.signatures.x509.signature = signer.sign(); - - return (true); -} - -function signAsync(cert, signer, done) { - if (cert.signatures.x509 === undefined) - cert.signatures.x509 = {}; - var sig = cert.signatures.x509; - - var der = new asn1.BerWriter(); - writeTBSCert(cert, der); - var blob = der.buffer; - sig.cache = blob; - - signer(blob, function (err, signature) { - if (err) { - done(err); - return; - } - sig.algo = signature.type + '-' + signature.hashAlgorithm; - if (SIGN_ALGS[sig.algo] === undefined) { - done(new Error('Invalid signing algorithm "' + - sig.algo + '"')); - return; - } - sig.signature = signature; - done(); - }); -} - -function write(cert, options) { - var sig = cert.signatures.x509; - assert.object(sig, 'x509 signature'); - - var der = new asn1.BerWriter(); - der.startSequence(); - if (sig.cache) { - der._ensure(sig.cache.length); - sig.cache.copy(der._buf, der._offset); - der._offset += sig.cache.length; - } else { - writeTBSCert(cert, der); - } - - der.startSequence(); - der.writeOID(SIGN_ALGS[sig.algo]); - if (sig.algo.match(/^rsa-/)) - der.writeNull(); - der.endSequence(); - - var sigData = sig.signature.toBuffer('asn1'); - var data = Buffer.alloc(sigData.length + 1); - data[0] = 0; - sigData.copy(data, 1); - der.writeBuffer(data, asn1.Ber.BitString); - der.endSequence(); - - return (der.buffer); -} - -function writeTBSCert(cert, der) { - var sig = cert.signatures.x509; - assert.object(sig, 'x509 signature'); - - der.startSequence(); - - der.startSequence(Local(0)); - der.writeInt(2); - der.endSequence(); - - der.writeBuffer(utils.mpNormalize(cert.serial), asn1.Ber.Integer); - - der.startSequence(); - der.writeOID(SIGN_ALGS[sig.algo]); - if (sig.algo.match(/^rsa-/)) - der.writeNull(); - der.endSequence(); - - cert.issuer.toAsn1(der); - - der.startSequence(); - writeDate(der, cert.validFrom); - writeDate(der, cert.validUntil); - der.endSequence(); - - var subject = cert.subjects[0]; - var altNames = cert.subjects.slice(1); - subject.toAsn1(der); - - pkcs8.writePkcs8(der, cert.subjectKey); - - if (sig.extras && sig.extras.issuerUniqueID) { - der.writeBuffer(sig.extras.issuerUniqueID, Local(1)); - } - - if (sig.extras && sig.extras.subjectUniqueID) { - der.writeBuffer(sig.extras.subjectUniqueID, Local(2)); - } - - if (altNames.length > 0 || subject.type === 'host' || - (cert.purposes !== undefined && cert.purposes.length > 0) || - (sig.extras && sig.extras.exts)) { - der.startSequence(Local(3)); - der.startSequence(); - - var exts = []; - if (cert.purposes !== undefined && cert.purposes.length > 0) { - exts.push({ - oid: EXTS.basicConstraints, - critical: true - }); - exts.push({ - oid: EXTS.keyUsage, - critical: true - }); - exts.push({ - oid: EXTS.extKeyUsage, - critical: true - }); - } - exts.push({ oid: EXTS.altName }); - if (sig.extras && sig.extras.exts) - exts = sig.extras.exts; - - for (var i = 0; i < exts.length; ++i) { - der.startSequence(); - der.writeOID(exts[i].oid); - - if (exts[i].critical !== undefined) - der.writeBoolean(exts[i].critical); - - if (exts[i].oid === EXTS.altName) { - der.startSequence(asn1.Ber.OctetString); - der.startSequence(); - if (subject.type === 'host') { - der.writeString(subject.hostname, - Context(2)); - } - for (var j = 0; j < altNames.length; ++j) { - if (altNames[j].type === 'host') { - der.writeString( - altNames[j].hostname, - ALTNAME.DNSName); - } else if (altNames[j].type === - 'email') { - der.writeString( - altNames[j].email, - ALTNAME.RFC822Name); - } else { - /* - * Encode anything else as a - * DN style name for now. - */ - der.startSequence( - ALTNAME.DirectoryName); - altNames[j].toAsn1(der); - der.endSequence(); - } - } - der.endSequence(); - der.endSequence(); - } else if (exts[i].oid === EXTS.basicConstraints) { - der.startSequence(asn1.Ber.OctetString); - der.startSequence(); - var ca = (cert.purposes.indexOf('ca') !== -1); - var pathLen = exts[i].pathLen; - der.writeBoolean(ca); - if (pathLen !== undefined) - der.writeInt(pathLen); - der.endSequence(); - der.endSequence(); - } else if (exts[i].oid === EXTS.extKeyUsage) { - der.startSequence(asn1.Ber.OctetString); - der.startSequence(); - cert.purposes.forEach(function (purpose) { - if (purpose === 'ca') - return; - if (KEYUSEBITS.indexOf(purpose) !== -1) - return; - var oid = purpose; - if (EXTPURPOSE[purpose] !== undefined) - oid = EXTPURPOSE[purpose]; - der.writeOID(oid); - }); - der.endSequence(); - der.endSequence(); - } else if (exts[i].oid === EXTS.keyUsage) { - der.startSequence(asn1.Ber.OctetString); - /* - * If we parsed this certificate from a byte - * stream (i.e. we didn't generate it in sshpk) - * then we'll have a ".bits" property on the - * ext with the original raw byte contents. - * - * If we have this, use it here instead of - * regenerating it. This guarantees we output - * the same data we parsed, so signatures still - * validate. - */ - if (exts[i].bits !== undefined) { - der.writeBuffer(exts[i].bits, - asn1.Ber.BitString); - } else { - var bits = writeBitField(cert.purposes, - KEYUSEBITS); - der.writeBuffer(bits, - asn1.Ber.BitString); - } - der.endSequence(); - } else { - der.writeBuffer(exts[i].data, - asn1.Ber.OctetString); - } - - der.endSequence(); - } - - der.endSequence(); - der.endSequence(); - } - - der.endSequence(); -} - -/* - * Reads an ASN.1 BER bitfield out of the Buffer produced by doing - * `BerReader#readString(asn1.Ber.BitString)`. That function gives us the raw - * contents of the BitString tag, which is a count of unused bits followed by - * the bits as a right-padded byte string. - * - * `bits` is the Buffer, `bitIndex` should contain an array of string names - * for the bits in the string, ordered starting with bit #0 in the ASN.1 spec. - * - * Returns an array of Strings, the names of the bits that were set to 1. - */ -function readBitField(bits, bitIndex) { - var bitLen = 8 * (bits.length - 1) - bits[0]; - var setBits = {}; - for (var i = 0; i < bitLen; ++i) { - var byteN = 1 + Math.floor(i / 8); - var bit = 7 - (i % 8); - var mask = 1 << bit; - var bitVal = ((bits[byteN] & mask) !== 0); - var name = bitIndex[i]; - if (bitVal && typeof (name) === 'string') { - setBits[name] = true; - } - } - return (Object.keys(setBits)); -} - -/* - * `setBits` is an array of strings, containing the names for each bit that - * sould be set to 1. `bitIndex` is same as in `readBitField()`. - * - * Returns a Buffer, ready to be written out with `BerWriter#writeString()`. - */ -function writeBitField(setBits, bitIndex) { - var bitLen = bitIndex.length; - var blen = Math.ceil(bitLen / 8); - var unused = blen * 8 - bitLen; - var bits = Buffer.alloc(1 + blen); // zero-filled - bits[0] = unused; - for (var i = 0; i < bitLen; ++i) { - var byteN = 1 + Math.floor(i / 8); - var bit = 7 - (i % 8); - var mask = 1 << bit; - var name = bitIndex[i]; - if (name === undefined) - continue; - var bitVal = (setBits.indexOf(name) !== -1); - if (bitVal) { - bits[byteN] |= mask; - } - } - return (bits); -} - - -/***/ }), - -/***/ 334: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; -/*! - * Copyright (c) 2015, Salesforce.com, Inc. - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * - * 1. Redistributions of source code must retain the above copyright notice, - * this list of conditions and the following disclaimer. - * - * 2. Redistributions in binary form must reproduce the above copyright notice, - * this list of conditions and the following disclaimer in the documentation - * and/or other materials provided with the distribution. - * - * 3. Neither the name of Salesforce.com nor the names of its contributors may - * be used to endorse or promote products derived from this software without - * specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE - * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR - * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF - * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS - * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN - * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) - * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE - * POSSIBILITY OF SUCH DAMAGE. - */ - -var Store = __webpack_require__(765).Store; -var permuteDomain = __webpack_require__(802).permuteDomain; -var pathMatch = __webpack_require__(47).pathMatch; -var util = __webpack_require__(669); - -function MemoryCookieStore() { - Store.call(this); - this.idx = {}; -} -util.inherits(MemoryCookieStore, Store); -exports.MemoryCookieStore = MemoryCookieStore; -MemoryCookieStore.prototype.idx = null; - -// Since it's just a struct in RAM, this Store is synchronous -MemoryCookieStore.prototype.synchronous = true; - -// force a default depth: -MemoryCookieStore.prototype.inspect = function() { - return "{ idx: "+util.inspect(this.idx, false, 2)+' }'; -}; - -// Use the new custom inspection symbol to add the custom inspect function if -// available. -if (util.inspect.custom) { - MemoryCookieStore.prototype[util.inspect.custom] = MemoryCookieStore.prototype.inspect; -} - -MemoryCookieStore.prototype.findCookie = function(domain, path, key, cb) { - if (!this.idx[domain]) { - return cb(null,undefined); - } - if (!this.idx[domain][path]) { - return cb(null,undefined); - } - return cb(null,this.idx[domain][path][key]||null); -}; - -MemoryCookieStore.prototype.findCookies = function(domain, path, cb) { - var results = []; - if (!domain) { - return cb(null,[]); - } - - var pathMatcher; - if (!path) { - // null means "all paths" - pathMatcher = function matchAll(domainIndex) { - for (var curPath in domainIndex) { - var pathIndex = domainIndex[curPath]; - for (var key in pathIndex) { - results.push(pathIndex[key]); - } - } - }; - - } else { - pathMatcher = function matchRFC(domainIndex) { - //NOTE: we should use path-match algorithm from S5.1.4 here - //(see : https://github.com/ChromiumWebApps/chromium/blob/b3d3b4da8bb94c1b2e061600df106d590fda3620/net/cookies/canonical_cookie.cc#L299) - Object.keys(domainIndex).forEach(function (cookiePath) { - if (pathMatch(path, cookiePath)) { - var pathIndex = domainIndex[cookiePath]; - - for (var key in pathIndex) { - results.push(pathIndex[key]); - } - } - }); - }; - } - - var domains = permuteDomain(domain) || [domain]; - var idx = this.idx; - domains.forEach(function(curDomain) { - var domainIndex = idx[curDomain]; - if (!domainIndex) { - return; - } - pathMatcher(domainIndex); - }); - - cb(null,results); -}; - -MemoryCookieStore.prototype.putCookie = function(cookie, cb) { - if (!this.idx[cookie.domain]) { - this.idx[cookie.domain] = {}; - } - if (!this.idx[cookie.domain][cookie.path]) { - this.idx[cookie.domain][cookie.path] = {}; - } - this.idx[cookie.domain][cookie.path][cookie.key] = cookie; - cb(null); -}; - -MemoryCookieStore.prototype.updateCookie = function(oldCookie, newCookie, cb) { - // updateCookie() may avoid updating cookies that are identical. For example, - // lastAccessed may not be important to some stores and an equality - // comparison could exclude that field. - this.putCookie(newCookie,cb); -}; - -MemoryCookieStore.prototype.removeCookie = function(domain, path, key, cb) { - if (this.idx[domain] && this.idx[domain][path] && this.idx[domain][path][key]) { - delete this.idx[domain][path][key]; - } - cb(null); -}; - -MemoryCookieStore.prototype.removeCookies = function(domain, path, cb) { - if (this.idx[domain]) { - if (path) { - delete this.idx[domain][path]; - } else { - delete this.idx[domain]; - } - } - return cb(null); -}; - -MemoryCookieStore.prototype.getAllCookies = function(cb) { - var cookies = []; - var idx = this.idx; - - var domains = Object.keys(idx); - domains.forEach(function(domain) { - var paths = Object.keys(idx[domain]); - paths.forEach(function(path) { - var keys = Object.keys(idx[domain][path]); - keys.forEach(function(key) { - if (key !== null) { - cookies.push(idx[domain][path][key]); - } - }); - }); - }); - - // Sort by creationIndex so deserializing retains the creation order. - // When implementing your own store, this SHOULD retain the order too - cookies.sort(function(a,b) { - return (a.creationIndex||0) - (b.creationIndex||0); - }); - - cb(null, cookies); -}; - - -/***/ }), - -/***/ 357: -/***/ (function(module) { - -module.exports = require("assert"); - -/***/ }), - -/***/ 361: +/***/ 233: /***/ (function(module) { "use strict"; @@ -13036,621 +5803,2704 @@ module.exports = function generate_dependencies(it, $keyword, $ruleType) { /***/ }), -/***/ 367: +/***/ 241: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2018 Joyent, Inc. + +module.exports = { + read: read, + write: write +}; + +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var utils = __webpack_require__(270); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); + +var pem = __webpack_require__(268); +var ssh = __webpack_require__(603); +var rfc4253 = __webpack_require__(538); +var dnssec = __webpack_require__(982); +var putty = __webpack_require__(624); + +var DNSSEC_PRIVKEY_HEADER_PREFIX = 'Private-key-format: v1'; + +function read(buf, options) { + if (typeof (buf) === 'string') { + if (buf.trim().match(/^[-]+[ ]*BEGIN/)) + return (pem.read(buf, options)); + if (buf.match(/^\s*ssh-[a-z]/)) + return (ssh.read(buf, options)); + if (buf.match(/^\s*ecdsa-/)) + return (ssh.read(buf, options)); + if (buf.match(/^putty-user-key-file-2:/i)) + return (putty.read(buf, options)); + if (findDNSSECHeader(buf)) + return (dnssec.read(buf, options)); + buf = Buffer.from(buf, 'binary'); + } else { + assert.buffer(buf); + if (findPEMHeader(buf)) + return (pem.read(buf, options)); + if (findSSHHeader(buf)) + return (ssh.read(buf, options)); + if (findPuTTYHeader(buf)) + return (putty.read(buf, options)); + if (findDNSSECHeader(buf)) + return (dnssec.read(buf, options)); + } + if (buf.readUInt32BE(0) < buf.length) + return (rfc4253.read(buf, options)); + throw (new Error('Failed to auto-detect format of key')); +} + +function findPuTTYHeader(buf) { + var offset = 0; + while (offset < buf.length && + (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9)) + ++offset; + if (offset + 22 <= buf.length && + buf.slice(offset, offset + 22).toString('ascii').toLowerCase() === + 'putty-user-key-file-2:') + return (true); + return (false); +} + +function findSSHHeader(buf) { + var offset = 0; + while (offset < buf.length && + (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9)) + ++offset; + if (offset + 4 <= buf.length && + buf.slice(offset, offset + 4).toString('ascii') === 'ssh-') + return (true); + if (offset + 6 <= buf.length && + buf.slice(offset, offset + 6).toString('ascii') === 'ecdsa-') + return (true); + return (false); +} + +function findPEMHeader(buf) { + var offset = 0; + while (offset < buf.length && + (buf[offset] === 32 || buf[offset] === 10)) + ++offset; + if (buf[offset] !== 45) + return (false); + while (offset < buf.length && + (buf[offset] === 45)) + ++offset; + while (offset < buf.length && + (buf[offset] === 32)) + ++offset; + if (offset + 5 > buf.length || + buf.slice(offset, offset + 5).toString('ascii') !== 'BEGIN') + return (false); + return (true); +} + +function findDNSSECHeader(buf) { + // private case first + if (buf.length <= DNSSEC_PRIVKEY_HEADER_PREFIX.length) + return (false); + var headerCheck = buf.slice(0, DNSSEC_PRIVKEY_HEADER_PREFIX.length); + if (headerCheck.toString('ascii') === DNSSEC_PRIVKEY_HEADER_PREFIX) + return (true); + + // public-key RFC3110 ? + // 'domain.com. IN KEY ...' or 'domain.com. IN DNSKEY ...' + // skip any comment-lines + if (typeof (buf) !== 'string') { + buf = buf.toString('ascii'); + } + var lines = buf.split('\n'); + var line = 0; + /* JSSTYLED */ + while (lines[line].match(/^\;/)) + line++; + if (lines[line].toString('ascii').match(/\. IN KEY /)) + return (true); + if (lines[line].toString('ascii').match(/\. IN DNSKEY /)) + return (true); + return (false); +} + +function write(key, options) { + throw (new Error('"auto" format cannot be used for writing')); +} + + +/***/ }), + +/***/ 242: +/***/ (function(module, exports) { + +(function(){ + + // Copyright (c) 2005 Tom Wu + // All Rights Reserved. + // See "LICENSE" for details. + + // Basic JavaScript BN library - subset useful for RSA encryption. + + // Bits per digit + var dbits; + + // JavaScript engine analysis + var canary = 0xdeadbeefcafe; + var j_lm = ((canary&0xffffff)==0xefcafe); + + // (public) Constructor + function BigInteger(a,b,c) { + if(a != null) + if("number" == typeof a) this.fromNumber(a,b,c); + else if(b == null && "string" != typeof a) this.fromString(a,256); + else this.fromString(a,b); + } + + // return new, unset BigInteger + function nbi() { return new BigInteger(null); } + + // am: Compute w_j += (x*this_i), propagate carries, + // c is initial carry, returns final carry. + // c < 3*dvalue, x < 2*dvalue, this_i < dvalue + // We need to select the fastest one that works in this environment. + + // am1: use a single mult and divide to get the high bits, + // max digit bits should be 26 because + // max internal value = 2*dvalue^2-2*dvalue (< 2^53) + function am1(i,x,w,j,c,n) { + while(--n >= 0) { + var v = x*this[i++]+w[j]+c; + c = Math.floor(v/0x4000000); + w[j++] = v&0x3ffffff; + } + return c; + } + // am2 avoids a big mult-and-extract completely. + // Max digit bits should be <= 30 because we do bitwise ops + // on values up to 2*hdvalue^2-hdvalue-1 (< 2^31) + function am2(i,x,w,j,c,n) { + var xl = x&0x7fff, xh = x>>15; + while(--n >= 0) { + var l = this[i]&0x7fff; + var h = this[i++]>>15; + var m = xh*l+h*xl; + l = xl*l+((m&0x7fff)<<15)+w[j]+(c&0x3fffffff); + c = (l>>>30)+(m>>>15)+xh*h+(c>>>30); + w[j++] = l&0x3fffffff; + } + return c; + } + // Alternately, set max digit bits to 28 since some + // browsers slow down when dealing with 32-bit numbers. + function am3(i,x,w,j,c,n) { + var xl = x&0x3fff, xh = x>>14; + while(--n >= 0) { + var l = this[i]&0x3fff; + var h = this[i++]>>14; + var m = xh*l+h*xl; + l = xl*l+((m&0x3fff)<<14)+w[j]+c; + c = (l>>28)+(m>>14)+xh*h; + w[j++] = l&0xfffffff; + } + return c; + } + var inBrowser = typeof navigator !== "undefined"; + if(inBrowser && j_lm && (navigator.appName == "Microsoft Internet Explorer")) { + BigInteger.prototype.am = am2; + dbits = 30; + } + else if(inBrowser && j_lm && (navigator.appName != "Netscape")) { + BigInteger.prototype.am = am1; + dbits = 26; + } + else { // Mozilla/Netscape seems to prefer am3 + BigInteger.prototype.am = am3; + dbits = 28; + } + + BigInteger.prototype.DB = dbits; + BigInteger.prototype.DM = ((1<= 0; --i) r[i] = this[i]; + r.t = this.t; + r.s = this.s; + } + + // (protected) set from integer value x, -DV <= x < DV + function bnpFromInt(x) { + this.t = 1; + this.s = (x<0)?-1:0; + if(x > 0) this[0] = x; + else if(x < -1) this[0] = x+this.DV; + else this.t = 0; + } + + // return bigint initialized to value + function nbv(i) { var r = nbi(); r.fromInt(i); return r; } + + // (protected) set from string and radix + function bnpFromString(s,b) { + var k; + if(b == 16) k = 4; + else if(b == 8) k = 3; + else if(b == 256) k = 8; // byte array + else if(b == 2) k = 1; + else if(b == 32) k = 5; + else if(b == 4) k = 2; + else { this.fromRadix(s,b); return; } + this.t = 0; + this.s = 0; + var i = s.length, mi = false, sh = 0; + while(--i >= 0) { + var x = (k==8)?s[i]&0xff:intAt(s,i); + if(x < 0) { + if(s.charAt(i) == "-") mi = true; + continue; + } + mi = false; + if(sh == 0) + this[this.t++] = x; + else if(sh+k > this.DB) { + this[this.t-1] |= (x&((1<<(this.DB-sh))-1))<>(this.DB-sh)); + } + else + this[this.t-1] |= x<= this.DB) sh -= this.DB; + } + if(k == 8 && (s[0]&0x80) != 0) { + this.s = -1; + if(sh > 0) this[this.t-1] |= ((1<<(this.DB-sh))-1)< 0 && this[this.t-1] == c) --this.t; + } + + // (public) return string representation in given radix + function bnToString(b) { + if(this.s < 0) return "-"+this.negate().toString(b); + var k; + if(b == 16) k = 4; + else if(b == 8) k = 3; + else if(b == 2) k = 1; + else if(b == 32) k = 5; + else if(b == 4) k = 2; + else return this.toRadix(b); + var km = (1< 0) { + if(p < this.DB && (d = this[i]>>p) > 0) { m = true; r = int2char(d); } + while(i >= 0) { + if(p < k) { + d = (this[i]&((1<>(p+=this.DB-k); + } + else { + d = (this[i]>>(p-=k))&km; + if(p <= 0) { p += this.DB; --i; } + } + if(d > 0) m = true; + if(m) r += int2char(d); + } + } + return m?r:"0"; + } + + // (public) -this + function bnNegate() { var r = nbi(); BigInteger.ZERO.subTo(this,r); return r; } + + // (public) |this| + function bnAbs() { return (this.s<0)?this.negate():this; } + + // (public) return + if this > a, - if this < a, 0 if equal + function bnCompareTo(a) { + var r = this.s-a.s; + if(r != 0) return r; + var i = this.t; + r = i-a.t; + if(r != 0) return (this.s<0)?-r:r; + while(--i >= 0) if((r=this[i]-a[i]) != 0) return r; + return 0; + } + + // returns bit length of the integer x + function nbits(x) { + var r = 1, t; + if((t=x>>>16) != 0) { x = t; r += 16; } + if((t=x>>8) != 0) { x = t; r += 8; } + if((t=x>>4) != 0) { x = t; r += 4; } + if((t=x>>2) != 0) { x = t; r += 2; } + if((t=x>>1) != 0) { x = t; r += 1; } + return r; + } + + // (public) return the number of bits in "this" + function bnBitLength() { + if(this.t <= 0) return 0; + return this.DB*(this.t-1)+nbits(this[this.t-1]^(this.s&this.DM)); + } + + // (protected) r = this << n*DB + function bnpDLShiftTo(n,r) { + var i; + for(i = this.t-1; i >= 0; --i) r[i+n] = this[i]; + for(i = n-1; i >= 0; --i) r[i] = 0; + r.t = this.t+n; + r.s = this.s; + } + + // (protected) r = this >> n*DB + function bnpDRShiftTo(n,r) { + for(var i = n; i < this.t; ++i) r[i-n] = this[i]; + r.t = Math.max(this.t-n,0); + r.s = this.s; + } + + // (protected) r = this << n + function bnpLShiftTo(n,r) { + var bs = n%this.DB; + var cbs = this.DB-bs; + var bm = (1<= 0; --i) { + r[i+ds+1] = (this[i]>>cbs)|c; + c = (this[i]&bm)<= 0; --i) r[i] = 0; + r[ds] = c; + r.t = this.t+ds+1; + r.s = this.s; + r.clamp(); + } + + // (protected) r = this >> n + function bnpRShiftTo(n,r) { + r.s = this.s; + var ds = Math.floor(n/this.DB); + if(ds >= this.t) { r.t = 0; return; } + var bs = n%this.DB; + var cbs = this.DB-bs; + var bm = (1<>bs; + for(var i = ds+1; i < this.t; ++i) { + r[i-ds-1] |= (this[i]&bm)<>bs; + } + if(bs > 0) r[this.t-ds-1] |= (this.s&bm)<>= this.DB; + } + if(a.t < this.t) { + c -= a.s; + while(i < this.t) { + c += this[i]; + r[i++] = c&this.DM; + c >>= this.DB; + } + c += this.s; + } + else { + c += this.s; + while(i < a.t) { + c -= a[i]; + r[i++] = c&this.DM; + c >>= this.DB; + } + c -= a.s; + } + r.s = (c<0)?-1:0; + if(c < -1) r[i++] = this.DV+c; + else if(c > 0) r[i++] = c; + r.t = i; + r.clamp(); + } + + // (protected) r = this * a, r != this,a (HAC 14.12) + // "this" should be the larger one if appropriate. + function bnpMultiplyTo(a,r) { + var x = this.abs(), y = a.abs(); + var i = x.t; + r.t = i+y.t; + while(--i >= 0) r[i] = 0; + for(i = 0; i < y.t; ++i) r[i+x.t] = x.am(0,y[i],r,i,0,x.t); + r.s = 0; + r.clamp(); + if(this.s != a.s) BigInteger.ZERO.subTo(r,r); + } + + // (protected) r = this^2, r != this (HAC 14.16) + function bnpSquareTo(r) { + var x = this.abs(); + var i = r.t = 2*x.t; + while(--i >= 0) r[i] = 0; + for(i = 0; i < x.t-1; ++i) { + var c = x.am(i,x[i],r,2*i,0,1); + if((r[i+x.t]+=x.am(i+1,2*x[i],r,2*i+1,c,x.t-i-1)) >= x.DV) { + r[i+x.t] -= x.DV; + r[i+x.t+1] = 1; + } + } + if(r.t > 0) r[r.t-1] += x.am(i,x[i],r,2*i,0,1); + r.s = 0; + r.clamp(); + } + + // (protected) divide this by m, quotient and remainder to q, r (HAC 14.20) + // r != q, this != m. q or r may be null. + function bnpDivRemTo(m,q,r) { + var pm = m.abs(); + if(pm.t <= 0) return; + var pt = this.abs(); + if(pt.t < pm.t) { + if(q != null) q.fromInt(0); + if(r != null) this.copyTo(r); + return; + } + if(r == null) r = nbi(); + var y = nbi(), ts = this.s, ms = m.s; + var nsh = this.DB-nbits(pm[pm.t-1]); // normalize modulus + if(nsh > 0) { pm.lShiftTo(nsh,y); pt.lShiftTo(nsh,r); } + else { pm.copyTo(y); pt.copyTo(r); } + var ys = y.t; + var y0 = y[ys-1]; + if(y0 == 0) return; + var yt = y0*(1<1)?y[ys-2]>>this.F2:0); + var d1 = this.FV/yt, d2 = (1<= 0) { + r[r.t++] = 1; + r.subTo(t,r); + } + BigInteger.ONE.dlShiftTo(ys,t); + t.subTo(y,y); // "negative" y so we can replace sub with am later + while(y.t < ys) y[y.t++] = 0; + while(--j >= 0) { + // Estimate quotient digit + var qd = (r[--i]==y0)?this.DM:Math.floor(r[i]*d1+(r[i-1]+e)*d2); + if((r[i]+=y.am(0,qd,r,j,0,ys)) < qd) { // Try it out + y.dlShiftTo(j,t); + r.subTo(t,r); + while(r[i] < --qd) r.subTo(t,r); + } + } + if(q != null) { + r.drShiftTo(ys,q); + if(ts != ms) BigInteger.ZERO.subTo(q,q); + } + r.t = ys; + r.clamp(); + if(nsh > 0) r.rShiftTo(nsh,r); // Denormalize remainder + if(ts < 0) BigInteger.ZERO.subTo(r,r); + } + + // (public) this mod a + function bnMod(a) { + var r = nbi(); + this.abs().divRemTo(a,null,r); + if(this.s < 0 && r.compareTo(BigInteger.ZERO) > 0) a.subTo(r,r); + return r; + } + + // Modular reduction using "classic" algorithm + function Classic(m) { this.m = m; } + function cConvert(x) { + if(x.s < 0 || x.compareTo(this.m) >= 0) return x.mod(this.m); + else return x; + } + function cRevert(x) { return x; } + function cReduce(x) { x.divRemTo(this.m,null,x); } + function cMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } + function cSqrTo(x,r) { x.squareTo(r); this.reduce(r); } + + Classic.prototype.convert = cConvert; + Classic.prototype.revert = cRevert; + Classic.prototype.reduce = cReduce; + Classic.prototype.mulTo = cMulTo; + Classic.prototype.sqrTo = cSqrTo; + + // (protected) return "-1/this % 2^DB"; useful for Mont. reduction + // justification: + // xy == 1 (mod m) + // xy = 1+km + // xy(2-xy) = (1+km)(1-km) + // x[y(2-xy)] = 1-k^2m^2 + // x[y(2-xy)] == 1 (mod m^2) + // if y is 1/x mod m, then y(2-xy) is 1/x mod m^2 + // should reduce x and y(2-xy) by m^2 at each step to keep size bounded. + // JS multiply "overflows" differently from C/C++, so care is needed here. + function bnpInvDigit() { + if(this.t < 1) return 0; + var x = this[0]; + if((x&1) == 0) return 0; + var y = x&3; // y == 1/x mod 2^2 + y = (y*(2-(x&0xf)*y))&0xf; // y == 1/x mod 2^4 + y = (y*(2-(x&0xff)*y))&0xff; // y == 1/x mod 2^8 + y = (y*(2-(((x&0xffff)*y)&0xffff)))&0xffff; // y == 1/x mod 2^16 + // last step - calculate inverse mod DV directly; + // assumes 16 < DB <= 32 and assumes ability to handle 48-bit ints + y = (y*(2-x*y%this.DV))%this.DV; // y == 1/x mod 2^dbits + // we really want the negative inverse, and -DV < y < DV + return (y>0)?this.DV-y:-y; + } + + // Montgomery reduction + function Montgomery(m) { + this.m = m; + this.mp = m.invDigit(); + this.mpl = this.mp&0x7fff; + this.mph = this.mp>>15; + this.um = (1<<(m.DB-15))-1; + this.mt2 = 2*m.t; + } + + // xR mod m + function montConvert(x) { + var r = nbi(); + x.abs().dlShiftTo(this.m.t,r); + r.divRemTo(this.m,null,r); + if(x.s < 0 && r.compareTo(BigInteger.ZERO) > 0) this.m.subTo(r,r); + return r; + } + + // x/R mod m + function montRevert(x) { + var r = nbi(); + x.copyTo(r); + this.reduce(r); + return r; + } + + // x = x/R mod m (HAC 14.32) + function montReduce(x) { + while(x.t <= this.mt2) // pad x so am has enough room later + x[x.t++] = 0; + for(var i = 0; i < this.m.t; ++i) { + // faster way of calculating u0 = x[i]*mp mod DV + var j = x[i]&0x7fff; + var u0 = (j*this.mpl+(((j*this.mph+(x[i]>>15)*this.mpl)&this.um)<<15))&x.DM; + // use am to combine the multiply-shift-add into one call + j = i+this.m.t; + x[j] += this.m.am(0,u0,x,i,0,this.m.t); + // propagate carry + while(x[j] >= x.DV) { x[j] -= x.DV; x[++j]++; } + } + x.clamp(); + x.drShiftTo(this.m.t,x); + if(x.compareTo(this.m) >= 0) x.subTo(this.m,x); + } + + // r = "x^2/R mod m"; x != r + function montSqrTo(x,r) { x.squareTo(r); this.reduce(r); } + + // r = "xy/R mod m"; x,y != r + function montMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } + + Montgomery.prototype.convert = montConvert; + Montgomery.prototype.revert = montRevert; + Montgomery.prototype.reduce = montReduce; + Montgomery.prototype.mulTo = montMulTo; + Montgomery.prototype.sqrTo = montSqrTo; + + // (protected) true iff this is even + function bnpIsEven() { return ((this.t>0)?(this[0]&1):this.s) == 0; } + + // (protected) this^e, e < 2^32, doing sqr and mul with "r" (HAC 14.79) + function bnpExp(e,z) { + if(e > 0xffffffff || e < 1) return BigInteger.ONE; + var r = nbi(), r2 = nbi(), g = z.convert(this), i = nbits(e)-1; + g.copyTo(r); + while(--i >= 0) { + z.sqrTo(r,r2); + if((e&(1< 0) z.mulTo(r2,g,r); + else { var t = r; r = r2; r2 = t; } + } + return z.revert(r); + } + + // (public) this^e % m, 0 <= e < 2^32 + function bnModPowInt(e,m) { + var z; + if(e < 256 || m.isEven()) z = new Classic(m); else z = new Montgomery(m); + return this.exp(e,z); + } + + // protected + BigInteger.prototype.copyTo = bnpCopyTo; + BigInteger.prototype.fromInt = bnpFromInt; + BigInteger.prototype.fromString = bnpFromString; + BigInteger.prototype.clamp = bnpClamp; + BigInteger.prototype.dlShiftTo = bnpDLShiftTo; + BigInteger.prototype.drShiftTo = bnpDRShiftTo; + BigInteger.prototype.lShiftTo = bnpLShiftTo; + BigInteger.prototype.rShiftTo = bnpRShiftTo; + BigInteger.prototype.subTo = bnpSubTo; + BigInteger.prototype.multiplyTo = bnpMultiplyTo; + BigInteger.prototype.squareTo = bnpSquareTo; + BigInteger.prototype.divRemTo = bnpDivRemTo; + BigInteger.prototype.invDigit = bnpInvDigit; + BigInteger.prototype.isEven = bnpIsEven; + BigInteger.prototype.exp = bnpExp; + + // public + BigInteger.prototype.toString = bnToString; + BigInteger.prototype.negate = bnNegate; + BigInteger.prototype.abs = bnAbs; + BigInteger.prototype.compareTo = bnCompareTo; + BigInteger.prototype.bitLength = bnBitLength; + BigInteger.prototype.mod = bnMod; + BigInteger.prototype.modPowInt = bnModPowInt; + + // "constants" + BigInteger.ZERO = nbv(0); + BigInteger.ONE = nbv(1); + + // Copyright (c) 2005-2009 Tom Wu + // All Rights Reserved. + // See "LICENSE" for details. + + // Extended JavaScript BN functions, required for RSA private ops. + + // Version 1.1: new BigInteger("0", 10) returns "proper" zero + // Version 1.2: square() API, isProbablePrime fix + + // (public) + function bnClone() { var r = nbi(); this.copyTo(r); return r; } + + // (public) return value as integer + function bnIntValue() { + if(this.s < 0) { + if(this.t == 1) return this[0]-this.DV; + else if(this.t == 0) return -1; + } + else if(this.t == 1) return this[0]; + else if(this.t == 0) return 0; + // assumes 16 < DB < 32 + return ((this[1]&((1<<(32-this.DB))-1))<>24; } + + // (public) return value as short (assumes DB>=16) + function bnShortValue() { return (this.t==0)?this.s:(this[0]<<16)>>16; } + + // (protected) return x s.t. r^x < DV + function bnpChunkSize(r) { return Math.floor(Math.LN2*this.DB/Math.log(r)); } + + // (public) 0 if this == 0, 1 if this > 0 + function bnSigNum() { + if(this.s < 0) return -1; + else if(this.t <= 0 || (this.t == 1 && this[0] <= 0)) return 0; + else return 1; + } + + // (protected) convert to radix string + function bnpToRadix(b) { + if(b == null) b = 10; + if(this.signum() == 0 || b < 2 || b > 36) return "0"; + var cs = this.chunkSize(b); + var a = Math.pow(b,cs); + var d = nbv(a), y = nbi(), z = nbi(), r = ""; + this.divRemTo(d,y,z); + while(y.signum() > 0) { + r = (a+z.intValue()).toString(b).substr(1) + r; + y.divRemTo(d,y,z); + } + return z.intValue().toString(b) + r; + } + + // (protected) convert from radix string + function bnpFromRadix(s,b) { + this.fromInt(0); + if(b == null) b = 10; + var cs = this.chunkSize(b); + var d = Math.pow(b,cs), mi = false, j = 0, w = 0; + for(var i = 0; i < s.length; ++i) { + var x = intAt(s,i); + if(x < 0) { + if(s.charAt(i) == "-" && this.signum() == 0) mi = true; + continue; + } + w = b*w+x; + if(++j >= cs) { + this.dMultiply(d); + this.dAddOffset(w,0); + j = 0; + w = 0; + } + } + if(j > 0) { + this.dMultiply(Math.pow(b,j)); + this.dAddOffset(w,0); + } + if(mi) BigInteger.ZERO.subTo(this,this); + } + + // (protected) alternate constructor + function bnpFromNumber(a,b,c) { + if("number" == typeof b) { + // new BigInteger(int,int,RNG) + if(a < 2) this.fromInt(1); + else { + this.fromNumber(a,c); + if(!this.testBit(a-1)) // force MSB set + this.bitwiseTo(BigInteger.ONE.shiftLeft(a-1),op_or,this); + if(this.isEven()) this.dAddOffset(1,0); // force odd + while(!this.isProbablePrime(b)) { + this.dAddOffset(2,0); + if(this.bitLength() > a) this.subTo(BigInteger.ONE.shiftLeft(a-1),this); + } + } + } + else { + // new BigInteger(int,RNG) + var x = new Array(), t = a&7; + x.length = (a>>3)+1; + b.nextBytes(x); + if(t > 0) x[0] &= ((1< 0) { + if(p < this.DB && (d = this[i]>>p) != (this.s&this.DM)>>p) + r[k++] = d|(this.s<<(this.DB-p)); + while(i >= 0) { + if(p < 8) { + d = (this[i]&((1<>(p+=this.DB-8); + } + else { + d = (this[i]>>(p-=8))&0xff; + if(p <= 0) { p += this.DB; --i; } + } + if((d&0x80) != 0) d |= -256; + if(k == 0 && (this.s&0x80) != (d&0x80)) ++k; + if(k > 0 || d != this.s) r[k++] = d; + } + } + return r; + } + + function bnEquals(a) { return(this.compareTo(a)==0); } + function bnMin(a) { return(this.compareTo(a)<0)?this:a; } + function bnMax(a) { return(this.compareTo(a)>0)?this:a; } + + // (protected) r = this op a (bitwise) + function bnpBitwiseTo(a,op,r) { + var i, f, m = Math.min(a.t,this.t); + for(i = 0; i < m; ++i) r[i] = op(this[i],a[i]); + if(a.t < this.t) { + f = a.s&this.DM; + for(i = m; i < this.t; ++i) r[i] = op(this[i],f); + r.t = this.t; + } + else { + f = this.s&this.DM; + for(i = m; i < a.t; ++i) r[i] = op(f,a[i]); + r.t = a.t; + } + r.s = op(this.s,a.s); + r.clamp(); + } + + // (public) this & a + function op_and(x,y) { return x&y; } + function bnAnd(a) { var r = nbi(); this.bitwiseTo(a,op_and,r); return r; } + + // (public) this | a + function op_or(x,y) { return x|y; } + function bnOr(a) { var r = nbi(); this.bitwiseTo(a,op_or,r); return r; } + + // (public) this ^ a + function op_xor(x,y) { return x^y; } + function bnXor(a) { var r = nbi(); this.bitwiseTo(a,op_xor,r); return r; } + + // (public) this & ~a + function op_andnot(x,y) { return x&~y; } + function bnAndNot(a) { var r = nbi(); this.bitwiseTo(a,op_andnot,r); return r; } + + // (public) ~this + function bnNot() { + var r = nbi(); + for(var i = 0; i < this.t; ++i) r[i] = this.DM&~this[i]; + r.t = this.t; + r.s = ~this.s; + return r; + } + + // (public) this << n + function bnShiftLeft(n) { + var r = nbi(); + if(n < 0) this.rShiftTo(-n,r); else this.lShiftTo(n,r); + return r; + } + + // (public) this >> n + function bnShiftRight(n) { + var r = nbi(); + if(n < 0) this.lShiftTo(-n,r); else this.rShiftTo(n,r); + return r; + } + + // return index of lowest 1-bit in x, x < 2^31 + function lbit(x) { + if(x == 0) return -1; + var r = 0; + if((x&0xffff) == 0) { x >>= 16; r += 16; } + if((x&0xff) == 0) { x >>= 8; r += 8; } + if((x&0xf) == 0) { x >>= 4; r += 4; } + if((x&3) == 0) { x >>= 2; r += 2; } + if((x&1) == 0) ++r; + return r; + } + + // (public) returns index of lowest 1-bit (or -1 if none) + function bnGetLowestSetBit() { + for(var i = 0; i < this.t; ++i) + if(this[i] != 0) return i*this.DB+lbit(this[i]); + if(this.s < 0) return this.t*this.DB; + return -1; + } + + // return number of 1 bits in x + function cbit(x) { + var r = 0; + while(x != 0) { x &= x-1; ++r; } + return r; + } + + // (public) return number of set bits + function bnBitCount() { + var r = 0, x = this.s&this.DM; + for(var i = 0; i < this.t; ++i) r += cbit(this[i]^x); + return r; + } + + // (public) true iff nth bit is set + function bnTestBit(n) { + var j = Math.floor(n/this.DB); + if(j >= this.t) return(this.s!=0); + return((this[j]&(1<<(n%this.DB)))!=0); + } + + // (protected) this op (1<>= this.DB; + } + if(a.t < this.t) { + c += a.s; + while(i < this.t) { + c += this[i]; + r[i++] = c&this.DM; + c >>= this.DB; + } + c += this.s; + } + else { + c += this.s; + while(i < a.t) { + c += a[i]; + r[i++] = c&this.DM; + c >>= this.DB; + } + c += a.s; + } + r.s = (c<0)?-1:0; + if(c > 0) r[i++] = c; + else if(c < -1) r[i++] = this.DV+c; + r.t = i; + r.clamp(); + } + + // (public) this + a + function bnAdd(a) { var r = nbi(); this.addTo(a,r); return r; } + + // (public) this - a + function bnSubtract(a) { var r = nbi(); this.subTo(a,r); return r; } + + // (public) this * a + function bnMultiply(a) { var r = nbi(); this.multiplyTo(a,r); return r; } + + // (public) this^2 + function bnSquare() { var r = nbi(); this.squareTo(r); return r; } + + // (public) this / a + function bnDivide(a) { var r = nbi(); this.divRemTo(a,r,null); return r; } + + // (public) this % a + function bnRemainder(a) { var r = nbi(); this.divRemTo(a,null,r); return r; } + + // (public) [this/a,this%a] + function bnDivideAndRemainder(a) { + var q = nbi(), r = nbi(); + this.divRemTo(a,q,r); + return new Array(q,r); + } + + // (protected) this *= n, this >= 0, 1 < n < DV + function bnpDMultiply(n) { + this[this.t] = this.am(0,n-1,this,0,0,this.t); + ++this.t; + this.clamp(); + } + + // (protected) this += n << w words, this >= 0 + function bnpDAddOffset(n,w) { + if(n == 0) return; + while(this.t <= w) this[this.t++] = 0; + this[w] += n; + while(this[w] >= this.DV) { + this[w] -= this.DV; + if(++w >= this.t) this[this.t++] = 0; + ++this[w]; + } + } + + // A "null" reducer + function NullExp() {} + function nNop(x) { return x; } + function nMulTo(x,y,r) { x.multiplyTo(y,r); } + function nSqrTo(x,r) { x.squareTo(r); } + + NullExp.prototype.convert = nNop; + NullExp.prototype.revert = nNop; + NullExp.prototype.mulTo = nMulTo; + NullExp.prototype.sqrTo = nSqrTo; + + // (public) this^e + function bnPow(e) { return this.exp(e,new NullExp()); } + + // (protected) r = lower n words of "this * a", a.t <= n + // "this" should be the larger one if appropriate. + function bnpMultiplyLowerTo(a,n,r) { + var i = Math.min(this.t+a.t,n); + r.s = 0; // assumes a,this >= 0 + r.t = i; + while(i > 0) r[--i] = 0; + var j; + for(j = r.t-this.t; i < j; ++i) r[i+this.t] = this.am(0,a[i],r,i,0,this.t); + for(j = Math.min(a.t,n); i < j; ++i) this.am(0,a[i],r,i,0,n-i); + r.clamp(); + } + + // (protected) r = "this * a" without lower n words, n > 0 + // "this" should be the larger one if appropriate. + function bnpMultiplyUpperTo(a,n,r) { + --n; + var i = r.t = this.t+a.t-n; + r.s = 0; // assumes a,this >= 0 + while(--i >= 0) r[i] = 0; + for(i = Math.max(n-this.t,0); i < a.t; ++i) + r[this.t+i-n] = this.am(n-i,a[i],r,0,0,this.t+i-n); + r.clamp(); + r.drShiftTo(1,r); + } + + // Barrett modular reduction + function Barrett(m) { + // setup Barrett + this.r2 = nbi(); + this.q3 = nbi(); + BigInteger.ONE.dlShiftTo(2*m.t,this.r2); + this.mu = this.r2.divide(m); + this.m = m; + } + + function barrettConvert(x) { + if(x.s < 0 || x.t > 2*this.m.t) return x.mod(this.m); + else if(x.compareTo(this.m) < 0) return x; + else { var r = nbi(); x.copyTo(r); this.reduce(r); return r; } + } + + function barrettRevert(x) { return x; } + + // x = x mod m (HAC 14.42) + function barrettReduce(x) { + x.drShiftTo(this.m.t-1,this.r2); + if(x.t > this.m.t+1) { x.t = this.m.t+1; x.clamp(); } + this.mu.multiplyUpperTo(this.r2,this.m.t+1,this.q3); + this.m.multiplyLowerTo(this.q3,this.m.t+1,this.r2); + while(x.compareTo(this.r2) < 0) x.dAddOffset(1,this.m.t+1); + x.subTo(this.r2,x); + while(x.compareTo(this.m) >= 0) x.subTo(this.m,x); + } + + // r = x^2 mod m; x != r + function barrettSqrTo(x,r) { x.squareTo(r); this.reduce(r); } + + // r = x*y mod m; x,y != r + function barrettMulTo(x,y,r) { x.multiplyTo(y,r); this.reduce(r); } + + Barrett.prototype.convert = barrettConvert; + Barrett.prototype.revert = barrettRevert; + Barrett.prototype.reduce = barrettReduce; + Barrett.prototype.mulTo = barrettMulTo; + Barrett.prototype.sqrTo = barrettSqrTo; + + // (public) this^e % m (HAC 14.85) + function bnModPow(e,m) { + var i = e.bitLength(), k, r = nbv(1), z; + if(i <= 0) return r; + else if(i < 18) k = 1; + else if(i < 48) k = 3; + else if(i < 144) k = 4; + else if(i < 768) k = 5; + else k = 6; + if(i < 8) + z = new Classic(m); + else if(m.isEven()) + z = new Barrett(m); + else + z = new Montgomery(m); + + // precomputation + var g = new Array(), n = 3, k1 = k-1, km = (1< 1) { + var g2 = nbi(); + z.sqrTo(g[1],g2); + while(n <= km) { + g[n] = nbi(); + z.mulTo(g2,g[n-2],g[n]); + n += 2; + } + } + + var j = e.t-1, w, is1 = true, r2 = nbi(), t; + i = nbits(e[j])-1; + while(j >= 0) { + if(i >= k1) w = (e[j]>>(i-k1))&km; + else { + w = (e[j]&((1<<(i+1))-1))<<(k1-i); + if(j > 0) w |= e[j-1]>>(this.DB+i-k1); + } + + n = k; + while((w&1) == 0) { w >>= 1; --n; } + if((i -= n) < 0) { i += this.DB; --j; } + if(is1) { // ret == 1, don't bother squaring or multiplying it + g[w].copyTo(r); + is1 = false; + } + else { + while(n > 1) { z.sqrTo(r,r2); z.sqrTo(r2,r); n -= 2; } + if(n > 0) z.sqrTo(r,r2); else { t = r; r = r2; r2 = t; } + z.mulTo(r2,g[w],r); + } + + while(j >= 0 && (e[j]&(1< 0) { + x.rShiftTo(g,x); + y.rShiftTo(g,y); + } + while(x.signum() > 0) { + if((i = x.getLowestSetBit()) > 0) x.rShiftTo(i,x); + if((i = y.getLowestSetBit()) > 0) y.rShiftTo(i,y); + if(x.compareTo(y) >= 0) { + x.subTo(y,x); + x.rShiftTo(1,x); + } + else { + y.subTo(x,y); + y.rShiftTo(1,y); + } + } + if(g > 0) y.lShiftTo(g,y); + return y; + } + + // (protected) this % n, n < 2^26 + function bnpModInt(n) { + if(n <= 0) return 0; + var d = this.DV%n, r = (this.s<0)?n-1:0; + if(this.t > 0) + if(d == 0) r = this[0]%n; + else for(var i = this.t-1; i >= 0; --i) r = (d*r+this[i])%n; + return r; + } + + // (public) 1/this % m (HAC 14.61) + function bnModInverse(m) { + var ac = m.isEven(); + if((this.isEven() && ac) || m.signum() == 0) return BigInteger.ZERO; + var u = m.clone(), v = this.clone(); + var a = nbv(1), b = nbv(0), c = nbv(0), d = nbv(1); + while(u.signum() != 0) { + while(u.isEven()) { + u.rShiftTo(1,u); + if(ac) { + if(!a.isEven() || !b.isEven()) { a.addTo(this,a); b.subTo(m,b); } + a.rShiftTo(1,a); + } + else if(!b.isEven()) b.subTo(m,b); + b.rShiftTo(1,b); + } + while(v.isEven()) { + v.rShiftTo(1,v); + if(ac) { + if(!c.isEven() || !d.isEven()) { c.addTo(this,c); d.subTo(m,d); } + c.rShiftTo(1,c); + } + else if(!d.isEven()) d.subTo(m,d); + d.rShiftTo(1,d); + } + if(u.compareTo(v) >= 0) { + u.subTo(v,u); + if(ac) a.subTo(c,a); + b.subTo(d,b); + } + else { + v.subTo(u,v); + if(ac) c.subTo(a,c); + d.subTo(b,d); + } + } + if(v.compareTo(BigInteger.ONE) != 0) return BigInteger.ZERO; + if(d.compareTo(m) >= 0) return d.subtract(m); + if(d.signum() < 0) d.addTo(m,d); else return d; + if(d.signum() < 0) return d.add(m); else return d; + } + + var lowprimes = [2,3,5,7,11,13,17,19,23,29,31,37,41,43,47,53,59,61,67,71,73,79,83,89,97,101,103,107,109,113,127,131,137,139,149,151,157,163,167,173,179,181,191,193,197,199,211,223,227,229,233,239,241,251,257,263,269,271,277,281,283,293,307,311,313,317,331,337,347,349,353,359,367,373,379,383,389,397,401,409,419,421,431,433,439,443,449,457,461,463,467,479,487,491,499,503,509,521,523,541,547,557,563,569,571,577,587,593,599,601,607,613,617,619,631,641,643,647,653,659,661,673,677,683,691,701,709,719,727,733,739,743,751,757,761,769,773,787,797,809,811,821,823,827,829,839,853,857,859,863,877,881,883,887,907,911,919,929,937,941,947,953,967,971,977,983,991,997]; + var lplim = (1<<26)/lowprimes[lowprimes.length-1]; + + // (public) test primality with certainty >= 1-.5^t + function bnIsProbablePrime(t) { + var i, x = this.abs(); + if(x.t == 1 && x[0] <= lowprimes[lowprimes.length-1]) { + for(i = 0; i < lowprimes.length; ++i) + if(x[0] == lowprimes[i]) return true; + return false; + } + if(x.isEven()) return false; + i = 1; + while(i < lowprimes.length) { + var m = lowprimes[i], j = i+1; + while(j < lowprimes.length && m < lplim) m *= lowprimes[j++]; + m = x.modInt(m); + while(i < j) if(m%lowprimes[i++] == 0) return false; + } + return x.millerRabin(t); + } + + // (protected) true if probably prime (HAC 4.24, Miller-Rabin) + function bnpMillerRabin(t) { + var n1 = this.subtract(BigInteger.ONE); + var k = n1.getLowestSetBit(); + if(k <= 0) return false; + var r = n1.shiftRight(k); + t = (t+1)>>1; + if(t > lowprimes.length) t = lowprimes.length; + var a = nbi(); + for(var i = 0; i < t; ++i) { + //Pick bases at random, instead of starting at 2 + a.fromInt(lowprimes[Math.floor(Math.random()*lowprimes.length)]); + var y = a.modPow(r,this); + if(y.compareTo(BigInteger.ONE) != 0 && y.compareTo(n1) != 0) { + var j = 1; + while(j++ < k && y.compareTo(n1) != 0) { + y = y.modPowInt(2,this); + if(y.compareTo(BigInteger.ONE) == 0) return false; + } + if(y.compareTo(n1) != 0) return false; + } + } + return true; + } + + // protected + BigInteger.prototype.chunkSize = bnpChunkSize; + BigInteger.prototype.toRadix = bnpToRadix; + BigInteger.prototype.fromRadix = bnpFromRadix; + BigInteger.prototype.fromNumber = bnpFromNumber; + BigInteger.prototype.bitwiseTo = bnpBitwiseTo; + BigInteger.prototype.changeBit = bnpChangeBit; + BigInteger.prototype.addTo = bnpAddTo; + BigInteger.prototype.dMultiply = bnpDMultiply; + BigInteger.prototype.dAddOffset = bnpDAddOffset; + BigInteger.prototype.multiplyLowerTo = bnpMultiplyLowerTo; + BigInteger.prototype.multiplyUpperTo = bnpMultiplyUpperTo; + BigInteger.prototype.modInt = bnpModInt; + BigInteger.prototype.millerRabin = bnpMillerRabin; + + // public + BigInteger.prototype.clone = bnClone; + BigInteger.prototype.intValue = bnIntValue; + BigInteger.prototype.byteValue = bnByteValue; + BigInteger.prototype.shortValue = bnShortValue; + BigInteger.prototype.signum = bnSigNum; + BigInteger.prototype.toByteArray = bnToByteArray; + BigInteger.prototype.equals = bnEquals; + BigInteger.prototype.min = bnMin; + BigInteger.prototype.max = bnMax; + BigInteger.prototype.and = bnAnd; + BigInteger.prototype.or = bnOr; + BigInteger.prototype.xor = bnXor; + BigInteger.prototype.andNot = bnAndNot; + BigInteger.prototype.not = bnNot; + BigInteger.prototype.shiftLeft = bnShiftLeft; + BigInteger.prototype.shiftRight = bnShiftRight; + BigInteger.prototype.getLowestSetBit = bnGetLowestSetBit; + BigInteger.prototype.bitCount = bnBitCount; + BigInteger.prototype.testBit = bnTestBit; + BigInteger.prototype.setBit = bnSetBit; + BigInteger.prototype.clearBit = bnClearBit; + BigInteger.prototype.flipBit = bnFlipBit; + BigInteger.prototype.add = bnAdd; + BigInteger.prototype.subtract = bnSubtract; + BigInteger.prototype.multiply = bnMultiply; + BigInteger.prototype.divide = bnDivide; + BigInteger.prototype.remainder = bnRemainder; + BigInteger.prototype.divideAndRemainder = bnDivideAndRemainder; + BigInteger.prototype.modPow = bnModPow; + BigInteger.prototype.modInverse = bnModInverse; + BigInteger.prototype.pow = bnPow; + BigInteger.prototype.gcd = bnGCD; + BigInteger.prototype.isProbablePrime = bnIsProbablePrime; + + // JSBN-specific extension + BigInteger.prototype.square = bnSquare; + + // Expose the Barrett function + BigInteger.prototype.Barrett = Barrett + + // BigInteger interfaces not implemented in jsbn: + + // BigInteger(int signum, byte[] magnitude) + // double doubleValue() + // float floatValue() + // int hashCode() + // long longValue() + // static BigInteger valueOf(long val) + + // Random number generator - requires a PRNG backend, e.g. prng4.js + + // For best results, put code like + // + // in your main HTML document. + + var rng_state; + var rng_pool; + var rng_pptr; + + // Mix in a 32-bit integer into the pool + function rng_seed_int(x) { + rng_pool[rng_pptr++] ^= x & 255; + rng_pool[rng_pptr++] ^= (x >> 8) & 255; + rng_pool[rng_pptr++] ^= (x >> 16) & 255; + rng_pool[rng_pptr++] ^= (x >> 24) & 255; + if(rng_pptr >= rng_psize) rng_pptr -= rng_psize; + } + + // Mix in the current time (w/milliseconds) into the pool + function rng_seed_time() { + rng_seed_int(new Date().getTime()); + } + + // Initialize the pool with junk if needed. + if(rng_pool == null) { + rng_pool = new Array(); + rng_pptr = 0; + var t; + if(typeof window !== "undefined" && window.crypto) { + if (window.crypto.getRandomValues) { + // Use webcrypto if available + var ua = new Uint8Array(32); + window.crypto.getRandomValues(ua); + for(t = 0; t < 32; ++t) + rng_pool[rng_pptr++] = ua[t]; + } + else if(navigator.appName == "Netscape" && navigator.appVersion < "5") { + // Extract entropy (256 bits) from NS4 RNG if available + var z = window.crypto.random(32); + for(t = 0; t < z.length; ++t) + rng_pool[rng_pptr++] = z.charCodeAt(t) & 255; + } + } + while(rng_pptr < rng_psize) { // extract some randomness from Math.random() + t = Math.floor(65536 * Math.random()); + rng_pool[rng_pptr++] = t >>> 8; + rng_pool[rng_pptr++] = t & 255; + } + rng_pptr = 0; + rng_seed_time(); + //rng_seed_int(window.screenX); + //rng_seed_int(window.screenY); + } + + function rng_get_byte() { + if(rng_state == null) { + rng_seed_time(); + rng_state = prng_newstate(); + rng_state.init(rng_pool); + for(rng_pptr = 0; rng_pptr < rng_pool.length; ++rng_pptr) + rng_pool[rng_pptr] = 0; + rng_pptr = 0; + //rng_pool = null; + } + // TODO: allow reseeding after first request + return rng_state.next(); + } + + function rng_get_bytes(ba) { + var i; + for(i = 0; i < ba.length; ++i) ba[i] = rng_get_byte(); + } + + function SecureRandom() {} + + SecureRandom.prototype.nextBytes = rng_get_bytes; + + // prng4.js - uses Arcfour as a PRNG + + function Arcfour() { + this.i = 0; + this.j = 0; + this.S = new Array(); + } + + // Initialize arcfour context from key, an array of ints, each from [0..255] + function ARC4init(key) { + var i, j, t; + for(i = 0; i < 256; ++i) + this.S[i] = i; + j = 0; + for(i = 0; i < 256; ++i) { + j = (j + this.S[i] + key[i % key.length]) & 255; + t = this.S[i]; + this.S[i] = this.S[j]; + this.S[j] = t; + } + this.i = 0; + this.j = 0; + } + + function ARC4next() { + var t; + this.i = (this.i + 1) & 255; + this.j = (this.j + this.S[this.i]) & 255; + t = this.S[this.i]; + this.S[this.i] = this.S[this.j]; + this.S[this.j] = t; + return this.S[(t + this.S[this.i]) & 255]; + } + + Arcfour.prototype.init = ARC4init; + Arcfour.prototype.next = ARC4next; + + // Plug in your RNG constructor here + function prng_newstate() { + return new Arcfour(); + } + + // Pool size must be a multiple of 4 and greater than 32. + // An array of bytes the size of the pool will be passed to init() + var rng_psize = 256; + + BigInteger.SecureRandom = SecureRandom; + BigInteger.BigInteger = BigInteger; + if (true) { + exports = module.exports = BigInteger; + } else {} + +}).call(this); + + +/***/ }), + +/***/ 243: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; -var tough = __webpack_require__(775) - -var Cookie = tough.Cookie -var CookieJar = tough.CookieJar - -exports.parse = function (str) { - if (str && str.uri) { - str = str.uri - } - if (typeof str !== 'string') { - throw new Error('The cookie function only accepts STRING as param') - } - return Cookie.parse(str, {loose: true}) -} - -// Adapt the sometimes-Async api of tough.CookieJar to our requirements -function RequestJar (store) { - var self = this - self._jar = new CookieJar(store, {looseMode: true}) -} -RequestJar.prototype.setCookie = function (cookieOrStr, uri, options) { - var self = this - return self._jar.setCookieSync(cookieOrStr, uri, options || {}) -} -RequestJar.prototype.getCookieString = function (uri) { - var self = this - return self._jar.getCookieStringSync(uri) -} -RequestJar.prototype.getCookies = function (uri) { - var self = this - return self._jar.getCookiesSync(uri) -} - -exports.jar = function (store) { - return new RequestJar(store) -} - - -/***/ }), - -/***/ 375: -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; -/* eslint-disable node/no-deprecated-api */ - - - -var buffer = __webpack_require__(293) -var Buffer = buffer.Buffer - -var safer = {} - -var key - -for (key in buffer) { - if (!buffer.hasOwnProperty(key)) continue - if (key === 'SlowBuffer' || key === 'Buffer') continue - safer[key] = buffer[key] -} - -var Safer = safer.Buffer = {} -for (key in Buffer) { - if (!Buffer.hasOwnProperty(key)) continue - if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue - Safer[key] = Buffer[key] -} - -safer.Buffer.prototype = Buffer.prototype - -if (!Safer.from || Safer.from === Uint8Array.from) { - Safer.from = function (value, encodingOrOffset, length) { - if (typeof value === 'number') { - throw new TypeError('The "value" argument must not be of type number. Received type ' + typeof value) - } - if (value && typeof value.length === 'undefined') { - throw new TypeError('The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + typeof value) - } - return Buffer(value, encodingOrOffset, length) - } -} - -if (!Safer.alloc) { - Safer.alloc = function (size, fill, encoding) { - if (typeof size !== 'number') { - throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size) - } - if (size < 0 || size >= 2 * (1 << 30)) { - throw new RangeError('The value "' + size + '" is invalid for option "size"') - } - var buf = Buffer(size) - if (!fill || fill.length === 0) { - buf.fill(0) - } else if (typeof encoding === 'string') { - buf.fill(fill, encoding) - } else { - buf.fill(fill) - } - return buf - } -} - -if (!safer.kStringMaxLength) { - try { - safer.kStringMaxLength = process.binding('buffer').kStringMaxLength - } catch (e) { - // we can't determine kStringMaxLength in environments where process.binding - // is unsupported, so let's not set it - } -} - -if (!safer.constants) { - safer.constants = { - MAX_LENGTH: safer.kMaxLength - } - if (safer.kStringMaxLength) { - safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength - } -} - -module.exports = safer - - -/***/ }), - -/***/ 386: -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -var URI = __webpack_require__(675) - , equal = __webpack_require__(58) - , util = __webpack_require__(435) - , SchemaObject = __webpack_require__(660) - , traverse = __webpack_require__(421); - -module.exports = resolve; - -resolve.normalizeId = normalizeId; -resolve.fullPath = getFullPath; -resolve.url = resolveUrl; -resolve.ids = resolveIds; -resolve.inlineRef = inlineRef; -resolve.schema = resolveSchema; - -/** - * [resolve and compile the references ($ref)] - * @this Ajv - * @param {Function} compile reference to schema compilation funciton (localCompile) - * @param {Object} root object with information about the root schema for the current schema - * @param {String} ref reference to resolve - * @return {Object|Function} schema object (if the schema can be inlined) or validation function - */ -function resolve(compile, root, ref) { - /* jshint validthis: true */ - var refVal = this._refs[ref]; - if (typeof refVal == 'string') { - if (this._refs[refVal]) refVal = this._refs[refVal]; - else return resolve.call(this, compile, root, refVal); - } - - refVal = refVal || this._schemas[ref]; - if (refVal instanceof SchemaObject) { - return inlineRef(refVal.schema, this._opts.inlineRefs) - ? refVal.schema - : refVal.validate || this._compile(refVal); - } - - var res = resolveSchema.call(this, root, ref); - var schema, v, baseId; - if (res) { - schema = res.schema; - root = res.root; - baseId = res.baseId; - } - - if (schema instanceof SchemaObject) { - v = schema.validate || compile.call(this, schema.schema, root, undefined, baseId); - } else if (schema !== undefined) { - v = inlineRef(schema, this._opts.inlineRefs) - ? schema - : compile.call(this, schema, root, undefined, baseId); - } - - return v; -} - - -/** - * Resolve schema, its root and baseId - * @this Ajv - * @param {Object} root root object with properties schema, refVal, refs - * @param {String} ref reference to resolve - * @return {Object} object with properties schema, root, baseId - */ -function resolveSchema(root, ref) { - /* jshint validthis: true */ - var p = URI.parse(ref) - , refPath = _getFullPath(p) - , baseId = getFullPath(this._getId(root.schema)); - if (Object.keys(root.schema).length === 0 || refPath !== baseId) { - var id = normalizeId(refPath); - var refVal = this._refs[id]; - if (typeof refVal == 'string') { - return resolveRecursive.call(this, root, refVal, p); - } else if (refVal instanceof SchemaObject) { - if (!refVal.validate) this._compile(refVal); - root = refVal; - } else { - refVal = this._schemas[id]; - if (refVal instanceof SchemaObject) { - if (!refVal.validate) this._compile(refVal); - if (id == normalizeId(ref)) - return { schema: refVal, root: root, baseId: baseId }; - root = refVal; - } else { - return; - } - } - if (!root.schema) return; - baseId = getFullPath(this._getId(root.schema)); - } - return getJsonPointer.call(this, p, baseId, root.schema, root); -} - - -/* @this Ajv */ -function resolveRecursive(root, ref, parsedRef) { - /* jshint validthis: true */ - var res = resolveSchema.call(this, root, ref); - if (res) { - var schema = res.schema; - var baseId = res.baseId; - root = res.root; - var id = this._getId(schema); - if (id) baseId = resolveUrl(baseId, id); - return getJsonPointer.call(this, parsedRef, baseId, schema, root); - } -} - - -var PREVENT_SCOPE_CHANGE = util.toHash(['properties', 'patternProperties', 'enum', 'dependencies', 'definitions']); -/* @this Ajv */ -function getJsonPointer(parsedRef, baseId, schema, root) { - /* jshint validthis: true */ - parsedRef.fragment = parsedRef.fragment || ''; - if (parsedRef.fragment.slice(0,1) != '/') return; - var parts = parsedRef.fragment.split('/'); - - for (var i = 1; i < parts.length; i++) { - var part = parts[i]; - if (part) { - part = util.unescapeFragment(part); - schema = schema[part]; - if (schema === undefined) break; - var id; - if (!PREVENT_SCOPE_CHANGE[part]) { - id = this._getId(schema); - if (id) baseId = resolveUrl(baseId, id); - if (schema.$ref) { - var $ref = resolveUrl(baseId, schema.$ref); - var res = resolveSchema.call(this, root, $ref); - if (res) { - schema = res.schema; - root = res.root; - baseId = res.baseId; - } - } - } - } - } - if (schema !== undefined && schema !== root.schema) - return { schema: schema, root: root, baseId: baseId }; -} - - -var SIMPLE_INLINED = util.toHash([ - 'type', 'format', 'pattern', - 'maxLength', 'minLength', - 'maxProperties', 'minProperties', - 'maxItems', 'minItems', - 'maximum', 'minimum', - 'uniqueItems', 'multipleOf', - 'required', 'enum' -]); -function inlineRef(schema, limit) { - if (limit === false) return false; - if (limit === undefined || limit === true) return checkNoRef(schema); - else if (limit) return countKeys(schema) <= limit; -} - - -function checkNoRef(schema) { - var item; - if (Array.isArray(schema)) { - for (var i=0; i= this.maxSockets) { + // We are over limit so we'll add it to the queue. + self.requests.push({host: options.host, port: options.port, request: req}) + return + } + + // If we are under maxSockets create a new one. + self.createConnection({host: options.host, port: options.port, request: req}) +} + +TunnelingAgent.prototype.createConnection = function createConnection(pending) { + var self = this + + self.createSocket(pending, function(socket) { + socket.on('free', onFree) + socket.on('close', onCloseOrRemove) + socket.on('agentRemove', onCloseOrRemove) + pending.request.onSocket(socket) + + function onFree() { + self.emit('free', socket, pending.host, pending.port) + } + + function onCloseOrRemove(err) { + self.removeSocket(socket) + socket.removeListener('free', onFree) + socket.removeListener('close', onCloseOrRemove) + socket.removeListener('agentRemove', onCloseOrRemove) } }) - -} -util.inherits(ForeverAgent, Agent) - -ForeverAgent.defaultMinSockets = 5 - - -ForeverAgent.prototype.createConnection = net.createConnection -ForeverAgent.prototype.addRequestNoreuse = Agent.prototype.addRequest -ForeverAgent.prototype.addRequest = function(req, host, port) { - var name = getConnectionName(host, port) - - if (typeof host !== 'string') { - var options = host - port = options.port - host = options.host - } - - if (this.freeSockets[name] && this.freeSockets[name].length > 0 && !req.useChunkedEncodingByDefault) { - var idleSocket = this.freeSockets[name].pop() - idleSocket.removeListener('error', idleSocket._onIdleError) - delete idleSocket._onIdleError - req._reusedSocket = true - req.onSocket(idleSocket) - } else { - this.addRequestNoreuse(req, host, port) - } } -ForeverAgent.prototype.removeSocket = function(s, name, host, port) { - if (this.sockets[name]) { - var index = this.sockets[name].indexOf(s) - if (index !== -1) { - this.sockets[name].splice(index, 1) +TunnelingAgent.prototype.createSocket = function createSocket(options, cb) { + var self = this + var placeholder = {} + self.sockets.push(placeholder) + + var connectOptions = mergeOptions({}, self.proxyOptions, + { method: 'CONNECT' + , path: options.host + ':' + options.port + , agent: false } - } else if (this.sockets[name] && this.sockets[name].length === 0) { - // don't leak - delete this.sockets[name] - delete this.requests[name] + ) + if (connectOptions.proxyAuth) { + connectOptions.headers = connectOptions.headers || {} + connectOptions.headers['Proxy-Authorization'] = 'Basic ' + + Buffer.from(connectOptions.proxyAuth).toString('base64') } - - if (this.freeSockets[name]) { - var index = this.freeSockets[name].indexOf(s) - if (index !== -1) { - this.freeSockets[name].splice(index, 1) - if (this.freeSockets[name].length === 0) { - delete this.freeSockets[name] + + debug('making CONNECT request') + var connectReq = self.request(connectOptions) + connectReq.useChunkedEncodingByDefault = false // for v0.6 + connectReq.once('response', onResponse) // for v0.6 + connectReq.once('upgrade', onUpgrade) // for v0.6 + connectReq.once('connect', onConnect) // for v0.7 or later + connectReq.once('error', onError) + connectReq.end() + + function onResponse(res) { + // Very hacky. This is necessary to avoid http-parser leaks. + res.upgrade = true + } + + function onUpgrade(res, socket, head) { + // Hacky. + process.nextTick(function() { + onConnect(res, socket, head) + }) + } + + function onConnect(res, socket, head) { + connectReq.removeAllListeners() + socket.removeAllListeners() + + if (res.statusCode === 200) { + assert.equal(head.length, 0) + debug('tunneling connection has established') + self.sockets[self.sockets.indexOf(placeholder)] = socket + cb(socket) + } else { + debug('tunneling socket could not be established, statusCode=%d', res.statusCode) + var error = new Error('tunneling socket could not be established, ' + 'statusCode=' + res.statusCode) + error.code = 'ECONNRESET' + options.request.emit('error', error) + self.removeSocket(placeholder) + } + } + + function onError(cause) { + connectReq.removeAllListeners() + + debug('tunneling socket could not be established, cause=%s\n', cause.message, cause.stack) + var error = new Error('tunneling socket could not be established, ' + 'cause=' + cause.message) + error.code = 'ECONNRESET' + options.request.emit('error', error) + self.removeSocket(placeholder) + } +} + +TunnelingAgent.prototype.removeSocket = function removeSocket(socket) { + var pos = this.sockets.indexOf(socket) + if (pos === -1) return + + this.sockets.splice(pos, 1) + + var pending = this.requests.shift() + if (pending) { + // If we have pending requests and a socket gets closed a new one + // needs to be created to take over in the pool for the one that closed. + this.createConnection(pending) + } +} + +function createSecureSocket(options, cb) { + var self = this + TunnelingAgent.prototype.createSocket.call(self, options, function(socket) { + // 0 is dummy port for v0.6 + var secureSocket = tls.connect(0, mergeOptions({}, self.options, + { servername: options.host + , socket: socket + } + )) + self.sockets[self.sockets.indexOf(socket)] = secureSocket + cb(secureSocket) + }) +} + + +function mergeOptions(target) { + for (var i = 1, len = arguments.length; i < len; ++i) { + var overrides = arguments[i] + if (typeof overrides === 'object') { + var keys = Object.keys(overrides) + for (var j = 0, keyLen = keys.length; j < keyLen; ++j) { + var k = keys[j] + if (overrides[k] !== undefined) { + target[k] = overrides[k] + } } } } - - if (this.requests[name] && this.requests[name].length) { - // If we have pending requests and a socket gets closed a new one - // needs to be created to take over in the pool for the one that closed. - this.createSocket(name, host, port).emit('free') - } + return target } -function ForeverAgentSSL (options) { - ForeverAgent.call(this, options) + +var debug +if (process.env.NODE_DEBUG && /\btunnel\b/.test(process.env.NODE_DEBUG)) { + debug = function() { + var args = Array.prototype.slice.call(arguments) + if (typeof args[0] === 'string') { + args[0] = 'TUNNEL: ' + args[0] + } else { + args.unshift('TUNNEL:') + } + console.error.apply(console, args) + } +} else { + debug = function() {} } -util.inherits(ForeverAgentSSL, ForeverAgent) +exports.debug = debug // for test -ForeverAgentSSL.prototype.createConnection = createConnectionSSL -ForeverAgentSSL.prototype.addRequestNoreuse = AgentSSL.prototype.addRequest -function createConnectionSSL (port, host, options) { - if (typeof port === 'object') { - options = port; - } else if (typeof host === 'object') { - options = host; - } else if (typeof options === 'object') { - options = options; - } else { - options = {}; - } +/***/ }), - if (typeof port === 'number') { - options.port = port; - } +/***/ 249: +/***/ (function(module, __unusedexports, __webpack_require__) { - if (typeof host === 'string') { - options.host = host; - } +// Copyright 2011 Mark Cavage All rights reserved. - return tls.connect(options); +var errors = __webpack_require__(584); +var types = __webpack_require__(362); + +var Reader = __webpack_require__(733); +var Writer = __webpack_require__(998); + + +// --- Exports + +module.exports = { + + Reader: Reader, + + Writer: Writer + +}; + +for (var t in types) { + if (types.hasOwnProperty(t)) + module.exports[t] = types[t]; +} +for (var e in errors) { + if (errors.hasOwnProperty(e)) + module.exports[e] = errors[e]; } /***/ }), -/***/ 408: +/***/ 254: /***/ (function(module) { -module.exports = {"$id":"postData.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["mimeType"],"properties":{"mimeType":{"type":"string"},"text":{"type":"string"},"params":{"type":"array","required":["name"],"properties":{"name":{"type":"string"},"value":{"type":"string"},"fileName":{"type":"string"},"contentType":{"type":"string"},"comment":{"type":"string"}}},"comment":{"type":"string"}}}; +function Caseless (dict) { + this.dict = dict || {} +} +Caseless.prototype.set = function (name, value, clobber) { + if (typeof name === 'object') { + for (var i in name) { + this.set(i, name[i], value) + } + } else { + if (typeof clobber === 'undefined') clobber = true + var has = this.has(name) + + if (!clobber && has) this.dict[has] = this.dict[has] + ',' + value + else this.dict[has || name] = value + return has + } +} +Caseless.prototype.has = function (name) { + var keys = Object.keys(this.dict) + , name = name.toLowerCase() + ; + for (var i=0;i 0) { + m2 = lines[--ei].match(/*JSSTYLED*/ + /[-]+[ ]*END ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); + } + assert.ok(m2, 'invalid PEM footer'); + + /* Begin and end banners must match key type */ + assert.equal(m[2], m2[2]); + var type = m[2].toLowerCase(); + + var alg; + if (m[1]) { + /* They also must match algorithms, if given */ + assert.equal(m[1], m2[1], 'PEM header and footer mismatch'); + alg = m[1].trim(); + } + + lines = lines.slice(si, ei + 1); + + var headers = {}; + while (true) { + lines = lines.slice(1); + m = lines[0].match(/*JSSTYLED*/ + /^([A-Za-z0-9-]+): (.+)$/); + if (!m) + break; + headers[m[1].toLowerCase()] = m[2]; + } + + /* Chop off the first and last lines */ + lines = lines.slice(0, -1).join(''); + buf = Buffer.from(lines, 'base64'); + + var cipher, key, iv; + if (headers['proc-type']) { + var parts = headers['proc-type'].split(','); + if (parts[0] === '4' && parts[1] === 'ENCRYPTED') { + if (typeof (options.passphrase) === 'string') { + options.passphrase = Buffer.from( + options.passphrase, 'utf-8'); + } + if (!Buffer.isBuffer(options.passphrase)) { + throw (new errors.KeyEncryptedError( + options.filename, 'PEM')); + } else { + parts = headers['dek-info'].split(','); + assert.ok(parts.length === 2); + cipher = parts[0].toLowerCase(); + iv = Buffer.from(parts[1], 'hex'); + key = utils.opensslKeyDeriv(cipher, iv, + options.passphrase, 1).key; + } + } + } + + if (alg && alg.toLowerCase() === 'encrypted') { + var eder = new asn1.BerReader(buf); + var pbesEnd; + eder.readSequence(); + + eder.readSequence(); + pbesEnd = eder.offset + eder.length; + + var method = eder.readOID(); + if (method !== OID_PBES2) { + throw (new Error('Unsupported PEM/PKCS8 encryption ' + + 'scheme: ' + method)); + } + + eder.readSequence(); /* PBES2-params */ + + eder.readSequence(); /* keyDerivationFunc */ + var kdfEnd = eder.offset + eder.length; + var kdfOid = eder.readOID(); + if (kdfOid !== OID_PBKDF2) + throw (new Error('Unsupported PBES2 KDF: ' + kdfOid)); + eder.readSequence(); + var salt = eder.readString(asn1.Ber.OctetString, true); + var iterations = eder.readInt(); + var hashAlg = 'sha1'; + if (eder.offset < kdfEnd) { + eder.readSequence(); + var hashAlgOid = eder.readOID(); + hashAlg = OID_TO_HASH[hashAlgOid]; + if (hashAlg === undefined) { + throw (new Error('Unsupported PBKDF2 hash: ' + + hashAlgOid)); + } + } + eder._offset = kdfEnd; + + eder.readSequence(); /* encryptionScheme */ + var cipherOid = eder.readOID(); + cipher = OID_TO_CIPHER[cipherOid]; + if (cipher === undefined) { + throw (new Error('Unsupported PBES2 cipher: ' + + cipherOid)); + } + iv = eder.readString(asn1.Ber.OctetString, true); + + eder._offset = pbesEnd; + buf = eder.readString(asn1.Ber.OctetString, true); + + if (typeof (options.passphrase) === 'string') { + options.passphrase = Buffer.from( + options.passphrase, 'utf-8'); + } + if (!Buffer.isBuffer(options.passphrase)) { + throw (new errors.KeyEncryptedError( + options.filename, 'PEM')); + } + + var cinfo = utils.opensshCipherInfo(cipher); + + cipher = cinfo.opensslName; + key = utils.pbkdf2(hashAlg, salt, iterations, cinfo.keySize, + options.passphrase); + alg = undefined; + } + + if (cipher && key && iv) { + var cipherStream = crypto.createDecipheriv(cipher, key, iv); + var chunk, chunks = []; + cipherStream.once('error', function (e) { + if (e.toString().indexOf('bad decrypt') !== -1) { + throw (new Error('Incorrect passphrase ' + + 'supplied, could not decrypt key')); + } + throw (e); + }); + cipherStream.write(buf); + cipherStream.end(); + while ((chunk = cipherStream.read()) !== null) + chunks.push(chunk); + buf = Buffer.concat(chunks); + } + + /* The new OpenSSH internal format abuses PEM headers */ + if (alg && alg.toLowerCase() === 'openssh') + return (sshpriv.readSSHPrivate(type, buf, options)); + if (alg && alg.toLowerCase() === 'ssh2') + return (rfc4253.readType(type, buf, options)); + + var der = new asn1.BerReader(buf); + der.originalInput = input; + + /* + * All of the PEM file types start with a sequence tag, so chop it + * off here + */ + der.readSequence(); + + /* PKCS#1 type keys name an algorithm in the banner explicitly */ + if (alg) { + if (forceType) + assert.strictEqual(forceType, 'pkcs1'); + return (pkcs1.readPkcs1(alg, type, der)); + } else { + if (forceType) + assert.strictEqual(forceType, 'pkcs8'); + return (pkcs8.readPkcs8(alg, type, der)); + } +} + +function write(key, options, type) { + assert.object(key); + + var alg = { + 'ecdsa': 'EC', + 'rsa': 'RSA', + 'dsa': 'DSA', + 'ed25519': 'EdDSA' + }[key.type]; + var header; + + var der = new asn1.BerWriter(); + + if (PrivateKey.isPrivateKey(key)) { + if (type && type === 'pkcs8') { + header = 'PRIVATE KEY'; + pkcs8.writePkcs8(der, key); + } else { + if (type) + assert.strictEqual(type, 'pkcs1'); + header = alg + ' PRIVATE KEY'; + pkcs1.writePkcs1(der, key); + } + + } else if (Key.isKey(key)) { + if (type && type === 'pkcs1') { + header = alg + ' PUBLIC KEY'; + pkcs1.writePkcs1(der, key); + } else { + if (type) + assert.strictEqual(type, 'pkcs8'); + header = 'PUBLIC KEY'; + pkcs8.writePkcs8(der, key); + } + + } else { + throw (new Error('key is not a Key or PrivateKey')); + } + + var tmp = der.buffer.toString('base64'); + var len = tmp.length + (tmp.length / 64) + + 18 + 16 + header.length*2 + 10; + var buf = Buffer.alloc(len); + var o = 0; + o += buf.write('-----BEGIN ' + header + '-----\n', o); + for (var i = 0; i < tmp.length; ) { + var limit = i + 64; + if (limit > tmp.length) + limit = tmp.length; + o += buf.write(tmp.slice(i, limit), o); + buf[o++] = 10; + i = limit; + } + o += buf.write('-----END ' + header + '-----\n', o); + + return (buf.slice(0, o)); +} + + +/***/ }), + +/***/ 270: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +module.exports = { + bufferSplit: bufferSplit, + addRSAMissing: addRSAMissing, + calculateDSAPublic: calculateDSAPublic, + calculateED25519Public: calculateED25519Public, + calculateX25519Public: calculateX25519Public, + mpNormalize: mpNormalize, + mpDenormalize: mpDenormalize, + ecNormalize: ecNormalize, + countZeros: countZeros, + assertCompatible: assertCompatible, + isCompatible: isCompatible, + opensslKeyDeriv: opensslKeyDeriv, + opensshCipherInfo: opensshCipherInfo, + publicFromPrivateECDSA: publicFromPrivateECDSA, + zeroPadToLength: zeroPadToLength, + writeBitString: writeBitString, + readBitString: readBitString, + pbkdf2: pbkdf2 +}; + +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var PrivateKey = __webpack_require__(502); +var Key = __webpack_require__(852); +var crypto = __webpack_require__(417); +var algs = __webpack_require__(98); +var asn1 = __webpack_require__(62); + +var ec = __webpack_require__(729); +var jsbn = __webpack_require__(242).BigInteger; +var nacl = __webpack_require__(196); + +var MAX_CLASS_DEPTH = 3; + +function isCompatible(obj, klass, needVer) { + if (obj === null || typeof (obj) !== 'object') + return (false); + if (needVer === undefined) + needVer = klass.prototype._sshpkApiVersion; + if (obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0]) + return (true); + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + if (!proto || ++depth > MAX_CLASS_DEPTH) + return (false); + } + if (proto.constructor.name !== klass.name) + return (false); + var ver = proto._sshpkApiVersion; + if (ver === undefined) + ver = klass._oldVersionDetect(obj); + if (ver[0] != needVer[0] || ver[1] < needVer[1]) + return (false); + return (true); +} + +function assertCompatible(obj, klass, needVer, name) { + if (name === undefined) + name = 'object'; + assert.ok(obj, name + ' must not be null'); + assert.object(obj, name + ' must be an object'); + if (needVer === undefined) + needVer = klass.prototype._sshpkApiVersion; + if (obj instanceof klass && + klass.prototype._sshpkApiVersion[0] == needVer[0]) + return; + var proto = Object.getPrototypeOf(obj); + var depth = 0; + while (proto.constructor.name !== klass.name) { + proto = Object.getPrototypeOf(proto); + assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, + name + ' must be a ' + klass.name + ' instance'); + } + assert.strictEqual(proto.constructor.name, klass.name, + name + ' must be a ' + klass.name + ' instance'); + var ver = proto._sshpkApiVersion; + if (ver === undefined) + ver = klass._oldVersionDetect(obj); + assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], + name + ' must be compatible with ' + klass.name + ' klass ' + + 'version ' + needVer[0] + '.' + needVer[1]); +} + +var CIPHER_LEN = { + 'des-ede3-cbc': { key: 24, iv: 8 }, + 'aes-128-cbc': { key: 16, iv: 16 }, + 'aes-256-cbc': { key: 32, iv: 16 } +}; +var PKCS5_SALT_LEN = 8; + +function opensslKeyDeriv(cipher, salt, passphrase, count) { + assert.buffer(salt, 'salt'); + assert.buffer(passphrase, 'passphrase'); + assert.number(count, 'iteration count'); + + var clen = CIPHER_LEN[cipher]; + assert.object(clen, 'supported cipher'); + + salt = salt.slice(0, PKCS5_SALT_LEN); + + var D, D_prev, bufs; + var material = Buffer.alloc(0); + while (material.length < clen.key + clen.iv) { + bufs = []; + if (D_prev) + bufs.push(D_prev); + bufs.push(passphrase); + bufs.push(salt); + D = Buffer.concat(bufs); + for (var j = 0; j < count; ++j) + D = crypto.createHash('md5').update(D).digest(); + material = Buffer.concat([material, D]); + D_prev = D; + } + + return ({ + key: material.slice(0, clen.key), + iv: material.slice(clen.key, clen.key + clen.iv) + }); +} + +/* See: RFC2898 */ +function pbkdf2(hashAlg, salt, iterations, size, passphrase) { + var hkey = Buffer.alloc(salt.length + 4); + salt.copy(hkey); + + var gen = 0, ts = []; + var i = 1; + while (gen < size) { + var t = T(i++); + gen += t.length; + ts.push(t); + } + return (Buffer.concat(ts).slice(0, size)); + + function T(I) { + hkey.writeUInt32BE(I, hkey.length - 4); + + var hmac = crypto.createHmac(hashAlg, passphrase); + hmac.update(hkey); + + var Ti = hmac.digest(); + var Uc = Ti; + var c = 1; + while (c++ < iterations) { + hmac = crypto.createHmac(hashAlg, passphrase); + hmac.update(Uc); + Uc = hmac.digest(); + for (var x = 0; x < Ti.length; ++x) + Ti[x] ^= Uc[x]; + } + return (Ti); + } +} + +/* Count leading zero bits on a buffer */ +function countZeros(buf) { + var o = 0, obit = 8; + while (o < buf.length) { + var mask = (1 << obit); + if ((buf[o] & mask) === mask) + break; + obit--; + if (obit < 0) { + o++; + obit = 8; + } + } + return (o*8 + (8 - obit) - 1); +} + +function bufferSplit(buf, chr) { + assert.buffer(buf); + assert.string(chr); + + var parts = []; + var lastPart = 0; + var matches = 0; + for (var i = 0; i < buf.length; ++i) { + if (buf[i] === chr.charCodeAt(matches)) + ++matches; + else if (buf[i] === chr.charCodeAt(0)) + matches = 1; + else + matches = 0; + + if (matches >= chr.length) { + var newPart = i + 1; + parts.push(buf.slice(lastPart, newPart - matches)); + lastPart = newPart; + matches = 0; + } + } + if (lastPart <= buf.length) + parts.push(buf.slice(lastPart, buf.length)); + + return (parts); +} + +function ecNormalize(buf, addZero) { + assert.buffer(buf); + if (buf[0] === 0x00 && buf[1] === 0x04) { + if (addZero) + return (buf); + return (buf.slice(1)); + } else if (buf[0] === 0x04) { + if (!addZero) + return (buf); + } else { + while (buf[0] === 0x00) + buf = buf.slice(1); + if (buf[0] === 0x02 || buf[0] === 0x03) + throw (new Error('Compressed elliptic curve points ' + + 'are not supported')); + if (buf[0] !== 0x04) + throw (new Error('Not a valid elliptic curve point')); + if (!addZero) + return (buf); + } + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x0; + buf.copy(b, 1); + return (b); +} + +function readBitString(der, tag) { + if (tag === undefined) + tag = asn1.Ber.BitString; + var buf = der.readString(tag, true); + assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' + + 'not supported (0x' + buf[0].toString(16) + ')'); + return (buf.slice(1)); +} + +function writeBitString(der, buf, tag) { + if (tag === undefined) + tag = asn1.Ber.BitString; + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + der.writeBuffer(b, tag); +} + +function mpNormalize(buf) { + assert.buffer(buf); + while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) + buf = buf.slice(1); + if ((buf[0] & 0x80) === 0x80) { + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + buf = b; + } + return (buf); +} + +function mpDenormalize(buf) { + assert.buffer(buf); + while (buf.length > 1 && buf[0] === 0x00) + buf = buf.slice(1); + return (buf); +} + +function zeroPadToLength(buf, len) { + assert.buffer(buf); + assert.number(len); + while (buf.length > len) { + assert.equal(buf[0], 0x00); + buf = buf.slice(1); + } + while (buf.length < len) { + var b = Buffer.alloc(buf.length + 1); + b[0] = 0x00; + buf.copy(b, 1); + buf = b; + } + return (buf); +} + +function bigintToMpBuf(bigint) { + var buf = Buffer.from(bigint.toByteArray()); + buf = mpNormalize(buf); + return (buf); +} + +function calculateDSAPublic(g, p, x) { + assert.buffer(g); + assert.buffer(p); + assert.buffer(x); + g = new jsbn(g); + p = new jsbn(p); + x = new jsbn(x); + var y = g.modPow(x, p); + var ybuf = bigintToMpBuf(y); + return (ybuf); +} + +function calculateED25519Public(k) { + assert.buffer(k); + + var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); + return (Buffer.from(kp.publicKey)); +} + +function calculateX25519Public(k) { + assert.buffer(k); + + var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); + return (Buffer.from(kp.publicKey)); +} + +function addRSAMissing(key) { + assert.object(key); + assertCompatible(key, PrivateKey, [1, 1]); + + var d = new jsbn(key.part.d.data); + var buf; + + if (!key.part.dmodp) { + var p = new jsbn(key.part.p.data); + var dmodp = d.mod(p.subtract(1)); + + buf = bigintToMpBuf(dmodp); + key.part.dmodp = {name: 'dmodp', data: buf}; + key.parts.push(key.part.dmodp); + } + if (!key.part.dmodq) { + var q = new jsbn(key.part.q.data); + var dmodq = d.mod(q.subtract(1)); + + buf = bigintToMpBuf(dmodq); + key.part.dmodq = {name: 'dmodq', data: buf}; + key.parts.push(key.part.dmodq); + } +} + +function publicFromPrivateECDSA(curveName, priv) { + assert.string(curveName, 'curveName'); + assert.buffer(priv); + var params = algs.curves[curveName]; + var p = new jsbn(params.p); + var a = new jsbn(params.a); + var b = new jsbn(params.b); + var curve = new ec.ECCurveFp(p, a, b); + var G = curve.decodePointHex(params.G.toString('hex')); + + var d = new jsbn(mpNormalize(priv)); + var pub = G.multiply(d); + pub = Buffer.from(curve.encodePointHex(pub), 'hex'); + + var parts = []; + parts.push({name: 'curve', data: Buffer.from(curveName)}); + parts.push({name: 'Q', data: pub}); + + var key = new Key({type: 'ecdsa', curve: curve, parts: parts}); + return (key); +} + +function opensshCipherInfo(cipher) { + var inf = {}; + switch (cipher) { + case '3des-cbc': + inf.keySize = 24; + inf.blockSize = 8; + inf.opensslName = 'des-ede3-cbc'; + break; + case 'blowfish-cbc': + inf.keySize = 16; + inf.blockSize = 8; + inf.opensslName = 'bf-cbc'; + break; + case 'aes128-cbc': + case 'aes128-ctr': + case 'aes128-gcm@openssh.com': + inf.keySize = 16; + inf.blockSize = 16; + inf.opensslName = 'aes-128-' + cipher.slice(7, 10); + break; + case 'aes192-cbc': + case 'aes192-ctr': + case 'aes192-gcm@openssh.com': + inf.keySize = 24; + inf.blockSize = 16; + inf.opensslName = 'aes-192-' + cipher.slice(7, 10); + break; + case 'aes256-cbc': + case 'aes256-ctr': + case 'aes256-gcm@openssh.com': + inf.keySize = 32; + inf.blockSize = 16; + inf.opensslName = 'aes-256-' + cipher.slice(7, 10); + break; + default: + throw (new Error( + 'Unsupported openssl cipher "' + cipher + '"')); + } + return (inf); +} + + +/***/ }), + +/***/ 281: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate_enum(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; @@ -13660,155 +8510,1024 @@ module.exports = function generate_items(it, $keyword, $ruleType) { var $breakOnError = !it.opts.allErrors; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - var $idx = 'i' + $lvl, - $dataNxt = $it.dataLevel = it.dataLevel + 1, - $nextData = 'data' + $dataNxt, - $currentBaseId = it.baseId; - out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; - if (Array.isArray($schema)) { - var $additionalItems = it.schema.additionalItems; - if ($additionalItems === false) { - out += ' ' + ($valid) + ' = ' + ($data) + '.length <= ' + ($schema.length) + '; '; - var $currErrSchemaPath = $errSchemaPath; - $errSchemaPath = it.errSchemaPath + '/additionalItems'; - out += ' if (!' + ($valid) + ') { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('additionalItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schema.length) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should NOT have more than ' + ($schema.length) + ' items\' '; - } - if (it.opts.verbose) { - out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } '; - $errSchemaPath = $currErrSchemaPath; - if ($breakOnError) { - $closingBraces += '}'; - out += ' else { '; - } + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $i = 'i' + $lvl, + $vSchema = 'schema' + $lvl; + if (!$isData) { + out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + ';'; + } + out += 'var ' + ($valid) + ';'; + if ($isData) { + out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {'; + } + out += '' + ($valid) + ' = false;for (var ' + ($i) + '=0; ' + ($i) + '<' + ($vSchema) + '.length; ' + ($i) + '++) if (equal(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + '])) { ' + ($valid) + ' = true; break; }'; + if ($isData) { + out += ' } '; + } + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('enum') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValues: schema' + ($lvl) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be equal to one of the allowed values\' '; } - var arr1 = $schema; - if (arr1) { - var $sch, $i = -1, - l1 = arr1.length - 1; - while ($i < l1) { - $sch = arr1[$i += 1]; - if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { - out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($i) + ') { '; - var $passData = $data + '[' + $i + ']'; - $it.schema = $sch; - $it.schemaPath = $schemaPath + '[' + $i + ']'; - $it.errSchemaPath = $errSchemaPath + '/' + $i; - $it.errorPath = it.util.getPathExpr(it.errorPath, $i, it.opts.jsonPointers, true); - $it.dataPathArr[$dataNxt] = $i; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; - } - out += ' } '; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; - } - } - } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } - if (typeof $additionalItems == 'object' && (it.opts.strictKeywords ? typeof $additionalItems == 'object' && Object.keys($additionalItems).length > 0 : it.util.schemaHasRules($additionalItems, it.RULES.all))) { - $it.schema = $additionalItems; - $it.schemaPath = it.schemaPath + '.additionalItems'; - $it.errSchemaPath = it.errSchemaPath + '/additionalItems'; - out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($schema.length) + ') { for (var ' + ($idx) + ' = ' + ($schema.length) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; - $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); - var $passData = $data + '[' + $idx + ']'; - $it.dataPathArr[$dataNxt] = $idx; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; - } - if ($breakOnError) { - out += ' if (!' + ($nextValid) + ') break; '; - } - out += ' } } '; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; - } - } - } else if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { - $it.schema = $schema; - $it.schemaPath = $schemaPath; - $it.errSchemaPath = $errSchemaPath; - out += ' for (var ' + ($idx) + ' = ' + (0) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; - $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); - var $passData = $data + '[' + $idx + ']'; - $it.dataPathArr[$dataNxt] = $idx; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + out += ' validate.errors = [' + (__err) + ']; return false; '; } - if ($breakOnError) { - out += ' if (!' + ($nextValid) + ') break; '; - } - out += ' }'; + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } + out += ' }'; if ($breakOnError) { - out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; + out += ' else { '; } - out = it.util.cleanUpCode(out); return out; } /***/ }), -/***/ 413: -/***/ (function(module) { +/***/ 286: +/***/ (function(__unusedmodule, exports) { + +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +// NOTE: These type checking functions intentionally don't use `instanceof` +// because it is fragile and can be easily faked with `Object.create()`. + +function isArray(arg) { + if (Array.isArray) { + return Array.isArray(arg); + } + return objectToString(arg) === '[object Array]'; +} +exports.isArray = isArray; + +function isBoolean(arg) { + return typeof arg === 'boolean'; +} +exports.isBoolean = isBoolean; + +function isNull(arg) { + return arg === null; +} +exports.isNull = isNull; + +function isNullOrUndefined(arg) { + return arg == null; +} +exports.isNullOrUndefined = isNullOrUndefined; + +function isNumber(arg) { + return typeof arg === 'number'; +} +exports.isNumber = isNumber; + +function isString(arg) { + return typeof arg === 'string'; +} +exports.isString = isString; + +function isSymbol(arg) { + return typeof arg === 'symbol'; +} +exports.isSymbol = isSymbol; + +function isUndefined(arg) { + return arg === void 0; +} +exports.isUndefined = isUndefined; + +function isRegExp(re) { + return objectToString(re) === '[object RegExp]'; +} +exports.isRegExp = isRegExp; + +function isObject(arg) { + return typeof arg === 'object' && arg !== null; +} +exports.isObject = isObject; + +function isDate(d) { + return objectToString(d) === '[object Date]'; +} +exports.isDate = isDate; + +function isError(e) { + return (objectToString(e) === '[object Error]' || e instanceof Error); +} +exports.isError = isError; + +function isFunction(arg) { + return typeof arg === 'function'; +} +exports.isFunction = isFunction; + +function isPrimitive(arg) { + return arg === null || + typeof arg === 'boolean' || + typeof arg === 'number' || + typeof arg === 'string' || + typeof arg === 'symbol' || // ES6 symbol + typeof arg === 'undefined'; +} +exports.isPrimitive = isPrimitive; + +exports.isBuffer = Buffer.isBuffer; + +function objectToString(o) { + return Object.prototype.toString.call(o); +} -module.exports = require("stream"); /***/ }), -/***/ 417: -/***/ (function(module) { +/***/ 287: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +"use strict"; + + +var url = __webpack_require__(835) +var qs = __webpack_require__(386) +var caseless = __webpack_require__(254) +var uuid = __webpack_require__(826) +var oauth = __webpack_require__(113) +var crypto = __webpack_require__(417) +var Buffer = __webpack_require__(149).Buffer + +function OAuth (request) { + this.request = request + this.params = null +} + +OAuth.prototype.buildParams = function (_oauth, uri, method, query, form, qsLib) { + var oa = {} + for (var i in _oauth) { + oa['oauth_' + i] = _oauth[i] + } + if (!oa.oauth_version) { + oa.oauth_version = '1.0' + } + if (!oa.oauth_timestamp) { + oa.oauth_timestamp = Math.floor(Date.now() / 1000).toString() + } + if (!oa.oauth_nonce) { + oa.oauth_nonce = uuid().replace(/-/g, '') + } + if (!oa.oauth_signature_method) { + oa.oauth_signature_method = 'HMAC-SHA1' + } + + var consumer_secret_or_private_key = oa.oauth_consumer_secret || oa.oauth_private_key // eslint-disable-line camelcase + delete oa.oauth_consumer_secret + delete oa.oauth_private_key + + var token_secret = oa.oauth_token_secret // eslint-disable-line camelcase + delete oa.oauth_token_secret + + var realm = oa.oauth_realm + delete oa.oauth_realm + delete oa.oauth_transport_method + + var baseurl = uri.protocol + '//' + uri.host + uri.pathname + var params = qsLib.parse([].concat(query, form, qsLib.stringify(oa)).join('&')) + + oa.oauth_signature = oauth.sign( + oa.oauth_signature_method, + method, + baseurl, + params, + consumer_secret_or_private_key, // eslint-disable-line camelcase + token_secret // eslint-disable-line camelcase + ) + + if (realm) { + oa.realm = realm + } + + return oa +} + +OAuth.prototype.buildBodyHash = function (_oauth, body) { + if (['HMAC-SHA1', 'RSA-SHA1'].indexOf(_oauth.signature_method || 'HMAC-SHA1') < 0) { + this.request.emit('error', new Error('oauth: ' + _oauth.signature_method + + ' signature_method not supported with body_hash signing.')) + } + + var shasum = crypto.createHash('sha1') + shasum.update(body || '') + var sha1 = shasum.digest('hex') + + return Buffer.from(sha1, 'hex').toString('base64') +} + +OAuth.prototype.concatParams = function (oa, sep, wrap) { + wrap = wrap || '' + + var params = Object.keys(oa).filter(function (i) { + return i !== 'realm' && i !== 'oauth_signature' + }).sort() + + if (oa.realm) { + params.splice(0, 0, 'realm') + } + params.push('oauth_signature') + + return params.map(function (i) { + return i + '=' + wrap + oauth.rfc3986(oa[i]) + wrap + }).join(sep) +} + +OAuth.prototype.onRequest = function (_oauth) { + var self = this + self.params = _oauth + + var uri = self.request.uri || {} + var method = self.request.method || '' + var headers = caseless(self.request.headers) + var body = self.request.body || '' + var qsLib = self.request.qsLib || qs + + var form + var query + var contentType = headers.get('content-type') || '' + var formContentType = 'application/x-www-form-urlencoded' + var transport = _oauth.transport_method || 'header' + + if (contentType.slice(0, formContentType.length) === formContentType) { + contentType = formContentType + form = body + } + if (uri.query) { + query = uri.query + } + if (transport === 'body' && (method !== 'POST' || contentType !== formContentType)) { + self.request.emit('error', new Error('oauth: transport_method of body requires POST ' + + 'and content-type ' + formContentType)) + } + + if (!form && typeof _oauth.body_hash === 'boolean') { + _oauth.body_hash = self.buildBodyHash(_oauth, self.request.body.toString()) + } + + var oa = self.buildParams(_oauth, uri, method, query, form, qsLib) + + switch (transport) { + case 'header': + self.request.setHeader('Authorization', 'OAuth ' + self.concatParams(oa, ',', '"')) + break + + case 'query': + var href = self.request.uri.href += (query ? '&' : '?') + self.concatParams(oa, '&') + self.request.uri = url.parse(href) + self.request.path = self.request.uri.path + break + + case 'body': + self.request.body = (form ? form + '&' : '') + self.concatParams(oa, '&') + break + + default: + self.request.emit('error', new Error('oauth: transport_method invalid')) + } +} + +exports.OAuth = OAuth -module.exports = require("crypto"); /***/ }), -/***/ 421: +/***/ 290: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2017 Joyent, Inc. + +module.exports = { + DiffieHellman: DiffieHellman, + generateECDSA: generateECDSA, + generateED25519: generateED25519 +}; + +var assert = __webpack_require__(477); +var crypto = __webpack_require__(417); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var utils = __webpack_require__(270); +var nacl = __webpack_require__(196); + +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); + +var CRYPTO_HAVE_ECDH = (crypto.createECDH !== undefined); + +var ecdh = __webpack_require__(886); +var ec = __webpack_require__(729); +var jsbn = __webpack_require__(242).BigInteger; + +function DiffieHellman(key) { + utils.assertCompatible(key, Key, [1, 4], 'key'); + this._isPriv = PrivateKey.isPrivateKey(key, [1, 3]); + this._algo = key.type; + this._curve = key.curve; + this._key = key; + if (key.type === 'dsa') { + if (!CRYPTO_HAVE_ECDH) { + throw (new Error('Due to bugs in the node 0.10 ' + + 'crypto API, node 0.12.x or later is required ' + + 'to use DH')); + } + this._dh = crypto.createDiffieHellman( + key.part.p.data, undefined, + key.part.g.data, undefined); + this._p = key.part.p; + this._g = key.part.g; + if (this._isPriv) + this._dh.setPrivateKey(key.part.x.data); + this._dh.setPublicKey(key.part.y.data); + + } else if (key.type === 'ecdsa') { + if (!CRYPTO_HAVE_ECDH) { + this._ecParams = new X9ECParameters(this._curve); + + if (this._isPriv) { + this._priv = new ECPrivate( + this._ecParams, key.part.d.data); + } + return; + } + + var curve = { + 'nistp256': 'prime256v1', + 'nistp384': 'secp384r1', + 'nistp521': 'secp521r1' + }[key.curve]; + this._dh = crypto.createECDH(curve); + if (typeof (this._dh) !== 'object' || + typeof (this._dh.setPrivateKey) !== 'function') { + CRYPTO_HAVE_ECDH = false; + DiffieHellman.call(this, key); + return; + } + if (this._isPriv) + this._dh.setPrivateKey(key.part.d.data); + this._dh.setPublicKey(key.part.Q.data); + + } else if (key.type === 'curve25519') { + if (this._isPriv) { + utils.assertCompatible(key, PrivateKey, [1, 5], 'key'); + this._priv = key.part.k.data; + } + + } else { + throw (new Error('DH not supported for ' + key.type + ' keys')); + } +} + +DiffieHellman.prototype.getPublicKey = function () { + if (this._isPriv) + return (this._key.toPublic()); + return (this._key); +}; + +DiffieHellman.prototype.getPrivateKey = function () { + if (this._isPriv) + return (this._key); + else + return (undefined); +}; +DiffieHellman.prototype.getKey = DiffieHellman.prototype.getPrivateKey; + +DiffieHellman.prototype._keyCheck = function (pk, isPub) { + assert.object(pk, 'key'); + if (!isPub) + utils.assertCompatible(pk, PrivateKey, [1, 3], 'key'); + utils.assertCompatible(pk, Key, [1, 4], 'key'); + + if (pk.type !== this._algo) { + throw (new Error('A ' + pk.type + ' key cannot be used in ' + + this._algo + ' Diffie-Hellman')); + } + + if (pk.curve !== this._curve) { + throw (new Error('A key from the ' + pk.curve + ' curve ' + + 'cannot be used with a ' + this._curve + + ' Diffie-Hellman')); + } + + if (pk.type === 'dsa') { + assert.deepEqual(pk.part.p, this._p, + 'DSA key prime does not match'); + assert.deepEqual(pk.part.g, this._g, + 'DSA key generator does not match'); + } +}; + +DiffieHellman.prototype.setKey = function (pk) { + this._keyCheck(pk); + + if (pk.type === 'dsa') { + this._dh.setPrivateKey(pk.part.x.data); + this._dh.setPublicKey(pk.part.y.data); + + } else if (pk.type === 'ecdsa') { + if (CRYPTO_HAVE_ECDH) { + this._dh.setPrivateKey(pk.part.d.data); + this._dh.setPublicKey(pk.part.Q.data); + } else { + this._priv = new ECPrivate( + this._ecParams, pk.part.d.data); + } + + } else if (pk.type === 'curve25519') { + var k = pk.part.k; + if (!pk.part.k) + k = pk.part.r; + this._priv = k.data; + if (this._priv[0] === 0x00) + this._priv = this._priv.slice(1); + this._priv = this._priv.slice(0, 32); + } + this._key = pk; + this._isPriv = true; +}; +DiffieHellman.prototype.setPrivateKey = DiffieHellman.prototype.setKey; + +DiffieHellman.prototype.computeSecret = function (otherpk) { + this._keyCheck(otherpk, true); + if (!this._isPriv) + throw (new Error('DH exchange has not been initialized with ' + + 'a private key yet')); + + var pub; + if (this._algo === 'dsa') { + return (this._dh.computeSecret( + otherpk.part.y.data)); + + } else if (this._algo === 'ecdsa') { + if (CRYPTO_HAVE_ECDH) { + return (this._dh.computeSecret( + otherpk.part.Q.data)); + } else { + pub = new ECPublic( + this._ecParams, otherpk.part.Q.data); + return (this._priv.deriveSharedSecret(pub)); + } + + } else if (this._algo === 'curve25519') { + pub = otherpk.part.A.data; + while (pub[0] === 0x00 && pub.length > 32) + pub = pub.slice(1); + var priv = this._priv; + assert.strictEqual(pub.length, 32); + assert.strictEqual(priv.length, 32); + + var secret = nacl.box.before(new Uint8Array(pub), + new Uint8Array(priv)); + + return (Buffer.from(secret)); + } + + throw (new Error('Invalid algorithm: ' + this._algo)); +}; + +DiffieHellman.prototype.generateKey = function () { + var parts = []; + var priv, pub; + if (this._algo === 'dsa') { + this._dh.generateKeys(); + + parts.push({name: 'p', data: this._p.data}); + parts.push({name: 'q', data: this._key.part.q.data}); + parts.push({name: 'g', data: this._g.data}); + parts.push({name: 'y', data: this._dh.getPublicKey()}); + parts.push({name: 'x', data: this._dh.getPrivateKey()}); + this._key = new PrivateKey({ + type: 'dsa', + parts: parts + }); + this._isPriv = true; + return (this._key); + + } else if (this._algo === 'ecdsa') { + if (CRYPTO_HAVE_ECDH) { + this._dh.generateKeys(); + + parts.push({name: 'curve', + data: Buffer.from(this._curve)}); + parts.push({name: 'Q', data: this._dh.getPublicKey()}); + parts.push({name: 'd', data: this._dh.getPrivateKey()}); + this._key = new PrivateKey({ + type: 'ecdsa', + curve: this._curve, + parts: parts + }); + this._isPriv = true; + return (this._key); + + } else { + var n = this._ecParams.getN(); + var r = new jsbn(crypto.randomBytes(n.bitLength())); + var n1 = n.subtract(jsbn.ONE); + priv = r.mod(n1).add(jsbn.ONE); + pub = this._ecParams.getG().multiply(priv); + + priv = Buffer.from(priv.toByteArray()); + pub = Buffer.from(this._ecParams.getCurve(). + encodePointHex(pub), 'hex'); + + this._priv = new ECPrivate(this._ecParams, priv); + + parts.push({name: 'curve', + data: Buffer.from(this._curve)}); + parts.push({name: 'Q', data: pub}); + parts.push({name: 'd', data: priv}); + + this._key = new PrivateKey({ + type: 'ecdsa', + curve: this._curve, + parts: parts + }); + this._isPriv = true; + return (this._key); + } + + } else if (this._algo === 'curve25519') { + var pair = nacl.box.keyPair(); + priv = Buffer.from(pair.secretKey); + pub = Buffer.from(pair.publicKey); + priv = Buffer.concat([priv, pub]); + assert.strictEqual(priv.length, 64); + assert.strictEqual(pub.length, 32); + + parts.push({name: 'A', data: pub}); + parts.push({name: 'k', data: priv}); + this._key = new PrivateKey({ + type: 'curve25519', + parts: parts + }); + this._isPriv = true; + return (this._key); + } + + throw (new Error('Invalid algorithm: ' + this._algo)); +}; +DiffieHellman.prototype.generateKeys = DiffieHellman.prototype.generateKey; + +/* These are helpers for using ecc-jsbn (for node 0.10 compatibility). */ + +function X9ECParameters(name) { + var params = algs.curves[name]; + assert.object(params); + + var p = new jsbn(params.p); + var a = new jsbn(params.a); + var b = new jsbn(params.b); + var n = new jsbn(params.n); + var h = jsbn.ONE; + var curve = new ec.ECCurveFp(p, a, b); + var G = curve.decodePointHex(params.G.toString('hex')); + + this.curve = curve; + this.g = G; + this.n = n; + this.h = h; +} +X9ECParameters.prototype.getCurve = function () { return (this.curve); }; +X9ECParameters.prototype.getG = function () { return (this.g); }; +X9ECParameters.prototype.getN = function () { return (this.n); }; +X9ECParameters.prototype.getH = function () { return (this.h); }; + +function ECPublic(params, buffer) { + this._params = params; + if (buffer[0] === 0x00) + buffer = buffer.slice(1); + this._pub = params.getCurve().decodePointHex(buffer.toString('hex')); +} + +function ECPrivate(params, buffer) { + this._params = params; + this._priv = new jsbn(utils.mpNormalize(buffer)); +} +ECPrivate.prototype.deriveSharedSecret = function (pubKey) { + assert.ok(pubKey instanceof ECPublic); + var S = pubKey._pub.multiply(this._priv); + return (Buffer.from(S.getX().toBigInteger().toByteArray())); +}; + +function generateED25519() { + var pair = nacl.sign.keyPair(); + var priv = Buffer.from(pair.secretKey); + var pub = Buffer.from(pair.publicKey); + assert.strictEqual(priv.length, 64); + assert.strictEqual(pub.length, 32); + + var parts = []; + parts.push({name: 'A', data: pub}); + parts.push({name: 'k', data: priv.slice(0, 32)}); + var key = new PrivateKey({ + type: 'ed25519', + parts: parts + }); + return (key); +} + +/* Generates a new ECDSA private key on a given curve. */ +function generateECDSA(curve) { + var parts = []; + var key; + + if (CRYPTO_HAVE_ECDH) { + /* + * Node crypto doesn't expose key generation directly, but the + * ECDH instances can generate keys. It turns out this just + * calls into the OpenSSL generic key generator, and we can + * read its output happily without doing an actual DH. So we + * use that here. + */ + var osCurve = { + 'nistp256': 'prime256v1', + 'nistp384': 'secp384r1', + 'nistp521': 'secp521r1' + }[curve]; + + var dh = crypto.createECDH(osCurve); + dh.generateKeys(); + + parts.push({name: 'curve', + data: Buffer.from(curve)}); + parts.push({name: 'Q', data: dh.getPublicKey()}); + parts.push({name: 'd', data: dh.getPrivateKey()}); + + key = new PrivateKey({ + type: 'ecdsa', + curve: curve, + parts: parts + }); + return (key); + } else { + + var ecParams = new X9ECParameters(curve); + + /* This algorithm taken from FIPS PUB 186-4 (section B.4.1) */ + var n = ecParams.getN(); + /* + * The crypto.randomBytes() function can only give us whole + * bytes, so taking a nod from X9.62, we round up. + */ + var cByteLen = Math.ceil((n.bitLength() + 64) / 8); + var c = new jsbn(crypto.randomBytes(cByteLen)); + + var n1 = n.subtract(jsbn.ONE); + var priv = c.mod(n1).add(jsbn.ONE); + var pub = ecParams.getG().multiply(priv); + + priv = Buffer.from(priv.toByteArray()); + pub = Buffer.from(ecParams.getCurve(). + encodePointHex(pub), 'hex'); + + parts.push({name: 'curve', data: Buffer.from(curve)}); + parts.push({name: 'Q', data: pub}); + parts.push({name: 'd', data: priv}); + + key = new PrivateKey({ + type: 'ecdsa', + curve: curve, + parts: parts + }); + return (key); + } +} + + +/***/ }), + +/***/ 293: +/***/ (function(module) { + +module.exports = require("buffer"); + +/***/ }), + +/***/ 314: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate_custom(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $rule = this, + $definition = 'definition' + $lvl, + $rDef = $rule.definition, + $closingBraces = ''; + var $compile, $inline, $macro, $ruleValidate, $validateCode; + if ($isData && $rDef.$data) { + $validateCode = 'keywordValidate' + $lvl; + var $validateSchema = $rDef.validateSchema; + out += ' var ' + ($definition) + ' = RULES.custom[\'' + ($keyword) + '\'].definition; var ' + ($validateCode) + ' = ' + ($definition) + '.validate;'; + } else { + $ruleValidate = it.useCustomRule($rule, $schema, it.schema, it); + if (!$ruleValidate) return; + $schemaValue = 'validate.schema' + $schemaPath; + $validateCode = $ruleValidate.code; + $compile = $rDef.compile; + $inline = $rDef.inline; + $macro = $rDef.macro; + } + var $ruleErrs = $validateCode + '.errors', + $i = 'i' + $lvl, + $ruleErr = 'ruleErr' + $lvl, + $asyncKeyword = $rDef.async; + if ($asyncKeyword && !it.async) throw new Error('async keyword in sync schema'); + if (!($inline || $macro)) { + out += '' + ($ruleErrs) + ' = null;'; + } + out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; + if ($isData && $rDef.$data) { + $closingBraces += '}'; + out += ' if (' + ($schemaValue) + ' === undefined) { ' + ($valid) + ' = true; } else { '; + if ($validateSchema) { + $closingBraces += '}'; + out += ' ' + ($valid) + ' = ' + ($definition) + '.validateSchema(' + ($schemaValue) + '); if (' + ($valid) + ') { '; + } + } + if ($inline) { + if ($rDef.statements) { + out += ' ' + ($ruleValidate.validate) + ' '; + } else { + out += ' ' + ($valid) + ' = ' + ($ruleValidate.validate) + '; '; + } + } else if ($macro) { + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + $it.schema = $ruleValidate.validate; + $it.schemaPath = ''; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + var $code = it.validate($it).replace(/validate\.schema/g, $validateCode); + it.compositeRule = $it.compositeRule = $wasComposite; + out += ' ' + ($code); + } else { + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; + out += ' ' + ($validateCode) + '.call( '; + if (it.opts.passContext) { + out += 'this'; + } else { + out += 'self'; + } + if ($compile || $rDef.schema === false) { + out += ' , ' + ($data) + ' '; + } else { + out += ' , ' + ($schemaValue) + ' , ' + ($data) + ' , validate.schema' + (it.schemaPath) + ' '; + } + out += ' , (dataPath || \'\')'; + if (it.errorPath != '""') { + out += ' + ' + (it.errorPath); + } + var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', + $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; + out += ' , ' + ($parentData) + ' , ' + ($parentDataProperty) + ' , rootData ) '; + var def_callRuleValidate = out; + out = $$outStack.pop(); + if ($rDef.errors === false) { + out += ' ' + ($valid) + ' = '; + if ($asyncKeyword) { + out += 'await '; + } + out += '' + (def_callRuleValidate) + '; '; + } else { + if ($asyncKeyword) { + $ruleErrs = 'customErrors' + $lvl; + out += ' var ' + ($ruleErrs) + ' = null; try { ' + ($valid) + ' = await ' + (def_callRuleValidate) + '; } catch (e) { ' + ($valid) + ' = false; if (e instanceof ValidationError) ' + ($ruleErrs) + ' = e.errors; else throw e; } '; + } else { + out += ' ' + ($ruleErrs) + ' = null; ' + ($valid) + ' = ' + (def_callRuleValidate) + '; '; + } + } + } + if ($rDef.modifying) { + out += ' if (' + ($parentData) + ') ' + ($data) + ' = ' + ($parentData) + '[' + ($parentDataProperty) + '];'; + } + out += '' + ($closingBraces); + if ($rDef.valid) { + if ($breakOnError) { + out += ' if (true) { '; + } + } else { + out += ' if ( '; + if ($rDef.valid === undefined) { + out += ' !'; + if ($macro) { + out += '' + ($nextValid); + } else { + out += '' + ($valid); + } + } else { + out += ' ' + (!$rDef.valid) + ' '; + } + out += ') { '; + $errorKeyword = $rule.keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'custom') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { keyword: \'' + ($rule.keyword) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should pass "' + ($rule.keyword) + '" keyword validation\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + var def_customError = out; + out = $$outStack.pop(); + if ($inline) { + if ($rDef.errors) { + if ($rDef.errors != 'full') { + out += ' for (var ' + ($i) + '=' + ($errs) + '; ' + ($i) + '= lvl) throw new Error('Cannot access property/index ' + up + ' levels up, current level is ' + lvl); - return paths[lvl - up]; - } - - if (up > lvl) throw new Error('Cannot access data ' + up + ' levels up, current level is ' + lvl); - data = 'data' + ((lvl - up) || ''); - if (!jsonPointer) return data; + $schemaValue = $schema; } - - var expr = data; - var segments = jsonPointer.split('/'); - for (var i=0; i', + $notOp = $isMax ? '>' : '<', + $errorKeyword = undefined; + if ($isDataExcl) { + var $schemaValueExcl = it.util.getData($schemaExcl.$data, $dataLvl, it.dataPathArr), + $exclusive = 'exclusive' + $lvl, + $exclType = 'exclType' + $lvl, + $exclIsNumber = 'exclIsNumber' + $lvl, + $opExpr = 'op' + $lvl, + $opStr = '\' + ' + $opExpr + ' + \''; + out += ' var schemaExcl' + ($lvl) + ' = ' + ($schemaValueExcl) + '; '; + $schemaValueExcl = 'schemaExcl' + $lvl; + out += ' var ' + ($exclusive) + '; var ' + ($exclType) + ' = typeof ' + ($schemaValueExcl) + '; if (' + ($exclType) + ' != \'boolean\' && ' + ($exclType) + ' != \'undefined\' && ' + ($exclType) + ' != \'number\') { '; + var $errorKeyword = $exclusiveKeyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_exclusiveLimit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'' + ($exclusiveKeyword) + ' should be boolean\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' ' + ($exclType) + ' == \'number\' ? ( (' + ($exclusive) + ' = ' + ($schemaValue) + ' === undefined || ' + ($schemaValueExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ') ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValueExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) : ( (' + ($exclusive) + ' = ' + ($schemaValueExcl) + ' === true) ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValue) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { var op' + ($lvl) + ' = ' + ($exclusive) + ' ? \'' + ($op) + '\' : \'' + ($op) + '=\'; '; + if ($schema === undefined) { + $errorKeyword = $exclusiveKeyword; + $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; + $schemaValue = $schemaValueExcl; + $isData = $isDataExcl; + } + } else { + var $exclIsNumber = typeof $schemaExcl == 'number', + $opStr = $op; + if ($exclIsNumber && $isData) { + var $opExpr = '\'' + $opStr + '\''; + out += ' if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' ( ' + ($schemaValue) + ' === undefined || ' + ($schemaExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ' ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { '; + } else { + if ($exclIsNumber && $schema === undefined) { + $exclusive = true; + $errorKeyword = $exclusiveKeyword; + $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; + $schemaValue = $schemaExcl; + $notOp += '='; + } else { + if ($exclIsNumber) $schemaValue = Math[$isMax ? 'min' : 'max']($schemaExcl, $schema); + if ($schemaExcl === ($exclIsNumber ? $schemaValue : true)) { + $exclusive = true; + $errorKeyword = $exclusiveKeyword; + $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword; + $notOp += '='; + } else { + $exclusive = false; + $opStr += '='; + } + } + var $opExpr = '\'' + $opStr + '\''; + out += ' if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + } + out += ' ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' || ' + ($data) + ' !== ' + ($data) + ') { '; } } - return expr; -} - - -function joinPaths (a, b) { - if (a == '""') return b; - return (a + ' + ' + b).replace(/' \+ '/g, ''); -} - - -function unescapeFragment(str) { - return unescapeJsonPointer(decodeURIComponent(str)); -} - - -function escapeFragment(str) { - return encodeURIComponent(escapeJsonPointer(str)); -} - - -function escapeJsonPointer(str) { - return str.replace(/~/g, '~0').replace(/\//g, '~1'); -} - - -function unescapeJsonPointer(str) { - return str.replace(/~1/g, '/').replace(/~0/g, '~'); + $errorKeyword = $errorKeyword || $keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_limit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { comparison: ' + ($opExpr) + ', limit: ' + ($schemaValue) + ', exclusive: ' + ($exclusive) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be ' + ($opStr) + ' '; + if ($isData) { + out += '\' + ' + ($schemaValue); + } else { + out += '' + ($schemaValue) + '\''; + } + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + if ($breakOnError) { + out += ' else { '; + } + return out; } /***/ }), -/***/ 442: +/***/ 342: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2012 Joyent, Inc. All rights reserved. + +var assert = __webpack_require__(477); +var util = __webpack_require__(669); +var utils = __webpack_require__(909); + + + +///--- Globals + +var HASH_ALGOS = utils.HASH_ALGOS; +var PK_ALGOS = utils.PK_ALGOS; +var HttpSignatureError = utils.HttpSignatureError; +var InvalidAlgorithmError = utils.InvalidAlgorithmError; +var validateAlgorithm = utils.validateAlgorithm; + +var State = { + New: 0, + Params: 1 +}; + +var ParamsState = { + Name: 0, + Quote: 1, + Value: 2, + Comma: 3 +}; + + +///--- Specific Errors + + +function ExpiredRequestError(message) { + HttpSignatureError.call(this, message, ExpiredRequestError); +} +util.inherits(ExpiredRequestError, HttpSignatureError); + + +function InvalidHeaderError(message) { + HttpSignatureError.call(this, message, InvalidHeaderError); +} +util.inherits(InvalidHeaderError, HttpSignatureError); + + +function InvalidParamsError(message) { + HttpSignatureError.call(this, message, InvalidParamsError); +} +util.inherits(InvalidParamsError, HttpSignatureError); + + +function MissingHeaderError(message) { + HttpSignatureError.call(this, message, MissingHeaderError); +} +util.inherits(MissingHeaderError, HttpSignatureError); + +function StrictParsingError(message) { + HttpSignatureError.call(this, message, StrictParsingError); +} +util.inherits(StrictParsingError, HttpSignatureError); + +///--- Exported API + +module.exports = { + + /** + * Parses the 'Authorization' header out of an http.ServerRequest object. + * + * Note that this API will fully validate the Authorization header, and throw + * on any error. It will not however check the signature, or the keyId format + * as those are specific to your environment. You can use the options object + * to pass in extra constraints. + * + * As a response object you can expect this: + * + * { + * "scheme": "Signature", + * "params": { + * "keyId": "foo", + * "algorithm": "rsa-sha256", + * "headers": [ + * "date" or "x-date", + * "digest" + * ], + * "signature": "base64" + * }, + * "signingString": "ready to be passed to crypto.verify()" + * } + * + * @param {Object} request an http.ServerRequest. + * @param {Object} options an optional options object with: + * - clockSkew: allowed clock skew in seconds (default 300). + * - headers: required header names (def: date or x-date) + * - algorithms: algorithms to support (default: all). + * - strict: should enforce latest spec parsing + * (default: false). + * @return {Object} parsed out object (see above). + * @throws {TypeError} on invalid input. + * @throws {InvalidHeaderError} on an invalid Authorization header error. + * @throws {InvalidParamsError} if the params in the scheme are invalid. + * @throws {MissingHeaderError} if the params indicate a header not present, + * either in the request headers from the params, + * or not in the params from a required header + * in options. + * @throws {StrictParsingError} if old attributes are used in strict parsing + * mode. + * @throws {ExpiredRequestError} if the value of date or x-date exceeds skew. + */ + parseRequest: function parseRequest(request, options) { + assert.object(request, 'request'); + assert.object(request.headers, 'request.headers'); + if (options === undefined) { + options = {}; + } + if (options.headers === undefined) { + options.headers = [request.headers['x-date'] ? 'x-date' : 'date']; + } + assert.object(options, 'options'); + assert.arrayOfString(options.headers, 'options.headers'); + assert.optionalFinite(options.clockSkew, 'options.clockSkew'); + + var authzHeaderName = options.authorizationHeaderName || 'authorization'; + + if (!request.headers[authzHeaderName]) { + throw new MissingHeaderError('no ' + authzHeaderName + ' header ' + + 'present in the request'); + } + + options.clockSkew = options.clockSkew || 300; + + + var i = 0; + var state = State.New; + var substate = ParamsState.Name; + var tmpName = ''; + var tmpValue = ''; + + var parsed = { + scheme: '', + params: {}, + signingString: '' + }; + + var authz = request.headers[authzHeaderName]; + for (i = 0; i < authz.length; i++) { + var c = authz.charAt(i); + + switch (Number(state)) { + + case State.New: + if (c !== ' ') parsed.scheme += c; + else state = State.Params; + break; + + case State.Params: + switch (Number(substate)) { + + case ParamsState.Name: + var code = c.charCodeAt(0); + // restricted name of A-Z / a-z + if ((code >= 0x41 && code <= 0x5a) || // A-Z + (code >= 0x61 && code <= 0x7a)) { // a-z + tmpName += c; + } else if (c === '=') { + if (tmpName.length === 0) + throw new InvalidHeaderError('bad param format'); + substate = ParamsState.Quote; + } else { + throw new InvalidHeaderError('bad param format'); + } + break; + + case ParamsState.Quote: + if (c === '"') { + tmpValue = ''; + substate = ParamsState.Value; + } else { + throw new InvalidHeaderError('bad param format'); + } + break; + + case ParamsState.Value: + if (c === '"') { + parsed.params[tmpName] = tmpValue; + substate = ParamsState.Comma; + } else { + tmpValue += c; + } + break; + + case ParamsState.Comma: + if (c === ',') { + tmpName = ''; + substate = ParamsState.Name; + } else { + throw new InvalidHeaderError('bad param format'); + } + break; + + default: + throw new Error('Invalid substate'); + } + break; + + default: + throw new Error('Invalid substate'); + } + + } + + if (!parsed.params.headers || parsed.params.headers === '') { + if (request.headers['x-date']) { + parsed.params.headers = ['x-date']; + } else { + parsed.params.headers = ['date']; + } + } else { + parsed.params.headers = parsed.params.headers.split(' '); + } + + // Minimally validate the parsed object + if (!parsed.scheme || parsed.scheme !== 'Signature') + throw new InvalidHeaderError('scheme was not "Signature"'); + + if (!parsed.params.keyId) + throw new InvalidHeaderError('keyId was not specified'); + + if (!parsed.params.algorithm) + throw new InvalidHeaderError('algorithm was not specified'); + + if (!parsed.params.signature) + throw new InvalidHeaderError('signature was not specified'); + + // Check the algorithm against the official list + parsed.params.algorithm = parsed.params.algorithm.toLowerCase(); + try { + validateAlgorithm(parsed.params.algorithm); + } catch (e) { + if (e instanceof InvalidAlgorithmError) + throw (new InvalidParamsError(parsed.params.algorithm + ' is not ' + + 'supported')); + else + throw (e); + } + + // Build the signingString + for (i = 0; i < parsed.params.headers.length; i++) { + var h = parsed.params.headers[i].toLowerCase(); + parsed.params.headers[i] = h; + + if (h === 'request-line') { + if (!options.strict) { + /* + * We allow headers from the older spec drafts if strict parsing isn't + * specified in options. + */ + parsed.signingString += + request.method + ' ' + request.url + ' HTTP/' + request.httpVersion; + } else { + /* Strict parsing doesn't allow older draft headers. */ + throw (new StrictParsingError('request-line is not a valid header ' + + 'with strict parsing enabled.')); + } + } else if (h === '(request-target)') { + parsed.signingString += + '(request-target): ' + request.method.toLowerCase() + ' ' + + request.url; + } else { + var value = request.headers[h]; + if (value === undefined) + throw new MissingHeaderError(h + ' was not in the request'); + parsed.signingString += h + ': ' + value; + } + + if ((i + 1) < parsed.params.headers.length) + parsed.signingString += '\n'; + } + + // Check against the constraints + var date; + if (request.headers.date || request.headers['x-date']) { + if (request.headers['x-date']) { + date = new Date(request.headers['x-date']); + } else { + date = new Date(request.headers.date); + } + var now = new Date(); + var skew = Math.abs(now.getTime() - date.getTime()); + + if (skew > options.clockSkew * 1000) { + throw new ExpiredRequestError('clock skew of ' + + (skew / 1000) + + 's was greater than ' + + options.clockSkew + 's'); + } + } + + options.headers.forEach(function (hdr) { + // Remember that we already checked any headers in the params + // were in the request, so if this passes we're good. + if (parsed.params.headers.indexOf(hdr.toLowerCase()) < 0) + throw new MissingHeaderError(hdr + ' was not a signed header'); + }); + + if (options.algorithms) { + if (options.algorithms.indexOf(parsed.params.algorithm) === -1) + throw new InvalidParamsError(parsed.params.algorithm + + ' is not a supported algorithm'); + } + + parsed.algorithm = parsed.params.algorithm.toUpperCase(); + parsed.keyId = parsed.params.keyId; + return parsed; + } + +}; + + +/***/ }), + +/***/ 343: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate_properties(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $key = 'key' + $lvl, + $idx = 'idx' + $lvl, + $dataNxt = $it.dataLevel = it.dataLevel + 1, + $nextData = 'data' + $dataNxt, + $dataProperties = 'dataProperties' + $lvl; + var $schemaKeys = Object.keys($schema || {}), + $pProperties = it.schema.patternProperties || {}, + $pPropertyKeys = Object.keys($pProperties), + $aProperties = it.schema.additionalProperties, + $someProperties = $schemaKeys.length || $pPropertyKeys.length, + $noAdditional = $aProperties === false, + $additionalIsSchema = typeof $aProperties == 'object' && Object.keys($aProperties).length, + $removeAdditional = it.opts.removeAdditional, + $checkAdditional = $noAdditional || $additionalIsSchema || $removeAdditional, + $ownProperties = it.opts.ownProperties, + $currentBaseId = it.baseId; + var $required = it.schema.required; + if ($required && !(it.opts.$data && $required.$data) && $required.length < it.opts.loopRequired) var $requiredHash = it.util.toHash($required); + out += 'var ' + ($errs) + ' = errors;var ' + ($nextValid) + ' = true;'; + if ($ownProperties) { + out += ' var ' + ($dataProperties) + ' = undefined;'; + } + if ($checkAdditional) { + if ($ownProperties) { + out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; + } else { + out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; + } + if ($someProperties) { + out += ' var isAdditional' + ($lvl) + ' = !(false '; + if ($schemaKeys.length) { + if ($schemaKeys.length > 8) { + out += ' || validate.schema' + ($schemaPath) + '.hasOwnProperty(' + ($key) + ') '; + } else { + var arr1 = $schemaKeys; + if (arr1) { + var $propertyKey, i1 = -1, + l1 = arr1.length - 1; + while (i1 < l1) { + $propertyKey = arr1[i1 += 1]; + out += ' || ' + ($key) + ' == ' + (it.util.toQuotedString($propertyKey)) + ' '; + } + } + } + } + if ($pPropertyKeys.length) { + var arr2 = $pPropertyKeys; + if (arr2) { + var $pProperty, $i = -1, + l2 = arr2.length - 1; + while ($i < l2) { + $pProperty = arr2[$i += 1]; + out += ' || ' + (it.usePattern($pProperty)) + '.test(' + ($key) + ') '; + } + } + } + out += ' ); if (isAdditional' + ($lvl) + ') { '; + } + if ($removeAdditional == 'all') { + out += ' delete ' + ($data) + '[' + ($key) + ']; '; + } else { + var $currentErrorPath = it.errorPath; + var $additionalProperty = '\' + ' + $key + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + } + if ($noAdditional) { + if ($removeAdditional) { + out += ' delete ' + ($data) + '[' + ($key) + ']; '; + } else { + out += ' ' + ($nextValid) + ' = false; '; + var $currErrSchemaPath = $errSchemaPath; + $errSchemaPath = it.errSchemaPath + '/additionalProperties'; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('additionalProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { additionalProperty: \'' + ($additionalProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is an invalid additional property'; + } else { + out += 'should NOT have additional properties'; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + $errSchemaPath = $currErrSchemaPath; + if ($breakOnError) { + out += ' break; '; + } + } + } else if ($additionalIsSchema) { + if ($removeAdditional == 'failing') { + out += ' var ' + ($errs) + ' = errors; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + $it.schema = $aProperties; + $it.schemaPath = it.schemaPath + '.additionalProperties'; + $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; + $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + var $passData = $data + '[' + $key + ']'; + $it.dataPathArr[$dataNxt] = $key; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + out += ' if (!' + ($nextValid) + ') { errors = ' + ($errs) + '; if (validate.errors !== null) { if (errors) validate.errors.length = errors; else validate.errors = null; } delete ' + ($data) + '[' + ($key) + ']; } '; + it.compositeRule = $it.compositeRule = $wasComposite; + } else { + $it.schema = $aProperties; + $it.schemaPath = it.schemaPath + '.additionalProperties'; + $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; + $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + var $passData = $data + '[' + $key + ']'; + $it.dataPathArr[$dataNxt] = $key; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + } + } + it.errorPath = $currentErrorPath; + } + if ($someProperties) { + out += ' } '; + } + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + var $useDefaults = it.opts.useDefaults && !it.compositeRule; + if ($schemaKeys.length) { + var arr3 = $schemaKeys; + if (arr3) { + var $propertyKey, i3 = -1, + l3 = arr3.length - 1; + while (i3 < l3) { + $propertyKey = arr3[i3 += 1]; + var $sch = $schema[$propertyKey]; + if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { + var $prop = it.util.getProperty($propertyKey), + $passData = $data + $prop, + $hasDefault = $useDefaults && $sch.default !== undefined; + $it.schema = $sch; + $it.schemaPath = $schemaPath + $prop; + $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($propertyKey); + $it.errorPath = it.util.getPath(it.errorPath, $propertyKey, it.opts.jsonPointers); + $it.dataPathArr[$dataNxt] = it.util.toQuotedString($propertyKey); + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + $code = it.util.varReplace($code, $nextData, $passData); + var $useData = $passData; + } else { + var $useData = $nextData; + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; '; + } + if ($hasDefault) { + out += ' ' + ($code) + ' '; + } else { + if ($requiredHash && $requiredHash[$propertyKey]) { + out += ' if ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') { ' + ($nextValid) + ' = false; '; + var $currentErrorPath = it.errorPath, + $currErrSchemaPath = $errSchemaPath, + $missingProperty = it.util.escapeQuotes($propertyKey); + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); + } + $errSchemaPath = it.errSchemaPath + '/required'; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + $errSchemaPath = $currErrSchemaPath; + it.errorPath = $currentErrorPath; + out += ' } else { '; + } else { + if ($breakOnError) { + out += ' if ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') { ' + ($nextValid) + ' = true; } else { '; + } else { + out += ' if (' + ($useData) + ' !== undefined '; + if ($ownProperties) { + out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ' ) { '; + } + } + out += ' ' + ($code) + ' } '; + } + } + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + } + if ($pPropertyKeys.length) { + var arr4 = $pPropertyKeys; + if (arr4) { + var $pProperty, i4 = -1, + l4 = arr4.length - 1; + while (i4 < l4) { + $pProperty = arr4[i4 += 1]; + var $sch = $pProperties[$pProperty]; + if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { + $it.schema = $sch; + $it.schemaPath = it.schemaPath + '.patternProperties' + it.util.getProperty($pProperty); + $it.errSchemaPath = it.errSchemaPath + '/patternProperties/' + it.util.escapeFragment($pProperty); + if ($ownProperties) { + out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; + } else { + out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; + } + out += ' if (' + (it.usePattern($pProperty)) + '.test(' + ($key) + ')) { '; + $it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); + var $passData = $data + '[' + $key + ']'; + $it.dataPathArr[$dataNxt] = $key; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + out += ' } '; + if ($breakOnError) { + out += ' else ' + ($nextValid) + ' = true; '; + } + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + } + } + if ($breakOnError) { + out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; + } + out = it.util.cleanUpCode(out); + return out; +} + + +/***/ }), + +/***/ 348: /***/ (function(__unusedmodule, exports, __webpack_require__) { /* * lib/jsprim.js: utilities for primitive JavaScript types */ -var mod_assert = __webpack_require__(283); +var mod_assert = __webpack_require__(477); var mod_util = __webpack_require__(669); -var mod_extsprintf = __webpack_require__(784); -var mod_verror = __webpack_require__(829); -var mod_jsonschema = __webpack_require__(975); +var mod_extsprintf = __webpack_require__(697); +var mod_verror = __webpack_require__(956); +var mod_jsonschema = __webpack_require__(703); /* * Public interface @@ -14970,1835 +11191,979 @@ function mergeObjects(provided, overrides, defaults) /***/ }), -/***/ 444: -/***/ (function(module, __unusedexports, __webpack_require__) { +/***/ 349: +/***/ (function(__unusedmodule, exports, __webpack_require__) { -// Copyright 2016 Joyent, Inc. +"use strict"; +/*! + * Copyright (c) 2015, Salesforce.com, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * 3. Neither the name of Salesforce.com nor the names of its contributors may + * be used to endorse or promote products derived from this software without + * specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ -var x509 = __webpack_require__(327); +var Store = __webpack_require__(627).Store; +var permuteDomain = __webpack_require__(383).permuteDomain; +var pathMatch = __webpack_require__(54).pathMatch; +var util = __webpack_require__(669); -module.exports = { - read: read, - verify: x509.verify, - sign: x509.sign, - write: write +function MemoryCookieStore() { + Store.call(this); + this.idx = {}; +} +util.inherits(MemoryCookieStore, Store); +exports.MemoryCookieStore = MemoryCookieStore; +MemoryCookieStore.prototype.idx = null; + +// Since it's just a struct in RAM, this Store is synchronous +MemoryCookieStore.prototype.synchronous = true; + +// force a default depth: +MemoryCookieStore.prototype.inspect = function() { + return "{ idx: "+util.inspect(this.idx, false, 2)+' }'; }; -var assert = __webpack_require__(283); -var asn1 = __webpack_require__(214); -var Buffer = __webpack_require__(375).Buffer; -var algs = __webpack_require__(936); -var utils = __webpack_require__(757); -var Key = __webpack_require__(820); -var PrivateKey = __webpack_require__(463); -var pem = __webpack_require__(502); -var Identity = __webpack_require__(905); -var Signature = __webpack_require__(719); -var Certificate = __webpack_require__(219); - -function read(buf, options) { - if (typeof (buf) !== 'string') { - assert.buffer(buf, 'buf'); - buf = buf.toString('ascii'); - } - - var lines = buf.trim().split(/[\r\n]+/g); - - var m; - var si = -1; - while (!m && si < lines.length) { - m = lines[++si].match(/*JSSTYLED*/ - /[-]+[ ]*BEGIN CERTIFICATE[ ]*[-]+/); - } - assert.ok(m, 'invalid PEM header'); - - var m2; - var ei = lines.length; - while (!m2 && ei > 0) { - m2 = lines[--ei].match(/*JSSTYLED*/ - /[-]+[ ]*END CERTIFICATE[ ]*[-]+/); - } - assert.ok(m2, 'invalid PEM footer'); - - lines = lines.slice(si, ei + 1); - - var headers = {}; - while (true) { - lines = lines.slice(1); - m = lines[0].match(/*JSSTYLED*/ - /^([A-Za-z0-9-]+): (.+)$/); - if (!m) - break; - headers[m[1].toLowerCase()] = m[2]; - } - - /* Chop off the first and last lines */ - lines = lines.slice(0, -1).join(''); - buf = Buffer.from(lines, 'base64'); - - return (x509.read(buf, options)); +// Use the new custom inspection symbol to add the custom inspect function if +// available. +if (util.inspect.custom) { + MemoryCookieStore.prototype[util.inspect.custom] = MemoryCookieStore.prototype.inspect; } -function write(cert, options) { - var dbuf = x509.write(cert, options); +MemoryCookieStore.prototype.findCookie = function(domain, path, key, cb) { + if (!this.idx[domain]) { + return cb(null,undefined); + } + if (!this.idx[domain][path]) { + return cb(null,undefined); + } + return cb(null,this.idx[domain][path][key]||null); +}; - var header = 'CERTIFICATE'; - var tmp = dbuf.toString('base64'); - var len = tmp.length + (tmp.length / 64) + - 18 + 16 + header.length*2 + 10; - var buf = Buffer.alloc(len); - var o = 0; - o += buf.write('-----BEGIN ' + header + '-----\n', o); - for (var i = 0; i < tmp.length; ) { - var limit = i + 64; - if (limit > tmp.length) - limit = tmp.length; - o += buf.write(tmp.slice(i, limit), o); - buf[o++] = 10; - i = limit; - } - o += buf.write('-----END ' + header + '-----\n', o); +MemoryCookieStore.prototype.findCookies = function(domain, path, cb) { + var results = []; + if (!domain) { + return cb(null,[]); + } - return (buf.slice(0, o)); + var pathMatcher; + if (!path) { + // null means "all paths" + pathMatcher = function matchAll(domainIndex) { + for (var curPath in domainIndex) { + var pathIndex = domainIndex[curPath]; + for (var key in pathIndex) { + results.push(pathIndex[key]); + } + } + }; + + } else { + pathMatcher = function matchRFC(domainIndex) { + //NOTE: we should use path-match algorithm from S5.1.4 here + //(see : https://github.com/ChromiumWebApps/chromium/blob/b3d3b4da8bb94c1b2e061600df106d590fda3620/net/cookies/canonical_cookie.cc#L299) + Object.keys(domainIndex).forEach(function (cookiePath) { + if (pathMatch(path, cookiePath)) { + var pathIndex = domainIndex[cookiePath]; + + for (var key in pathIndex) { + results.push(pathIndex[key]); + } + } + }); + }; + } + + var domains = permuteDomain(domain) || [domain]; + var idx = this.idx; + domains.forEach(function(curDomain) { + var domainIndex = idx[curDomain]; + if (!domainIndex) { + return; + } + pathMatcher(domainIndex); + }); + + cb(null,results); +}; + +MemoryCookieStore.prototype.putCookie = function(cookie, cb) { + if (!this.idx[cookie.domain]) { + this.idx[cookie.domain] = {}; + } + if (!this.idx[cookie.domain][cookie.path]) { + this.idx[cookie.domain][cookie.path] = {}; + } + this.idx[cookie.domain][cookie.path][cookie.key] = cookie; + cb(null); +}; + +MemoryCookieStore.prototype.updateCookie = function(oldCookie, newCookie, cb) { + // updateCookie() may avoid updating cookies that are identical. For example, + // lastAccessed may not be important to some stores and an equality + // comparison could exclude that field. + this.putCookie(newCookie,cb); +}; + +MemoryCookieStore.prototype.removeCookie = function(domain, path, key, cb) { + if (this.idx[domain] && this.idx[domain][path] && this.idx[domain][path][key]) { + delete this.idx[domain][path][key]; + } + cb(null); +}; + +MemoryCookieStore.prototype.removeCookies = function(domain, path, cb) { + if (this.idx[domain]) { + if (path) { + delete this.idx[domain][path]; + } else { + delete this.idx[domain]; + } + } + return cb(null); +}; + +MemoryCookieStore.prototype.removeAllCookies = function(cb) { + this.idx = {}; + return cb(null); } +MemoryCookieStore.prototype.getAllCookies = function(cb) { + var cookies = []; + var idx = this.idx; + + var domains = Object.keys(idx); + domains.forEach(function(domain) { + var paths = Object.keys(idx[domain]); + paths.forEach(function(path) { + var keys = Object.keys(idx[domain][path]); + keys.forEach(function(key) { + if (key !== null) { + cookies.push(idx[domain][path][key]); + } + }); + }); + }); + + // Sort by creationIndex so deserializing retains the creation order. + // When implementing your own store, this SHOULD retain the order too + cookies.sort(function(a,b) { + return (a.creationIndex||0) - (b.creationIndex||0); + }); + + cb(null, cookies); +}; + /***/ }), -/***/ 463: +/***/ 357: +/***/ (function(module) { + +module.exports = require("assert"); + +/***/ }), + +/***/ 362: +/***/ (function(module) { + +// Copyright 2011 Mark Cavage All rights reserved. + + +module.exports = { + EOC: 0, + Boolean: 1, + Integer: 2, + BitString: 3, + OctetString: 4, + Null: 5, + OID: 6, + ObjectDescriptor: 7, + External: 8, + Real: 9, // float + Enumeration: 10, + PDV: 11, + Utf8String: 12, + RelativeOID: 13, + Sequence: 16, + Set: 17, + NumericString: 18, + PrintableString: 19, + T61String: 20, + VideotexString: 21, + IA5String: 22, + UTCTime: 23, + GeneralizedTime: 24, + GraphicString: 25, + VisibleString: 26, + GeneralString: 28, + UniversalString: 29, + CharacterString: 30, + BMPString: 31, + Constructor: 32, + Context: 128 +}; + + +/***/ }), + +/***/ 363: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +module.exports = { + Verifier: Verifier, + Signer: Signer +}; + +var nacl = __webpack_require__(196); +var stream = __webpack_require__(413); +var util = __webpack_require__(669); +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var Signature = __webpack_require__(575); + +function Verifier(key, hashAlgo) { + if (hashAlgo.toLowerCase() !== 'sha512') + throw (new Error('ED25519 only supports the use of ' + + 'SHA-512 hashes')); + + this.key = key; + this.chunks = []; + + stream.Writable.call(this, {}); +} +util.inherits(Verifier, stream.Writable); + +Verifier.prototype._write = function (chunk, enc, cb) { + this.chunks.push(chunk); + cb(); +}; + +Verifier.prototype.update = function (chunk) { + if (typeof (chunk) === 'string') + chunk = Buffer.from(chunk, 'binary'); + this.chunks.push(chunk); +}; + +Verifier.prototype.verify = function (signature, fmt) { + var sig; + if (Signature.isSignature(signature, [2, 0])) { + if (signature.type !== 'ed25519') + return (false); + sig = signature.toBuffer('raw'); + + } else if (typeof (signature) === 'string') { + sig = Buffer.from(signature, 'base64'); + + } else if (Signature.isSignature(signature, [1, 0])) { + throw (new Error('signature was created by too old ' + + 'a version of sshpk and cannot be verified')); + } + + assert.buffer(sig); + return (nacl.sign.detached.verify( + new Uint8Array(Buffer.concat(this.chunks)), + new Uint8Array(sig), + new Uint8Array(this.key.part.A.data))); +}; + +function Signer(key, hashAlgo) { + if (hashAlgo.toLowerCase() !== 'sha512') + throw (new Error('ED25519 only supports the use of ' + + 'SHA-512 hashes')); + + this.key = key; + this.chunks = []; + + stream.Writable.call(this, {}); +} +util.inherits(Signer, stream.Writable); + +Signer.prototype._write = function (chunk, enc, cb) { + this.chunks.push(chunk); + cb(); +}; + +Signer.prototype.update = function (chunk) { + if (typeof (chunk) === 'string') + chunk = Buffer.from(chunk, 'binary'); + this.chunks.push(chunk); +}; + +Signer.prototype.sign = function () { + var sig = nacl.sign.detached( + new Uint8Array(Buffer.concat(this.chunks)), + new Uint8Array(Buffer.concat([ + this.key.part.k.data, this.key.part.A.data]))); + var sigBuf = Buffer.from(sig); + var sigObj = Signature.parse(sigBuf, 'ed25519', 'raw'); + sigObj.hashAlgorithm = 'sha512'; + return (sigObj); +}; + + +/***/ }), + +/***/ 374: +/***/ (function(module) { + +"use strict"; + + +var hasOwn = Object.prototype.hasOwnProperty; +var toStr = Object.prototype.toString; +var defineProperty = Object.defineProperty; +var gOPD = Object.getOwnPropertyDescriptor; + +var isArray = function isArray(arr) { + if (typeof Array.isArray === 'function') { + return Array.isArray(arr); + } + + return toStr.call(arr) === '[object Array]'; +}; + +var isPlainObject = function isPlainObject(obj) { + if (!obj || toStr.call(obj) !== '[object Object]') { + return false; + } + + var hasOwnConstructor = hasOwn.call(obj, 'constructor'); + var hasIsPrototypeOf = obj.constructor && obj.constructor.prototype && hasOwn.call(obj.constructor.prototype, 'isPrototypeOf'); + // Not own constructor property must be Object + if (obj.constructor && !hasOwnConstructor && !hasIsPrototypeOf) { + return false; + } + + // Own properties are enumerated firstly, so to speed up, + // if last one is own, then all properties are own. + var key; + for (key in obj) { /**/ } + + return typeof key === 'undefined' || hasOwn.call(obj, key); +}; + +// If name is '__proto__', and Object.defineProperty is available, define __proto__ as an own property on target +var setProperty = function setProperty(target, options) { + if (defineProperty && options.name === '__proto__') { + defineProperty(target, options.name, { + enumerable: true, + configurable: true, + value: options.newValue, + writable: true + }); + } else { + target[options.name] = options.newValue; + } +}; + +// Return undefined instead of __proto__ if '__proto__' is not an own property +var getProperty = function getProperty(obj, name) { + if (name === '__proto__') { + if (!hasOwn.call(obj, name)) { + return void 0; + } else if (gOPD) { + // In early versions of node, obj['__proto__'] is buggy when obj has + // __proto__ as an own property. Object.getOwnPropertyDescriptor() works. + return gOPD(obj, name).value; + } + } + + return obj[name]; +}; + +module.exports = function extend() { + var options, name, src, copy, copyIsArray, clone; + var target = arguments[0]; + var i = 1; + var length = arguments.length; + var deep = false; + + // Handle a deep copy situation + if (typeof target === 'boolean') { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + if (target == null || (typeof target !== 'object' && typeof target !== 'function')) { + target = {}; + } + + for (; i < length; ++i) { + options = arguments[i]; + // Only deal with non-null/undefined values + if (options != null) { + // Extend the base object + for (name in options) { + src = getProperty(target, name); + copy = getProperty(options, name); + + // Prevent never-ending loop + if (target !== copy) { + // Recurse if we're merging plain objects or arrays + if (deep && copy && (isPlainObject(copy) || (copyIsArray = isArray(copy)))) { + if (copyIsArray) { + copyIsArray = false; + clone = src && isArray(src) ? src : []; + } else { + clone = src && isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + setProperty(target, { name: name, newValue: extend(deep, clone, copy) }); + + // Don't bring in undefined values + } else if (typeof copy !== 'undefined') { + setProperty(target, { name: name, newValue: copy }); + } + } + } + } + } + + // Return the modified object + return target; +}; + + +/***/ }), + +/***/ 378: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2017 Joyent, Inc. -module.exports = PrivateKey; +module.exports = Identity; -var assert = __webpack_require__(283); -var Buffer = __webpack_require__(375).Buffer; -var algs = __webpack_require__(936); +var assert = __webpack_require__(477); +var algs = __webpack_require__(98); var crypto = __webpack_require__(417); -var Fingerprint = __webpack_require__(658); -var Signature = __webpack_require__(719); -var errs = __webpack_require__(266); +var Fingerprint = __webpack_require__(400); +var Signature = __webpack_require__(575); +var errs = __webpack_require__(753); var util = __webpack_require__(669); -var utils = __webpack_require__(757); -var dhe = __webpack_require__(472); -var generateECDSA = dhe.generateECDSA; -var generateED25519 = dhe.generateED25519; -var edCompat = __webpack_require__(73); -var nacl = __webpack_require__(199); +var utils = __webpack_require__(270); +var asn1 = __webpack_require__(62); +var Buffer = __webpack_require__(215).Buffer; -var Key = __webpack_require__(820); +/*JSSTYLED*/ +var DNS_NAME_RE = /^([*]|[a-z0-9][a-z0-9\-]{0,62})(?:\.([*]|[a-z0-9][a-z0-9\-]{0,62}))*$/i; -var InvalidAlgorithmError = errs.InvalidAlgorithmError; -var KeyParseError = errs.KeyParseError; -var KeyEncryptedError = errs.KeyEncryptedError; +var oids = {}; +oids.cn = '2.5.4.3'; +oids.o = '2.5.4.10'; +oids.ou = '2.5.4.11'; +oids.l = '2.5.4.7'; +oids.s = '2.5.4.8'; +oids.c = '2.5.4.6'; +oids.sn = '2.5.4.4'; +oids.postalCode = '2.5.4.17'; +oids.serialNumber = '2.5.4.5'; +oids.street = '2.5.4.9'; +oids.x500UniqueIdentifier = '2.5.4.45'; +oids.role = '2.5.4.72'; +oids.telephoneNumber = '2.5.4.20'; +oids.description = '2.5.4.13'; +oids.dc = '0.9.2342.19200300.100.1.25'; +oids.uid = '0.9.2342.19200300.100.1.1'; +oids.mail = '0.9.2342.19200300.100.1.3'; +oids.title = '2.5.4.12'; +oids.gn = '2.5.4.42'; +oids.initials = '2.5.4.43'; +oids.pseudonym = '2.5.4.65'; +oids.emailAddress = '1.2.840.113549.1.9.1'; -var formats = {}; -formats['auto'] = __webpack_require__(737); -formats['pem'] = __webpack_require__(502); -formats['pkcs1'] = __webpack_require__(39); -formats['pkcs8'] = __webpack_require__(274); -formats['rfc4253'] = __webpack_require__(533); -formats['ssh-private'] = __webpack_require__(269); -formats['openssh'] = formats['ssh-private']; -formats['ssh'] = formats['ssh-private']; -formats['dnssec'] = __webpack_require__(554); +var unoids = {}; +Object.keys(oids).forEach(function (k) { + unoids[oids[k]] = k; +}); -function PrivateKey(opts) { +function Identity(opts) { + var self = this; assert.object(opts, 'options'); - Key.call(this, opts); - - this._pubCache = undefined; -} -util.inherits(PrivateKey, Key); - -PrivateKey.formats = formats; - -PrivateKey.prototype.toBuffer = function (format, options) { - if (format === undefined) - format = 'pkcs1'; - assert.string(format, 'format'); - assert.object(formats[format], 'formats[format]'); - assert.optionalObject(options, 'options'); - - return (formats[format].write(this, options)); -}; - -PrivateKey.prototype.hash = function (algo, type) { - return (this.toPublic().hash(algo, type)); -}; - -PrivateKey.prototype.fingerprint = function (algo, type) { - return (this.toPublic().fingerprint(algo, type)); -}; - -PrivateKey.prototype.toPublic = function () { - if (this._pubCache) - return (this._pubCache); - - var algInfo = algs.info[this.type]; - var pubParts = []; - for (var i = 0; i < algInfo.parts.length; ++i) { - var p = algInfo.parts[i]; - pubParts.push(this.part[p]); - } - - this._pubCache = new Key({ - type: this.type, - source: this, - parts: pubParts + assert.arrayOfObject(opts.components, 'options.components'); + this.components = opts.components; + this.componentLookup = {}; + this.components.forEach(function (c) { + if (c.name && !c.oid) + c.oid = oids[c.name]; + if (c.oid && !c.name) + c.name = unoids[c.oid]; + if (self.componentLookup[c.name] === undefined) + self.componentLookup[c.name] = []; + self.componentLookup[c.name].push(c); }); - if (this.comment) - this._pubCache.comment = this.comment; - return (this._pubCache); -}; - -PrivateKey.prototype.derive = function (newType) { - assert.string(newType, 'type'); - var priv, pub, pair; - - if (this.type === 'ed25519' && newType === 'curve25519') { - priv = this.part.k.data; - if (priv[0] === 0x00) - priv = priv.slice(1); - - pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv)); - pub = Buffer.from(pair.publicKey); - - return (new PrivateKey({ - type: 'curve25519', - parts: [ - { name: 'A', data: utils.mpNormalize(pub) }, - { name: 'k', data: utils.mpNormalize(priv) } - ] - })); - } else if (this.type === 'curve25519' && newType === 'ed25519') { - priv = this.part.k.data; - if (priv[0] === 0x00) - priv = priv.slice(1); - - pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv)); - pub = Buffer.from(pair.publicKey); - - return (new PrivateKey({ - type: 'ed25519', - parts: [ - { name: 'A', data: utils.mpNormalize(pub) }, - { name: 'k', data: utils.mpNormalize(priv) } - ] - })); + if (this.componentLookup.cn && this.componentLookup.cn.length > 0) { + this.cn = this.componentLookup.cn[0].value; } - throw (new Error('Key derivation not supported from ' + this.type + - ' to ' + newType)); -}; + assert.optionalString(opts.type, 'options.type'); + if (opts.type === undefined) { + if (this.components.length === 1 && + this.componentLookup.cn && + this.componentLookup.cn.length === 1 && + this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { + this.type = 'host'; + this.hostname = this.componentLookup.cn[0].value; -PrivateKey.prototype.createVerify = function (hashAlgo) { - return (this.toPublic().createVerify(hashAlgo)); -}; + } else if (this.componentLookup.dc && + this.components.length === this.componentLookup.dc.length) { + this.type = 'host'; + this.hostname = this.componentLookup.dc.map( + function (c) { + return (c.value); + }).join('.'); -PrivateKey.prototype.createSign = function (hashAlgo) { - if (hashAlgo === undefined) - hashAlgo = this.defaultHashAlgorithm(); - assert.string(hashAlgo, 'hash algorithm'); + } else if (this.componentLookup.uid && + this.components.length === + this.componentLookup.uid.length) { + this.type = 'user'; + this.uid = this.componentLookup.uid[0].value; - /* ED25519 is not supported by OpenSSL, use a javascript impl. */ - if (this.type === 'ed25519' && edCompat !== undefined) - return (new edCompat.Signer(this, hashAlgo)); - if (this.type === 'curve25519') - throw (new Error('Curve25519 keys are not suitable for ' + - 'signing or verification')); + } else if (this.componentLookup.cn && + this.componentLookup.cn.length === 1 && + this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { + this.type = 'host'; + this.hostname = this.componentLookup.cn[0].value; - var v, nm, err; - try { - nm = hashAlgo.toUpperCase(); - v = crypto.createSign(nm); - } catch (e) { - err = e; + } else if (this.componentLookup.uid && + this.componentLookup.uid.length === 1) { + this.type = 'user'; + this.uid = this.componentLookup.uid[0].value; + + } else if (this.componentLookup.mail && + this.componentLookup.mail.length === 1) { + this.type = 'email'; + this.email = this.componentLookup.mail[0].value; + + } else if (this.componentLookup.cn && + this.componentLookup.cn.length === 1) { + this.type = 'user'; + this.uid = this.componentLookup.cn[0].value; + + } else { + this.type = 'unknown'; + } + } else { + this.type = opts.type; + if (this.type === 'host') + this.hostname = opts.hostname; + else if (this.type === 'user') + this.uid = opts.uid; + else if (this.type === 'email') + this.email = opts.email; + else + throw (new Error('Unknown type ' + this.type)); } - if (v === undefined || (err instanceof Error && - err.message.match(/Unknown message digest/))) { - nm = 'RSA-'; - nm += hashAlgo.toUpperCase(); - v = crypto.createSign(nm); - } - assert.ok(v, 'failed to create verifier'); - var oldSign = v.sign.bind(v); - var key = this.toBuffer('pkcs1'); - var type = this.type; - var curve = this.curve; - v.sign = function () { - var sig = oldSign(key); - if (typeof (sig) === 'string') - sig = Buffer.from(sig, 'binary'); - sig = Signature.parse(sig, type, 'asn1'); - sig.hashAlgorithm = hashAlgo; - sig.curve = curve; - return (sig); - }; - return (v); +} + +Identity.prototype.toString = function () { + return (this.components.map(function (c) { + var n = c.name.toUpperCase(); + /*JSSTYLED*/ + n = n.replace(/=/g, '\\='); + var v = c.value; + /*JSSTYLED*/ + v = v.replace(/,/g, '\\,'); + return (n + '=' + v); + }).join(', ')); }; -PrivateKey.parse = function (data, format, options) { - if (typeof (data) !== 'string') - assert.buffer(data, 'data'); - if (format === undefined) - format = 'auto'; - assert.string(format, 'format'); - if (typeof (options) === 'string') - options = { filename: options }; - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalString(options.filename, 'options.filename'); - if (options.filename === undefined) - options.filename = '(unnamed)'; - - assert.object(formats[format], 'formats[format]'); - - try { - var k = formats[format].read(data, options); - assert.ok(k instanceof PrivateKey, 'key is not a private key'); - if (!k.comment) - k.comment = options.filename; - return (k); - } catch (e) { - if (e.name === 'KeyEncryptedError') - throw (e); - throw (new KeyParseError(options.filename, format, e)); - } +Identity.prototype.get = function (name, asArray) { + assert.string(name, 'name'); + var arr = this.componentLookup[name]; + if (arr === undefined || arr.length === 0) + return (undefined); + if (!asArray && arr.length > 1) + throw (new Error('Multiple values for attribute ' + name)); + if (!asArray) + return (arr[0].value); + return (arr.map(function (c) { + return (c.value); + })); }; -PrivateKey.isPrivateKey = function (obj, ver) { - return (utils.isCompatible(obj, PrivateKey, ver)); -}; - -PrivateKey.generate = function (type, options) { - if (options === undefined) - options = {}; - assert.object(options, 'options'); - - switch (type) { - case 'ecdsa': - if (options.curve === undefined) - options.curve = 'nistp256'; - assert.string(options.curve, 'options.curve'); - return (generateECDSA(options.curve)); - case 'ed25519': - return (generateED25519()); - default: - throw (new Error('Key generation not supported with key ' + - 'type "' + type + '"')); - } +Identity.prototype.toArray = function (idx) { + return (this.components.map(function (c) { + return ({ + name: c.name, + value: c.value + }); + })); }; /* - * API versions for PrivateKey: - * [1,0] -- initial ver - * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats - * [1,2] -- added defaultHashAlgorithm - * [1,3] -- added derive, ed, createDH - * [1,4] -- first tagged version - * [1,5] -- changed ed25519 part names and format - * [1,6] -- type arguments for hash() and fingerprint() + * These are from X.680 -- PrintableString allowed chars are in section 37.4 + * table 8. Spec for IA5Strings is "1,6 + SPACE + DEL" where 1 refers to + * ISO IR #001 (standard ASCII control characters) and 6 refers to ISO IR #006 + * (the basic ASCII character set). */ -PrivateKey.prototype._sshpkApiVersion = [1, 6]; +/* JSSTYLED */ +var NOT_PRINTABLE = /[^a-zA-Z0-9 '(),+.\/:=?-]/; +/* JSSTYLED */ +var NOT_IA5 = /[^\x00-\x7f]/; -PrivateKey._oldVersionDetect = function (obj) { - assert.func(obj.toPublic); - assert.func(obj.createSign); - if (obj.derive) - return ([1, 3]); - if (obj.defaultHashAlgorithm) - return ([1, 2]); - if (obj.formats['auto']) - return ([1, 1]); +Identity.prototype.toAsn1 = function (der, tag) { + der.startSequence(tag); + this.components.forEach(function (c) { + der.startSequence(asn1.Ber.Constructor | asn1.Ber.Set); + der.startSequence(); + der.writeOID(c.oid); + /* + * If we fit in a PrintableString, use that. Otherwise use an + * IA5String or UTF8String. + * + * If this identity was parsed from a DN, use the ASN.1 types + * from the original representation (otherwise this might not + * be a full match for the original in some validators). + */ + if (c.asn1type === asn1.Ber.Utf8String || + c.value.match(NOT_IA5)) { + var v = Buffer.from(c.value, 'utf8'); + der.writeBuffer(v, asn1.Ber.Utf8String); + + } else if (c.asn1type === asn1.Ber.IA5String || + c.value.match(NOT_PRINTABLE)) { + der.writeString(c.value, asn1.Ber.IA5String); + + } else { + var type = asn1.Ber.PrintableString; + if (c.asn1type !== undefined) + type = c.asn1type; + der.writeString(c.value, type); + } + der.endSequence(); + der.endSequence(); + }); + der.endSequence(); +}; + +function globMatch(a, b) { + if (a === '**' || b === '**') + return (true); + var aParts = a.split('.'); + var bParts = b.split('.'); + if (aParts.length !== bParts.length) + return (false); + for (var i = 0; i < aParts.length; ++i) { + if (aParts[i] === '*' || bParts[i] === '*') + continue; + if (aParts[i] !== bParts[i]) + return (false); + } + return (true); +} + +Identity.prototype.equals = function (other) { + if (!Identity.isIdentity(other, [1, 0])) + return (false); + if (other.components.length !== this.components.length) + return (false); + for (var i = 0; i < this.components.length; ++i) { + if (this.components[i].oid !== other.components[i].oid) + return (false); + if (!globMatch(this.components[i].value, + other.components[i].value)) { + return (false); + } + } + return (true); +}; + +Identity.forHost = function (hostname) { + assert.string(hostname, 'hostname'); + return (new Identity({ + type: 'host', + hostname: hostname, + components: [ { name: 'cn', value: hostname } ] + })); +}; + +Identity.forUser = function (uid) { + assert.string(uid, 'uid'); + return (new Identity({ + type: 'user', + uid: uid, + components: [ { name: 'uid', value: uid } ] + })); +}; + +Identity.forEmail = function (email) { + assert.string(email, 'email'); + return (new Identity({ + type: 'email', + email: email, + components: [ { name: 'mail', value: email } ] + })); +}; + +Identity.parseDN = function (dn) { + assert.string(dn, 'dn'); + var parts = ['']; + var idx = 0; + var rem = dn; + while (rem.length > 0) { + var m; + /*JSSTYLED*/ + if ((m = /^,/.exec(rem)) !== null) { + parts[++idx] = ''; + rem = rem.slice(m[0].length); + /*JSSTYLED*/ + } else if ((m = /^\\,/.exec(rem)) !== null) { + parts[idx] += ','; + rem = rem.slice(m[0].length); + /*JSSTYLED*/ + } else if ((m = /^\\./.exec(rem)) !== null) { + parts[idx] += m[0]; + rem = rem.slice(m[0].length); + /*JSSTYLED*/ + } else if ((m = /^[^\\,]+/.exec(rem)) !== null) { + parts[idx] += m[0]; + rem = rem.slice(m[0].length); + } else { + throw (new Error('Failed to parse DN')); + } + } + var cmps = parts.map(function (c) { + c = c.trim(); + var eqPos = c.indexOf('='); + while (eqPos > 0 && c.charAt(eqPos - 1) === '\\') + eqPos = c.indexOf('=', eqPos + 1); + if (eqPos === -1) { + throw (new Error('Failed to parse DN')); + } + /*JSSTYLED*/ + var name = c.slice(0, eqPos).toLowerCase().replace(/\\=/g, '='); + var value = c.slice(eqPos + 1); + return ({ name: name, value: value }); + }); + return (new Identity({ components: cmps })); +}; + +Identity.fromArray = function (components) { + assert.arrayOfObject(components, 'components'); + components.forEach(function (cmp) { + assert.object(cmp, 'component'); + assert.string(cmp.name, 'component.name'); + if (!Buffer.isBuffer(cmp.value) && + !(typeof (cmp.value) === 'string')) { + throw (new Error('Invalid component value')); + } + }); + return (new Identity({ components: components })); +}; + +Identity.parseAsn1 = function (der, top) { + var components = []; + der.readSequence(top); + var end = der.offset + der.length; + while (der.offset < end) { + der.readSequence(asn1.Ber.Constructor | asn1.Ber.Set); + var after = der.offset + der.length; + der.readSequence(); + var oid = der.readOID(); + var type = der.peek(); + var value; + switch (type) { + case asn1.Ber.PrintableString: + case asn1.Ber.IA5String: + case asn1.Ber.OctetString: + case asn1.Ber.T61String: + value = der.readString(type); + break; + case asn1.Ber.Utf8String: + value = der.readString(type, true); + value = value.toString('utf8'); + break; + case asn1.Ber.CharacterString: + case asn1.Ber.BMPString: + value = der.readString(type, true); + value = value.toString('utf16le'); + break; + default: + throw (new Error('Unknown asn1 type ' + type)); + } + components.push({ oid: oid, asn1type: type, value: value }); + der._offset = after; + } + der._offset = end; + return (new Identity({ + components: components + })); +}; + +Identity.isIdentity = function (obj, ver) { + return (utils.isCompatible(obj, Identity, ver)); +}; + +/* + * API versions for Identity: + * [1,0] -- initial ver + */ +Identity.prototype._sshpkApiVersion = [1, 0]; + +Identity._oldVersionDetect = function (obj) { return ([1, 0]); }; /***/ }), -/***/ 465: +/***/ 380: /***/ (function(module) { -module.exports = {"$schema":"http://json-schema.org/draft-07/schema#","$id":"https://raw.githubusercontent.com/epoberezkin/ajv/master/lib/refs/data.json#","description":"Meta-schema for $data reference (JSON Schema extension proposal)","type":"object","required":["$data"],"properties":{"$data":{"type":"string","anyOf":[{"format":"relative-json-pointer"},{"format":"json-pointer"}]}},"additionalProperties":false}; +module.exports = {"$id":"request.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["method","url","httpVersion","cookies","headers","queryString","headersSize","bodySize"],"properties":{"method":{"type":"string"},"url":{"type":"string","format":"uri"},"httpVersion":{"type":"string"},"cookies":{"type":"array","items":{"$ref":"cookie.json#"}},"headers":{"type":"array","items":{"$ref":"header.json#"}},"queryString":{"type":"array","items":{"$ref":"query.json#"}},"postData":{"$ref":"postData.json#"},"headersSize":{"type":"integer"},"bodySize":{"type":"integer"},"comment":{"type":"string"}}}; /***/ }), -/***/ 470: +/***/ 382: /***/ (function(module, __unusedexports, __webpack_require__) { -"use strict"; -// Copyright 2010-2012 Mikeal Rogers -// -// Licensed under the Apache License, Version 2.0 (the "License"); -// you may not use this file except in compliance with the License. -// You may obtain a copy of the License at -// -// http://www.apache.org/licenses/LICENSE-2.0 -// -// Unless required by applicable law or agreed to in writing, software -// distributed under the License is distributed on an "AS IS" BASIS, -// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -// See the License for the specific language governing permissions and -// limitations under the License. +var stream = __webpack_require__(413) - -var extend = __webpack_require__(922) -var cookies = __webpack_require__(367) -var helpers = __webpack_require__(561) - -var paramsHaveRequestBody = helpers.paramsHaveRequestBody - -// organize params for patch, post, put, head, del -function initParams (uri, options, callback) { - if (typeof options === 'function') { - callback = options - } - - var params = {} - if (typeof options === 'object') { - extend(params, options, {uri: uri}) - } else if (typeof uri === 'string') { - extend(params, {uri: uri}) - } else { - extend(params, uri) - } - - params.callback = callback || params.callback - return params +function isStream (obj) { + return obj instanceof stream.Stream } -function request (uri, options, callback) { - if (typeof uri === 'undefined') { - throw new Error('undefined is not a valid uri or options object.') - } - var params = initParams(uri, options, callback) - - if (params.method === 'HEAD' && paramsHaveRequestBody(params)) { - throw new Error('HTTP HEAD requests MUST NOT include a request body.') - } - - return new request.Request(params) +function isReadable (obj) { + return isStream(obj) && typeof obj._read == 'function' && typeof obj._readableState == 'object' } -function verbFunc (verb) { - var method = verb.toUpperCase() - return function (uri, options, callback) { - var params = initParams(uri, options, callback) - params.method = method - return request(params, params.callback) - } + +function isWritable (obj) { + return isStream(obj) && typeof obj._write == 'function' && typeof obj._writableState == 'object' } -// define like this to please codeintel/intellisense IDEs -request.get = verbFunc('get') -request.head = verbFunc('head') -request.options = verbFunc('options') -request.post = verbFunc('post') -request.put = verbFunc('put') -request.patch = verbFunc('patch') -request.del = verbFunc('delete') -request['delete'] = verbFunc('delete') -request.jar = function (store) { - return cookies.jar(store) +function isDuplex (obj) { + return isReadable(obj) && isWritable(obj) } -request.cookie = function (str) { - return cookies.parse(str) -} -function wrapRequestMethod (method, options, requester, verb) { - return function (uri, opts, callback) { - var params = initParams(uri, opts, callback) - - var target = {} - extend(true, target, options, params) - - target.pool = params.pool || options.pool - - if (verb) { - target.method = verb.toUpperCase() - } - - if (typeof requester === 'function') { - method = requester - } - - return method(target, target.callback) - } -} - -request.defaults = function (options, requester) { - var self = this - - options = options || {} - - if (typeof options === 'function') { - requester = options - options = {} - } - - var defaults = wrapRequestMethod(self, options, requester) - - var verbs = ['get', 'head', 'post', 'put', 'patch', 'del', 'delete'] - verbs.forEach(function (verb) { - defaults[verb] = wrapRequestMethod(self[verb], options, requester, verb) - }) - - defaults.cookie = wrapRequestMethod(self.cookie, options, requester) - defaults.jar = self.jar - defaults.defaults = self.defaults - return defaults -} - -request.forever = function (agentOptions, optionsArg) { - var options = {} - if (optionsArg) { - extend(options, optionsArg) - } - if (agentOptions) { - options.agentOptions = agentOptions - } - - options.forever = true - return request.defaults(options) -} - -// Exports - -module.exports = request -request.Request = __webpack_require__(570) -request.initParams = initParams - -// Backwards compatibility for request.debug -Object.defineProperty(request, 'debug', { - enumerable: true, - get: function () { - return request.Request.debug - }, - set: function (debug) { - request.Request.debug = debug - } -}) +module.exports = isStream +module.exports.isReadable = isReadable +module.exports.isWritable = isWritable +module.exports.isDuplex = isDuplex /***/ }), -/***/ 472: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. - -module.exports = { - DiffieHellman: DiffieHellman, - generateECDSA: generateECDSA, - generateED25519: generateED25519 -}; - -var assert = __webpack_require__(283); -var crypto = __webpack_require__(417); -var Buffer = __webpack_require__(375).Buffer; -var algs = __webpack_require__(936); -var utils = __webpack_require__(757); -var nacl = __webpack_require__(199); - -var Key = __webpack_require__(820); -var PrivateKey = __webpack_require__(463); - -var CRYPTO_HAVE_ECDH = (crypto.createECDH !== undefined); - -var ecdh = __webpack_require__(503); -var ec = __webpack_require__(814); -var jsbn = __webpack_require__(71).BigInteger; - -function DiffieHellman(key) { - utils.assertCompatible(key, Key, [1, 4], 'key'); - this._isPriv = PrivateKey.isPrivateKey(key, [1, 3]); - this._algo = key.type; - this._curve = key.curve; - this._key = key; - if (key.type === 'dsa') { - if (!CRYPTO_HAVE_ECDH) { - throw (new Error('Due to bugs in the node 0.10 ' + - 'crypto API, node 0.12.x or later is required ' + - 'to use DH')); - } - this._dh = crypto.createDiffieHellman( - key.part.p.data, undefined, - key.part.g.data, undefined); - this._p = key.part.p; - this._g = key.part.g; - if (this._isPriv) - this._dh.setPrivateKey(key.part.x.data); - this._dh.setPublicKey(key.part.y.data); - - } else if (key.type === 'ecdsa') { - if (!CRYPTO_HAVE_ECDH) { - this._ecParams = new X9ECParameters(this._curve); - - if (this._isPriv) { - this._priv = new ECPrivate( - this._ecParams, key.part.d.data); - } - return; - } - - var curve = { - 'nistp256': 'prime256v1', - 'nistp384': 'secp384r1', - 'nistp521': 'secp521r1' - }[key.curve]; - this._dh = crypto.createECDH(curve); - if (typeof (this._dh) !== 'object' || - typeof (this._dh.setPrivateKey) !== 'function') { - CRYPTO_HAVE_ECDH = false; - DiffieHellman.call(this, key); - return; - } - if (this._isPriv) - this._dh.setPrivateKey(key.part.d.data); - this._dh.setPublicKey(key.part.Q.data); - - } else if (key.type === 'curve25519') { - if (this._isPriv) { - utils.assertCompatible(key, PrivateKey, [1, 5], 'key'); - this._priv = key.part.k.data; - } - - } else { - throw (new Error('DH not supported for ' + key.type + ' keys')); - } -} - -DiffieHellman.prototype.getPublicKey = function () { - if (this._isPriv) - return (this._key.toPublic()); - return (this._key); -}; - -DiffieHellman.prototype.getPrivateKey = function () { - if (this._isPriv) - return (this._key); - else - return (undefined); -}; -DiffieHellman.prototype.getKey = DiffieHellman.prototype.getPrivateKey; - -DiffieHellman.prototype._keyCheck = function (pk, isPub) { - assert.object(pk, 'key'); - if (!isPub) - utils.assertCompatible(pk, PrivateKey, [1, 3], 'key'); - utils.assertCompatible(pk, Key, [1, 4], 'key'); - - if (pk.type !== this._algo) { - throw (new Error('A ' + pk.type + ' key cannot be used in ' + - this._algo + ' Diffie-Hellman')); - } - - if (pk.curve !== this._curve) { - throw (new Error('A key from the ' + pk.curve + ' curve ' + - 'cannot be used with a ' + this._curve + - ' Diffie-Hellman')); - } - - if (pk.type === 'dsa') { - assert.deepEqual(pk.part.p, this._p, - 'DSA key prime does not match'); - assert.deepEqual(pk.part.g, this._g, - 'DSA key generator does not match'); - } -}; - -DiffieHellman.prototype.setKey = function (pk) { - this._keyCheck(pk); - - if (pk.type === 'dsa') { - this._dh.setPrivateKey(pk.part.x.data); - this._dh.setPublicKey(pk.part.y.data); - - } else if (pk.type === 'ecdsa') { - if (CRYPTO_HAVE_ECDH) { - this._dh.setPrivateKey(pk.part.d.data); - this._dh.setPublicKey(pk.part.Q.data); - } else { - this._priv = new ECPrivate( - this._ecParams, pk.part.d.data); - } - - } else if (pk.type === 'curve25519') { - var k = pk.part.k; - if (!pk.part.k) - k = pk.part.r; - this._priv = k.data; - if (this._priv[0] === 0x00) - this._priv = this._priv.slice(1); - this._priv = this._priv.slice(0, 32); - } - this._key = pk; - this._isPriv = true; -}; -DiffieHellman.prototype.setPrivateKey = DiffieHellman.prototype.setKey; - -DiffieHellman.prototype.computeSecret = function (otherpk) { - this._keyCheck(otherpk, true); - if (!this._isPriv) - throw (new Error('DH exchange has not been initialized with ' + - 'a private key yet')); - - var pub; - if (this._algo === 'dsa') { - return (this._dh.computeSecret( - otherpk.part.y.data)); - - } else if (this._algo === 'ecdsa') { - if (CRYPTO_HAVE_ECDH) { - return (this._dh.computeSecret( - otherpk.part.Q.data)); - } else { - pub = new ECPublic( - this._ecParams, otherpk.part.Q.data); - return (this._priv.deriveSharedSecret(pub)); - } - - } else if (this._algo === 'curve25519') { - pub = otherpk.part.A.data; - while (pub[0] === 0x00 && pub.length > 32) - pub = pub.slice(1); - var priv = this._priv; - assert.strictEqual(pub.length, 32); - assert.strictEqual(priv.length, 32); - - var secret = nacl.box.before(new Uint8Array(pub), - new Uint8Array(priv)); - - return (Buffer.from(secret)); - } - - throw (new Error('Invalid algorithm: ' + this._algo)); -}; - -DiffieHellman.prototype.generateKey = function () { - var parts = []; - var priv, pub; - if (this._algo === 'dsa') { - this._dh.generateKeys(); - - parts.push({name: 'p', data: this._p.data}); - parts.push({name: 'q', data: this._key.part.q.data}); - parts.push({name: 'g', data: this._g.data}); - parts.push({name: 'y', data: this._dh.getPublicKey()}); - parts.push({name: 'x', data: this._dh.getPrivateKey()}); - this._key = new PrivateKey({ - type: 'dsa', - parts: parts - }); - this._isPriv = true; - return (this._key); - - } else if (this._algo === 'ecdsa') { - if (CRYPTO_HAVE_ECDH) { - this._dh.generateKeys(); - - parts.push({name: 'curve', - data: Buffer.from(this._curve)}); - parts.push({name: 'Q', data: this._dh.getPublicKey()}); - parts.push({name: 'd', data: this._dh.getPrivateKey()}); - this._key = new PrivateKey({ - type: 'ecdsa', - curve: this._curve, - parts: parts - }); - this._isPriv = true; - return (this._key); - - } else { - var n = this._ecParams.getN(); - var r = new jsbn(crypto.randomBytes(n.bitLength())); - var n1 = n.subtract(jsbn.ONE); - priv = r.mod(n1).add(jsbn.ONE); - pub = this._ecParams.getG().multiply(priv); - - priv = Buffer.from(priv.toByteArray()); - pub = Buffer.from(this._ecParams.getCurve(). - encodePointHex(pub), 'hex'); - - this._priv = new ECPrivate(this._ecParams, priv); - - parts.push({name: 'curve', - data: Buffer.from(this._curve)}); - parts.push({name: 'Q', data: pub}); - parts.push({name: 'd', data: priv}); - - this._key = new PrivateKey({ - type: 'ecdsa', - curve: this._curve, - parts: parts - }); - this._isPriv = true; - return (this._key); - } - - } else if (this._algo === 'curve25519') { - var pair = nacl.box.keyPair(); - priv = Buffer.from(pair.secretKey); - pub = Buffer.from(pair.publicKey); - priv = Buffer.concat([priv, pub]); - assert.strictEqual(priv.length, 64); - assert.strictEqual(pub.length, 32); - - parts.push({name: 'A', data: pub}); - parts.push({name: 'k', data: priv}); - this._key = new PrivateKey({ - type: 'curve25519', - parts: parts - }); - this._isPriv = true; - return (this._key); - } - - throw (new Error('Invalid algorithm: ' + this._algo)); -}; -DiffieHellman.prototype.generateKeys = DiffieHellman.prototype.generateKey; - -/* These are helpers for using ecc-jsbn (for node 0.10 compatibility). */ - -function X9ECParameters(name) { - var params = algs.curves[name]; - assert.object(params); - - var p = new jsbn(params.p); - var a = new jsbn(params.a); - var b = new jsbn(params.b); - var n = new jsbn(params.n); - var h = jsbn.ONE; - var curve = new ec.ECCurveFp(p, a, b); - var G = curve.decodePointHex(params.G.toString('hex')); - - this.curve = curve; - this.g = G; - this.n = n; - this.h = h; -} -X9ECParameters.prototype.getCurve = function () { return (this.curve); }; -X9ECParameters.prototype.getG = function () { return (this.g); }; -X9ECParameters.prototype.getN = function () { return (this.n); }; -X9ECParameters.prototype.getH = function () { return (this.h); }; - -function ECPublic(params, buffer) { - this._params = params; - if (buffer[0] === 0x00) - buffer = buffer.slice(1); - this._pub = params.getCurve().decodePointHex(buffer.toString('hex')); -} - -function ECPrivate(params, buffer) { - this._params = params; - this._priv = new jsbn(utils.mpNormalize(buffer)); -} -ECPrivate.prototype.deriveSharedSecret = function (pubKey) { - assert.ok(pubKey instanceof ECPublic); - var S = pubKey._pub.multiply(this._priv); - return (Buffer.from(S.getX().toBigInteger().toByteArray())); -}; - -function generateED25519() { - var pair = nacl.sign.keyPair(); - var priv = Buffer.from(pair.secretKey); - var pub = Buffer.from(pair.publicKey); - assert.strictEqual(priv.length, 64); - assert.strictEqual(pub.length, 32); - - var parts = []; - parts.push({name: 'A', data: pub}); - parts.push({name: 'k', data: priv.slice(0, 32)}); - var key = new PrivateKey({ - type: 'ed25519', - parts: parts - }); - return (key); -} - -/* Generates a new ECDSA private key on a given curve. */ -function generateECDSA(curve) { - var parts = []; - var key; - - if (CRYPTO_HAVE_ECDH) { - /* - * Node crypto doesn't expose key generation directly, but the - * ECDH instances can generate keys. It turns out this just - * calls into the OpenSSL generic key generator, and we can - * read its output happily without doing an actual DH. So we - * use that here. - */ - var osCurve = { - 'nistp256': 'prime256v1', - 'nistp384': 'secp384r1', - 'nistp521': 'secp521r1' - }[curve]; - - var dh = crypto.createECDH(osCurve); - dh.generateKeys(); - - parts.push({name: 'curve', - data: Buffer.from(curve)}); - parts.push({name: 'Q', data: dh.getPublicKey()}); - parts.push({name: 'd', data: dh.getPrivateKey()}); - - key = new PrivateKey({ - type: 'ecdsa', - curve: curve, - parts: parts - }); - return (key); - } else { - - var ecParams = new X9ECParameters(curve); - - /* This algorithm taken from FIPS PUB 186-4 (section B.4.1) */ - var n = ecParams.getN(); - /* - * The crypto.randomBytes() function can only give us whole - * bytes, so taking a nod from X9.62, we round up. - */ - var cByteLen = Math.ceil((n.bitLength() + 64) / 8); - var c = new jsbn(crypto.randomBytes(cByteLen)); - - var n1 = n.subtract(jsbn.ONE); - var priv = c.mod(n1).add(jsbn.ONE); - var pub = ecParams.getG().multiply(priv); - - priv = Buffer.from(priv.toByteArray()); - pub = Buffer.from(ecParams.getCurve(). - encodePointHex(pub), 'hex'); - - parts.push({name: 'curve', data: Buffer.from(curve)}); - parts.push({name: 'Q', data: pub}); - parts.push({name: 'd', data: priv}); - - key = new PrivateKey({ - type: 'ecdsa', - curve: curve, - parts: parts - }); - return (key); - } -} - - -/***/ }), - -/***/ 482: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2011 Mark Cavage All rights reserved. - -var errors = __webpack_require__(690); -var types = __webpack_require__(616); - -var Reader = __webpack_require__(872); -var Writer = __webpack_require__(53); - - -// --- Exports - -module.exports = { - - Reader: Reader, - - Writer: Writer - -}; - -for (var t in types) { - if (types.hasOwnProperty(t)) - module.exports[t] = types[t]; -} -for (var e in errors) { - if (errors.hasOwnProperty(e)) - module.exports[e] = errors[e]; -} - - -/***/ }), - -/***/ 487: -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -var compileSchema = __webpack_require__(925) - , resolve = __webpack_require__(386) - , Cache = __webpack_require__(186) - , SchemaObject = __webpack_require__(660) - , stableStringify = __webpack_require__(516) - , formats = __webpack_require__(886) - , rules = __webpack_require__(637) - , $dataMetaSchema = __webpack_require__(869) - , util = __webpack_require__(435); - -module.exports = Ajv; - -Ajv.prototype.validate = validate; -Ajv.prototype.compile = compile; -Ajv.prototype.addSchema = addSchema; -Ajv.prototype.addMetaSchema = addMetaSchema; -Ajv.prototype.validateSchema = validateSchema; -Ajv.prototype.getSchema = getSchema; -Ajv.prototype.removeSchema = removeSchema; -Ajv.prototype.addFormat = addFormat; -Ajv.prototype.errorsText = errorsText; - -Ajv.prototype._addSchema = _addSchema; -Ajv.prototype._compile = _compile; - -Ajv.prototype.compileAsync = __webpack_require__(988); -var customKeyword = __webpack_require__(152); -Ajv.prototype.addKeyword = customKeyword.add; -Ajv.prototype.getKeyword = customKeyword.get; -Ajv.prototype.removeKeyword = customKeyword.remove; -Ajv.prototype.validateKeyword = customKeyword.validate; - -var errorClasses = __webpack_require__(702); -Ajv.ValidationError = errorClasses.Validation; -Ajv.MissingRefError = errorClasses.MissingRef; -Ajv.$dataMetaSchema = $dataMetaSchema; - -var META_SCHEMA_ID = 'http://json-schema.org/draft-07/schema'; - -var META_IGNORE_OPTIONS = [ 'removeAdditional', 'useDefaults', 'coerceTypes', 'strictDefaults' ]; -var META_SUPPORT_DATA = ['/properties']; - -/** - * Creates validator instance. - * Usage: `Ajv(opts)` - * @param {Object} opts optional options - * @return {Object} ajv instance - */ -function Ajv(opts) { - if (!(this instanceof Ajv)) return new Ajv(opts); - opts = this._opts = util.copy(opts) || {}; - setLogger(this); - this._schemas = {}; - this._refs = {}; - this._fragments = {}; - this._formats = formats(opts.format); - - this._cache = opts.cache || new Cache; - this._loadingSchemas = {}; - this._compilations = []; - this.RULES = rules(); - this._getId = chooseGetId(opts); - - opts.loopRequired = opts.loopRequired || Infinity; - if (opts.errorDataPath == 'property') opts._errorDataPathProperty = true; - if (opts.serialize === undefined) opts.serialize = stableStringify; - this._metaOpts = getMetaSchemaOptions(this); - - if (opts.formats) addInitialFormats(this); - addDefaultMetaSchema(this); - if (typeof opts.meta == 'object') this.addMetaSchema(opts.meta); - if (opts.nullable) this.addKeyword('nullable', {metaSchema: {type: 'boolean'}}); - addInitialSchemas(this); -} - - - -/** - * Validate data using schema - * Schema will be compiled and cached (using serialized JSON as key. [fast-json-stable-stringify](https://github.com/epoberezkin/fast-json-stable-stringify) is used to serialize. - * @this Ajv - * @param {String|Object} schemaKeyRef key, ref or schema object - * @param {Any} data to be validated - * @return {Boolean} validation result. Errors from the last validation will be available in `ajv.errors` (and also in compiled schema: `schema.errors`). - */ -function validate(schemaKeyRef, data) { - var v; - if (typeof schemaKeyRef == 'string') { - v = this.getSchema(schemaKeyRef); - if (!v) throw new Error('no schema with key or ref "' + schemaKeyRef + '"'); - } else { - var schemaObj = this._addSchema(schemaKeyRef); - v = schemaObj.validate || this._compile(schemaObj); - } - - var valid = v(data); - if (v.$async !== true) this.errors = v.errors; - return valid; -} - - -/** - * Create validating function for passed schema. - * @this Ajv - * @param {Object} schema schema object - * @param {Boolean} _meta true if schema is a meta-schema. Used internally to compile meta schemas of custom keywords. - * @return {Function} validating function - */ -function compile(schema, _meta) { - var schemaObj = this._addSchema(schema, undefined, _meta); - return schemaObj.validate || this._compile(schemaObj); -} - - -/** - * Adds schema to the instance. - * @this Ajv - * @param {Object|Array} schema schema or array of schemas. If array is passed, `key` and other parameters will be ignored. - * @param {String} key Optional schema key. Can be passed to `validate` method instead of schema object or id/ref. One schema per instance can have empty `id` and `key`. - * @param {Boolean} _skipValidation true to skip schema validation. Used internally, option validateSchema should be used instead. - * @param {Boolean} _meta true if schema is a meta-schema. Used internally, addMetaSchema should be used instead. - * @return {Ajv} this for method chaining - */ -function addSchema(schema, key, _skipValidation, _meta) { - if (Array.isArray(schema)){ - for (var i=0; i} errors optional array of validation errors, if not passed errors from the instance are used. - * @param {Object} options optional options with properties `separator` and `dataVar`. - * @return {String} human readable string with all errors descriptions - */ -function errorsText(errors, options) { - errors = errors || this.errors; - if (!errors) return 'No errors'; - options = options || {}; - var separator = options.separator === undefined ? ', ' : options.separator; - var dataVar = options.dataVar === undefined ? 'data' : options.dataVar; - - var text = ''; - for (var i=0; i 0) { - m2 = lines[--ei].match(/*JSSTYLED*/ - /[-]+[ ]*END ([A-Z0-9][A-Za-z0-9]+ )?(PUBLIC|PRIVATE) KEY[ ]*[-]+/); - } - assert.ok(m2, 'invalid PEM footer'); - - /* Begin and end banners must match key type */ - assert.equal(m[2], m2[2]); - var type = m[2].toLowerCase(); - - var alg; - if (m[1]) { - /* They also must match algorithms, if given */ - assert.equal(m[1], m2[1], 'PEM header and footer mismatch'); - alg = m[1].trim(); - } - - lines = lines.slice(si, ei + 1); - - var headers = {}; - while (true) { - lines = lines.slice(1); - m = lines[0].match(/*JSSTYLED*/ - /^([A-Za-z0-9-]+): (.+)$/); - if (!m) - break; - headers[m[1].toLowerCase()] = m[2]; - } - - /* Chop off the first and last lines */ - lines = lines.slice(0, -1).join(''); - buf = Buffer.from(lines, 'base64'); - - var cipher, key, iv; - if (headers['proc-type']) { - var parts = headers['proc-type'].split(','); - if (parts[0] === '4' && parts[1] === 'ENCRYPTED') { - if (typeof (options.passphrase) === 'string') { - options.passphrase = Buffer.from( - options.passphrase, 'utf-8'); - } - if (!Buffer.isBuffer(options.passphrase)) { - throw (new errors.KeyEncryptedError( - options.filename, 'PEM')); - } else { - parts = headers['dek-info'].split(','); - assert.ok(parts.length === 2); - cipher = parts[0].toLowerCase(); - iv = Buffer.from(parts[1], 'hex'); - key = utils.opensslKeyDeriv(cipher, iv, - options.passphrase, 1).key; - } - } - } - - if (alg && alg.toLowerCase() === 'encrypted') { - var eder = new asn1.BerReader(buf); - var pbesEnd; - eder.readSequence(); - - eder.readSequence(); - pbesEnd = eder.offset + eder.length; - - var method = eder.readOID(); - if (method !== OID_PBES2) { - throw (new Error('Unsupported PEM/PKCS8 encryption ' + - 'scheme: ' + method)); - } - - eder.readSequence(); /* PBES2-params */ - - eder.readSequence(); /* keyDerivationFunc */ - var kdfEnd = eder.offset + eder.length; - var kdfOid = eder.readOID(); - if (kdfOid !== OID_PBKDF2) - throw (new Error('Unsupported PBES2 KDF: ' + kdfOid)); - eder.readSequence(); - var salt = eder.readString(asn1.Ber.OctetString, true); - var iterations = eder.readInt(); - var hashAlg = 'sha1'; - if (eder.offset < kdfEnd) { - eder.readSequence(); - var hashAlgOid = eder.readOID(); - hashAlg = OID_TO_HASH[hashAlgOid]; - if (hashAlg === undefined) { - throw (new Error('Unsupported PBKDF2 hash: ' + - hashAlgOid)); - } - } - eder._offset = kdfEnd; - - eder.readSequence(); /* encryptionScheme */ - var cipherOid = eder.readOID(); - cipher = OID_TO_CIPHER[cipherOid]; - if (cipher === undefined) { - throw (new Error('Unsupported PBES2 cipher: ' + - cipherOid)); - } - iv = eder.readString(asn1.Ber.OctetString, true); - - eder._offset = pbesEnd; - buf = eder.readString(asn1.Ber.OctetString, true); - - if (typeof (options.passphrase) === 'string') { - options.passphrase = Buffer.from( - options.passphrase, 'utf-8'); - } - if (!Buffer.isBuffer(options.passphrase)) { - throw (new errors.KeyEncryptedError( - options.filename, 'PEM')); - } - - var cinfo = utils.opensshCipherInfo(cipher); - - cipher = cinfo.opensslName; - key = utils.pbkdf2(hashAlg, salt, iterations, cinfo.keySize, - options.passphrase); - alg = undefined; - } - - if (cipher && key && iv) { - var cipherStream = crypto.createDecipheriv(cipher, key, iv); - var chunk, chunks = []; - cipherStream.once('error', function (e) { - if (e.toString().indexOf('bad decrypt') !== -1) { - throw (new Error('Incorrect passphrase ' + - 'supplied, could not decrypt key')); - } - throw (e); - }); - cipherStream.write(buf); - cipherStream.end(); - while ((chunk = cipherStream.read()) !== null) - chunks.push(chunk); - buf = Buffer.concat(chunks); - } - - /* The new OpenSSH internal format abuses PEM headers */ - if (alg && alg.toLowerCase() === 'openssh') - return (sshpriv.readSSHPrivate(type, buf, options)); - if (alg && alg.toLowerCase() === 'ssh2') - return (rfc4253.readType(type, buf, options)); - - var der = new asn1.BerReader(buf); - der.originalInput = input; - - /* - * All of the PEM file types start with a sequence tag, so chop it - * off here - */ - der.readSequence(); - - /* PKCS#1 type keys name an algorithm in the banner explicitly */ - if (alg) { - if (forceType) - assert.strictEqual(forceType, 'pkcs1'); - return (pkcs1.readPkcs1(alg, type, der)); - } else { - if (forceType) - assert.strictEqual(forceType, 'pkcs8'); - return (pkcs8.readPkcs8(alg, type, der)); - } -} - -function write(key, options, type) { - assert.object(key); - - var alg = { - 'ecdsa': 'EC', - 'rsa': 'RSA', - 'dsa': 'DSA', - 'ed25519': 'EdDSA' - }[key.type]; - var header; - - var der = new asn1.BerWriter(); - - if (PrivateKey.isPrivateKey(key)) { - if (type && type === 'pkcs8') { - header = 'PRIVATE KEY'; - pkcs8.writePkcs8(der, key); - } else { - if (type) - assert.strictEqual(type, 'pkcs1'); - header = alg + ' PRIVATE KEY'; - pkcs1.writePkcs1(der, key); - } - - } else if (Key.isKey(key)) { - if (type && type === 'pkcs1') { - header = alg + ' PUBLIC KEY'; - pkcs1.writePkcs1(der, key); - } else { - if (type) - assert.strictEqual(type, 'pkcs8'); - header = 'PUBLIC KEY'; - pkcs8.writePkcs8(der, key); - } - - } else { - throw (new Error('key is not a Key or PrivateKey')); - } - - var tmp = der.buffer.toString('base64'); - var len = tmp.length + (tmp.length / 64) + - 18 + 16 + header.length*2 + 10; - var buf = Buffer.alloc(len); - var o = 0; - o += buf.write('-----BEGIN ' + header + '-----\n', o); - for (var i = 0; i < tmp.length; ) { - var limit = i + 64; - if (limit > tmp.length) - limit = tmp.length; - o += buf.write(tmp.slice(i, limit), o); - buf[o++] = 10; - i = limit; - } - o += buf.write('-----END ' + header + '-----\n', o); - - return (buf.slice(0, o)); -} - - -/***/ }), - -/***/ 503: +/***/ 383: /***/ (function(__unusedmodule, exports, __webpack_require__) { -var crypto = __webpack_require__(417); -var BigInteger = __webpack_require__(71).BigInteger; -var ECPointFp = __webpack_require__(814).ECPointFp; -var Buffer = __webpack_require__(375).Buffer; -exports.ECCurves = __webpack_require__(571); +"use strict"; +/*! + * Copyright (c) 2015, Salesforce.com, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * 3. Neither the name of Salesforce.com nor the names of its contributors may + * be used to endorse or promote products derived from this software without + * specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ -// zero prepad -function unstupid(hex,len) -{ - return (hex.length >= len) ? hex : unstupid("0"+hex,len); -} - -exports.ECKey = function(curve, key, isPublic) -{ - var priv; - var c = curve(); - var n = c.getN(); - var bytes = Math.floor(n.bitLength()/8); - - if(key) - { - if(isPublic) - { - var curve = c.getCurve(); -// var x = key.slice(1,bytes+1); // skip the 04 for uncompressed format -// var y = key.slice(bytes+1); -// this.P = new ECPointFp(curve, -// curve.fromBigInteger(new BigInteger(x.toString("hex"), 16)), -// curve.fromBigInteger(new BigInteger(y.toString("hex"), 16))); - this.P = curve.decodePointHex(key.toString("hex")); - }else{ - if(key.length != bytes) return false; - priv = new BigInteger(key.toString("hex"), 16); - } - }else{ - var n1 = n.subtract(BigInteger.ONE); - var r = new BigInteger(crypto.randomBytes(n.bitLength())); - priv = r.mod(n1).add(BigInteger.ONE); - this.P = c.getG().multiply(priv); - } - if(this.P) - { -// var pubhex = unstupid(this.P.getX().toBigInteger().toString(16),bytes*2)+unstupid(this.P.getY().toBigInteger().toString(16),bytes*2); -// this.PublicKey = Buffer.from("04"+pubhex,"hex"); - this.PublicKey = Buffer.from(c.getCurve().encodeCompressedPointHex(this.P),"hex"); - } - if(priv) - { - this.PrivateKey = Buffer.from(unstupid(priv.toString(16),bytes*2),"hex"); - this.deriveSharedSecret = function(key) - { - if(!key || !key.P) return false; - var S = key.P.multiply(priv); - return Buffer.from(unstupid(S.getX().toBigInteger().toString(16),bytes*2),"hex"); - } - } +var pubsuffix = __webpack_require__(519); + +// Gives the permutation of all possible domainMatch()es of a given domain. The +// array is in shortest-to-longest order. Handy for indexing. +function permuteDomain (domain) { + var pubSuf = pubsuffix.getPublicSuffix(domain); + if (!pubSuf) { + return null; + } + if (pubSuf == domain) { + return [domain]; + } + + var prefix = domain.slice(0, -(pubSuf.length + 1)); // ".example.com" + var parts = prefix.split('.').reverse(); + var cur = pubSuf; + var permutations = [cur]; + while (parts.length) { + cur = parts.shift() + '.' + cur; + permutations.push(cur); + } + return permutations; } +exports.permuteDomain = permuteDomain; /***/ }), -/***/ 509: +/***/ 386: +/***/ (function(module, __unusedexports, __webpack_require__) { + +"use strict"; + + +var stringify = __webpack_require__(897); +var parse = __webpack_require__(755); +var formats = __webpack_require__(13); + +module.exports = { + formats: formats, + parse: parse, + stringify: stringify +}; + + +/***/ }), + +/***/ 397: /***/ (function(module) { "use strict"; -module.exports = function generate__limitItems(it, $keyword, $ruleType) { +module.exports = function generate_multipleOf(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; @@ -16806,7 +12171,6 @@ module.exports = function generate__limitItems(it, $keyword, $ruleType) { var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; - var $errorKeyword; var $data = 'data' + ($dataLvl || ''); var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; @@ -16816,32 +12180,33 @@ module.exports = function generate__limitItems(it, $keyword, $ruleType) { } else { $schemaValue = $schema; } - var $op = $keyword == 'maxItems' ? '>' : '<'; - out += 'if ( '; + out += 'var division' + ($lvl) + ';if ('; if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; + out += ' ' + ($schemaValue) + ' !== undefined && ( typeof ' + ($schemaValue) + ' != \'number\' || '; } - out += ' ' + ($data) + '.length ' + ($op) + ' ' + ($schemaValue) + ') { '; - var $errorKeyword = $keyword; + out += ' (division' + ($lvl) + ' = ' + ($data) + ' / ' + ($schemaValue) + ', '; + if (it.opts.multipleOfPrecision) { + out += ' Math.abs(Math.round(division' + ($lvl) + ') - division' + ($lvl) + ') > 1e-' + (it.opts.multipleOfPrecision) + ' '; + } else { + out += ' division' + ($lvl) + ' !== parseInt(division' + ($lvl) + ') '; + } + out += ' ) '; + if ($isData) { + out += ' ) '; + } + out += ' ) { '; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || '_limitItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; + out += ' { keyword: \'' + ('multipleOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { multipleOf: ' + ($schemaValue) + ' } '; if (it.opts.messages !== false) { - out += ' , message: \'should NOT have '; - if ($keyword == 'maxItems') { - out += 'more'; - } else { - out += 'fewer'; - } - out += ' than '; + out += ' , message: \'should be multiple of '; if ($isData) { - out += '\' + ' + ($schemaValue) + ' + \''; + out += '\' + ' + ($schemaValue); } else { - out += '' + ($schema); + out += '' + ($schemaValue) + '\''; } - out += ' items\' '; } if (it.opts.verbose) { out += ' , schema: '; @@ -16878,1130 +12243,1071 @@ module.exports = function generate__limitItems(it, $keyword, $ruleType) { /***/ }), -/***/ 512: -/***/ (function(__unusedmodule, exports, __webpack_require__) { +/***/ 400: +/***/ (function(module, __unusedexports, __webpack_require__) { -var crypto = __webpack_require__(417) +// Copyright 2018 Joyent, Inc. -function sha (key, body, algorithm) { - return crypto.createHmac(algorithm, key).update(body).digest('base64') +module.exports = Fingerprint; + +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var crypto = __webpack_require__(417); +var errs = __webpack_require__(753); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var Certificate = __webpack_require__(752); +var utils = __webpack_require__(270); + +var FingerprintFormatError = errs.FingerprintFormatError; +var InvalidAlgorithmError = errs.InvalidAlgorithmError; + +function Fingerprint(opts) { + assert.object(opts, 'options'); + assert.string(opts.type, 'options.type'); + assert.buffer(opts.hash, 'options.hash'); + assert.string(opts.algorithm, 'options.algorithm'); + + this.algorithm = opts.algorithm.toLowerCase(); + if (algs.hashAlgs[this.algorithm] !== true) + throw (new InvalidAlgorithmError(this.algorithm)); + + this.hash = opts.hash; + this.type = opts.type; + this.hashType = opts.hashType; } -function rsa (key, body) { - return crypto.createSign('RSA-SHA1').update(body).sign(key, 'base64') +Fingerprint.prototype.toString = function (format) { + if (format === undefined) { + if (this.algorithm === 'md5' || this.hashType === 'spki') + format = 'hex'; + else + format = 'base64'; + } + assert.string(format); + + switch (format) { + case 'hex': + if (this.hashType === 'spki') + return (this.hash.toString('hex')); + return (addColons(this.hash.toString('hex'))); + case 'base64': + if (this.hashType === 'spki') + return (this.hash.toString('base64')); + return (sshBase64Format(this.algorithm, + this.hash.toString('base64'))); + default: + throw (new FingerprintFormatError(undefined, format)); + } +}; + +Fingerprint.prototype.matches = function (other) { + assert.object(other, 'key or certificate'); + if (this.type === 'key' && this.hashType !== 'ssh') { + utils.assertCompatible(other, Key, [1, 7], 'key with spki'); + if (PrivateKey.isPrivateKey(other)) { + utils.assertCompatible(other, PrivateKey, [1, 6], + 'privatekey with spki support'); + } + } else if (this.type === 'key') { + utils.assertCompatible(other, Key, [1, 0], 'key'); + } else { + utils.assertCompatible(other, Certificate, [1, 0], + 'certificate'); + } + + var theirHash = other.hash(this.algorithm, this.hashType); + var theirHash2 = crypto.createHash(this.algorithm). + update(theirHash).digest('base64'); + + if (this.hash2 === undefined) + this.hash2 = crypto.createHash(this.algorithm). + update(this.hash).digest('base64'); + + return (this.hash2 === theirHash2); +}; + +/*JSSTYLED*/ +var base64RE = /^[A-Za-z0-9+\/=]+$/; +/*JSSTYLED*/ +var hexRE = /^[a-fA-F0-9]+$/; + +Fingerprint.parse = function (fp, options) { + assert.string(fp, 'fingerprint'); + + var alg, hash, enAlgs; + if (Array.isArray(options)) { + enAlgs = options; + options = {}; + } + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + if (options.enAlgs !== undefined) + enAlgs = options.enAlgs; + if (options.algorithms !== undefined) + enAlgs = options.algorithms; + assert.optionalArrayOfString(enAlgs, 'algorithms'); + + var hashType = 'ssh'; + if (options.hashType !== undefined) + hashType = options.hashType; + assert.string(hashType, 'options.hashType'); + + var parts = fp.split(':'); + if (parts.length == 2) { + alg = parts[0].toLowerCase(); + if (!base64RE.test(parts[1])) + throw (new FingerprintFormatError(fp)); + try { + hash = Buffer.from(parts[1], 'base64'); + } catch (e) { + throw (new FingerprintFormatError(fp)); + } + } else if (parts.length > 2) { + alg = 'md5'; + if (parts[0].toLowerCase() === 'md5') + parts = parts.slice(1); + parts = parts.map(function (p) { + while (p.length < 2) + p = '0' + p; + if (p.length > 2) + throw (new FingerprintFormatError(fp)); + return (p); + }); + parts = parts.join(''); + if (!hexRE.test(parts) || parts.length % 2 !== 0) + throw (new FingerprintFormatError(fp)); + try { + hash = Buffer.from(parts, 'hex'); + } catch (e) { + throw (new FingerprintFormatError(fp)); + } + } else { + if (hexRE.test(fp)) { + hash = Buffer.from(fp, 'hex'); + } else if (base64RE.test(fp)) { + hash = Buffer.from(fp, 'base64'); + } else { + throw (new FingerprintFormatError(fp)); + } + + switch (hash.length) { + case 32: + alg = 'sha256'; + break; + case 16: + alg = 'md5'; + break; + case 20: + alg = 'sha1'; + break; + case 64: + alg = 'sha512'; + break; + default: + throw (new FingerprintFormatError(fp)); + } + + /* Plain hex/base64: guess it's probably SPKI unless told. */ + if (options.hashType === undefined) + hashType = 'spki'; + } + + if (alg === undefined) + throw (new FingerprintFormatError(fp)); + + if (algs.hashAlgs[alg] === undefined) + throw (new InvalidAlgorithmError(alg)); + + if (enAlgs !== undefined) { + enAlgs = enAlgs.map(function (a) { return a.toLowerCase(); }); + if (enAlgs.indexOf(alg) === -1) + throw (new InvalidAlgorithmError(alg)); + } + + return (new Fingerprint({ + algorithm: alg, + hash: hash, + type: options.type || 'key', + hashType: hashType + })); +}; + +function addColons(s) { + /*JSSTYLED*/ + return (s.replace(/(.{2})(?=.)/g, '$1:')); } -function rfc3986 (str) { - return encodeURIComponent(str) - .replace(/!/g,'%21') - .replace(/\*/g,'%2A') - .replace(/\(/g,'%28') - .replace(/\)/g,'%29') - .replace(/'/g,'%27') +function base64Strip(s) { + /*JSSTYLED*/ + return (s.replace(/=*$/, '')); } -// Maps object to bi-dimensional array -// Converts { foo: 'A', bar: [ 'b', 'B' ]} to -// [ ['foo', 'A'], ['bar', 'b'], ['bar', 'B'] ] -function map (obj) { - var key, val, arr = [] - for (key in obj) { - val = obj[key] - if (Array.isArray(val)) - for (var i = 0; i < val.length; i++) - arr.push([key, val[i]]) - else if (typeof val === 'object') - for (var prop in val) - arr.push([key + '[' + prop + ']', val[prop]]) - else - arr.push([key, val]) - } - return arr +function sshBase64Format(alg, h) { + return (alg.toUpperCase() + ':' + base64Strip(h)); } -// Compare function for sort -function compare (a, b) { - return a > b ? 1 : a < b ? -1 : 0 -} +Fingerprint.isFingerprint = function (obj, ver) { + return (utils.isCompatible(obj, Fingerprint, ver)); +}; -function generateBase (httpMethod, base_uri, params) { - // adapted from https://dev.twitter.com/docs/auth/oauth and - // https://dev.twitter.com/docs/auth/creating-signature +/* + * API versions for Fingerprint: + * [1,0] -- initial ver + * [1,1] -- first tagged ver + * [1,2] -- hashType and spki support + */ +Fingerprint.prototype._sshpkApiVersion = [1, 2]; - // Parameter normalization - // http://tools.ietf.org/html/rfc5849#section-3.4.1.3.2 - var normalized = map(params) - // 1. First, the name and value of each parameter are encoded - .map(function (p) { - return [ rfc3986(p[0]), rfc3986(p[1] || '') ] - }) - // 2. The parameters are sorted by name, using ascending byte value - // ordering. If two or more parameters share the same name, they - // are sorted by their value. - .sort(function (a, b) { - return compare(a[0], b[0]) || compare(a[1], b[1]) - }) - // 3. The name of each parameter is concatenated to its corresponding - // value using an "=" character (ASCII code 61) as a separator, even - // if the value is empty. - .map(function (p) { return p.join('=') }) - // 4. The sorted name/value pairs are concatenated together into a - // single string by using an "&" character (ASCII code 38) as - // separator. - .join('&') +Fingerprint._oldVersionDetect = function (obj) { + assert.func(obj.toString); + assert.func(obj.matches); + return ([1, 0]); +}; - var base = [ - rfc3986(httpMethod ? httpMethod.toUpperCase() : 'GET'), - rfc3986(base_uri), - rfc3986(normalized) - ].join('&') - - return base -} - -function hmacsign (httpMethod, base_uri, params, consumer_secret, token_secret) { - var base = generateBase(httpMethod, base_uri, params) - var key = [ - consumer_secret || '', - token_secret || '' - ].map(rfc3986).join('&') - - return sha(key, base, 'sha1') -} - -function hmacsign256 (httpMethod, base_uri, params, consumer_secret, token_secret) { - var base = generateBase(httpMethod, base_uri, params) - var key = [ - consumer_secret || '', - token_secret || '' - ].map(rfc3986).join('&') - - return sha(key, base, 'sha256') -} - -function rsasign (httpMethod, base_uri, params, private_key, token_secret) { - var base = generateBase(httpMethod, base_uri, params) - var key = private_key || '' - - return rsa(key, base) -} - -function plaintext (consumer_secret, token_secret) { - var key = [ - consumer_secret || '', - token_secret || '' - ].map(rfc3986).join('&') - - return key -} - -function sign (signMethod, httpMethod, base_uri, params, consumer_secret, token_secret) { - var method - var skipArgs = 1 - - switch (signMethod) { - case 'RSA-SHA1': - method = rsasign - break - case 'HMAC-SHA1': - method = hmacsign - break - case 'HMAC-SHA256': - method = hmacsign256 - break - case 'PLAINTEXT': - method = plaintext - skipArgs = 4 - break - default: - throw new Error('Signature method not supported: ' + signMethod) - } - - return method.apply(null, [].slice.call(arguments, skipArgs)) -} - -exports.hmacsign = hmacsign -exports.hmacsign256 = hmacsign256 -exports.rsasign = rsasign -exports.plaintext = plaintext -exports.sign = sign -exports.rfc3986 = rfc3986 -exports.generateBase = generateBase /***/ }), -/***/ 516: +/***/ 413: /***/ (function(module) { +module.exports = require("stream"); + +/***/ }), + +/***/ 416: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + "use strict"; -module.exports = function (data, opts) { - if (!opts) opts = {}; - if (typeof opts === 'function') opts = { cmp: opts }; - var cycles = (typeof opts.cycles === 'boolean') ? opts.cycles : false; +var fs = __webpack_require__(747) +var qs = __webpack_require__(191) +var validate = __webpack_require__(846) +var extend = __webpack_require__(374) - var cmp = opts.cmp && (function (f) { - return function (node) { - return function (a, b) { - var aobj = { key: a, value: node[a] }; - var bobj = { key: b, value: node[b] }; - return f(aobj, bobj); - }; - }; - })(opts.cmp); +function Har (request) { + this.request = request +} - var seen = []; - return (function stringify (node) { - if (node && node.toJSON && typeof node.toJSON === 'function') { - node = node.toJSON(); +Har.prototype.reducer = function (obj, pair) { + // new property ? + if (obj[pair.name] === undefined) { + obj[pair.name] = pair.value + return obj + } + + // existing? convert to array + var arr = [ + obj[pair.name], + pair.value + ] + + obj[pair.name] = arr + + return obj +} + +Har.prototype.prep = function (data) { + // construct utility properties + data.queryObj = {} + data.headersObj = {} + data.postData.jsonObj = false + data.postData.paramsObj = false + + // construct query objects + if (data.queryString && data.queryString.length) { + data.queryObj = data.queryString.reduce(this.reducer, {}) + } + + // construct headers objects + if (data.headers && data.headers.length) { + // loweCase header keys + data.headersObj = data.headers.reduceRight(function (headers, header) { + headers[header.name] = header.value + return headers + }, {}) + } + + // construct Cookie header + if (data.cookies && data.cookies.length) { + var cookies = data.cookies.map(function (cookie) { + return cookie.name + '=' + cookie.value + }) + + if (cookies.length) { + data.headersObj.cookie = cookies.join('; ') + } + } + + // prep body + function some (arr) { + return arr.some(function (type) { + return data.postData.mimeType.indexOf(type) === 0 + }) + } + + if (some([ + 'multipart/mixed', + 'multipart/related', + 'multipart/form-data', + 'multipart/alternative'])) { + // reset values + data.postData.mimeType = 'multipart/form-data' + } else if (some([ + 'application/x-www-form-urlencoded'])) { + if (!data.postData.params) { + data.postData.text = '' + } else { + data.postData.paramsObj = data.postData.params.reduce(this.reducer, {}) + + // always overwrite + data.postData.text = qs.stringify(data.postData.paramsObj) + } + } else if (some([ + 'text/json', + 'text/x-json', + 'application/json', + 'application/x-json'])) { + data.postData.mimeType = 'application/json' + + if (data.postData.text) { + try { + data.postData.jsonObj = JSON.parse(data.postData.text) + } catch (e) { + this.request.debug(e) + + // force back to text/plain + data.postData.mimeType = 'text/plain' + } + } + } + + return data +} + +Har.prototype.options = function (options) { + // skip if no har property defined + if (!options.har) { + return options + } + + var har = {} + extend(har, options.har) + + // only process the first entry + if (har.log && har.log.entries) { + har = har.log.entries[0] + } + + // add optional properties to make validation successful + har.url = har.url || options.url || options.uri || options.baseUrl || '/' + har.httpVersion = har.httpVersion || 'HTTP/1.1' + har.queryString = har.queryString || [] + har.headers = har.headers || [] + har.cookies = har.cookies || [] + har.postData = har.postData || {} + har.postData.mimeType = har.postData.mimeType || 'application/octet-stream' + + har.bodySize = 0 + har.headersSize = 0 + har.postData.size = 0 + + if (!validate.request(har)) { + return options + } + + // clean up and get some utility properties + var req = this.prep(har) + + // construct new options + if (req.url) { + options.url = req.url + } + + if (req.method) { + options.method = req.method + } + + if (Object.keys(req.queryObj).length) { + options.qs = req.queryObj + } + + if (Object.keys(req.headersObj).length) { + options.headers = req.headersObj + } + + function test (type) { + return req.postData.mimeType.indexOf(type) === 0 + } + if (test('application/x-www-form-urlencoded')) { + options.form = req.postData.paramsObj + } else if (test('application/json')) { + if (req.postData.jsonObj) { + options.body = req.postData.jsonObj + options.json = true + } + } else if (test('multipart/form-data')) { + options.formData = {} + + req.postData.params.forEach(function (param) { + var attachment = {} + + if (!param.fileName && !param.contentType) { + options.formData[param.name] = param.value + return + } + + // attempt to read from disk! + if (param.fileName && !param.value) { + attachment.value = fs.createReadStream(param.fileName) + } else if (param.value) { + attachment.value = param.value + } + + if (param.fileName) { + attachment.options = { + filename: param.fileName, + contentType: param.contentType ? param.contentType : null } + } - if (node === undefined) return; - if (typeof node == 'number') return isFinite(node) ? '' + node : 'null'; - if (typeof node !== 'object') return JSON.stringify(node); + options.formData[param.name] = attachment + }) + } else { + if (req.postData.text) { + options.body = req.postData.text + } + } - var i, out; - if (Array.isArray(node)) { - out = '['; - for (i = 0; i < node.length; i++) { - if (i) out += ','; - out += stringify(node[i]) || 'null'; - } - return out + ']'; - } + return options +} - if (node === null) return 'null'; - - if (seen.indexOf(node) !== -1) { - if (cycles) return JSON.stringify('__cycle__'); - throw new TypeError('Converting circular structure to JSON'); - } - - var seenIndex = seen.push(node) - 1; - var keys = Object.keys(node).sort(cmp && cmp(node)); - out = ''; - for (i = 0; i < keys.length; i++) { - var key = keys[i]; - var value = stringify(node[key]); - - if (!value) continue; - if (out) out += ','; - out += JSON.stringify(key) + ':' + value; - } - seen.splice(seenIndex, 1); - return '{' + out + '}'; - })(data); -}; +exports.Har = Har /***/ }), -/***/ 517: +/***/ 417: +/***/ (function(module) { + +module.exports = require("crypto"); + +/***/ }), + +/***/ 424: /***/ (function(module, __unusedexports, __webpack_require__) { -// Copyright 2012 Joyent, Inc. All rights reserved. +var iterate = __webpack_require__(157) + , initState = __webpack_require__(147) + , terminator = __webpack_require__(939) + ; -var assert = __webpack_require__(283); -var sshpk = __webpack_require__(804); -var util = __webpack_require__(669); +// Public API +module.exports = parallel; -var HASH_ALGOS = { - 'sha1': true, - 'sha256': true, - 'sha512': true -}; +/** + * Runs iterator over provided array elements in parallel + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} callback - invoked when all elements processed + * @returns {function} - jobs terminator + */ +function parallel(list, iterator, callback) +{ + var state = initState(list); -var PK_ALGOS = { - 'rsa': true, - 'dsa': true, - 'ecdsa': true -}; + while (state.index < (state['keyedList'] || list).length) + { + iterate(list, iterator, state, function(error, result) + { + if (error) + { + callback(error, result); + return; + } -function HttpSignatureError(message, caller) { - if (Error.captureStackTrace) - Error.captureStackTrace(this, caller || HttpSignatureError); + // looks like it's the last one + if (Object.keys(state.jobs).length === 0) + { + callback(null, state.results); + return; + } + }); - this.message = message; - this.name = caller.name; -} -util.inherits(HttpSignatureError, Error); - -function InvalidAlgorithmError(message) { - HttpSignatureError.call(this, message, InvalidAlgorithmError); -} -util.inherits(InvalidAlgorithmError, HttpSignatureError); - -function validateAlgorithm(algorithm) { - var alg = algorithm.toLowerCase().split('-'); - - if (alg.length !== 2) { - throw (new InvalidAlgorithmError(alg[0].toUpperCase() + ' is not a ' + - 'valid algorithm')); + state.index++; } - if (alg[0] !== 'hmac' && !PK_ALGOS[alg[0]]) { - throw (new InvalidAlgorithmError(alg[0].toUpperCase() + ' type keys ' + - 'are not supported')); - } - - if (!HASH_ALGOS[alg[1]]) { - throw (new InvalidAlgorithmError(alg[1].toUpperCase() + ' is not a ' + - 'supported hash algorithm')); - } - - return (alg); + return terminator.bind(state, callback); } -///--- API + +/***/ }), + +/***/ 428: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +var assert = __webpack_require__(477); +var crypto = __webpack_require__(417); +var sshpk = __webpack_require__(650); +var utils = __webpack_require__(909); + +var HASH_ALGOS = utils.HASH_ALGOS; +var PK_ALGOS = utils.PK_ALGOS; +var InvalidAlgorithmError = utils.InvalidAlgorithmError; +var HttpSignatureError = utils.HttpSignatureError; +var validateAlgorithm = utils.validateAlgorithm; + +///--- Exported API module.exports = { - - HASH_ALGOS: HASH_ALGOS, - PK_ALGOS: PK_ALGOS, - - HttpSignatureError: HttpSignatureError, - InvalidAlgorithmError: InvalidAlgorithmError, - - validateAlgorithm: validateAlgorithm, - /** - * Converts an OpenSSH public key (rsa only) to a PKCS#8 PEM file. + * Verify RSA/DSA signature against public key. You are expected to pass in + * an object that was returned from `parse()`. * - * The intent of this module is to interoperate with OpenSSL only, - * specifically the node crypto module's `verify` method. - * - * @param {String} key an OpenSSH public key. - * @return {String} PEM encoded form of the RSA public key. - * @throws {TypeError} on bad input. - * @throws {Error} on invalid ssh key formatted data. + * @param {Object} parsedSignature the object you got from `parse`. + * @param {String} pubkey RSA/DSA private key PEM. + * @return {Boolean} true if valid, false otherwise. + * @throws {TypeError} if you pass in bad arguments. + * @throws {InvalidAlgorithmError} */ - sshKeyToPEM: function sshKeyToPEM(key) { - assert.string(key, 'ssh_key'); + verifySignature: function verifySignature(parsedSignature, pubkey) { + assert.object(parsedSignature, 'parsedSignature'); + if (typeof (pubkey) === 'string' || Buffer.isBuffer(pubkey)) + pubkey = sshpk.parseKey(pubkey); + assert.ok(sshpk.Key.isKey(pubkey, [1, 1]), 'pubkey must be a sshpk.Key'); - var k = sshpk.parseKey(key, 'ssh'); - return (k.toString('pem')); - }, + var alg = validateAlgorithm(parsedSignature.algorithm); + if (alg[0] === 'hmac' || alg[0] !== pubkey.type) + return (false); - - /** - * Generates an OpenSSH fingerprint from an ssh public key. - * - * @param {String} key an OpenSSH public key. - * @return {String} key fingerprint. - * @throws {TypeError} on bad input. - * @throws {Error} if what you passed doesn't look like an ssh public key. - */ - fingerprint: function fingerprint(key) { - assert.string(key, 'ssh_key'); - - var k = sshpk.parseKey(key, 'ssh'); - return (k.fingerprint('md5').toString('hex')); + var v = pubkey.createVerify(alg[1]); + v.update(parsedSignature.signingString); + return (v.verify(parsedSignature.params.signature, 'base64')); }, /** - * Converts a PKGCS#8 PEM file to an OpenSSH public key (rsa) + * Verify HMAC against shared secret. You are expected to pass in an object + * that was returned from `parse()`. * - * The reverse of the above function. + * @param {Object} parsedSignature the object you got from `parse`. + * @param {String} secret HMAC shared secret. + * @return {Boolean} true if valid, false otherwise. + * @throws {TypeError} if you pass in bad arguments. + * @throws {InvalidAlgorithmError} */ - pemToRsaSSHKey: function pemToRsaSSHKey(pem, comment) { - assert.equal('string', typeof (pem), 'typeof pem'); + verifyHMAC: function verifyHMAC(parsedSignature, secret) { + assert.object(parsedSignature, 'parsedHMAC'); + assert.string(secret, 'secret'); - var k = sshpk.parseKey(pem, 'pem'); - k.comment = comment; - return (k.toString('ssh')); + var alg = validateAlgorithm(parsedSignature.algorithm); + if (alg[0] !== 'hmac') + return (false); + + var hashAlg = alg[1].toUpperCase(); + + var hmac = crypto.createHmac(hashAlg, secret); + hmac.update(parsedSignature.signingString); + + /* + * Now double-hash to avoid leaking timing information - there's + * no easy constant-time compare in JS, so we use this approach + * instead. See for more info: + * https://www.isecpartners.com/blog/2011/february/double-hmac- + * verification.aspx + */ + var h1 = crypto.createHmac(hashAlg, secret); + h1.update(hmac.digest()); + h1 = h1.digest(); + var h2 = crypto.createHmac(hashAlg, secret); + h2.update(new Buffer(parsedSignature.params.signature, 'base64')); + h2 = h2.digest(); + + /* Node 0.8 returns strings from .digest(). */ + if (typeof (h1) === 'string') + return (h1 === h2); + /* And node 0.10 lacks the .equals() method on Buffers. */ + if (Buffer.isBuffer(h1) && !h1.equals) + return (h1.toString('binary') === h2.toString('binary')); + + return (h1.equals(h2)); } }; /***/ }), -/***/ 533: +/***/ 431: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +"use strict"; + +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; + result["default"] = mod; + return result; +}; +Object.defineProperty(exports, "__esModule", { value: true }); +const os = __importStar(__webpack_require__(87)); +/** + * Commands + * + * Command Format: + * ::name key=value,key=value::message + * + * Examples: + * ::warning::This is the message + * ::set-env name=MY_VAR::some value + */ +function issueCommand(command, properties, message) { + const cmd = new Command(command, properties, message); + process.stdout.write(cmd.toString() + os.EOL); +} +exports.issueCommand = issueCommand; +function issue(name, message = '') { + issueCommand(name, {}, message); +} +exports.issue = issue; +const CMD_STRING = '::'; +class Command { + constructor(command, properties, message) { + if (!command) { + command = 'missing.command'; + } + this.command = command; + this.properties = properties; + this.message = message; + } + toString() { + let cmdStr = CMD_STRING + this.command; + if (this.properties && Object.keys(this.properties).length > 0) { + cmdStr += ' '; + let first = true; + for (const key in this.properties) { + if (this.properties.hasOwnProperty(key)) { + const val = this.properties[key]; + if (val) { + if (first) { + first = false; + } + else { + cmdStr += ','; + } + cmdStr += `${key}=${escapeProperty(val)}`; + } + } + } + } + cmdStr += `${CMD_STRING}${escapeData(this.message)}`; + return cmdStr; + } +} +function escapeData(s) { + return (s || '') + .replace(/%/g, '%25') + .replace(/\r/g, '%0D') + .replace(/\n/g, '%0A'); +} +function escapeProperty(s) { + return (s || '') + .replace(/%/g, '%25') + .replace(/\r/g, '%0D') + .replace(/\n/g, '%0A') + .replace(/:/g, '%3A') + .replace(/,/g, '%2C'); +} +//# sourceMappingURL=command.js.map + +/***/ }), + +/***/ 449: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2015 Joyent, Inc. module.exports = { - read: read.bind(undefined, false, undefined), - readType: read.bind(undefined, false), + read: read, + readPkcs1: readPkcs1, write: write, - /* semi-private api, used by sshpk-agent */ - readPartial: read.bind(undefined, true), - - /* shared with ssh format */ - readInternal: read, - keyTypeToAlg: keyTypeToAlg, - algToKeyType: algToKeyType + writePkcs1: writePkcs1 }; -var assert = __webpack_require__(283); -var Buffer = __webpack_require__(375).Buffer; -var algs = __webpack_require__(936); -var utils = __webpack_require__(757); -var Key = __webpack_require__(820); -var PrivateKey = __webpack_require__(463); -var SSHBuffer = __webpack_require__(907); +var assert = __webpack_require__(477); +var asn1 = __webpack_require__(62); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var utils = __webpack_require__(270); -function algToKeyType(alg) { - assert.string(alg); - if (alg === 'ssh-dss') - return ('dsa'); - else if (alg === 'ssh-rsa') - return ('rsa'); - else if (alg === 'ssh-ed25519') - return ('ed25519'); - else if (alg === 'ssh-curve25519') - return ('curve25519'); - else if (alg.match(/^ecdsa-sha2-/)) - return ('ecdsa'); - else - throw (new Error('Unknown algorithm ' + alg)); -} +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var pem = __webpack_require__(268); -function keyTypeToAlg(key) { - assert.object(key); - if (key.type === 'dsa') - return ('ssh-dss'); - else if (key.type === 'rsa') - return ('ssh-rsa'); - else if (key.type === 'ed25519') - return ('ssh-ed25519'); - else if (key.type === 'curve25519') - return ('ssh-curve25519'); - else if (key.type === 'ecdsa') - return ('ecdsa-sha2-' + key.part.curve.data.toString()); - else - throw (new Error('Unknown key type ' + key.type)); -} +var pkcs8 = __webpack_require__(707); +var readECDSACurve = pkcs8.readECDSACurve; -function read(partial, type, buf, options) { - if (typeof (buf) === 'string') - buf = Buffer.from(buf); - assert.buffer(buf, 'buf'); - - var key = {}; - - var parts = key.parts = []; - var sshbuf = new SSHBuffer({buffer: buf}); - - var alg = sshbuf.readString(); - assert.ok(!sshbuf.atEnd(), 'key must have at least one part'); - - key.type = algToKeyType(alg); - - var partCount = algs.info[key.type].parts.length; - if (type && type === 'private') - partCount = algs.privInfo[key.type].parts.length; - - while (!sshbuf.atEnd() && parts.length < partCount) - parts.push(sshbuf.readPart()); - while (!partial && !sshbuf.atEnd()) - parts.push(sshbuf.readPart()); - - assert.ok(parts.length >= 1, - 'key must have at least one part'); - assert.ok(partial || sshbuf.atEnd(), - 'leftover bytes at end of key'); - - var Constructor = Key; - var algInfo = algs.info[key.type]; - if (type === 'private' || algInfo.parts.length !== parts.length) { - algInfo = algs.privInfo[key.type]; - Constructor = PrivateKey; - } - assert.strictEqual(algInfo.parts.length, parts.length); - - if (key.type === 'ecdsa') { - var res = /^ecdsa-sha2-(.+)$/.exec(alg); - assert.ok(res !== null); - assert.strictEqual(res[1], parts[0].data.toString()); - } - - var normalized = true; - for (var i = 0; i < algInfo.parts.length; ++i) { - var p = parts[i]; - p.name = algInfo.parts[i]; - /* - * OpenSSH stores ed25519 "private" keys as seed + public key - * concat'd together (k followed by A). We want to keep them - * separate for other formats that don't do this. - */ - if (key.type === 'ed25519' && p.name === 'k') - p.data = p.data.slice(0, 32); - - if (p.name !== 'curve' && algInfo.normalize !== false) { - var nd; - if (key.type === 'ed25519') { - nd = utils.zeroPadToLength(p.data, 32); - } else { - nd = utils.mpNormalize(p.data); - } - if (nd.toString('binary') !== - p.data.toString('binary')) { - p.data = nd; - normalized = false; - } - } - } - - if (normalized) - key._rfc4253Cache = sshbuf.toBuffer(); - - if (partial && typeof (partial) === 'object') { - partial.remainder = sshbuf.remainder(); - partial.consumed = sshbuf._offset; - } - - return (new Constructor(key)); +function read(buf, options) { + return (pem.read(buf, options, 'pkcs1')); } function write(key, options) { - assert.object(key); - - var alg = keyTypeToAlg(key); - var i; - - var algInfo = algs.info[key.type]; - if (PrivateKey.isPrivateKey(key)) - algInfo = algs.privInfo[key.type]; - var parts = algInfo.parts; - - var buf = new SSHBuffer({}); - - buf.writeString(alg); - - for (i = 0; i < parts.length; ++i) { - var data = key.part[parts[i]].data; - if (algInfo.normalize !== false) { - if (key.type === 'ed25519') - data = utils.zeroPadToLength(data, 32); - else - data = utils.mpNormalize(data); - } - if (key.type === 'ed25519' && parts[i] === 'k') - data = Buffer.concat([data, key.part.A.data]); - buf.writeBuffer(data); - } - - return (buf.toBuffer()); + return (pem.write(key, options, 'pkcs1')); } - -/***/ }), - -/***/ 536: -/***/ (function(module) { - -module.exports = {"$id":"query.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","value"],"properties":{"name":{"type":"string"},"value":{"type":"string"},"comment":{"type":"string"}}}; - -/***/ }), - -/***/ 542: -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_contains(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - var $idx = 'i' + $lvl, - $dataNxt = $it.dataLevel = it.dataLevel + 1, - $nextData = 'data' + $dataNxt, - $currentBaseId = it.baseId, - $nonEmptySchema = (it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all)); - out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; - if ($nonEmptySchema) { - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - $it.schema = $schema; - $it.schemaPath = $schemaPath; - $it.errSchemaPath = $errSchemaPath; - out += ' var ' + ($nextValid) + ' = false; for (var ' + ($idx) + ' = 0; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; - $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); - var $passData = $data + '[' + $idx + ']'; - $it.dataPathArr[$dataNxt] = $idx; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; - } - out += ' if (' + ($nextValid) + ') break; } '; - it.compositeRule = $it.compositeRule = $wasComposite; - out += ' ' + ($closingBraces) + ' if (!' + ($nextValid) + ') {'; - } else { - out += ' if (' + ($data) + '.length == 0) {'; - } - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('contains') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; - if (it.opts.messages !== false) { - out += ' , message: \'should contain a valid item\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } else { '; - if ($nonEmptySchema) { - out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; - } - if (it.opts.allErrors) { - out += ' } '; - } - out = it.util.cleanUpCode(out); - return out; +/* Helper to read in a single mpint */ +function readMPInt(der, nm) { + assert.strictEqual(der.peek(), asn1.Ber.Integer, + nm + ' is not an Integer'); + return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); } - -/***/ }), - -/***/ 554: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. - -module.exports = { - read: read, - write: write -}; - -var assert = __webpack_require__(283); -var Buffer = __webpack_require__(375).Buffer; -var Key = __webpack_require__(820); -var PrivateKey = __webpack_require__(463); -var utils = __webpack_require__(757); -var SSHBuffer = __webpack_require__(907); -var Dhe = __webpack_require__(472); - -var supportedAlgos = { - 'rsa-sha1' : 5, - 'rsa-sha256' : 8, - 'rsa-sha512' : 10, - 'ecdsa-p256-sha256' : 13, - 'ecdsa-p384-sha384' : 14 - /* - * ed25519 is hypothetically supported with id 15 - * but the common tools available don't appear to be - * capable of generating/using ed25519 keys - */ -}; - -var supportedAlgosById = {}; -Object.keys(supportedAlgos).forEach(function (k) { - supportedAlgosById[supportedAlgos[k]] = k.toUpperCase(); -}); - -function read(buf, options) { - if (typeof (buf) !== 'string') { - assert.buffer(buf, 'buf'); - buf = buf.toString('ascii'); +function readPkcs1(alg, type, der) { + switch (alg) { + case 'RSA': + if (type === 'public') + return (readPkcs1RSAPublic(der)); + else if (type === 'private') + return (readPkcs1RSAPrivate(der)); + throw (new Error('Unknown key type: ' + type)); + case 'DSA': + if (type === 'public') + return (readPkcs1DSAPublic(der)); + else if (type === 'private') + return (readPkcs1DSAPrivate(der)); + throw (new Error('Unknown key type: ' + type)); + case 'EC': + case 'ECDSA': + if (type === 'private') + return (readPkcs1ECDSAPrivate(der)); + else if (type === 'public') + return (readPkcs1ECDSAPublic(der)); + throw (new Error('Unknown key type: ' + type)); + case 'EDDSA': + case 'EdDSA': + if (type === 'private') + return (readPkcs1EdDSAPrivate(der)); + throw (new Error(type + ' keys not supported with EdDSA')); + default: + throw (new Error('Unknown key algo: ' + alg)); } - var lines = buf.split('\n'); - if (lines[0].match(/^Private-key-format\: v1/)) { - var algElems = lines[1].split(' '); - var algoNum = parseInt(algElems[1], 10); - var algoName = algElems[2]; - if (!supportedAlgosById[algoNum]) - throw (new Error('Unsupported algorithm: ' + algoName)); - return (readDNSSECPrivateKey(algoNum, lines.slice(2))); - } - - // skip any comment-lines - var line = 0; - /* JSSTYLED */ - while (lines[line].match(/^\;/)) - line++; - // we should now have *one single* line left with our KEY on it. - if ((lines[line].match(/\. IN KEY /) || - lines[line].match(/\. IN DNSKEY /)) && lines[line+1].length === 0) { - return (readRFC3110(lines[line])); - } - throw (new Error('Cannot parse dnssec key')); } -function readRFC3110(keyString) { - var elems = keyString.split(' '); - //unused var flags = parseInt(elems[3], 10); - //unused var protocol = parseInt(elems[4], 10); - var algorithm = parseInt(elems[5], 10); - if (!supportedAlgosById[algorithm]) - throw (new Error('Unsupported algorithm: ' + algorithm)); - var base64key = elems.slice(6, elems.length).join(); - var keyBuffer = Buffer.from(base64key, 'base64'); - if (supportedAlgosById[algorithm].match(/^RSA-/)) { - // join the rest of the body into a single base64-blob - var publicExponentLen = keyBuffer.readUInt8(0); - if (publicExponentLen != 3 && publicExponentLen != 1) - throw (new Error('Cannot parse dnssec key: ' + - 'unsupported exponent length')); +function readPkcs1RSAPublic(der) { + // modulus and exponent + var n = readMPInt(der, 'modulus'); + var e = readMPInt(der, 'exponent'); - var publicExponent = keyBuffer.slice(1, publicExponentLen+1); - publicExponent = utils.mpNormalize(publicExponent); - var modulus = keyBuffer.slice(1+publicExponentLen); - modulus = utils.mpNormalize(modulus); - // now, make the key - var rsaKey = { - type: 'rsa', - parts: [] - }; - rsaKey.parts.push({ name: 'e', data: publicExponent}); - rsaKey.parts.push({ name: 'n', data: modulus}); - return (new Key(rsaKey)); - } - if (supportedAlgosById[algorithm] === 'ECDSA-P384-SHA384' || - supportedAlgosById[algorithm] === 'ECDSA-P256-SHA256') { - var curve = 'nistp384'; - var size = 384; - if (supportedAlgosById[algorithm].match(/^ECDSA-P256-SHA256/)) { - curve = 'nistp256'; - size = 256; - } - - var ecdsaKey = { - type: 'ecdsa', - curve: curve, - size: size, - parts: [ - {name: 'curve', data: Buffer.from(curve) }, - {name: 'Q', data: utils.ecNormalize(keyBuffer) } - ] - }; - return (new Key(ecdsaKey)); - } - throw (new Error('Unsupported algorithm: ' + - supportedAlgosById[algorithm])); -} - -function elementToBuf(e) { - return (Buffer.from(e.split(' ')[1], 'base64')); -} - -function readDNSSECRSAPrivateKey(elements) { - var rsaParams = {}; - elements.forEach(function (element) { - if (element.split(' ')[0] === 'Modulus:') - rsaParams['n'] = elementToBuf(element); - else if (element.split(' ')[0] === 'PublicExponent:') - rsaParams['e'] = elementToBuf(element); - else if (element.split(' ')[0] === 'PrivateExponent:') - rsaParams['d'] = elementToBuf(element); - else if (element.split(' ')[0] === 'Prime1:') - rsaParams['p'] = elementToBuf(element); - else if (element.split(' ')[0] === 'Prime2:') - rsaParams['q'] = elementToBuf(element); - else if (element.split(' ')[0] === 'Exponent1:') - rsaParams['dmodp'] = elementToBuf(element); - else if (element.split(' ')[0] === 'Exponent2:') - rsaParams['dmodq'] = elementToBuf(element); - else if (element.split(' ')[0] === 'Coefficient:') - rsaParams['iqmp'] = elementToBuf(element); - }); // now, make the key var key = { type: 'rsa', parts: [ - { name: 'e', data: utils.mpNormalize(rsaParams['e'])}, - { name: 'n', data: utils.mpNormalize(rsaParams['n'])}, - { name: 'd', data: utils.mpNormalize(rsaParams['d'])}, - { name: 'p', data: utils.mpNormalize(rsaParams['p'])}, - { name: 'q', data: utils.mpNormalize(rsaParams['q'])}, - { name: 'dmodp', - data: utils.mpNormalize(rsaParams['dmodp'])}, - { name: 'dmodq', - data: utils.mpNormalize(rsaParams['dmodq'])}, - { name: 'iqmp', - data: utils.mpNormalize(rsaParams['iqmp'])} + { name: 'e', data: e }, + { name: 'n', data: n } ] }; + + return (new Key(key)); +} + +function readPkcs1RSAPrivate(der) { + var version = readMPInt(der, 'version'); + assert.strictEqual(version[0], 0); + + // modulus then public exponent + var n = readMPInt(der, 'modulus'); + var e = readMPInt(der, 'public exponent'); + var d = readMPInt(der, 'private exponent'); + var p = readMPInt(der, 'prime1'); + var q = readMPInt(der, 'prime2'); + var dmodp = readMPInt(der, 'exponent1'); + var dmodq = readMPInt(der, 'exponent2'); + var iqmp = readMPInt(der, 'iqmp'); + + // now, make the key + var key = { + type: 'rsa', + parts: [ + { name: 'n', data: n }, + { name: 'e', data: e }, + { name: 'd', data: d }, + { name: 'iqmp', data: iqmp }, + { name: 'p', data: p }, + { name: 'q', data: q }, + { name: 'dmodp', data: dmodp }, + { name: 'dmodq', data: dmodq } + ] + }; + return (new PrivateKey(key)); } -function readDNSSECPrivateKey(alg, elements) { - if (supportedAlgosById[alg].match(/^RSA-/)) { - return (readDNSSECRSAPrivateKey(elements)); - } - if (supportedAlgosById[alg] === 'ECDSA-P384-SHA384' || - supportedAlgosById[alg] === 'ECDSA-P256-SHA256') { - var d = Buffer.from(elements[0].split(' ')[1], 'base64'); - var curve = 'nistp384'; - var size = 384; - if (supportedAlgosById[alg] === 'ECDSA-P256-SHA256') { - curve = 'nistp256'; - size = 256; +function readPkcs1DSAPrivate(der) { + var version = readMPInt(der, 'version'); + assert.strictEqual(version.readUInt8(0), 0); + + var p = readMPInt(der, 'p'); + var q = readMPInt(der, 'q'); + var g = readMPInt(der, 'g'); + var y = readMPInt(der, 'y'); + var x = readMPInt(der, 'x'); + + // now, make the key + var key = { + type: 'dsa', + parts: [ + { name: 'p', data: p }, + { name: 'q', data: q }, + { name: 'g', data: g }, + { name: 'y', data: y }, + { name: 'x', data: x } + ] + }; + + return (new PrivateKey(key)); +} + +function readPkcs1EdDSAPrivate(der) { + var version = readMPInt(der, 'version'); + assert.strictEqual(version.readUInt8(0), 1); + + // private key + var k = der.readString(asn1.Ber.OctetString, true); + + der.readSequence(0xa0); + var oid = der.readOID(); + assert.strictEqual(oid, '1.3.101.112', 'the ed25519 curve identifier'); + + der.readSequence(0xa1); + var A = utils.readBitString(der); + + var key = { + type: 'ed25519', + parts: [ + { name: 'A', data: utils.zeroPadToLength(A, 32) }, + { name: 'k', data: k } + ] + }; + + return (new PrivateKey(key)); +} + +function readPkcs1DSAPublic(der) { + var y = readMPInt(der, 'y'); + var p = readMPInt(der, 'p'); + var q = readMPInt(der, 'q'); + var g = readMPInt(der, 'g'); + + var key = { + type: 'dsa', + parts: [ + { name: 'y', data: y }, + { name: 'p', data: p }, + { name: 'q', data: q }, + { name: 'g', data: g } + ] + }; + + return (new Key(key)); +} + +function readPkcs1ECDSAPublic(der) { + der.readSequence(); + + var oid = der.readOID(); + assert.strictEqual(oid, '1.2.840.10045.2.1', 'must be ecPublicKey'); + + var curveOid = der.readOID(); + + var curve; + var curves = Object.keys(algs.curves); + for (var j = 0; j < curves.length; ++j) { + var c = curves[j]; + var cd = algs.curves[c]; + if (cd.pkcs8oid === curveOid) { + curve = c; + break; } - // DNSSEC generates the public-key on the fly (go calculate it) - var publicKey = utils.publicFromPrivateECDSA(curve, d); - var Q = publicKey.part['Q'].data; - var ecdsaKey = { - type: 'ecdsa', - curve: curve, - size: size, - parts: [ - {name: 'curve', data: Buffer.from(curve) }, - {name: 'd', data: d }, - {name: 'Q', data: Q } - ] - }; - return (new PrivateKey(ecdsaKey)); } - throw (new Error('Unsupported algorithm: ' + supportedAlgosById[alg])); + assert.string(curve, 'a known ECDSA named curve'); + + var Q = der.readString(asn1.Ber.BitString, true); + Q = utils.ecNormalize(Q); + + var key = { + type: 'ecdsa', + parts: [ + { name: 'curve', data: Buffer.from(curve) }, + { name: 'Q', data: Q } + ] + }; + + return (new Key(key)); } -function dnssecTimestamp(date) { - var year = date.getFullYear() + ''; //stringify - var month = (date.getMonth() + 1); - var timestampStr = year + month + date.getUTCDate(); - timestampStr += '' + date.getUTCHours() + date.getUTCMinutes(); - timestampStr += date.getUTCSeconds(); - return (timestampStr); +function readPkcs1ECDSAPrivate(der) { + var version = readMPInt(der, 'version'); + assert.strictEqual(version.readUInt8(0), 1); + + // private key + var d = der.readString(asn1.Ber.OctetString, true); + + der.readSequence(0xa0); + var curve = readECDSACurve(der); + assert.string(curve, 'a known elliptic curve'); + + der.readSequence(0xa1); + var Q = der.readString(asn1.Ber.BitString, true); + Q = utils.ecNormalize(Q); + + var key = { + type: 'ecdsa', + parts: [ + { name: 'curve', data: Buffer.from(curve) }, + { name: 'Q', data: Q }, + { name: 'd', data: d } + ] + }; + + return (new PrivateKey(key)); } -function rsaAlgFromOptions(opts) { - if (!opts || !opts.hashAlgo || opts.hashAlgo === 'sha1') - return ('5 (RSASHA1)'); - else if (opts.hashAlgo === 'sha256') - return ('8 (RSASHA256)'); - else if (opts.hashAlgo === 'sha512') - return ('10 (RSASHA512)'); - else - throw (new Error('Unknown or unsupported hash: ' + - opts.hashAlgo)); +function writePkcs1(der, key) { + der.startSequence(); + + switch (key.type) { + case 'rsa': + if (PrivateKey.isPrivateKey(key)) + writePkcs1RSAPrivate(der, key); + else + writePkcs1RSAPublic(der, key); + break; + case 'dsa': + if (PrivateKey.isPrivateKey(key)) + writePkcs1DSAPrivate(der, key); + else + writePkcs1DSAPublic(der, key); + break; + case 'ecdsa': + if (PrivateKey.isPrivateKey(key)) + writePkcs1ECDSAPrivate(der, key); + else + writePkcs1ECDSAPublic(der, key); + break; + case 'ed25519': + if (PrivateKey.isPrivateKey(key)) + writePkcs1EdDSAPrivate(der, key); + else + writePkcs1EdDSAPublic(der, key); + break; + default: + throw (new Error('Unknown key algo: ' + key.type)); + } + + der.endSequence(); } -function writeRSA(key, options) { - // if we're missing parts, add them. - if (!key.part.dmodp || !key.part.dmodq) { +function writePkcs1RSAPublic(der, key) { + der.writeBuffer(key.part.n.data, asn1.Ber.Integer); + der.writeBuffer(key.part.e.data, asn1.Ber.Integer); +} + +function writePkcs1RSAPrivate(der, key) { + var ver = Buffer.from([0]); + der.writeBuffer(ver, asn1.Ber.Integer); + + der.writeBuffer(key.part.n.data, asn1.Ber.Integer); + der.writeBuffer(key.part.e.data, asn1.Ber.Integer); + der.writeBuffer(key.part.d.data, asn1.Ber.Integer); + der.writeBuffer(key.part.p.data, asn1.Ber.Integer); + der.writeBuffer(key.part.q.data, asn1.Ber.Integer); + if (!key.part.dmodp || !key.part.dmodq) utils.addRSAMissing(key); - } - - var out = ''; - out += 'Private-key-format: v1.3\n'; - out += 'Algorithm: ' + rsaAlgFromOptions(options) + '\n'; - var n = utils.mpDenormalize(key.part['n'].data); - out += 'Modulus: ' + n.toString('base64') + '\n'; - var e = utils.mpDenormalize(key.part['e'].data); - out += 'PublicExponent: ' + e.toString('base64') + '\n'; - var d = utils.mpDenormalize(key.part['d'].data); - out += 'PrivateExponent: ' + d.toString('base64') + '\n'; - var p = utils.mpDenormalize(key.part['p'].data); - out += 'Prime1: ' + p.toString('base64') + '\n'; - var q = utils.mpDenormalize(key.part['q'].data); - out += 'Prime2: ' + q.toString('base64') + '\n'; - var dmodp = utils.mpDenormalize(key.part['dmodp'].data); - out += 'Exponent1: ' + dmodp.toString('base64') + '\n'; - var dmodq = utils.mpDenormalize(key.part['dmodq'].data); - out += 'Exponent2: ' + dmodq.toString('base64') + '\n'; - var iqmp = utils.mpDenormalize(key.part['iqmp'].data); - out += 'Coefficient: ' + iqmp.toString('base64') + '\n'; - // Assume that we're valid as-of now - var timestamp = new Date(); - out += 'Created: ' + dnssecTimestamp(timestamp) + '\n'; - out += 'Publish: ' + dnssecTimestamp(timestamp) + '\n'; - out += 'Activate: ' + dnssecTimestamp(timestamp) + '\n'; - return (Buffer.from(out, 'ascii')); + der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); + der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); + der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); } -function writeECDSA(key, options) { - var out = ''; - out += 'Private-key-format: v1.3\n'; +function writePkcs1DSAPrivate(der, key) { + var ver = Buffer.from([0]); + der.writeBuffer(ver, asn1.Ber.Integer); - if (key.curve === 'nistp256') { - out += 'Algorithm: 13 (ECDSAP256SHA256)\n'; - } else if (key.curve === 'nistp384') { - out += 'Algorithm: 14 (ECDSAP384SHA384)\n'; - } else { - throw (new Error('Unsupported curve')); - } - var base64Key = key.part['d'].data.toString('base64'); - out += 'PrivateKey: ' + base64Key + '\n'; - - // Assume that we're valid as-of now - var timestamp = new Date(); - out += 'Created: ' + dnssecTimestamp(timestamp) + '\n'; - out += 'Publish: ' + dnssecTimestamp(timestamp) + '\n'; - out += 'Activate: ' + dnssecTimestamp(timestamp) + '\n'; - - return (Buffer.from(out, 'ascii')); + der.writeBuffer(key.part.p.data, asn1.Ber.Integer); + der.writeBuffer(key.part.q.data, asn1.Ber.Integer); + der.writeBuffer(key.part.g.data, asn1.Ber.Integer); + der.writeBuffer(key.part.y.data, asn1.Ber.Integer); + der.writeBuffer(key.part.x.data, asn1.Ber.Integer); } -function write(key, options) { - if (PrivateKey.isPrivateKey(key)) { - if (key.type === 'rsa') { - return (writeRSA(key, options)); - } else if (key.type === 'ecdsa') { - return (writeECDSA(key, options)); - } else { - throw (new Error('Unsupported algorithm: ' + key.type)); - } - } else if (Key.isKey(key)) { - /* - * RFC3110 requires a keyname, and a keytype, which we - * don't really have a mechanism for specifying such - * additional metadata. - */ - throw (new Error('Format "dnssec" only supports ' + - 'writing private keys')); - } else { - throw (new Error('key is not a Key or PrivateKey')); - } +function writePkcs1DSAPublic(der, key) { + der.writeBuffer(key.part.y.data, asn1.Ber.Integer); + der.writeBuffer(key.part.p.data, asn1.Ber.Integer); + der.writeBuffer(key.part.q.data, asn1.Ber.Integer); + der.writeBuffer(key.part.g.data, asn1.Ber.Integer); +} + +function writePkcs1ECDSAPublic(der, key) { + der.startSequence(); + + der.writeOID('1.2.840.10045.2.1'); /* ecPublicKey */ + var curve = key.part.curve.data.toString(); + var curveOid = algs.curves[curve].pkcs8oid; + assert.string(curveOid, 'a known ECDSA named curve'); + der.writeOID(curveOid); + + der.endSequence(); + + var Q = utils.ecNormalize(key.part.Q.data, true); + der.writeBuffer(Q, asn1.Ber.BitString); +} + +function writePkcs1ECDSAPrivate(der, key) { + var ver = Buffer.from([1]); + der.writeBuffer(ver, asn1.Ber.Integer); + + der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); + + der.startSequence(0xa0); + var curve = key.part.curve.data.toString(); + var curveOid = algs.curves[curve].pkcs8oid; + assert.string(curveOid, 'a known ECDSA named curve'); + der.writeOID(curveOid); + der.endSequence(); + + der.startSequence(0xa1); + var Q = utils.ecNormalize(key.part.Q.data, true); + der.writeBuffer(Q, asn1.Ber.BitString); + der.endSequence(); +} + +function writePkcs1EdDSAPrivate(der, key) { + var ver = Buffer.from([1]); + der.writeBuffer(ver, asn1.Ber.Integer); + + der.writeBuffer(key.part.k.data, asn1.Ber.OctetString); + + der.startSequence(0xa0); + der.writeOID('1.3.101.112'); + der.endSequence(); + + der.startSequence(0xa1); + utils.writeBitString(der, key.part.A.data); + der.endSequence(); +} + +function writePkcs1EdDSAPublic(der, key) { + throw (new Error('Public keys are not supported for EdDSA PKCS#1')); } /***/ }), -/***/ 561: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -var jsonSafeStringify = __webpack_require__(88) -var crypto = __webpack_require__(417) -var Buffer = __webpack_require__(674).Buffer - -var defer = typeof setImmediate === 'undefined' - ? process.nextTick - : setImmediate - -function paramsHaveRequestBody (params) { - return ( - params.body || - params.requestBodyStream || - (params.json && typeof params.json !== 'boolean') || - params.multipart - ) -} - -function safeStringify (obj, replacer) { - var ret - try { - ret = JSON.stringify(obj, replacer) - } catch (e) { - ret = jsonSafeStringify(obj, replacer) - } - return ret -} - -function md5 (str) { - return crypto.createHash('md5').update(str).digest('hex') -} - -function isReadStream (rs) { - return rs.readable && rs.path && rs.mode -} - -function toBase64 (str) { - return Buffer.from(str || '', 'utf8').toString('base64') -} - -function copy (obj) { - var o = {} - Object.keys(obj).forEach(function (i) { - o[i] = obj[i] - }) - return o -} - -function version () { - var numbers = process.version.replace('v', '').split('.') - return { - major: parseInt(numbers[0], 10), - minor: parseInt(numbers[1], 10), - patch: parseInt(numbers[2], 10) - } -} - -exports.paramsHaveRequestBody = paramsHaveRequestBody -exports.safeStringify = safeStringify -exports.md5 = md5 -exports.isReadStream = isReadStream -exports.toBase64 = toBase64 -exports.copy = copy -exports.version = version -exports.defer = defer - - -/***/ }), - -/***/ 562: -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_uniqueItems(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - if (($schema || $isData) && it.opts.uniqueItems !== false) { - if ($isData) { - out += ' var ' + ($valid) + '; if (' + ($schemaValue) + ' === false || ' + ($schemaValue) + ' === undefined) ' + ($valid) + ' = true; else if (typeof ' + ($schemaValue) + ' != \'boolean\') ' + ($valid) + ' = false; else { '; - } - out += ' var i = ' + ($data) + '.length , ' + ($valid) + ' = true , j; if (i > 1) { '; - var $itemType = it.schema.items && it.schema.items.type, - $typeIsArray = Array.isArray($itemType); - if (!$itemType || $itemType == 'object' || $itemType == 'array' || ($typeIsArray && ($itemType.indexOf('object') >= 0 || $itemType.indexOf('array') >= 0))) { - out += ' outer: for (;i--;) { for (j = i; j--;) { if (equal(' + ($data) + '[i], ' + ($data) + '[j])) { ' + ($valid) + ' = false; break outer; } } } '; - } else { - out += ' var itemIndices = {}, item; for (;i--;) { var item = ' + ($data) + '[i]; '; - var $method = 'checkDataType' + ($typeIsArray ? 's' : ''); - out += ' if (' + (it.util[$method]($itemType, 'item', true)) + ') continue; '; - if ($typeIsArray) { - out += ' if (typeof item == \'string\') item = \'"\' + item; '; - } - out += ' if (typeof itemIndices[item] == \'number\') { ' + ($valid) + ' = false; j = itemIndices[item]; break; } itemIndices[item] = i; } '; - } - out += ' } '; - if ($isData) { - out += ' } '; - } - out += ' if (!' + ($valid) + ') { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('uniqueItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { i: i, j: j } '; - if (it.opts.messages !== false) { - out += ' , message: \'should NOT have duplicate items (items ## \' + j + \' and \' + i + \' are identical)\' '; - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + ($schema); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } '; - if ($breakOnError) { - out += ' else { '; - } - } else { - if ($breakOnError) { - out += ' if (true) { '; - } - } - return out; -} - - -/***/ }), - -/***/ 563: -/***/ (function(module, __unusedexports, __webpack_require__) { - -var rng = __webpack_require__(683); -var bytesToUuid = __webpack_require__(151); - -function v4(options, buf, offset) { - var i = buf && offset || 0; - - if (typeof(options) == 'string') { - buf = options === 'binary' ? new Array(16) : null; - options = null; - } - options = options || {}; - - var rnds = options.random || (options.rng || rng)(); - - // Per 4.4, set bits for version and `clock_seq_hi_and_reserved` - rnds[6] = (rnds[6] & 0x0f) | 0x40; - rnds[8] = (rnds[8] & 0x3f) | 0x80; - - // Copy bytes to buffer, if provided - if (buf) { - for (var ii = 0; ii < 16; ++ii) { - buf[i + ii] = rnds[ii]; - } - } - - return buf || bytesToUuid(rnds); -} - -module.exports = v4; - - -/***/ }), - -/***/ 566: -/***/ (function(module) { - -// populates missing values -module.exports = function(dst, src) { - - Object.keys(src).forEach(function(prop) - { - dst[prop] = dst[prop] || src[prop]; - }); - - return dst; -}; - - -/***/ }), - -/***/ 570: +/***/ 455: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; @@ -18013,29 +13319,29 @@ var url = __webpack_require__(835) var util = __webpack_require__(669) var stream = __webpack_require__(413) var zlib = __webpack_require__(761) -var aws2 = __webpack_require__(934) -var aws4 = __webpack_require__(28) -var httpSignature = __webpack_require__(706) -var mime = __webpack_require__(104) -var caseless = __webpack_require__(812) -var ForeverAgent = __webpack_require__(402) -var FormData = __webpack_require__(639) -var extend = __webpack_require__(922) -var isstream = __webpack_require__(854) -var isTypedArray = __webpack_require__(15).strict -var helpers = __webpack_require__(561) -var cookies = __webpack_require__(367) -var getProxyFromURI = __webpack_require__(146) -var Querystring = __webpack_require__(14).Querystring -var Har = __webpack_require__(147).Har -var Auth = __webpack_require__(13).Auth -var OAuth = __webpack_require__(289).OAuth -var hawk = __webpack_require__(607) -var Multipart = __webpack_require__(189).Multipart -var Redirect = __webpack_require__(587).Redirect -var Tunnel = __webpack_require__(723).Tunnel -var now = __webpack_require__(117) -var Buffer = __webpack_require__(674).Buffer +var aws2 = __webpack_require__(942) +var aws4 = __webpack_require__(658) +var httpSignature = __webpack_require__(789) +var mime = __webpack_require__(779) +var caseless = __webpack_require__(254) +var ForeverAgent = __webpack_require__(792) +var FormData = __webpack_require__(928) +var extend = __webpack_require__(374) +var isstream = __webpack_require__(382) +var isTypedArray = __webpack_require__(944).strict +var helpers = __webpack_require__(810) +var cookies = __webpack_require__(602) +var getProxyFromURI = __webpack_require__(721) +var Querystring = __webpack_require__(629).Querystring +var Har = __webpack_require__(416).Har +var Auth = __webpack_require__(554).Auth +var OAuth = __webpack_require__(287).OAuth +var hawk = __webpack_require__(964) +var Multipart = __webpack_require__(469).Multipart +var Redirect = __webpack_require__(552).Redirect +var Tunnel = __webpack_require__(461).Tunnel +var now = __webpack_require__(742) +var Buffer = __webpack_require__(149).Buffer var safeStringify = helpers.safeStringify var isReadStream = helpers.isReadStream @@ -18835,8 +14141,7 @@ Request.prototype.start = function () { if (isConnecting) { var onReqSockConnect = function () { socket.removeListener('connect', onReqSockConnect) - clearTimeout(self.timeoutTimer) - self.timeoutTimer = null + self.clearTimeout() setReqTimeout() } @@ -18881,10 +14186,7 @@ Request.prototype.onRequestError = function (error) { self.req.end() return } - if (self.timeout && self.timeoutTimer) { - clearTimeout(self.timeoutTimer) - self.timeoutTimer = null - } + self.clearTimeout() self.emit('error', error) } @@ -18971,10 +14273,7 @@ Request.prototype.onRequestResponse = function (response) { if (self.setHost) { self.removeHeader('host') } - if (self.timeout && self.timeoutTimer) { - clearTimeout(self.timeoutTimer) - self.timeoutTimer = null - } + self.clearTimeout() var targetCookieJar = (self._jar && self._jar.setCookie) ? self._jar : globalCookieJar var addCookie = function (cookie) { @@ -19179,6 +14478,7 @@ Request.prototype.abort = function () { self.response.destroy() } + self.clearTimeout() self.emit('abort') } @@ -19455,7 +14755,7 @@ Request.prototype.jar = function (jar) { cookies = false self._disableCookies = true } else { - var targetCookieJar = (jar && jar.getCookieString) ? jar : globalCookieJar + var targetCookieJar = jar.getCookieString ? jar : globalCookieJar var urihref = self.uri.href // fetch cookie in the Specified host if (targetCookieJar) { @@ -19539,6 +14839,7 @@ Request.prototype.resume = function () { } Request.prototype.destroy = function () { var self = this + this.clearTimeout() if (!self._ended) { self.end() } else if (self.response) { @@ -19546,6 +14847,13 @@ Request.prototype.destroy = function () { } } +Request.prototype.clearTimeout = function () { + if (this.timeoutTimer) { + clearTimeout(this.timeoutTimer) + this.timeoutTimer = null + } +} + Request.defaultProxyHeaderWhiteList = Tunnel.defaultProxyHeaderWhiteList.slice() @@ -19560,366 +14868,2270 @@ module.exports = Request /***/ }), -/***/ 571: +/***/ 459: +/***/ (function(module) { + +// generated by genversion +module.exports = '2.5.0' + + +/***/ }), + +/***/ 461: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +"use strict"; + + +var url = __webpack_require__(835) +var tunnel = __webpack_require__(243) + +var defaultProxyHeaderWhiteList = [ + 'accept', + 'accept-charset', + 'accept-encoding', + 'accept-language', + 'accept-ranges', + 'cache-control', + 'content-encoding', + 'content-language', + 'content-location', + 'content-md5', + 'content-range', + 'content-type', + 'connection', + 'date', + 'expect', + 'max-forwards', + 'pragma', + 'referer', + 'te', + 'user-agent', + 'via' +] + +var defaultProxyHeaderExclusiveList = [ + 'proxy-authorization' +] + +function constructProxyHost (uriObject) { + var port = uriObject.port + var protocol = uriObject.protocol + var proxyHost = uriObject.hostname + ':' + + if (port) { + proxyHost += port + } else if (protocol === 'https:') { + proxyHost += '443' + } else { + proxyHost += '80' + } + + return proxyHost +} + +function constructProxyHeaderWhiteList (headers, proxyHeaderWhiteList) { + var whiteList = proxyHeaderWhiteList + .reduce(function (set, header) { + set[header.toLowerCase()] = true + return set + }, {}) + + return Object.keys(headers) + .filter(function (header) { + return whiteList[header.toLowerCase()] + }) + .reduce(function (set, header) { + set[header] = headers[header] + return set + }, {}) +} + +function constructTunnelOptions (request, proxyHeaders) { + var proxy = request.proxy + + var tunnelOptions = { + proxy: { + host: proxy.hostname, + port: +proxy.port, + proxyAuth: proxy.auth, + headers: proxyHeaders + }, + headers: request.headers, + ca: request.ca, + cert: request.cert, + key: request.key, + passphrase: request.passphrase, + pfx: request.pfx, + ciphers: request.ciphers, + rejectUnauthorized: request.rejectUnauthorized, + secureOptions: request.secureOptions, + secureProtocol: request.secureProtocol + } + + return tunnelOptions +} + +function constructTunnelFnName (uri, proxy) { + var uriProtocol = (uri.protocol === 'https:' ? 'https' : 'http') + var proxyProtocol = (proxy.protocol === 'https:' ? 'Https' : 'Http') + return [uriProtocol, proxyProtocol].join('Over') +} + +function getTunnelFn (request) { + var uri = request.uri + var proxy = request.proxy + var tunnelFnName = constructTunnelFnName(uri, proxy) + return tunnel[tunnelFnName] +} + +function Tunnel (request) { + this.request = request + this.proxyHeaderWhiteList = defaultProxyHeaderWhiteList + this.proxyHeaderExclusiveList = [] + if (typeof request.tunnel !== 'undefined') { + this.tunnelOverride = request.tunnel + } +} + +Tunnel.prototype.isEnabled = function () { + var self = this + var request = self.request + // Tunnel HTTPS by default. Allow the user to override this setting. + + // If self.tunnelOverride is set (the user specified a value), use it. + if (typeof self.tunnelOverride !== 'undefined') { + return self.tunnelOverride + } + + // If the destination is HTTPS, tunnel. + if (request.uri.protocol === 'https:') { + return true + } + + // Otherwise, do not use tunnel. + return false +} + +Tunnel.prototype.setup = function (options) { + var self = this + var request = self.request + + options = options || {} + + if (typeof request.proxy === 'string') { + request.proxy = url.parse(request.proxy) + } + + if (!request.proxy || !request.tunnel) { + return false + } + + // Setup Proxy Header Exclusive List and White List + if (options.proxyHeaderWhiteList) { + self.proxyHeaderWhiteList = options.proxyHeaderWhiteList + } + if (options.proxyHeaderExclusiveList) { + self.proxyHeaderExclusiveList = options.proxyHeaderExclusiveList + } + + var proxyHeaderExclusiveList = self.proxyHeaderExclusiveList.concat(defaultProxyHeaderExclusiveList) + var proxyHeaderWhiteList = self.proxyHeaderWhiteList.concat(proxyHeaderExclusiveList) + + // Setup Proxy Headers and Proxy Headers Host + // Only send the Proxy White Listed Header names + var proxyHeaders = constructProxyHeaderWhiteList(request.headers, proxyHeaderWhiteList) + proxyHeaders.host = constructProxyHost(request.uri) + + proxyHeaderExclusiveList.forEach(request.removeHeader, request) + + // Set Agent from Tunnel Data + var tunnelFn = getTunnelFn(request) + var tunnelOptions = constructTunnelOptions(request, proxyHeaders) + request.agent = tunnelFn(tunnelOptions) + + return true +} + +Tunnel.defaultProxyHeaderWhiteList = defaultProxyHeaderWhiteList +Tunnel.defaultProxyHeaderExclusiveList = defaultProxyHeaderExclusiveList +exports.Tunnel = Tunnel + + +/***/ }), + +/***/ 469: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +"use strict"; + + +var uuid = __webpack_require__(826) +var CombinedStream = __webpack_require__(547) +var isstream = __webpack_require__(382) +var Buffer = __webpack_require__(149).Buffer + +function Multipart (request) { + this.request = request + this.boundary = uuid() + this.chunked = false + this.body = null +} + +Multipart.prototype.isChunked = function (options) { + var self = this + var chunked = false + var parts = options.data || options + + if (!parts.forEach) { + self.request.emit('error', new Error('Argument error, options.multipart.')) + } + + if (options.chunked !== undefined) { + chunked = options.chunked + } + + if (self.request.getHeader('transfer-encoding') === 'chunked') { + chunked = true + } + + if (!chunked) { + parts.forEach(function (part) { + if (typeof part.body === 'undefined') { + self.request.emit('error', new Error('Body attribute missing in multipart.')) + } + if (isstream(part.body)) { + chunked = true + } + }) + } + + return chunked +} + +Multipart.prototype.setHeaders = function (chunked) { + var self = this + + if (chunked && !self.request.hasHeader('transfer-encoding')) { + self.request.setHeader('transfer-encoding', 'chunked') + } + + var header = self.request.getHeader('content-type') + + if (!header || header.indexOf('multipart') === -1) { + self.request.setHeader('content-type', 'multipart/related; boundary=' + self.boundary) + } else { + if (header.indexOf('boundary') !== -1) { + self.boundary = header.replace(/.*boundary=([^\s;]+).*/, '$1') + } else { + self.request.setHeader('content-type', header + '; boundary=' + self.boundary) + } + } +} + +Multipart.prototype.build = function (parts, chunked) { + var self = this + var body = chunked ? new CombinedStream() : [] + + function add (part) { + if (typeof part === 'number') { + part = part.toString() + } + return chunked ? body.append(part) : body.push(Buffer.from(part)) + } + + if (self.request.preambleCRLF) { + add('\r\n') + } + + parts.forEach(function (part) { + var preamble = '--' + self.boundary + '\r\n' + Object.keys(part).forEach(function (key) { + if (key === 'body') { return } + preamble += key + ': ' + part[key] + '\r\n' + }) + preamble += '\r\n' + add(preamble) + add(part.body) + add('\r\n') + }) + add('--' + self.boundary + '--') + + if (self.request.postambleCRLF) { + add('\r\n') + } + + return body +} + +Multipart.prototype.onRequest = function (options) { + var self = this + + var chunked = self.isChunked(options) + var parts = options.data || options + + self.setHeaders(chunked) + self.chunked = chunked + self.body = self.build(parts, chunked) +} + +exports.Multipart = Multipart + + +/***/ }), + +/***/ 470: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +"use strict"; + +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; + result["default"] = mod; + return result; +}; +Object.defineProperty(exports, "__esModule", { value: true }); +const command_1 = __webpack_require__(431); +const os = __importStar(__webpack_require__(87)); +const path = __importStar(__webpack_require__(622)); +/** + * The code to exit an action + */ +var ExitCode; +(function (ExitCode) { + /** + * A code indicating that the action was successful + */ + ExitCode[ExitCode["Success"] = 0] = "Success"; + /** + * A code indicating that the action was a failure + */ + ExitCode[ExitCode["Failure"] = 1] = "Failure"; +})(ExitCode = exports.ExitCode || (exports.ExitCode = {})); +//----------------------------------------------------------------------- +// Variables +//----------------------------------------------------------------------- +/** + * Sets env variable for this action and future actions in the job + * @param name the name of the variable to set + * @param val the value of the variable + */ +function exportVariable(name, val) { + process.env[name] = val; + command_1.issueCommand('set-env', { name }, val); +} +exports.exportVariable = exportVariable; +/** + * Registers a secret which will get masked from logs + * @param secret value of the secret + */ +function setSecret(secret) { + command_1.issueCommand('add-mask', {}, secret); +} +exports.setSecret = setSecret; +/** + * Prepends inputPath to the PATH (for this action and future actions) + * @param inputPath + */ +function addPath(inputPath) { + command_1.issueCommand('add-path', {}, inputPath); + process.env['PATH'] = `${inputPath}${path.delimiter}${process.env['PATH']}`; +} +exports.addPath = addPath; +/** + * Gets the value of an input. The value is also trimmed. + * + * @param name name of the input to get + * @param options optional. See InputOptions. + * @returns string + */ +function getInput(name, options) { + const val = process.env[`INPUT_${name.replace(/ /g, '_').toUpperCase()}`] || ''; + if (options && options.required && !val) { + throw new Error(`Input required and not supplied: ${name}`); + } + return val.trim(); +} +exports.getInput = getInput; +/** + * Sets the value of an output. + * + * @param name name of the output to set + * @param value value to store + */ +function setOutput(name, value) { + command_1.issueCommand('set-output', { name }, value); +} +exports.setOutput = setOutput; +//----------------------------------------------------------------------- +// Results +//----------------------------------------------------------------------- +/** + * Sets the action status to failed. + * When the action exits it will be with an exit code of 1 + * @param message add error issue message + */ +function setFailed(message) { + process.exitCode = ExitCode.Failure; + error(message); +} +exports.setFailed = setFailed; +//----------------------------------------------------------------------- +// Logging Commands +//----------------------------------------------------------------------- +/** + * Gets whether Actions Step Debug is on or not + */ +function isDebug() { + return process.env['RUNNER_DEBUG'] === '1'; +} +exports.isDebug = isDebug; +/** + * Writes debug message to user log + * @param message debug message + */ +function debug(message) { + command_1.issueCommand('debug', {}, message); +} +exports.debug = debug; +/** + * Adds an error issue + * @param message error issue message + */ +function error(message) { + command_1.issue('error', message); +} +exports.error = error; +/** + * Adds an warning issue + * @param message warning issue message + */ +function warning(message) { + command_1.issue('warning', message); +} +exports.warning = warning; +/** + * Writes info to log with console.log. + * @param message info message + */ +function info(message) { + process.stdout.write(message + os.EOL); +} +exports.info = info; +/** + * Begin an output group. + * + * Output until the next `groupEnd` will be foldable in this group + * + * @param name The name of the output group + */ +function startGroup(name) { + command_1.issue('group', name); +} +exports.startGroup = startGroup; +/** + * End an output group. + */ +function endGroup() { + command_1.issue('endgroup'); +} +exports.endGroup = endGroup; +/** + * Wrap an asynchronous function call in a group. + * + * Returns the same type as the function itself. + * + * @param name The name of the group + * @param fn The function to wrap in the group + */ +function group(name, fn) { + return __awaiter(this, void 0, void 0, function* () { + startGroup(name); + let result; + try { + result = yield fn(); + } + finally { + endGroup(); + } + return result; + }); +} +exports.group = group; +//----------------------------------------------------------------------- +// Wrapper action state +//----------------------------------------------------------------------- +/** + * Saves state for current action, the state can only be retrieved by this action's post job execution. + * + * @param name name of the state to store + * @param value value to store + */ +function saveState(name, value) { + command_1.issueCommand('save-state', { name }, value); +} +exports.saveState = saveState; +/** + * Gets the value of an state set by this action's main execution. + * + * @param name name of the state to get + * @returns string + */ +function getState(name) { + return process.env[`STATE_${name}`] || ''; +} +exports.getState = getState; +//# sourceMappingURL=core.js.map + +/***/ }), + +/***/ 477: /***/ (function(module, __unusedexports, __webpack_require__) { -// Named EC curves +// Copyright (c) 2012, Mark Cavage. All rights reserved. +// Copyright 2015 Joyent, Inc. -// Requires ec.js, jsbn.js, and jsbn2.js -var BigInteger = __webpack_require__(71).BigInteger -var ECCurveFp = __webpack_require__(814).ECCurveFp +var assert = __webpack_require__(357); +var Stream = __webpack_require__(413).Stream; +var util = __webpack_require__(669); -// ---------------- -// X9ECParameters +///--- Globals -// constructor -function X9ECParameters(curve,g,n,h) { - this.curve = curve; - this.g = g; - this.n = n; - this.h = h; +/* JSSTYLED */ +var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; + + +///--- Internal + +function _capitalize(str) { + return (str.charAt(0).toUpperCase() + str.slice(1)); } -function x9getCurve() { - return this.curve; +function _toss(name, expected, oper, arg, actual) { + throw new assert.AssertionError({ + message: util.format('%s (%s) is required', name, expected), + actual: (actual === undefined) ? typeof (arg) : actual(arg), + expected: expected, + operator: oper || '===', + stackStartFunction: _toss.caller + }); } -function x9getG() { - return this.g; +function _getClass(arg) { + return (Object.prototype.toString.call(arg).slice(8, -1)); } -function x9getN() { - return this.n; +function noop() { + // Why even bother with asserts? } -function x9getH() { - return this.h; + +///--- Exports + +var types = { + bool: { + check: function (arg) { return typeof (arg) === 'boolean'; } + }, + func: { + check: function (arg) { return typeof (arg) === 'function'; } + }, + string: { + check: function (arg) { return typeof (arg) === 'string'; } + }, + object: { + check: function (arg) { + return typeof (arg) === 'object' && arg !== null; + } + }, + number: { + check: function (arg) { + return typeof (arg) === 'number' && !isNaN(arg); + } + }, + finite: { + check: function (arg) { + return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); + } + }, + buffer: { + check: function (arg) { return Buffer.isBuffer(arg); }, + operator: 'Buffer.isBuffer' + }, + array: { + check: function (arg) { return Array.isArray(arg); }, + operator: 'Array.isArray' + }, + stream: { + check: function (arg) { return arg instanceof Stream; }, + operator: 'instanceof', + actual: _getClass + }, + date: { + check: function (arg) { return arg instanceof Date; }, + operator: 'instanceof', + actual: _getClass + }, + regexp: { + check: function (arg) { return arg instanceof RegExp; }, + operator: 'instanceof', + actual: _getClass + }, + uuid: { + check: function (arg) { + return typeof (arg) === 'string' && UUID_REGEXP.test(arg); + }, + operator: 'isUUID' + } +}; + +function _setExports(ndebug) { + var keys = Object.keys(types); + var out; + + /* re-export standard assert */ + if (process.env.NODE_NDEBUG) { + out = noop; + } else { + out = function (arg, msg) { + if (!arg) { + _toss(msg, 'true', arg); + } + }; + } + + /* standard checks */ + keys.forEach(function (k) { + if (ndebug) { + out[k] = noop; + return; + } + var type = types[k]; + out[k] = function (arg, msg) { + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); + + /* optional checks */ + keys.forEach(function (k) { + var name = 'optional' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + out[name] = function (arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!type.check(arg)) { + _toss(msg, k, type.operator, arg, type.actual); + } + }; + }); + + /* arrayOf checks */ + keys.forEach(function (k) { + var name = 'arrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function (arg, msg) { + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); + + /* optionalArrayOf checks */ + keys.forEach(function (k) { + var name = 'optionalArrayOf' + _capitalize(k); + if (ndebug) { + out[name] = noop; + return; + } + var type = types[k]; + var expected = '[' + k + ']'; + out[name] = function (arg, msg) { + if (arg === undefined || arg === null) { + return; + } + if (!Array.isArray(arg)) { + _toss(msg, expected, type.operator, arg, type.actual); + } + var i; + for (i = 0; i < arg.length; i++) { + if (!type.check(arg[i])) { + _toss(msg, expected, type.operator, arg, type.actual); + } + } + }; + }); + + /* re-export built-in assertions */ + Object.keys(assert).forEach(function (k) { + if (k === 'AssertionError') { + out[k] = assert[k]; + return; + } + if (ndebug) { + out[k] = noop; + return; + } + out[k] = assert[k]; + }); + + /* export ourselves (for unit tests _only_) */ + out._setExports = _setExports; + + return out; } -X9ECParameters.prototype.getCurve = x9getCurve; -X9ECParameters.prototype.getG = x9getG; -X9ECParameters.prototype.getN = x9getN; -X9ECParameters.prototype.getH = x9getH; +module.exports = _setExports(process.env.NODE_NDEBUG); -// ---------------- -// SECNamedCurves -function fromHex(s) { return new BigInteger(s, 16); } +/***/ }), -function secp128r1() { - // p = 2^128 - 2^97 - 1 - var p = fromHex("FFFFFFFDFFFFFFFFFFFFFFFFFFFFFFFF"); - var a = fromHex("FFFFFFFDFFFFFFFFFFFFFFFFFFFFFFFC"); - var b = fromHex("E87579C11079F43DD824993C2CEE5ED3"); - //byte[] S = Hex.decode("000E0D4D696E6768756151750CC03A4473D03679"); - var n = fromHex("FFFFFFFE0000000075A30D1B9038A115"); - var h = BigInteger.ONE; - var curve = new ECCurveFp(p, a, b); - var G = curve.decodePointHex("04" - + "161FF7528B899B2D0C28607CA52C5B86" - + "CF5AC8395BAFEB13C02DA292DDED7A83"); - return new X9ECParameters(curve, G, n, h); -} +/***/ 479: +/***/ (function(module) { -function secp160k1() { - // p = 2^160 - 2^32 - 2^14 - 2^12 - 2^9 - 2^8 - 2^7 - 2^3 - 2^2 - 1 - var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFAC73"); - var a = BigInteger.ZERO; - var b = fromHex("7"); - //byte[] S = null; - var n = fromHex("0100000000000000000001B8FA16DFAB9ACA16B6B3"); - var h = BigInteger.ONE; - var curve = new ECCurveFp(p, a, b); - var G = curve.decodePointHex("04" - + "3B4C382CE37AA192A4019E763036F4F5DD4D7EBB" - + "938CF935318FDCED6BC28286531733C3F03C4FEE"); - return new X9ECParameters(curve, G, n, h); -} +"use strict"; -function secp160r1() { - // p = 2^160 - 2^31 - 1 - var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFF"); - var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFC"); - var b = fromHex("1C97BEFC54BD7A8B65ACF89F81D4D4ADC565FA45"); - //byte[] S = Hex.decode("1053CDE42C14D696E67687561517533BF3F83345"); - var n = fromHex("0100000000000000000001F4C8F927AED3CA752257"); - var h = BigInteger.ONE; - var curve = new ECCurveFp(p, a, b); - var G = curve.decodePointHex("04" - + "4A96B5688EF573284664698968C38BB913CBFC82" - + "23A628553168947D59DCC912042351377AC5FB32"); - return new X9ECParameters(curve, G, n, h); -} - -function secp192k1() { - // p = 2^192 - 2^32 - 2^12 - 2^8 - 2^7 - 2^6 - 2^3 - 1 - var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFEE37"); - var a = BigInteger.ZERO; - var b = fromHex("3"); - //byte[] S = null; - var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFE26F2FC170F69466A74DEFD8D"); - var h = BigInteger.ONE; - var curve = new ECCurveFp(p, a, b); - var G = curve.decodePointHex("04" - + "DB4FF10EC057E9AE26B07D0280B7F4341DA5D1B1EAE06C7D" - + "9B2F2F6D9C5628A7844163D015BE86344082AA88D95E2F9D"); - return new X9ECParameters(curve, G, n, h); -} - -function secp192r1() { - // p = 2^192 - 2^64 - 1 - var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFF"); - var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFC"); - var b = fromHex("64210519E59C80E70FA7E9AB72243049FEB8DEECC146B9B1"); - //byte[] S = Hex.decode("3045AE6FC8422F64ED579528D38120EAE12196D5"); - var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFF99DEF836146BC9B1B4D22831"); - var h = BigInteger.ONE; - var curve = new ECCurveFp(p, a, b); - var G = curve.decodePointHex("04" - + "188DA80EB03090F67CBF20EB43A18800F4FF0AFD82FF1012" - + "07192B95FFC8DA78631011ED6B24CDD573F977A11E794811"); - return new X9ECParameters(curve, G, n, h); -} - -function secp224r1() { - // p = 2^224 - 2^96 + 1 - var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF000000000000000000000001"); - var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFE"); - var b = fromHex("B4050A850C04B3ABF54132565044B0B7D7BFD8BA270B39432355FFB4"); - //byte[] S = Hex.decode("BD71344799D5C7FCDC45B59FA3B9AB8F6A948BC5"); - var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFF16A2E0B8F03E13DD29455C5C2A3D"); - var h = BigInteger.ONE; - var curve = new ECCurveFp(p, a, b); - var G = curve.decodePointHex("04" - + "B70E0CBD6BB4BF7F321390B94A03C1D356C21122343280D6115C1D21" - + "BD376388B5F723FB4C22DFE6CD4375A05A07476444D5819985007E34"); - return new X9ECParameters(curve, G, n, h); -} - -function secp256r1() { - // p = 2^224 (2^32 - 1) + 2^192 + 2^96 - 1 - var p = fromHex("FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFF"); - var a = fromHex("FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFC"); - var b = fromHex("5AC635D8AA3A93E7B3EBBD55769886BC651D06B0CC53B0F63BCE3C3E27D2604B"); - //byte[] S = Hex.decode("C49D360886E704936A6678E1139D26B7819F7E90"); - var n = fromHex("FFFFFFFF00000000FFFFFFFFFFFFFFFFBCE6FAADA7179E84F3B9CAC2FC632551"); - var h = BigInteger.ONE; - var curve = new ECCurveFp(p, a, b); - var G = curve.decodePointHex("04" - + "6B17D1F2E12C4247F8BCE6E563A440F277037D812DEB33A0F4A13945D898C296" - + "4FE342E2FE1A7F9B8EE7EB4A7C0F9E162BCE33576B315ECECBB6406837BF51F5"); - return new X9ECParameters(curve, G, n, h); -} - -// TODO: make this into a proper hashtable -function getSECCurveByName(name) { - if(name == "secp128r1") return secp128r1(); - if(name == "secp160k1") return secp160k1(); - if(name == "secp160r1") return secp160r1(); - if(name == "secp192k1") return secp192k1(); - if(name == "secp192r1") return secp192r1(); - if(name == "secp224r1") return secp224r1(); - if(name == "secp256r1") return secp256r1(); - return null; -} - -module.exports = { - "secp128r1":secp128r1, - "secp160k1":secp160k1, - "secp160r1":secp160r1, - "secp192k1":secp192k1, - "secp192r1":secp192r1, - "secp224r1":secp224r1, - "secp256r1":secp256r1 +module.exports = function generate_if(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + $it.level++; + var $nextValid = 'valid' + $it.level; + var $thenSch = it.schema['then'], + $elseSch = it.schema['else'], + $thenPresent = $thenSch !== undefined && (it.opts.strictKeywords ? typeof $thenSch == 'object' && Object.keys($thenSch).length > 0 : it.util.schemaHasRules($thenSch, it.RULES.all)), + $elsePresent = $elseSch !== undefined && (it.opts.strictKeywords ? typeof $elseSch == 'object' && Object.keys($elseSch).length > 0 : it.util.schemaHasRules($elseSch, it.RULES.all)), + $currentBaseId = $it.baseId; + if ($thenPresent || $elsePresent) { + var $ifClause; + $it.createErrors = false; + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = true; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + $it.createErrors = true; + out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; + it.compositeRule = $it.compositeRule = $wasComposite; + if ($thenPresent) { + out += ' if (' + ($nextValid) + ') { '; + $it.schema = it.schema['then']; + $it.schemaPath = it.schemaPath + '.then'; + $it.errSchemaPath = it.errSchemaPath + '/then'; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + out += ' ' + ($valid) + ' = ' + ($nextValid) + '; '; + if ($thenPresent && $elsePresent) { + $ifClause = 'ifClause' + $lvl; + out += ' var ' + ($ifClause) + ' = \'then\'; '; + } else { + $ifClause = '\'then\''; + } + out += ' } '; + if ($elsePresent) { + out += ' else { '; + } + } else { + out += ' if (!' + ($nextValid) + ') { '; + } + if ($elsePresent) { + $it.schema = it.schema['else']; + $it.schemaPath = it.schemaPath + '.else'; + $it.errSchemaPath = it.errSchemaPath + '/else'; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + out += ' ' + ($valid) + ' = ' + ($nextValid) + '; '; + if ($thenPresent && $elsePresent) { + $ifClause = 'ifClause' + $lvl; + out += ' var ' + ($ifClause) + ' = \'else\'; '; + } else { + $ifClause = '\'else\''; + } + out += ' } '; + } + out += ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('if') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { failingKeyword: ' + ($ifClause) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should match "\' + ' + ($ifClause) + ' + \'" schema\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError(vErrors); '; + } else { + out += ' validate.errors = vErrors; return false; '; + } + } + out += ' } '; + if ($breakOnError) { + out += ' else { '; + } + out = it.util.cleanUpCode(out); + } else { + if ($breakOnError) { + out += ' if (true) { '; + } + } + return out; } /***/ }), -/***/ 583: +/***/ 496: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; -var utils = __webpack_require__(601); +var ruleModules = __webpack_require__(894) + , toHash = __webpack_require__(855).toHash; -var has = Object.prototype.hasOwnProperty; +module.exports = function rules() { + var RULES = [ + { type: 'number', + rules: [ { 'maximum': ['exclusiveMaximum'] }, + { 'minimum': ['exclusiveMinimum'] }, 'multipleOf', 'format'] }, + { type: 'string', + rules: [ 'maxLength', 'minLength', 'pattern', 'format' ] }, + { type: 'array', + rules: [ 'maxItems', 'minItems', 'items', 'contains', 'uniqueItems' ] }, + { type: 'object', + rules: [ 'maxProperties', 'minProperties', 'required', 'dependencies', 'propertyNames', + { 'properties': ['additionalProperties', 'patternProperties'] } ] }, + { rules: [ '$ref', 'const', 'enum', 'not', 'anyOf', 'oneOf', 'allOf', 'if' ] } + ]; -var defaults = { - allowDots: false, - allowPrototypes: false, - arrayLimit: 20, - decoder: utils.decode, - delimiter: '&', - depth: 5, - parameterLimit: 1000, - plainObjects: false, - strictNullHandling: false -}; + var ALL = [ 'type', '$comment' ]; + var KEYWORDS = [ + '$schema', '$id', 'id', '$data', '$async', 'title', + 'description', 'default', 'definitions', + 'examples', 'readOnly', 'writeOnly', + 'contentMediaType', 'contentEncoding', + 'additionalItems', 'then', 'else' + ]; + var TYPES = [ 'number', 'integer', 'string', 'array', 'object', 'boolean', 'null' ]; + RULES.all = toHash(ALL); + RULES.types = toHash(TYPES); -var parseValues = function parseQueryStringValues(str, options) { - var obj = {}; - var cleanStr = options.ignoreQueryPrefix ? str.replace(/^\?/, '') : str; - var limit = options.parameterLimit === Infinity ? undefined : options.parameterLimit; - var parts = cleanStr.split(options.delimiter, limit); + RULES.forEach(function (group) { + group.rules = group.rules.map(function (keyword) { + var implKeywords; + if (typeof keyword == 'object') { + var key = Object.keys(keyword)[0]; + implKeywords = keyword[key]; + keyword = key; + implKeywords.forEach(function (k) { + ALL.push(k); + RULES.all[k] = true; + }); + } + ALL.push(keyword); + var rule = RULES.all[keyword] = { + keyword: keyword, + code: ruleModules[keyword], + implements: implKeywords + }; + return rule; + }); - for (var i = 0; i < parts.length; ++i) { - var part = parts[i]; + RULES.all.$comment = { + keyword: '$comment', + code: ruleModules.$comment + }; - var bracketEqualsPos = part.indexOf(']='); - var pos = bracketEqualsPos === -1 ? part.indexOf('=') : bracketEqualsPos + 1; + if (group.type) RULES.types[group.type] = group; + }); - var key, val; - if (pos === -1) { - key = options.decoder(part, defaults.decoder); - val = options.strictNullHandling ? null : ''; - } else { - key = options.decoder(part.slice(0, pos), defaults.decoder); - val = options.decoder(part.slice(pos + 1), defaults.decoder); - } - if (has.call(obj, key)) { - obj[key] = [].concat(obj[key]).concat(val); - } else { - obj[key] = val; - } - } + RULES.keywords = toHash(ALL.concat(KEYWORDS)); + RULES.custom = {}; - return obj; -}; - -var parseObject = function (chain, val, options) { - var leaf = val; - - for (var i = chain.length - 1; i >= 0; --i) { - var obj; - var root = chain[i]; - - if (root === '[]') { - obj = []; - obj = obj.concat(leaf); - } else { - obj = options.plainObjects ? Object.create(null) : {}; - var cleanRoot = root.charAt(0) === '[' && root.charAt(root.length - 1) === ']' ? root.slice(1, -1) : root; - var index = parseInt(cleanRoot, 10); - if ( - !isNaN(index) - && root !== cleanRoot - && String(index) === cleanRoot - && index >= 0 - && (options.parseArrays && index <= options.arrayLimit) - ) { - obj = []; - obj[index] = leaf; - } else { - obj[cleanRoot] = leaf; - } - } - - leaf = obj; - } - - return leaf; -}; - -var parseKeys = function parseQueryStringKeys(givenKey, val, options) { - if (!givenKey) { - return; - } - - // Transform dot notation to bracket notation - var key = options.allowDots ? givenKey.replace(/\.([^.[]+)/g, '[$1]') : givenKey; - - // The regex chunks - - var brackets = /(\[[^[\]]*])/; - var child = /(\[[^[\]]*])/g; - - // Get the parent - - var segment = brackets.exec(key); - var parent = segment ? key.slice(0, segment.index) : key; - - // Stash the parent if it exists - - var keys = []; - if (parent) { - // If we aren't using plain objects, optionally prefix keys - // that would overwrite object prototype properties - if (!options.plainObjects && has.call(Object.prototype, parent)) { - if (!options.allowPrototypes) { - return; - } - } - - keys.push(parent); - } - - // Loop through children appending to the array until we hit depth - - var i = 0; - while ((segment = child.exec(key)) !== null && i < options.depth) { - i += 1; - if (!options.plainObjects && has.call(Object.prototype, segment[1].slice(1, -1))) { - if (!options.allowPrototypes) { - return; - } - } - keys.push(segment[1]); - } - - // If there's a remainder, just add whatever is left - - if (segment) { - keys.push('[' + key.slice(segment.index) + ']'); - } - - return parseObject(keys, val, options); -}; - -module.exports = function (str, opts) { - var options = opts ? utils.assign({}, opts) : {}; - - if (options.decoder !== null && options.decoder !== undefined && typeof options.decoder !== 'function') { - throw new TypeError('Decoder has to be a function.'); - } - - options.ignoreQueryPrefix = options.ignoreQueryPrefix === true; - options.delimiter = typeof options.delimiter === 'string' || utils.isRegExp(options.delimiter) ? options.delimiter : defaults.delimiter; - options.depth = typeof options.depth === 'number' ? options.depth : defaults.depth; - options.arrayLimit = typeof options.arrayLimit === 'number' ? options.arrayLimit : defaults.arrayLimit; - options.parseArrays = options.parseArrays !== false; - options.decoder = typeof options.decoder === 'function' ? options.decoder : defaults.decoder; - options.allowDots = typeof options.allowDots === 'boolean' ? options.allowDots : defaults.allowDots; - options.plainObjects = typeof options.plainObjects === 'boolean' ? options.plainObjects : defaults.plainObjects; - options.allowPrototypes = typeof options.allowPrototypes === 'boolean' ? options.allowPrototypes : defaults.allowPrototypes; - options.parameterLimit = typeof options.parameterLimit === 'number' ? options.parameterLimit : defaults.parameterLimit; - options.strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; - - if (str === '' || str === null || typeof str === 'undefined') { - return options.plainObjects ? Object.create(null) : {}; - } - - var tempObj = typeof str === 'string' ? parseValues(str, options) : str; - var obj = options.plainObjects ? Object.create(null) : {}; - - // Iterate over the keys and setup the new object - - var keys = Object.keys(tempObj); - for (var i = 0; i < keys.length; ++i) { - var key = keys[i]; - var newObj = parseKeys(key, tempObj[key], options); - obj = utils.merge(obj, newObj, options); - } - - return utils.compact(obj); + return RULES; }; /***/ }), -/***/ 587: +/***/ 500: +/***/ (function(module) { + +module.exports = defer; + +/** + * Runs provided function on next iteration of the event loop + * + * @param {function} fn - function to run + */ +function defer(fn) +{ + var nextTick = typeof setImmediate == 'function' + ? setImmediate + : ( + typeof process == 'object' && typeof process.nextTick == 'function' + ? process.nextTick + : null + ); + + if (nextTick) + { + nextTick(fn); + } + else + { + setTimeout(fn, 0); + } +} + + +/***/ }), + +/***/ 502: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2017 Joyent, Inc. + +module.exports = PrivateKey; + +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var crypto = __webpack_require__(417); +var Fingerprint = __webpack_require__(400); +var Signature = __webpack_require__(575); +var errs = __webpack_require__(753); +var util = __webpack_require__(669); +var utils = __webpack_require__(270); +var dhe = __webpack_require__(290); +var generateECDSA = dhe.generateECDSA; +var generateED25519 = dhe.generateED25519; +var edCompat = __webpack_require__(363); +var nacl = __webpack_require__(196); + +var Key = __webpack_require__(852); + +var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var KeyParseError = errs.KeyParseError; +var KeyEncryptedError = errs.KeyEncryptedError; + +var formats = {}; +formats['auto'] = __webpack_require__(241); +formats['pem'] = __webpack_require__(268); +formats['pkcs1'] = __webpack_require__(449); +formats['pkcs8'] = __webpack_require__(707); +formats['rfc4253'] = __webpack_require__(538); +formats['ssh-private'] = __webpack_require__(78); +formats['openssh'] = formats['ssh-private']; +formats['ssh'] = formats['ssh-private']; +formats['dnssec'] = __webpack_require__(982); + +function PrivateKey(opts) { + assert.object(opts, 'options'); + Key.call(this, opts); + + this._pubCache = undefined; +} +util.inherits(PrivateKey, Key); + +PrivateKey.formats = formats; + +PrivateKey.prototype.toBuffer = function (format, options) { + if (format === undefined) + format = 'pkcs1'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); + + return (formats[format].write(this, options)); +}; + +PrivateKey.prototype.hash = function (algo, type) { + return (this.toPublic().hash(algo, type)); +}; + +PrivateKey.prototype.fingerprint = function (algo, type) { + return (this.toPublic().fingerprint(algo, type)); +}; + +PrivateKey.prototype.toPublic = function () { + if (this._pubCache) + return (this._pubCache); + + var algInfo = algs.info[this.type]; + var pubParts = []; + for (var i = 0; i < algInfo.parts.length; ++i) { + var p = algInfo.parts[i]; + pubParts.push(this.part[p]); + } + + this._pubCache = new Key({ + type: this.type, + source: this, + parts: pubParts + }); + if (this.comment) + this._pubCache.comment = this.comment; + return (this._pubCache); +}; + +PrivateKey.prototype.derive = function (newType) { + assert.string(newType, 'type'); + var priv, pub, pair; + + if (this.type === 'ed25519' && newType === 'curve25519') { + priv = this.part.k.data; + if (priv[0] === 0x00) + priv = priv.slice(1); + + pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv)); + pub = Buffer.from(pair.publicKey); + + return (new PrivateKey({ + type: 'curve25519', + parts: [ + { name: 'A', data: utils.mpNormalize(pub) }, + { name: 'k', data: utils.mpNormalize(priv) } + ] + })); + } else if (this.type === 'curve25519' && newType === 'ed25519') { + priv = this.part.k.data; + if (priv[0] === 0x00) + priv = priv.slice(1); + + pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv)); + pub = Buffer.from(pair.publicKey); + + return (new PrivateKey({ + type: 'ed25519', + parts: [ + { name: 'A', data: utils.mpNormalize(pub) }, + { name: 'k', data: utils.mpNormalize(priv) } + ] + })); + } + throw (new Error('Key derivation not supported from ' + this.type + + ' to ' + newType)); +}; + +PrivateKey.prototype.createVerify = function (hashAlgo) { + return (this.toPublic().createVerify(hashAlgo)); +}; + +PrivateKey.prototype.createSign = function (hashAlgo) { + if (hashAlgo === undefined) + hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); + + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return (new edCompat.Signer(this, hashAlgo)); + if (this.type === 'curve25519') + throw (new Error('Curve25519 keys are not suitable for ' + + 'signing or verification')); + + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } catch (e) { + err = e; + } + if (v === undefined || (err instanceof Error && + err.message.match(/Unknown message digest/))) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createSign(nm); + } + assert.ok(v, 'failed to create verifier'); + var oldSign = v.sign.bind(v); + var key = this.toBuffer('pkcs1'); + var type = this.type; + var curve = this.curve; + v.sign = function () { + var sig = oldSign(key); + if (typeof (sig) === 'string') + sig = Buffer.from(sig, 'binary'); + sig = Signature.parse(sig, type, 'asn1'); + sig.hashAlgorithm = hashAlgo; + sig.curve = curve; + return (sig); + }; + return (v); +}; + +PrivateKey.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; + + assert.object(formats[format], 'formats[format]'); + + try { + var k = formats[format].read(data, options); + assert.ok(k instanceof PrivateKey, 'key is not a private key'); + if (!k.comment) + k.comment = options.filename; + return (k); + } catch (e) { + if (e.name === 'KeyEncryptedError') + throw (e); + throw (new KeyParseError(options.filename, format, e)); + } +}; + +PrivateKey.isPrivateKey = function (obj, ver) { + return (utils.isCompatible(obj, PrivateKey, ver)); +}; + +PrivateKey.generate = function (type, options) { + if (options === undefined) + options = {}; + assert.object(options, 'options'); + + switch (type) { + case 'ecdsa': + if (options.curve === undefined) + options.curve = 'nistp256'; + assert.string(options.curve, 'options.curve'); + return (generateECDSA(options.curve)); + case 'ed25519': + return (generateED25519()); + default: + throw (new Error('Key generation not supported with key ' + + 'type "' + type + '"')); + } +}; + +/* + * API versions for PrivateKey: + * [1,0] -- initial ver + * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats + * [1,2] -- added defaultHashAlgorithm + * [1,3] -- added derive, ed, createDH + * [1,4] -- first tagged version + * [1,5] -- changed ed25519 part names and format + * [1,6] -- type arguments for hash() and fingerprint() + */ +PrivateKey.prototype._sshpkApiVersion = [1, 6]; + +PrivateKey._oldVersionDetect = function (obj) { + assert.func(obj.toPublic); + assert.func(obj.createSign); + if (obj.derive) + return ([1, 3]); + if (obj.defaultHashAlgorithm) + return ([1, 2]); + if (obj.formats['auto']) + return ([1, 1]); + return ([1, 0]); +}; + + +/***/ }), + +/***/ 512: +/***/ (function(module) { + +module.exports = {"application/1d-interleaved-parityfec":{"source":"iana"},"application/3gpdash-qoe-report+xml":{"source":"iana","compressible":true},"application/3gpp-ims+xml":{"source":"iana","compressible":true},"application/a2l":{"source":"iana"},"application/activemessage":{"source":"iana"},"application/activity+json":{"source":"iana","compressible":true},"application/alto-costmap+json":{"source":"iana","compressible":true},"application/alto-costmapfilter+json":{"source":"iana","compressible":true},"application/alto-directory+json":{"source":"iana","compressible":true},"application/alto-endpointcost+json":{"source":"iana","compressible":true},"application/alto-endpointcostparams+json":{"source":"iana","compressible":true},"application/alto-endpointprop+json":{"source":"iana","compressible":true},"application/alto-endpointpropparams+json":{"source":"iana","compressible":true},"application/alto-error+json":{"source":"iana","compressible":true},"application/alto-networkmap+json":{"source":"iana","compressible":true},"application/alto-networkmapfilter+json":{"source":"iana","compressible":true},"application/aml":{"source":"iana"},"application/andrew-inset":{"source":"iana","extensions":["ez"]},"application/applefile":{"source":"iana"},"application/applixware":{"source":"apache","extensions":["aw"]},"application/atf":{"source":"iana"},"application/atfx":{"source":"iana"},"application/atom+xml":{"source":"iana","compressible":true,"extensions":["atom"]},"application/atomcat+xml":{"source":"iana","compressible":true,"extensions":["atomcat"]},"application/atomdeleted+xml":{"source":"iana","compressible":true,"extensions":["atomdeleted"]},"application/atomicmail":{"source":"iana"},"application/atomsvc+xml":{"source":"iana","compressible":true,"extensions":["atomsvc"]},"application/atsc-dwd+xml":{"source":"iana","compressible":true,"extensions":["dwd"]},"application/atsc-held+xml":{"source":"iana","compressible":true,"extensions":["held"]},"application/atsc-rdt+json":{"source":"iana","compressible":true},"application/atsc-rsat+xml":{"source":"iana","compressible":true,"extensions":["rsat"]},"application/atxml":{"source":"iana"},"application/auth-policy+xml":{"source":"iana","compressible":true},"application/bacnet-xdd+zip":{"source":"iana","compressible":false},"application/batch-smtp":{"source":"iana"},"application/bdoc":{"compressible":false,"extensions":["bdoc"]},"application/beep+xml":{"source":"iana","compressible":true},"application/calendar+json":{"source":"iana","compressible":true},"application/calendar+xml":{"source":"iana","compressible":true,"extensions":["xcs"]},"application/call-completion":{"source":"iana"},"application/cals-1840":{"source":"iana"},"application/cbor":{"source":"iana"},"application/cbor-seq":{"source":"iana"},"application/cccex":{"source":"iana"},"application/ccmp+xml":{"source":"iana","compressible":true},"application/ccxml+xml":{"source":"iana","compressible":true,"extensions":["ccxml"]},"application/cdfx+xml":{"source":"iana","compressible":true,"extensions":["cdfx"]},"application/cdmi-capability":{"source":"iana","extensions":["cdmia"]},"application/cdmi-container":{"source":"iana","extensions":["cdmic"]},"application/cdmi-domain":{"source":"iana","extensions":["cdmid"]},"application/cdmi-object":{"source":"iana","extensions":["cdmio"]},"application/cdmi-queue":{"source":"iana","extensions":["cdmiq"]},"application/cdni":{"source":"iana"},"application/cea":{"source":"iana"},"application/cea-2018+xml":{"source":"iana","compressible":true},"application/cellml+xml":{"source":"iana","compressible":true},"application/cfw":{"source":"iana"},"application/clue+xml":{"source":"iana","compressible":true},"application/clue_info+xml":{"source":"iana","compressible":true},"application/cms":{"source":"iana"},"application/cnrp+xml":{"source":"iana","compressible":true},"application/coap-group+json":{"source":"iana","compressible":true},"application/coap-payload":{"source":"iana"},"application/commonground":{"source":"iana"},"application/conference-info+xml":{"source":"iana","compressible":true},"application/cose":{"source":"iana"},"application/cose-key":{"source":"iana"},"application/cose-key-set":{"source":"iana"},"application/cpl+xml":{"source":"iana","compressible":true},"application/csrattrs":{"source":"iana"},"application/csta+xml":{"source":"iana","compressible":true},"application/cstadata+xml":{"source":"iana","compressible":true},"application/csvm+json":{"source":"iana","compressible":true},"application/cu-seeme":{"source":"apache","extensions":["cu"]},"application/cwt":{"source":"iana"},"application/cybercash":{"source":"iana"},"application/dart":{"compressible":true},"application/dash+xml":{"source":"iana","compressible":true,"extensions":["mpd"]},"application/dashdelta":{"source":"iana"},"application/davmount+xml":{"source":"iana","compressible":true,"extensions":["davmount"]},"application/dca-rft":{"source":"iana"},"application/dcd":{"source":"iana"},"application/dec-dx":{"source":"iana"},"application/dialog-info+xml":{"source":"iana","compressible":true},"application/dicom":{"source":"iana"},"application/dicom+json":{"source":"iana","compressible":true},"application/dicom+xml":{"source":"iana","compressible":true},"application/dii":{"source":"iana"},"application/dit":{"source":"iana"},"application/dns":{"source":"iana"},"application/dns+json":{"source":"iana","compressible":true},"application/dns-message":{"source":"iana"},"application/docbook+xml":{"source":"apache","compressible":true,"extensions":["dbk"]},"application/dskpp+xml":{"source":"iana","compressible":true},"application/dssc+der":{"source":"iana","extensions":["dssc"]},"application/dssc+xml":{"source":"iana","compressible":true,"extensions":["xdssc"]},"application/dvcs":{"source":"iana"},"application/ecmascript":{"source":"iana","compressible":true,"extensions":["ecma","es"]},"application/edi-consent":{"source":"iana"},"application/edi-x12":{"source":"iana","compressible":false},"application/edifact":{"source":"iana","compressible":false},"application/efi":{"source":"iana"},"application/emergencycalldata.comment+xml":{"source":"iana","compressible":true},"application/emergencycalldata.control+xml":{"source":"iana","compressible":true},"application/emergencycalldata.deviceinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.ecall.msd":{"source":"iana"},"application/emergencycalldata.providerinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.serviceinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.subscriberinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.veds+xml":{"source":"iana","compressible":true},"application/emma+xml":{"source":"iana","compressible":true,"extensions":["emma"]},"application/emotionml+xml":{"source":"iana","compressible":true,"extensions":["emotionml"]},"application/encaprtp":{"source":"iana"},"application/epp+xml":{"source":"iana","compressible":true},"application/epub+zip":{"source":"iana","compressible":false,"extensions":["epub"]},"application/eshop":{"source":"iana"},"application/exi":{"source":"iana","extensions":["exi"]},"application/expect-ct-report+json":{"source":"iana","compressible":true},"application/fastinfoset":{"source":"iana"},"application/fastsoap":{"source":"iana"},"application/fdt+xml":{"source":"iana","compressible":true,"extensions":["fdt"]},"application/fhir+json":{"source":"iana","compressible":true},"application/fhir+xml":{"source":"iana","compressible":true},"application/fido.trusted-apps+json":{"compressible":true},"application/fits":{"source":"iana"},"application/flexfec":{"source":"iana"},"application/font-sfnt":{"source":"iana"},"application/font-tdpfr":{"source":"iana","extensions":["pfr"]},"application/font-woff":{"source":"iana","compressible":false},"application/framework-attributes+xml":{"source":"iana","compressible":true},"application/geo+json":{"source":"iana","compressible":true,"extensions":["geojson"]},"application/geo+json-seq":{"source":"iana"},"application/geopackage+sqlite3":{"source":"iana"},"application/geoxacml+xml":{"source":"iana","compressible":true},"application/gltf-buffer":{"source":"iana"},"application/gml+xml":{"source":"iana","compressible":true,"extensions":["gml"]},"application/gpx+xml":{"source":"apache","compressible":true,"extensions":["gpx"]},"application/gxf":{"source":"apache","extensions":["gxf"]},"application/gzip":{"source":"iana","compressible":false,"extensions":["gz"]},"application/h224":{"source":"iana"},"application/held+xml":{"source":"iana","compressible":true},"application/hjson":{"extensions":["hjson"]},"application/http":{"source":"iana"},"application/hyperstudio":{"source":"iana","extensions":["stk"]},"application/ibe-key-request+xml":{"source":"iana","compressible":true},"application/ibe-pkg-reply+xml":{"source":"iana","compressible":true},"application/ibe-pp-data":{"source":"iana"},"application/iges":{"source":"iana"},"application/im-iscomposing+xml":{"source":"iana","compressible":true},"application/index":{"source":"iana"},"application/index.cmd":{"source":"iana"},"application/index.obj":{"source":"iana"},"application/index.response":{"source":"iana"},"application/index.vnd":{"source":"iana"},"application/inkml+xml":{"source":"iana","compressible":true,"extensions":["ink","inkml"]},"application/iotp":{"source":"iana"},"application/ipfix":{"source":"iana","extensions":["ipfix"]},"application/ipp":{"source":"iana"},"application/isup":{"source":"iana"},"application/its+xml":{"source":"iana","compressible":true,"extensions":["its"]},"application/java-archive":{"source":"apache","compressible":false,"extensions":["jar","war","ear"]},"application/java-serialized-object":{"source":"apache","compressible":false,"extensions":["ser"]},"application/java-vm":{"source":"apache","compressible":false,"extensions":["class"]},"application/javascript":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["js","mjs"]},"application/jf2feed+json":{"source":"iana","compressible":true},"application/jose":{"source":"iana"},"application/jose+json":{"source":"iana","compressible":true},"application/jrd+json":{"source":"iana","compressible":true},"application/json":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["json","map"]},"application/json-patch+json":{"source":"iana","compressible":true},"application/json-seq":{"source":"iana"},"application/json5":{"extensions":["json5"]},"application/jsonml+json":{"source":"apache","compressible":true,"extensions":["jsonml"]},"application/jwk+json":{"source":"iana","compressible":true},"application/jwk-set+json":{"source":"iana","compressible":true},"application/jwt":{"source":"iana"},"application/kpml-request+xml":{"source":"iana","compressible":true},"application/kpml-response+xml":{"source":"iana","compressible":true},"application/ld+json":{"source":"iana","compressible":true,"extensions":["jsonld"]},"application/lgr+xml":{"source":"iana","compressible":true,"extensions":["lgr"]},"application/link-format":{"source":"iana"},"application/load-control+xml":{"source":"iana","compressible":true},"application/lost+xml":{"source":"iana","compressible":true,"extensions":["lostxml"]},"application/lostsync+xml":{"source":"iana","compressible":true},"application/lxf":{"source":"iana"},"application/mac-binhex40":{"source":"iana","extensions":["hqx"]},"application/mac-compactpro":{"source":"apache","extensions":["cpt"]},"application/macwriteii":{"source":"iana"},"application/mads+xml":{"source":"iana","compressible":true,"extensions":["mads"]},"application/manifest+json":{"charset":"UTF-8","compressible":true,"extensions":["webmanifest"]},"application/marc":{"source":"iana","extensions":["mrc"]},"application/marcxml+xml":{"source":"iana","compressible":true,"extensions":["mrcx"]},"application/mathematica":{"source":"iana","extensions":["ma","nb","mb"]},"application/mathml+xml":{"source":"iana","compressible":true,"extensions":["mathml"]},"application/mathml-content+xml":{"source":"iana","compressible":true},"application/mathml-presentation+xml":{"source":"iana","compressible":true},"application/mbms-associated-procedure-description+xml":{"source":"iana","compressible":true},"application/mbms-deregister+xml":{"source":"iana","compressible":true},"application/mbms-envelope+xml":{"source":"iana","compressible":true},"application/mbms-msk+xml":{"source":"iana","compressible":true},"application/mbms-msk-response+xml":{"source":"iana","compressible":true},"application/mbms-protection-description+xml":{"source":"iana","compressible":true},"application/mbms-reception-report+xml":{"source":"iana","compressible":true},"application/mbms-register+xml":{"source":"iana","compressible":true},"application/mbms-register-response+xml":{"source":"iana","compressible":true},"application/mbms-schedule+xml":{"source":"iana","compressible":true},"application/mbms-user-service-description+xml":{"source":"iana","compressible":true},"application/mbox":{"source":"iana","extensions":["mbox"]},"application/media-policy-dataset+xml":{"source":"iana","compressible":true},"application/media_control+xml":{"source":"iana","compressible":true},"application/mediaservercontrol+xml":{"source":"iana","compressible":true,"extensions":["mscml"]},"application/merge-patch+json":{"source":"iana","compressible":true},"application/metalink+xml":{"source":"apache","compressible":true,"extensions":["metalink"]},"application/metalink4+xml":{"source":"iana","compressible":true,"extensions":["meta4"]},"application/mets+xml":{"source":"iana","compressible":true,"extensions":["mets"]},"application/mf4":{"source":"iana"},"application/mikey":{"source":"iana"},"application/mipc":{"source":"iana"},"application/mmt-aei+xml":{"source":"iana","compressible":true,"extensions":["maei"]},"application/mmt-usd+xml":{"source":"iana","compressible":true,"extensions":["musd"]},"application/mods+xml":{"source":"iana","compressible":true,"extensions":["mods"]},"application/moss-keys":{"source":"iana"},"application/moss-signature":{"source":"iana"},"application/mosskey-data":{"source":"iana"},"application/mosskey-request":{"source":"iana"},"application/mp21":{"source":"iana","extensions":["m21","mp21"]},"application/mp4":{"source":"iana","extensions":["mp4s","m4p"]},"application/mpeg4-generic":{"source":"iana"},"application/mpeg4-iod":{"source":"iana"},"application/mpeg4-iod-xmt":{"source":"iana"},"application/mrb-consumer+xml":{"source":"iana","compressible":true,"extensions":["xdf"]},"application/mrb-publish+xml":{"source":"iana","compressible":true,"extensions":["xdf"]},"application/msc-ivr+xml":{"source":"iana","compressible":true},"application/msc-mixer+xml":{"source":"iana","compressible":true},"application/msword":{"source":"iana","compressible":false,"extensions":["doc","dot"]},"application/mud+json":{"source":"iana","compressible":true},"application/multipart-core":{"source":"iana"},"application/mxf":{"source":"iana","extensions":["mxf"]},"application/n-quads":{"source":"iana","extensions":["nq"]},"application/n-triples":{"source":"iana","extensions":["nt"]},"application/nasdata":{"source":"iana"},"application/news-checkgroups":{"source":"iana"},"application/news-groupinfo":{"source":"iana"},"application/news-transmission":{"source":"iana"},"application/nlsml+xml":{"source":"iana","compressible":true},"application/node":{"source":"iana"},"application/nss":{"source":"iana"},"application/ocsp-request":{"source":"iana"},"application/ocsp-response":{"source":"iana"},"application/octet-stream":{"source":"iana","compressible":false,"extensions":["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","exe","dll","deb","dmg","iso","img","msi","msp","msm","buffer"]},"application/oda":{"source":"iana","extensions":["oda"]},"application/odm+xml":{"source":"iana","compressible":true},"application/odx":{"source":"iana"},"application/oebps-package+xml":{"source":"iana","compressible":true,"extensions":["opf"]},"application/ogg":{"source":"iana","compressible":false,"extensions":["ogx"]},"application/omdoc+xml":{"source":"apache","compressible":true,"extensions":["omdoc"]},"application/onenote":{"source":"apache","extensions":["onetoc","onetoc2","onetmp","onepkg"]},"application/oscore":{"source":"iana"},"application/oxps":{"source":"iana","extensions":["oxps"]},"application/p2p-overlay+xml":{"source":"iana","compressible":true,"extensions":["relo"]},"application/parityfec":{"source":"iana"},"application/passport":{"source":"iana"},"application/patch-ops-error+xml":{"source":"iana","compressible":true,"extensions":["xer"]},"application/pdf":{"source":"iana","compressible":false,"extensions":["pdf"]},"application/pdx":{"source":"iana"},"application/pem-certificate-chain":{"source":"iana"},"application/pgp-encrypted":{"source":"iana","compressible":false,"extensions":["pgp"]},"application/pgp-keys":{"source":"iana"},"application/pgp-signature":{"source":"iana","extensions":["asc","sig"]},"application/pics-rules":{"source":"apache","extensions":["prf"]},"application/pidf+xml":{"source":"iana","compressible":true},"application/pidf-diff+xml":{"source":"iana","compressible":true},"application/pkcs10":{"source":"iana","extensions":["p10"]},"application/pkcs12":{"source":"iana"},"application/pkcs7-mime":{"source":"iana","extensions":["p7m","p7c"]},"application/pkcs7-signature":{"source":"iana","extensions":["p7s"]},"application/pkcs8":{"source":"iana","extensions":["p8"]},"application/pkcs8-encrypted":{"source":"iana"},"application/pkix-attr-cert":{"source":"iana","extensions":["ac"]},"application/pkix-cert":{"source":"iana","extensions":["cer"]},"application/pkix-crl":{"source":"iana","extensions":["crl"]},"application/pkix-pkipath":{"source":"iana","extensions":["pkipath"]},"application/pkixcmp":{"source":"iana","extensions":["pki"]},"application/pls+xml":{"source":"iana","compressible":true,"extensions":["pls"]},"application/poc-settings+xml":{"source":"iana","compressible":true},"application/postscript":{"source":"iana","compressible":true,"extensions":["ai","eps","ps"]},"application/ppsp-tracker+json":{"source":"iana","compressible":true},"application/problem+json":{"source":"iana","compressible":true},"application/problem+xml":{"source":"iana","compressible":true},"application/provenance+xml":{"source":"iana","compressible":true,"extensions":["provx"]},"application/prs.alvestrand.titrax-sheet":{"source":"iana"},"application/prs.cww":{"source":"iana","extensions":["cww"]},"application/prs.hpub+zip":{"source":"iana","compressible":false},"application/prs.nprend":{"source":"iana"},"application/prs.plucker":{"source":"iana"},"application/prs.rdf-xml-crypt":{"source":"iana"},"application/prs.xsf+xml":{"source":"iana","compressible":true},"application/pskc+xml":{"source":"iana","compressible":true,"extensions":["pskcxml"]},"application/qsig":{"source":"iana"},"application/raml+yaml":{"compressible":true,"extensions":["raml"]},"application/raptorfec":{"source":"iana"},"application/rdap+json":{"source":"iana","compressible":true},"application/rdf+xml":{"source":"iana","compressible":true,"extensions":["rdf","owl"]},"application/reginfo+xml":{"source":"iana","compressible":true,"extensions":["rif"]},"application/relax-ng-compact-syntax":{"source":"iana","extensions":["rnc"]},"application/remote-printing":{"source":"iana"},"application/reputon+json":{"source":"iana","compressible":true},"application/resource-lists+xml":{"source":"iana","compressible":true,"extensions":["rl"]},"application/resource-lists-diff+xml":{"source":"iana","compressible":true,"extensions":["rld"]},"application/rfc+xml":{"source":"iana","compressible":true},"application/riscos":{"source":"iana"},"application/rlmi+xml":{"source":"iana","compressible":true},"application/rls-services+xml":{"source":"iana","compressible":true,"extensions":["rs"]},"application/route-apd+xml":{"source":"iana","compressible":true,"extensions":["rapd"]},"application/route-s-tsid+xml":{"source":"iana","compressible":true,"extensions":["sls"]},"application/route-usd+xml":{"source":"iana","compressible":true,"extensions":["rusd"]},"application/rpki-ghostbusters":{"source":"iana","extensions":["gbr"]},"application/rpki-manifest":{"source":"iana","extensions":["mft"]},"application/rpki-publication":{"source":"iana"},"application/rpki-roa":{"source":"iana","extensions":["roa"]},"application/rpki-updown":{"source":"iana"},"application/rsd+xml":{"source":"apache","compressible":true,"extensions":["rsd"]},"application/rss+xml":{"source":"apache","compressible":true,"extensions":["rss"]},"application/rtf":{"source":"iana","compressible":true,"extensions":["rtf"]},"application/rtploopback":{"source":"iana"},"application/rtx":{"source":"iana"},"application/samlassertion+xml":{"source":"iana","compressible":true},"application/samlmetadata+xml":{"source":"iana","compressible":true},"application/sbml+xml":{"source":"iana","compressible":true,"extensions":["sbml"]},"application/scaip+xml":{"source":"iana","compressible":true},"application/scim+json":{"source":"iana","compressible":true},"application/scvp-cv-request":{"source":"iana","extensions":["scq"]},"application/scvp-cv-response":{"source":"iana","extensions":["scs"]},"application/scvp-vp-request":{"source":"iana","extensions":["spq"]},"application/scvp-vp-response":{"source":"iana","extensions":["spp"]},"application/sdp":{"source":"iana","extensions":["sdp"]},"application/secevent+jwt":{"source":"iana"},"application/senml+cbor":{"source":"iana"},"application/senml+json":{"source":"iana","compressible":true},"application/senml+xml":{"source":"iana","compressible":true,"extensions":["senmlx"]},"application/senml-exi":{"source":"iana"},"application/sensml+cbor":{"source":"iana"},"application/sensml+json":{"source":"iana","compressible":true},"application/sensml+xml":{"source":"iana","compressible":true,"extensions":["sensmlx"]},"application/sensml-exi":{"source":"iana"},"application/sep+xml":{"source":"iana","compressible":true},"application/sep-exi":{"source":"iana"},"application/session-info":{"source":"iana"},"application/set-payment":{"source":"iana"},"application/set-payment-initiation":{"source":"iana","extensions":["setpay"]},"application/set-registration":{"source":"iana"},"application/set-registration-initiation":{"source":"iana","extensions":["setreg"]},"application/sgml":{"source":"iana"},"application/sgml-open-catalog":{"source":"iana"},"application/shf+xml":{"source":"iana","compressible":true,"extensions":["shf"]},"application/sieve":{"source":"iana","extensions":["siv","sieve"]},"application/simple-filter+xml":{"source":"iana","compressible":true},"application/simple-message-summary":{"source":"iana"},"application/simplesymbolcontainer":{"source":"iana"},"application/sipc":{"source":"iana"},"application/slate":{"source":"iana"},"application/smil":{"source":"iana"},"application/smil+xml":{"source":"iana","compressible":true,"extensions":["smi","smil"]},"application/smpte336m":{"source":"iana"},"application/soap+fastinfoset":{"source":"iana"},"application/soap+xml":{"source":"iana","compressible":true},"application/sparql-query":{"source":"iana","extensions":["rq"]},"application/sparql-results+xml":{"source":"iana","compressible":true,"extensions":["srx"]},"application/spirits-event+xml":{"source":"iana","compressible":true},"application/sql":{"source":"iana"},"application/srgs":{"source":"iana","extensions":["gram"]},"application/srgs+xml":{"source":"iana","compressible":true,"extensions":["grxml"]},"application/sru+xml":{"source":"iana","compressible":true,"extensions":["sru"]},"application/ssdl+xml":{"source":"apache","compressible":true,"extensions":["ssdl"]},"application/ssml+xml":{"source":"iana","compressible":true,"extensions":["ssml"]},"application/stix+json":{"source":"iana","compressible":true},"application/swid+xml":{"source":"iana","compressible":true,"extensions":["swidtag"]},"application/tamp-apex-update":{"source":"iana"},"application/tamp-apex-update-confirm":{"source":"iana"},"application/tamp-community-update":{"source":"iana"},"application/tamp-community-update-confirm":{"source":"iana"},"application/tamp-error":{"source":"iana"},"application/tamp-sequence-adjust":{"source":"iana"},"application/tamp-sequence-adjust-confirm":{"source":"iana"},"application/tamp-status-query":{"source":"iana"},"application/tamp-status-response":{"source":"iana"},"application/tamp-update":{"source":"iana"},"application/tamp-update-confirm":{"source":"iana"},"application/tar":{"compressible":true},"application/taxii+json":{"source":"iana","compressible":true},"application/tei+xml":{"source":"iana","compressible":true,"extensions":["tei","teicorpus"]},"application/tetra_isi":{"source":"iana"},"application/thraud+xml":{"source":"iana","compressible":true,"extensions":["tfi"]},"application/timestamp-query":{"source":"iana"},"application/timestamp-reply":{"source":"iana"},"application/timestamped-data":{"source":"iana","extensions":["tsd"]},"application/tlsrpt+gzip":{"source":"iana"},"application/tlsrpt+json":{"source":"iana","compressible":true},"application/tnauthlist":{"source":"iana"},"application/toml":{"compressible":true,"extensions":["toml"]},"application/trickle-ice-sdpfrag":{"source":"iana"},"application/trig":{"source":"iana"},"application/ttml+xml":{"source":"iana","compressible":true,"extensions":["ttml"]},"application/tve-trigger":{"source":"iana"},"application/tzif":{"source":"iana"},"application/tzif-leap":{"source":"iana"},"application/ulpfec":{"source":"iana"},"application/urc-grpsheet+xml":{"source":"iana","compressible":true},"application/urc-ressheet+xml":{"source":"iana","compressible":true,"extensions":["rsheet"]},"application/urc-targetdesc+xml":{"source":"iana","compressible":true},"application/urc-uisocketdesc+xml":{"source":"iana","compressible":true},"application/vcard+json":{"source":"iana","compressible":true},"application/vcard+xml":{"source":"iana","compressible":true},"application/vemmi":{"source":"iana"},"application/vividence.scriptfile":{"source":"apache"},"application/vnd.1000minds.decision-model+xml":{"source":"iana","compressible":true,"extensions":["1km"]},"application/vnd.3gpp-prose+xml":{"source":"iana","compressible":true},"application/vnd.3gpp-prose-pc3ch+xml":{"source":"iana","compressible":true},"application/vnd.3gpp-v2x-local-service-information":{"source":"iana"},"application/vnd.3gpp.access-transfer-events+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.bsf+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.gmop+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mc-signalling-ear":{"source":"iana"},"application/vnd.3gpp.mcdata-affiliation-command+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-payload":{"source":"iana"},"application/vnd.3gpp.mcdata-service-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-signalling":{"source":"iana"},"application/vnd.3gpp.mcdata-ue-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-user-profile+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-affiliation-command+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-floor-request+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-location-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-mbms-usage-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-service-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-signed+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-ue-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-ue-init-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-user-profile+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-affiliation-command+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-affiliation-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-location-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-mbms-usage-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-service-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-transmission-request+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-ue-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-user-profile+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mid-call+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.pic-bw-large":{"source":"iana","extensions":["plb"]},"application/vnd.3gpp.pic-bw-small":{"source":"iana","extensions":["psb"]},"application/vnd.3gpp.pic-bw-var":{"source":"iana","extensions":["pvb"]},"application/vnd.3gpp.sms":{"source":"iana"},"application/vnd.3gpp.sms+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.srvcc-ext+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.srvcc-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.state-and-event-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.ussd+xml":{"source":"iana","compressible":true},"application/vnd.3gpp2.bcmcsinfo+xml":{"source":"iana","compressible":true},"application/vnd.3gpp2.sms":{"source":"iana"},"application/vnd.3gpp2.tcap":{"source":"iana","extensions":["tcap"]},"application/vnd.3lightssoftware.imagescal":{"source":"iana"},"application/vnd.3m.post-it-notes":{"source":"iana","extensions":["pwn"]},"application/vnd.accpac.simply.aso":{"source":"iana","extensions":["aso"]},"application/vnd.accpac.simply.imp":{"source":"iana","extensions":["imp"]},"application/vnd.acucobol":{"source":"iana","extensions":["acu"]},"application/vnd.acucorp":{"source":"iana","extensions":["atc","acutc"]},"application/vnd.adobe.air-application-installer-package+zip":{"source":"apache","compressible":false,"extensions":["air"]},"application/vnd.adobe.flash.movie":{"source":"iana"},"application/vnd.adobe.formscentral.fcdt":{"source":"iana","extensions":["fcdt"]},"application/vnd.adobe.fxp":{"source":"iana","extensions":["fxp","fxpl"]},"application/vnd.adobe.partial-upload":{"source":"iana"},"application/vnd.adobe.xdp+xml":{"source":"iana","compressible":true,"extensions":["xdp"]},"application/vnd.adobe.xfdf":{"source":"iana","extensions":["xfdf"]},"application/vnd.aether.imp":{"source":"iana"},"application/vnd.afpc.afplinedata":{"source":"iana"},"application/vnd.afpc.afplinedata-pagedef":{"source":"iana"},"application/vnd.afpc.foca-charset":{"source":"iana"},"application/vnd.afpc.foca-codedfont":{"source":"iana"},"application/vnd.afpc.foca-codepage":{"source":"iana"},"application/vnd.afpc.modca":{"source":"iana"},"application/vnd.afpc.modca-formdef":{"source":"iana"},"application/vnd.afpc.modca-mediummap":{"source":"iana"},"application/vnd.afpc.modca-objectcontainer":{"source":"iana"},"application/vnd.afpc.modca-overlay":{"source":"iana"},"application/vnd.afpc.modca-pagesegment":{"source":"iana"},"application/vnd.ah-barcode":{"source":"iana"},"application/vnd.ahead.space":{"source":"iana","extensions":["ahead"]},"application/vnd.airzip.filesecure.azf":{"source":"iana","extensions":["azf"]},"application/vnd.airzip.filesecure.azs":{"source":"iana","extensions":["azs"]},"application/vnd.amadeus+json":{"source":"iana","compressible":true},"application/vnd.amazon.ebook":{"source":"apache","extensions":["azw"]},"application/vnd.amazon.mobi8-ebook":{"source":"iana"},"application/vnd.americandynamics.acc":{"source":"iana","extensions":["acc"]},"application/vnd.amiga.ami":{"source":"iana","extensions":["ami"]},"application/vnd.amundsen.maze+xml":{"source":"iana","compressible":true},"application/vnd.android.ota":{"source":"iana"},"application/vnd.android.package-archive":{"source":"apache","compressible":false,"extensions":["apk"]},"application/vnd.anki":{"source":"iana"},"application/vnd.anser-web-certificate-issue-initiation":{"source":"iana","extensions":["cii"]},"application/vnd.anser-web-funds-transfer-initiation":{"source":"apache","extensions":["fti"]},"application/vnd.antix.game-component":{"source":"iana","extensions":["atx"]},"application/vnd.apache.thrift.binary":{"source":"iana"},"application/vnd.apache.thrift.compact":{"source":"iana"},"application/vnd.apache.thrift.json":{"source":"iana"},"application/vnd.api+json":{"source":"iana","compressible":true},"application/vnd.aplextor.warrp+json":{"source":"iana","compressible":true},"application/vnd.apothekende.reservation+json":{"source":"iana","compressible":true},"application/vnd.apple.installer+xml":{"source":"iana","compressible":true,"extensions":["mpkg"]},"application/vnd.apple.keynote":{"source":"iana","extensions":["keynote"]},"application/vnd.apple.mpegurl":{"source":"iana","extensions":["m3u8"]},"application/vnd.apple.numbers":{"source":"iana","extensions":["numbers"]},"application/vnd.apple.pages":{"source":"iana","extensions":["pages"]},"application/vnd.apple.pkpass":{"compressible":false,"extensions":["pkpass"]},"application/vnd.arastra.swi":{"source":"iana"},"application/vnd.aristanetworks.swi":{"source":"iana","extensions":["swi"]},"application/vnd.artisan+json":{"source":"iana","compressible":true},"application/vnd.artsquare":{"source":"iana"},"application/vnd.astraea-software.iota":{"source":"iana","extensions":["iota"]},"application/vnd.audiograph":{"source":"iana","extensions":["aep"]},"application/vnd.autopackage":{"source":"iana"},"application/vnd.avalon+json":{"source":"iana","compressible":true},"application/vnd.avistar+xml":{"source":"iana","compressible":true},"application/vnd.balsamiq.bmml+xml":{"source":"iana","compressible":true,"extensions":["bmml"]},"application/vnd.balsamiq.bmpr":{"source":"iana"},"application/vnd.banana-accounting":{"source":"iana"},"application/vnd.bbf.usp.error":{"source":"iana"},"application/vnd.bbf.usp.msg":{"source":"iana"},"application/vnd.bbf.usp.msg+json":{"source":"iana","compressible":true},"application/vnd.bekitzur-stech+json":{"source":"iana","compressible":true},"application/vnd.bint.med-content":{"source":"iana"},"application/vnd.biopax.rdf+xml":{"source":"iana","compressible":true},"application/vnd.blink-idb-value-wrapper":{"source":"iana"},"application/vnd.blueice.multipass":{"source":"iana","extensions":["mpm"]},"application/vnd.bluetooth.ep.oob":{"source":"iana"},"application/vnd.bluetooth.le.oob":{"source":"iana"},"application/vnd.bmi":{"source":"iana","extensions":["bmi"]},"application/vnd.bpf":{"source":"iana"},"application/vnd.bpf3":{"source":"iana"},"application/vnd.businessobjects":{"source":"iana","extensions":["rep"]},"application/vnd.byu.uapi+json":{"source":"iana","compressible":true},"application/vnd.cab-jscript":{"source":"iana"},"application/vnd.canon-cpdl":{"source":"iana"},"application/vnd.canon-lips":{"source":"iana"},"application/vnd.capasystems-pg+json":{"source":"iana","compressible":true},"application/vnd.cendio.thinlinc.clientconf":{"source":"iana"},"application/vnd.century-systems.tcp_stream":{"source":"iana"},"application/vnd.chemdraw+xml":{"source":"iana","compressible":true,"extensions":["cdxml"]},"application/vnd.chess-pgn":{"source":"iana"},"application/vnd.chipnuts.karaoke-mmd":{"source":"iana","extensions":["mmd"]},"application/vnd.ciedi":{"source":"iana"},"application/vnd.cinderella":{"source":"iana","extensions":["cdy"]},"application/vnd.cirpack.isdn-ext":{"source":"iana"},"application/vnd.citationstyles.style+xml":{"source":"iana","compressible":true,"extensions":["csl"]},"application/vnd.claymore":{"source":"iana","extensions":["cla"]},"application/vnd.cloanto.rp9":{"source":"iana","extensions":["rp9"]},"application/vnd.clonk.c4group":{"source":"iana","extensions":["c4g","c4d","c4f","c4p","c4u"]},"application/vnd.cluetrust.cartomobile-config":{"source":"iana","extensions":["c11amc"]},"application/vnd.cluetrust.cartomobile-config-pkg":{"source":"iana","extensions":["c11amz"]},"application/vnd.coffeescript":{"source":"iana"},"application/vnd.collabio.xodocuments.document":{"source":"iana"},"application/vnd.collabio.xodocuments.document-template":{"source":"iana"},"application/vnd.collabio.xodocuments.presentation":{"source":"iana"},"application/vnd.collabio.xodocuments.presentation-template":{"source":"iana"},"application/vnd.collabio.xodocuments.spreadsheet":{"source":"iana"},"application/vnd.collabio.xodocuments.spreadsheet-template":{"source":"iana"},"application/vnd.collection+json":{"source":"iana","compressible":true},"application/vnd.collection.doc+json":{"source":"iana","compressible":true},"application/vnd.collection.next+json":{"source":"iana","compressible":true},"application/vnd.comicbook+zip":{"source":"iana","compressible":false},"application/vnd.comicbook-rar":{"source":"iana"},"application/vnd.commerce-battelle":{"source":"iana"},"application/vnd.commonspace":{"source":"iana","extensions":["csp"]},"application/vnd.contact.cmsg":{"source":"iana","extensions":["cdbcmsg"]},"application/vnd.coreos.ignition+json":{"source":"iana","compressible":true},"application/vnd.cosmocaller":{"source":"iana","extensions":["cmc"]},"application/vnd.crick.clicker":{"source":"iana","extensions":["clkx"]},"application/vnd.crick.clicker.keyboard":{"source":"iana","extensions":["clkk"]},"application/vnd.crick.clicker.palette":{"source":"iana","extensions":["clkp"]},"application/vnd.crick.clicker.template":{"source":"iana","extensions":["clkt"]},"application/vnd.crick.clicker.wordbank":{"source":"iana","extensions":["clkw"]},"application/vnd.criticaltools.wbs+xml":{"source":"iana","compressible":true,"extensions":["wbs"]},"application/vnd.cryptii.pipe+json":{"source":"iana","compressible":true},"application/vnd.crypto-shade-file":{"source":"iana"},"application/vnd.ctc-posml":{"source":"iana","extensions":["pml"]},"application/vnd.ctct.ws+xml":{"source":"iana","compressible":true},"application/vnd.cups-pdf":{"source":"iana"},"application/vnd.cups-postscript":{"source":"iana"},"application/vnd.cups-ppd":{"source":"iana","extensions":["ppd"]},"application/vnd.cups-raster":{"source":"iana"},"application/vnd.cups-raw":{"source":"iana"},"application/vnd.curl":{"source":"iana"},"application/vnd.curl.car":{"source":"apache","extensions":["car"]},"application/vnd.curl.pcurl":{"source":"apache","extensions":["pcurl"]},"application/vnd.cyan.dean.root+xml":{"source":"iana","compressible":true},"application/vnd.cybank":{"source":"iana"},"application/vnd.d2l.coursepackage1p0+zip":{"source":"iana","compressible":false},"application/vnd.dart":{"source":"iana","compressible":true,"extensions":["dart"]},"application/vnd.data-vision.rdz":{"source":"iana","extensions":["rdz"]},"application/vnd.datapackage+json":{"source":"iana","compressible":true},"application/vnd.dataresource+json":{"source":"iana","compressible":true},"application/vnd.debian.binary-package":{"source":"iana"},"application/vnd.dece.data":{"source":"iana","extensions":["uvf","uvvf","uvd","uvvd"]},"application/vnd.dece.ttml+xml":{"source":"iana","compressible":true,"extensions":["uvt","uvvt"]},"application/vnd.dece.unspecified":{"source":"iana","extensions":["uvx","uvvx"]},"application/vnd.dece.zip":{"source":"iana","extensions":["uvz","uvvz"]},"application/vnd.denovo.fcselayout-link":{"source":"iana","extensions":["fe_launch"]},"application/vnd.desmume.movie":{"source":"iana"},"application/vnd.dir-bi.plate-dl-nosuffix":{"source":"iana"},"application/vnd.dm.delegation+xml":{"source":"iana","compressible":true},"application/vnd.dna":{"source":"iana","extensions":["dna"]},"application/vnd.document+json":{"source":"iana","compressible":true},"application/vnd.dolby.mlp":{"source":"apache","extensions":["mlp"]},"application/vnd.dolby.mobile.1":{"source":"iana"},"application/vnd.dolby.mobile.2":{"source":"iana"},"application/vnd.doremir.scorecloud-binary-document":{"source":"iana"},"application/vnd.dpgraph":{"source":"iana","extensions":["dpg"]},"application/vnd.dreamfactory":{"source":"iana","extensions":["dfac"]},"application/vnd.drive+json":{"source":"iana","compressible":true},"application/vnd.ds-keypoint":{"source":"apache","extensions":["kpxx"]},"application/vnd.dtg.local":{"source":"iana"},"application/vnd.dtg.local.flash":{"source":"iana"},"application/vnd.dtg.local.html":{"source":"iana"},"application/vnd.dvb.ait":{"source":"iana","extensions":["ait"]},"application/vnd.dvb.dvbj":{"source":"iana"},"application/vnd.dvb.esgcontainer":{"source":"iana"},"application/vnd.dvb.ipdcdftnotifaccess":{"source":"iana"},"application/vnd.dvb.ipdcesgaccess":{"source":"iana"},"application/vnd.dvb.ipdcesgaccess2":{"source":"iana"},"application/vnd.dvb.ipdcesgpdd":{"source":"iana"},"application/vnd.dvb.ipdcroaming":{"source":"iana"},"application/vnd.dvb.iptv.alfec-base":{"source":"iana"},"application/vnd.dvb.iptv.alfec-enhancement":{"source":"iana"},"application/vnd.dvb.notif-aggregate-root+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-container+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-generic+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-ia-msglist+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-ia-registration-request+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-ia-registration-response+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-init+xml":{"source":"iana","compressible":true},"application/vnd.dvb.pfr":{"source":"iana"},"application/vnd.dvb.service":{"source":"iana","extensions":["svc"]},"application/vnd.dxr":{"source":"iana"},"application/vnd.dynageo":{"source":"iana","extensions":["geo"]},"application/vnd.dzr":{"source":"iana"},"application/vnd.easykaraoke.cdgdownload":{"source":"iana"},"application/vnd.ecdis-update":{"source":"iana"},"application/vnd.ecip.rlp":{"source":"iana"},"application/vnd.ecowin.chart":{"source":"iana","extensions":["mag"]},"application/vnd.ecowin.filerequest":{"source":"iana"},"application/vnd.ecowin.fileupdate":{"source":"iana"},"application/vnd.ecowin.series":{"source":"iana"},"application/vnd.ecowin.seriesrequest":{"source":"iana"},"application/vnd.ecowin.seriesupdate":{"source":"iana"},"application/vnd.efi.img":{"source":"iana"},"application/vnd.efi.iso":{"source":"iana"},"application/vnd.emclient.accessrequest+xml":{"source":"iana","compressible":true},"application/vnd.enliven":{"source":"iana","extensions":["nml"]},"application/vnd.enphase.envoy":{"source":"iana"},"application/vnd.eprints.data+xml":{"source":"iana","compressible":true},"application/vnd.epson.esf":{"source":"iana","extensions":["esf"]},"application/vnd.epson.msf":{"source":"iana","extensions":["msf"]},"application/vnd.epson.quickanime":{"source":"iana","extensions":["qam"]},"application/vnd.epson.salt":{"source":"iana","extensions":["slt"]},"application/vnd.epson.ssf":{"source":"iana","extensions":["ssf"]},"application/vnd.ericsson.quickcall":{"source":"iana"},"application/vnd.espass-espass+zip":{"source":"iana","compressible":false},"application/vnd.eszigno3+xml":{"source":"iana","compressible":true,"extensions":["es3","et3"]},"application/vnd.etsi.aoc+xml":{"source":"iana","compressible":true},"application/vnd.etsi.asic-e+zip":{"source":"iana","compressible":false},"application/vnd.etsi.asic-s+zip":{"source":"iana","compressible":false},"application/vnd.etsi.cug+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvcommand+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvdiscovery+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvprofile+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsad-bc+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsad-cod+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsad-npvr+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvservice+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsync+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvueprofile+xml":{"source":"iana","compressible":true},"application/vnd.etsi.mcid+xml":{"source":"iana","compressible":true},"application/vnd.etsi.mheg5":{"source":"iana"},"application/vnd.etsi.overload-control-policy-dataset+xml":{"source":"iana","compressible":true},"application/vnd.etsi.pstn+xml":{"source":"iana","compressible":true},"application/vnd.etsi.sci+xml":{"source":"iana","compressible":true},"application/vnd.etsi.simservs+xml":{"source":"iana","compressible":true},"application/vnd.etsi.timestamp-token":{"source":"iana"},"application/vnd.etsi.tsl+xml":{"source":"iana","compressible":true},"application/vnd.etsi.tsl.der":{"source":"iana"},"application/vnd.eudora.data":{"source":"iana"},"application/vnd.evolv.ecig.profile":{"source":"iana"},"application/vnd.evolv.ecig.settings":{"source":"iana"},"application/vnd.evolv.ecig.theme":{"source":"iana"},"application/vnd.exstream-empower+zip":{"source":"iana","compressible":false},"application/vnd.exstream-package":{"source":"iana"},"application/vnd.ezpix-album":{"source":"iana","extensions":["ez2"]},"application/vnd.ezpix-package":{"source":"iana","extensions":["ez3"]},"application/vnd.f-secure.mobile":{"source":"iana"},"application/vnd.fastcopy-disk-image":{"source":"iana"},"application/vnd.fdf":{"source":"iana","extensions":["fdf"]},"application/vnd.fdsn.mseed":{"source":"iana","extensions":["mseed"]},"application/vnd.fdsn.seed":{"source":"iana","extensions":["seed","dataless"]},"application/vnd.ffsns":{"source":"iana"},"application/vnd.ficlab.flb+zip":{"source":"iana","compressible":false},"application/vnd.filmit.zfc":{"source":"iana"},"application/vnd.fints":{"source":"iana"},"application/vnd.firemonkeys.cloudcell":{"source":"iana"},"application/vnd.flographit":{"source":"iana","extensions":["gph"]},"application/vnd.fluxtime.clip":{"source":"iana","extensions":["ftc"]},"application/vnd.font-fontforge-sfd":{"source":"iana"},"application/vnd.framemaker":{"source":"iana","extensions":["fm","frame","maker","book"]},"application/vnd.frogans.fnc":{"source":"iana","extensions":["fnc"]},"application/vnd.frogans.ltf":{"source":"iana","extensions":["ltf"]},"application/vnd.fsc.weblaunch":{"source":"iana","extensions":["fsc"]},"application/vnd.fujitsu.oasys":{"source":"iana","extensions":["oas"]},"application/vnd.fujitsu.oasys2":{"source":"iana","extensions":["oa2"]},"application/vnd.fujitsu.oasys3":{"source":"iana","extensions":["oa3"]},"application/vnd.fujitsu.oasysgp":{"source":"iana","extensions":["fg5"]},"application/vnd.fujitsu.oasysprs":{"source":"iana","extensions":["bh2"]},"application/vnd.fujixerox.art-ex":{"source":"iana"},"application/vnd.fujixerox.art4":{"source":"iana"},"application/vnd.fujixerox.ddd":{"source":"iana","extensions":["ddd"]},"application/vnd.fujixerox.docuworks":{"source":"iana","extensions":["xdw"]},"application/vnd.fujixerox.docuworks.binder":{"source":"iana","extensions":["xbd"]},"application/vnd.fujixerox.docuworks.container":{"source":"iana"},"application/vnd.fujixerox.hbpl":{"source":"iana"},"application/vnd.fut-misnet":{"source":"iana"},"application/vnd.futoin+cbor":{"source":"iana"},"application/vnd.futoin+json":{"source":"iana","compressible":true},"application/vnd.fuzzysheet":{"source":"iana","extensions":["fzs"]},"application/vnd.genomatix.tuxedo":{"source":"iana","extensions":["txd"]},"application/vnd.gentics.grd+json":{"source":"iana","compressible":true},"application/vnd.geo+json":{"source":"iana","compressible":true},"application/vnd.geocube+xml":{"source":"iana","compressible":true},"application/vnd.geogebra.file":{"source":"iana","extensions":["ggb"]},"application/vnd.geogebra.tool":{"source":"iana","extensions":["ggt"]},"application/vnd.geometry-explorer":{"source":"iana","extensions":["gex","gre"]},"application/vnd.geonext":{"source":"iana","extensions":["gxt"]},"application/vnd.geoplan":{"source":"iana","extensions":["g2w"]},"application/vnd.geospace":{"source":"iana","extensions":["g3w"]},"application/vnd.gerber":{"source":"iana"},"application/vnd.globalplatform.card-content-mgt":{"source":"iana"},"application/vnd.globalplatform.card-content-mgt-response":{"source":"iana"},"application/vnd.gmx":{"source":"iana","extensions":["gmx"]},"application/vnd.google-apps.document":{"compressible":false,"extensions":["gdoc"]},"application/vnd.google-apps.presentation":{"compressible":false,"extensions":["gslides"]},"application/vnd.google-apps.spreadsheet":{"compressible":false,"extensions":["gsheet"]},"application/vnd.google-earth.kml+xml":{"source":"iana","compressible":true,"extensions":["kml"]},"application/vnd.google-earth.kmz":{"source":"iana","compressible":false,"extensions":["kmz"]},"application/vnd.gov.sk.e-form+xml":{"source":"iana","compressible":true},"application/vnd.gov.sk.e-form+zip":{"source":"iana","compressible":false},"application/vnd.gov.sk.xmldatacontainer+xml":{"source":"iana","compressible":true},"application/vnd.grafeq":{"source":"iana","extensions":["gqf","gqs"]},"application/vnd.gridmp":{"source":"iana"},"application/vnd.groove-account":{"source":"iana","extensions":["gac"]},"application/vnd.groove-help":{"source":"iana","extensions":["ghf"]},"application/vnd.groove-identity-message":{"source":"iana","extensions":["gim"]},"application/vnd.groove-injector":{"source":"iana","extensions":["grv"]},"application/vnd.groove-tool-message":{"source":"iana","extensions":["gtm"]},"application/vnd.groove-tool-template":{"source":"iana","extensions":["tpl"]},"application/vnd.groove-vcard":{"source":"iana","extensions":["vcg"]},"application/vnd.hal+json":{"source":"iana","compressible":true},"application/vnd.hal+xml":{"source":"iana","compressible":true,"extensions":["hal"]},"application/vnd.handheld-entertainment+xml":{"source":"iana","compressible":true,"extensions":["zmm"]},"application/vnd.hbci":{"source":"iana","extensions":["hbci"]},"application/vnd.hc+json":{"source":"iana","compressible":true},"application/vnd.hcl-bireports":{"source":"iana"},"application/vnd.hdt":{"source":"iana"},"application/vnd.heroku+json":{"source":"iana","compressible":true},"application/vnd.hhe.lesson-player":{"source":"iana","extensions":["les"]},"application/vnd.hp-hpgl":{"source":"iana","extensions":["hpgl"]},"application/vnd.hp-hpid":{"source":"iana","extensions":["hpid"]},"application/vnd.hp-hps":{"source":"iana","extensions":["hps"]},"application/vnd.hp-jlyt":{"source":"iana","extensions":["jlt"]},"application/vnd.hp-pcl":{"source":"iana","extensions":["pcl"]},"application/vnd.hp-pclxl":{"source":"iana","extensions":["pclxl"]},"application/vnd.httphone":{"source":"iana"},"application/vnd.hydrostatix.sof-data":{"source":"iana","extensions":["sfd-hdstx"]},"application/vnd.hyper+json":{"source":"iana","compressible":true},"application/vnd.hyper-item+json":{"source":"iana","compressible":true},"application/vnd.hyperdrive+json":{"source":"iana","compressible":true},"application/vnd.hzn-3d-crossword":{"source":"iana"},"application/vnd.ibm.afplinedata":{"source":"iana"},"application/vnd.ibm.electronic-media":{"source":"iana"},"application/vnd.ibm.minipay":{"source":"iana","extensions":["mpy"]},"application/vnd.ibm.modcap":{"source":"iana","extensions":["afp","listafp","list3820"]},"application/vnd.ibm.rights-management":{"source":"iana","extensions":["irm"]},"application/vnd.ibm.secure-container":{"source":"iana","extensions":["sc"]},"application/vnd.iccprofile":{"source":"iana","extensions":["icc","icm"]},"application/vnd.ieee.1905":{"source":"iana"},"application/vnd.igloader":{"source":"iana","extensions":["igl"]},"application/vnd.imagemeter.folder+zip":{"source":"iana","compressible":false},"application/vnd.imagemeter.image+zip":{"source":"iana","compressible":false},"application/vnd.immervision-ivp":{"source":"iana","extensions":["ivp"]},"application/vnd.immervision-ivu":{"source":"iana","extensions":["ivu"]},"application/vnd.ims.imsccv1p1":{"source":"iana"},"application/vnd.ims.imsccv1p2":{"source":"iana"},"application/vnd.ims.imsccv1p3":{"source":"iana"},"application/vnd.ims.lis.v2.result+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolconsumerprofile+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolproxy+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolproxy.id+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolsettings+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolsettings.simple+json":{"source":"iana","compressible":true},"application/vnd.informedcontrol.rms+xml":{"source":"iana","compressible":true},"application/vnd.informix-visionary":{"source":"iana"},"application/vnd.infotech.project":{"source":"iana"},"application/vnd.infotech.project+xml":{"source":"iana","compressible":true},"application/vnd.innopath.wamp.notification":{"source":"iana"},"application/vnd.insors.igm":{"source":"iana","extensions":["igm"]},"application/vnd.intercon.formnet":{"source":"iana","extensions":["xpw","xpx"]},"application/vnd.intergeo":{"source":"iana","extensions":["i2g"]},"application/vnd.intertrust.digibox":{"source":"iana"},"application/vnd.intertrust.nncp":{"source":"iana"},"application/vnd.intu.qbo":{"source":"iana","extensions":["qbo"]},"application/vnd.intu.qfx":{"source":"iana","extensions":["qfx"]},"application/vnd.iptc.g2.catalogitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.conceptitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.knowledgeitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.newsitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.newsmessage+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.packageitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.planningitem+xml":{"source":"iana","compressible":true},"application/vnd.ipunplugged.rcprofile":{"source":"iana","extensions":["rcprofile"]},"application/vnd.irepository.package+xml":{"source":"iana","compressible":true,"extensions":["irp"]},"application/vnd.is-xpr":{"source":"iana","extensions":["xpr"]},"application/vnd.isac.fcs":{"source":"iana","extensions":["fcs"]},"application/vnd.iso11783-10+zip":{"source":"iana","compressible":false},"application/vnd.jam":{"source":"iana","extensions":["jam"]},"application/vnd.japannet-directory-service":{"source":"iana"},"application/vnd.japannet-jpnstore-wakeup":{"source":"iana"},"application/vnd.japannet-payment-wakeup":{"source":"iana"},"application/vnd.japannet-registration":{"source":"iana"},"application/vnd.japannet-registration-wakeup":{"source":"iana"},"application/vnd.japannet-setstore-wakeup":{"source":"iana"},"application/vnd.japannet-verification":{"source":"iana"},"application/vnd.japannet-verification-wakeup":{"source":"iana"},"application/vnd.jcp.javame.midlet-rms":{"source":"iana","extensions":["rms"]},"application/vnd.jisp":{"source":"iana","extensions":["jisp"]},"application/vnd.joost.joda-archive":{"source":"iana","extensions":["joda"]},"application/vnd.jsk.isdn-ngn":{"source":"iana"},"application/vnd.kahootz":{"source":"iana","extensions":["ktz","ktr"]},"application/vnd.kde.karbon":{"source":"iana","extensions":["karbon"]},"application/vnd.kde.kchart":{"source":"iana","extensions":["chrt"]},"application/vnd.kde.kformula":{"source":"iana","extensions":["kfo"]},"application/vnd.kde.kivio":{"source":"iana","extensions":["flw"]},"application/vnd.kde.kontour":{"source":"iana","extensions":["kon"]},"application/vnd.kde.kpresenter":{"source":"iana","extensions":["kpr","kpt"]},"application/vnd.kde.kspread":{"source":"iana","extensions":["ksp"]},"application/vnd.kde.kword":{"source":"iana","extensions":["kwd","kwt"]},"application/vnd.kenameaapp":{"source":"iana","extensions":["htke"]},"application/vnd.kidspiration":{"source":"iana","extensions":["kia"]},"application/vnd.kinar":{"source":"iana","extensions":["kne","knp"]},"application/vnd.koan":{"source":"iana","extensions":["skp","skd","skt","skm"]},"application/vnd.kodak-descriptor":{"source":"iana","extensions":["sse"]},"application/vnd.las":{"source":"iana"},"application/vnd.las.las+json":{"source":"iana","compressible":true},"application/vnd.las.las+xml":{"source":"iana","compressible":true,"extensions":["lasxml"]},"application/vnd.laszip":{"source":"iana"},"application/vnd.leap+json":{"source":"iana","compressible":true},"application/vnd.liberty-request+xml":{"source":"iana","compressible":true},"application/vnd.llamagraphics.life-balance.desktop":{"source":"iana","extensions":["lbd"]},"application/vnd.llamagraphics.life-balance.exchange+xml":{"source":"iana","compressible":true,"extensions":["lbe"]},"application/vnd.logipipe.circuit+zip":{"source":"iana","compressible":false},"application/vnd.loom":{"source":"iana"},"application/vnd.lotus-1-2-3":{"source":"iana","extensions":["123"]},"application/vnd.lotus-approach":{"source":"iana","extensions":["apr"]},"application/vnd.lotus-freelance":{"source":"iana","extensions":["pre"]},"application/vnd.lotus-notes":{"source":"iana","extensions":["nsf"]},"application/vnd.lotus-organizer":{"source":"iana","extensions":["org"]},"application/vnd.lotus-screencam":{"source":"iana","extensions":["scm"]},"application/vnd.lotus-wordpro":{"source":"iana","extensions":["lwp"]},"application/vnd.macports.portpkg":{"source":"iana","extensions":["portpkg"]},"application/vnd.mapbox-vector-tile":{"source":"iana"},"application/vnd.marlin.drm.actiontoken+xml":{"source":"iana","compressible":true},"application/vnd.marlin.drm.conftoken+xml":{"source":"iana","compressible":true},"application/vnd.marlin.drm.license+xml":{"source":"iana","compressible":true},"application/vnd.marlin.drm.mdcf":{"source":"iana"},"application/vnd.mason+json":{"source":"iana","compressible":true},"application/vnd.maxmind.maxmind-db":{"source":"iana"},"application/vnd.mcd":{"source":"iana","extensions":["mcd"]},"application/vnd.medcalcdata":{"source":"iana","extensions":["mc1"]},"application/vnd.mediastation.cdkey":{"source":"iana","extensions":["cdkey"]},"application/vnd.meridian-slingshot":{"source":"iana"},"application/vnd.mfer":{"source":"iana","extensions":["mwf"]},"application/vnd.mfmp":{"source":"iana","extensions":["mfm"]},"application/vnd.micro+json":{"source":"iana","compressible":true},"application/vnd.micrografx.flo":{"source":"iana","extensions":["flo"]},"application/vnd.micrografx.igx":{"source":"iana","extensions":["igx"]},"application/vnd.microsoft.portable-executable":{"source":"iana"},"application/vnd.microsoft.windows.thumbnail-cache":{"source":"iana"},"application/vnd.miele+json":{"source":"iana","compressible":true},"application/vnd.mif":{"source":"iana","extensions":["mif"]},"application/vnd.minisoft-hp3000-save":{"source":"iana"},"application/vnd.mitsubishi.misty-guard.trustweb":{"source":"iana"},"application/vnd.mobius.daf":{"source":"iana","extensions":["daf"]},"application/vnd.mobius.dis":{"source":"iana","extensions":["dis"]},"application/vnd.mobius.mbk":{"source":"iana","extensions":["mbk"]},"application/vnd.mobius.mqy":{"source":"iana","extensions":["mqy"]},"application/vnd.mobius.msl":{"source":"iana","extensions":["msl"]},"application/vnd.mobius.plc":{"source":"iana","extensions":["plc"]},"application/vnd.mobius.txf":{"source":"iana","extensions":["txf"]},"application/vnd.mophun.application":{"source":"iana","extensions":["mpn"]},"application/vnd.mophun.certificate":{"source":"iana","extensions":["mpc"]},"application/vnd.motorola.flexsuite":{"source":"iana"},"application/vnd.motorola.flexsuite.adsi":{"source":"iana"},"application/vnd.motorola.flexsuite.fis":{"source":"iana"},"application/vnd.motorola.flexsuite.gotap":{"source":"iana"},"application/vnd.motorola.flexsuite.kmr":{"source":"iana"},"application/vnd.motorola.flexsuite.ttc":{"source":"iana"},"application/vnd.motorola.flexsuite.wem":{"source":"iana"},"application/vnd.motorola.iprm":{"source":"iana"},"application/vnd.mozilla.xul+xml":{"source":"iana","compressible":true,"extensions":["xul"]},"application/vnd.ms-3mfdocument":{"source":"iana"},"application/vnd.ms-artgalry":{"source":"iana","extensions":["cil"]},"application/vnd.ms-asf":{"source":"iana"},"application/vnd.ms-cab-compressed":{"source":"iana","extensions":["cab"]},"application/vnd.ms-color.iccprofile":{"source":"apache"},"application/vnd.ms-excel":{"source":"iana","compressible":false,"extensions":["xls","xlm","xla","xlc","xlt","xlw"]},"application/vnd.ms-excel.addin.macroenabled.12":{"source":"iana","extensions":["xlam"]},"application/vnd.ms-excel.sheet.binary.macroenabled.12":{"source":"iana","extensions":["xlsb"]},"application/vnd.ms-excel.sheet.macroenabled.12":{"source":"iana","extensions":["xlsm"]},"application/vnd.ms-excel.template.macroenabled.12":{"source":"iana","extensions":["xltm"]},"application/vnd.ms-fontobject":{"source":"iana","compressible":true,"extensions":["eot"]},"application/vnd.ms-htmlhelp":{"source":"iana","extensions":["chm"]},"application/vnd.ms-ims":{"source":"iana","extensions":["ims"]},"application/vnd.ms-lrm":{"source":"iana","extensions":["lrm"]},"application/vnd.ms-office.activex+xml":{"source":"iana","compressible":true},"application/vnd.ms-officetheme":{"source":"iana","extensions":["thmx"]},"application/vnd.ms-opentype":{"source":"apache","compressible":true},"application/vnd.ms-outlook":{"compressible":false,"extensions":["msg"]},"application/vnd.ms-package.obfuscated-opentype":{"source":"apache"},"application/vnd.ms-pki.seccat":{"source":"apache","extensions":["cat"]},"application/vnd.ms-pki.stl":{"source":"apache","extensions":["stl"]},"application/vnd.ms-playready.initiator+xml":{"source":"iana","compressible":true},"application/vnd.ms-powerpoint":{"source":"iana","compressible":false,"extensions":["ppt","pps","pot"]},"application/vnd.ms-powerpoint.addin.macroenabled.12":{"source":"iana","extensions":["ppam"]},"application/vnd.ms-powerpoint.presentation.macroenabled.12":{"source":"iana","extensions":["pptm"]},"application/vnd.ms-powerpoint.slide.macroenabled.12":{"source":"iana","extensions":["sldm"]},"application/vnd.ms-powerpoint.slideshow.macroenabled.12":{"source":"iana","extensions":["ppsm"]},"application/vnd.ms-powerpoint.template.macroenabled.12":{"source":"iana","extensions":["potm"]},"application/vnd.ms-printdevicecapabilities+xml":{"source":"iana","compressible":true},"application/vnd.ms-printing.printticket+xml":{"source":"apache","compressible":true},"application/vnd.ms-printschematicket+xml":{"source":"iana","compressible":true},"application/vnd.ms-project":{"source":"iana","extensions":["mpp","mpt"]},"application/vnd.ms-tnef":{"source":"iana"},"application/vnd.ms-windows.devicepairing":{"source":"iana"},"application/vnd.ms-windows.nwprinting.oob":{"source":"iana"},"application/vnd.ms-windows.printerpairing":{"source":"iana"},"application/vnd.ms-windows.wsd.oob":{"source":"iana"},"application/vnd.ms-wmdrm.lic-chlg-req":{"source":"iana"},"application/vnd.ms-wmdrm.lic-resp":{"source":"iana"},"application/vnd.ms-wmdrm.meter-chlg-req":{"source":"iana"},"application/vnd.ms-wmdrm.meter-resp":{"source":"iana"},"application/vnd.ms-word.document.macroenabled.12":{"source":"iana","extensions":["docm"]},"application/vnd.ms-word.template.macroenabled.12":{"source":"iana","extensions":["dotm"]},"application/vnd.ms-works":{"source":"iana","extensions":["wps","wks","wcm","wdb"]},"application/vnd.ms-wpl":{"source":"iana","extensions":["wpl"]},"application/vnd.ms-xpsdocument":{"source":"iana","compressible":false,"extensions":["xps"]},"application/vnd.msa-disk-image":{"source":"iana"},"application/vnd.mseq":{"source":"iana","extensions":["mseq"]},"application/vnd.msign":{"source":"iana"},"application/vnd.multiad.creator":{"source":"iana"},"application/vnd.multiad.creator.cif":{"source":"iana"},"application/vnd.music-niff":{"source":"iana"},"application/vnd.musician":{"source":"iana","extensions":["mus"]},"application/vnd.muvee.style":{"source":"iana","extensions":["msty"]},"application/vnd.mynfc":{"source":"iana","extensions":["taglet"]},"application/vnd.ncd.control":{"source":"iana"},"application/vnd.ncd.reference":{"source":"iana"},"application/vnd.nearst.inv+json":{"source":"iana","compressible":true},"application/vnd.nervana":{"source":"iana"},"application/vnd.netfpx":{"source":"iana"},"application/vnd.neurolanguage.nlu":{"source":"iana","extensions":["nlu"]},"application/vnd.nimn":{"source":"iana"},"application/vnd.nintendo.nitro.rom":{"source":"iana"},"application/vnd.nintendo.snes.rom":{"source":"iana"},"application/vnd.nitf":{"source":"iana","extensions":["ntf","nitf"]},"application/vnd.noblenet-directory":{"source":"iana","extensions":["nnd"]},"application/vnd.noblenet-sealer":{"source":"iana","extensions":["nns"]},"application/vnd.noblenet-web":{"source":"iana","extensions":["nnw"]},"application/vnd.nokia.catalogs":{"source":"iana"},"application/vnd.nokia.conml+wbxml":{"source":"iana"},"application/vnd.nokia.conml+xml":{"source":"iana","compressible":true},"application/vnd.nokia.iptv.config+xml":{"source":"iana","compressible":true},"application/vnd.nokia.isds-radio-presets":{"source":"iana"},"application/vnd.nokia.landmark+wbxml":{"source":"iana"},"application/vnd.nokia.landmark+xml":{"source":"iana","compressible":true},"application/vnd.nokia.landmarkcollection+xml":{"source":"iana","compressible":true},"application/vnd.nokia.n-gage.ac+xml":{"source":"iana","compressible":true,"extensions":["ac"]},"application/vnd.nokia.n-gage.data":{"source":"iana","extensions":["ngdat"]},"application/vnd.nokia.n-gage.symbian.install":{"source":"iana","extensions":["n-gage"]},"application/vnd.nokia.ncd":{"source":"iana"},"application/vnd.nokia.pcd+wbxml":{"source":"iana"},"application/vnd.nokia.pcd+xml":{"source":"iana","compressible":true},"application/vnd.nokia.radio-preset":{"source":"iana","extensions":["rpst"]},"application/vnd.nokia.radio-presets":{"source":"iana","extensions":["rpss"]},"application/vnd.novadigm.edm":{"source":"iana","extensions":["edm"]},"application/vnd.novadigm.edx":{"source":"iana","extensions":["edx"]},"application/vnd.novadigm.ext":{"source":"iana","extensions":["ext"]},"application/vnd.ntt-local.content-share":{"source":"iana"},"application/vnd.ntt-local.file-transfer":{"source":"iana"},"application/vnd.ntt-local.ogw_remote-access":{"source":"iana"},"application/vnd.ntt-local.sip-ta_remote":{"source":"iana"},"application/vnd.ntt-local.sip-ta_tcp_stream":{"source":"iana"},"application/vnd.oasis.opendocument.chart":{"source":"iana","extensions":["odc"]},"application/vnd.oasis.opendocument.chart-template":{"source":"iana","extensions":["otc"]},"application/vnd.oasis.opendocument.database":{"source":"iana","extensions":["odb"]},"application/vnd.oasis.opendocument.formula":{"source":"iana","extensions":["odf"]},"application/vnd.oasis.opendocument.formula-template":{"source":"iana","extensions":["odft"]},"application/vnd.oasis.opendocument.graphics":{"source":"iana","compressible":false,"extensions":["odg"]},"application/vnd.oasis.opendocument.graphics-template":{"source":"iana","extensions":["otg"]},"application/vnd.oasis.opendocument.image":{"source":"iana","extensions":["odi"]},"application/vnd.oasis.opendocument.image-template":{"source":"iana","extensions":["oti"]},"application/vnd.oasis.opendocument.presentation":{"source":"iana","compressible":false,"extensions":["odp"]},"application/vnd.oasis.opendocument.presentation-template":{"source":"iana","extensions":["otp"]},"application/vnd.oasis.opendocument.spreadsheet":{"source":"iana","compressible":false,"extensions":["ods"]},"application/vnd.oasis.opendocument.spreadsheet-template":{"source":"iana","extensions":["ots"]},"application/vnd.oasis.opendocument.text":{"source":"iana","compressible":false,"extensions":["odt"]},"application/vnd.oasis.opendocument.text-master":{"source":"iana","extensions":["odm"]},"application/vnd.oasis.opendocument.text-template":{"source":"iana","extensions":["ott"]},"application/vnd.oasis.opendocument.text-web":{"source":"iana","extensions":["oth"]},"application/vnd.obn":{"source":"iana"},"application/vnd.ocf+cbor":{"source":"iana"},"application/vnd.oftn.l10n+json":{"source":"iana","compressible":true},"application/vnd.oipf.contentaccessdownload+xml":{"source":"iana","compressible":true},"application/vnd.oipf.contentaccessstreaming+xml":{"source":"iana","compressible":true},"application/vnd.oipf.cspg-hexbinary":{"source":"iana"},"application/vnd.oipf.dae.svg+xml":{"source":"iana","compressible":true},"application/vnd.oipf.dae.xhtml+xml":{"source":"iana","compressible":true},"application/vnd.oipf.mippvcontrolmessage+xml":{"source":"iana","compressible":true},"application/vnd.oipf.pae.gem":{"source":"iana"},"application/vnd.oipf.spdiscovery+xml":{"source":"iana","compressible":true},"application/vnd.oipf.spdlist+xml":{"source":"iana","compressible":true},"application/vnd.oipf.ueprofile+xml":{"source":"iana","compressible":true},"application/vnd.oipf.userprofile+xml":{"source":"iana","compressible":true},"application/vnd.olpc-sugar":{"source":"iana","extensions":["xo"]},"application/vnd.oma-scws-config":{"source":"iana"},"application/vnd.oma-scws-http-request":{"source":"iana"},"application/vnd.oma-scws-http-response":{"source":"iana"},"application/vnd.oma.bcast.associated-procedure-parameter+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.drm-trigger+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.imd+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.ltkm":{"source":"iana"},"application/vnd.oma.bcast.notification+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.provisioningtrigger":{"source":"iana"},"application/vnd.oma.bcast.sgboot":{"source":"iana"},"application/vnd.oma.bcast.sgdd+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.sgdu":{"source":"iana"},"application/vnd.oma.bcast.simple-symbol-container":{"source":"iana"},"application/vnd.oma.bcast.smartcard-trigger+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.sprov+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.stkm":{"source":"iana"},"application/vnd.oma.cab-address-book+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-feature-handler+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-pcc+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-subs-invite+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-user-prefs+xml":{"source":"iana","compressible":true},"application/vnd.oma.dcd":{"source":"iana"},"application/vnd.oma.dcdc":{"source":"iana"},"application/vnd.oma.dd2+xml":{"source":"iana","compressible":true,"extensions":["dd2"]},"application/vnd.oma.drm.risd+xml":{"source":"iana","compressible":true},"application/vnd.oma.group-usage-list+xml":{"source":"iana","compressible":true},"application/vnd.oma.lwm2m+json":{"source":"iana","compressible":true},"application/vnd.oma.lwm2m+tlv":{"source":"iana"},"application/vnd.oma.pal+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.detailed-progress-report+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.final-report+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.groups+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.invocation-descriptor+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.optimized-progress-report+xml":{"source":"iana","compressible":true},"application/vnd.oma.push":{"source":"iana"},"application/vnd.oma.scidm.messages+xml":{"source":"iana","compressible":true},"application/vnd.oma.xcap-directory+xml":{"source":"iana","compressible":true},"application/vnd.omads-email+xml":{"source":"iana","compressible":true},"application/vnd.omads-file+xml":{"source":"iana","compressible":true},"application/vnd.omads-folder+xml":{"source":"iana","compressible":true},"application/vnd.omaloc-supl-init":{"source":"iana"},"application/vnd.onepager":{"source":"iana"},"application/vnd.onepagertamp":{"source":"iana"},"application/vnd.onepagertamx":{"source":"iana"},"application/vnd.onepagertat":{"source":"iana"},"application/vnd.onepagertatp":{"source":"iana"},"application/vnd.onepagertatx":{"source":"iana"},"application/vnd.openblox.game+xml":{"source":"iana","compressible":true,"extensions":["obgx"]},"application/vnd.openblox.game-binary":{"source":"iana"},"application/vnd.openeye.oeb":{"source":"iana"},"application/vnd.openofficeorg.extension":{"source":"apache","extensions":["oxt"]},"application/vnd.openstreetmap.data+xml":{"source":"iana","compressible":true,"extensions":["osm"]},"application/vnd.openxmlformats-officedocument.custom-properties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.customxmlproperties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawing+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.chart+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.chartshapes+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramcolors+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramdata+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramlayout+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramstyle+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.extended-properties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.commentauthors+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.comments+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.handoutmaster+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.notesmaster+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.notesslide+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.presentation":{"source":"iana","compressible":false,"extensions":["pptx"]},"application/vnd.openxmlformats-officedocument.presentationml.presentation.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.presprops+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slide":{"source":"iana","extensions":["sldx"]},"application/vnd.openxmlformats-officedocument.presentationml.slide+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slidelayout+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slidemaster+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slideshow":{"source":"iana","extensions":["ppsx"]},"application/vnd.openxmlformats-officedocument.presentationml.slideshow.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slideupdateinfo+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.tablestyles+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.tags+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.template":{"source":"iana","extensions":["potx"]},"application/vnd.openxmlformats-officedocument.presentationml.template.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.viewprops+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.calcchain+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.comments+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.connections+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.dialogsheet+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.externallink+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcachedefinition+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcacherecords+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.pivottable+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.querytable+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.revisionheaders+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.revisionlog+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.sharedstrings+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.sheet":{"source":"iana","compressible":false,"extensions":["xlsx"]},"application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.sheetmetadata+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.table+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.tablesinglecells+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.template":{"source":"iana","extensions":["xltx"]},"application/vnd.openxmlformats-officedocument.spreadsheetml.template.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.usernames+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.volatiledependencies+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.theme+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.themeoverride+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.vmldrawing":{"source":"iana"},"application/vnd.openxmlformats-officedocument.wordprocessingml.comments+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.document":{"source":"iana","compressible":false,"extensions":["docx"]},"application/vnd.openxmlformats-officedocument.wordprocessingml.document.glossary+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.document.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.endnotes+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.fonttable+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.footer+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.footnotes+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.numbering+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.settings+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.styles+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.template":{"source":"iana","extensions":["dotx"]},"application/vnd.openxmlformats-officedocument.wordprocessingml.template.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.websettings+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-package.core-properties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-package.digital-signature-xmlsignature+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-package.relationships+xml":{"source":"iana","compressible":true},"application/vnd.oracle.resource+json":{"source":"iana","compressible":true},"application/vnd.orange.indata":{"source":"iana"},"application/vnd.osa.netdeploy":{"source":"iana"},"application/vnd.osgeo.mapguide.package":{"source":"iana","extensions":["mgp"]},"application/vnd.osgi.bundle":{"source":"iana"},"application/vnd.osgi.dp":{"source":"iana","extensions":["dp"]},"application/vnd.osgi.subsystem":{"source":"iana","extensions":["esa"]},"application/vnd.otps.ct-kip+xml":{"source":"iana","compressible":true},"application/vnd.oxli.countgraph":{"source":"iana"},"application/vnd.pagerduty+json":{"source":"iana","compressible":true},"application/vnd.palm":{"source":"iana","extensions":["pdb","pqa","oprc"]},"application/vnd.panoply":{"source":"iana"},"application/vnd.paos.xml":{"source":"iana"},"application/vnd.patentdive":{"source":"iana"},"application/vnd.patientecommsdoc":{"source":"iana"},"application/vnd.pawaafile":{"source":"iana","extensions":["paw"]},"application/vnd.pcos":{"source":"iana"},"application/vnd.pg.format":{"source":"iana","extensions":["str"]},"application/vnd.pg.osasli":{"source":"iana","extensions":["ei6"]},"application/vnd.piaccess.application-licence":{"source":"iana"},"application/vnd.picsel":{"source":"iana","extensions":["efif"]},"application/vnd.pmi.widget":{"source":"iana","extensions":["wg"]},"application/vnd.poc.group-advertisement+xml":{"source":"iana","compressible":true},"application/vnd.pocketlearn":{"source":"iana","extensions":["plf"]},"application/vnd.powerbuilder6":{"source":"iana","extensions":["pbd"]},"application/vnd.powerbuilder6-s":{"source":"iana"},"application/vnd.powerbuilder7":{"source":"iana"},"application/vnd.powerbuilder7-s":{"source":"iana"},"application/vnd.powerbuilder75":{"source":"iana"},"application/vnd.powerbuilder75-s":{"source":"iana"},"application/vnd.preminet":{"source":"iana"},"application/vnd.previewsystems.box":{"source":"iana","extensions":["box"]},"application/vnd.proteus.magazine":{"source":"iana","extensions":["mgz"]},"application/vnd.psfs":{"source":"iana"},"application/vnd.publishare-delta-tree":{"source":"iana","extensions":["qps"]},"application/vnd.pvi.ptid1":{"source":"iana","extensions":["ptid"]},"application/vnd.pwg-multiplexed":{"source":"iana"},"application/vnd.pwg-xhtml-print+xml":{"source":"iana","compressible":true},"application/vnd.qualcomm.brew-app-res":{"source":"iana"},"application/vnd.quarantainenet":{"source":"iana"},"application/vnd.quark.quarkxpress":{"source":"iana","extensions":["qxd","qxt","qwd","qwt","qxl","qxb"]},"application/vnd.quobject-quoxdocument":{"source":"iana"},"application/vnd.radisys.moml+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-conf+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-conn+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-dialog+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-stream+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-conf+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-base+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-fax-detect+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-fax-sendrecv+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-group+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-speech+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-transform+xml":{"source":"iana","compressible":true},"application/vnd.rainstor.data":{"source":"iana"},"application/vnd.rapid":{"source":"iana"},"application/vnd.rar":{"source":"iana"},"application/vnd.realvnc.bed":{"source":"iana","extensions":["bed"]},"application/vnd.recordare.musicxml":{"source":"iana","extensions":["mxl"]},"application/vnd.recordare.musicxml+xml":{"source":"iana","compressible":true,"extensions":["musicxml"]},"application/vnd.renlearn.rlprint":{"source":"iana"},"application/vnd.restful+json":{"source":"iana","compressible":true},"application/vnd.rig.cryptonote":{"source":"iana","extensions":["cryptonote"]},"application/vnd.rim.cod":{"source":"apache","extensions":["cod"]},"application/vnd.rn-realmedia":{"source":"apache","extensions":["rm"]},"application/vnd.rn-realmedia-vbr":{"source":"apache","extensions":["rmvb"]},"application/vnd.route66.link66+xml":{"source":"iana","compressible":true,"extensions":["link66"]},"application/vnd.rs-274x":{"source":"iana"},"application/vnd.ruckus.download":{"source":"iana"},"application/vnd.s3sms":{"source":"iana"},"application/vnd.sailingtracker.track":{"source":"iana","extensions":["st"]},"application/vnd.sbm.cid":{"source":"iana"},"application/vnd.sbm.mid2":{"source":"iana"},"application/vnd.scribus":{"source":"iana"},"application/vnd.sealed.3df":{"source":"iana"},"application/vnd.sealed.csf":{"source":"iana"},"application/vnd.sealed.doc":{"source":"iana"},"application/vnd.sealed.eml":{"source":"iana"},"application/vnd.sealed.mht":{"source":"iana"},"application/vnd.sealed.net":{"source":"iana"},"application/vnd.sealed.ppt":{"source":"iana"},"application/vnd.sealed.tiff":{"source":"iana"},"application/vnd.sealed.xls":{"source":"iana"},"application/vnd.sealedmedia.softseal.html":{"source":"iana"},"application/vnd.sealedmedia.softseal.pdf":{"source":"iana"},"application/vnd.seemail":{"source":"iana","extensions":["see"]},"application/vnd.sema":{"source":"iana","extensions":["sema"]},"application/vnd.semd":{"source":"iana","extensions":["semd"]},"application/vnd.semf":{"source":"iana","extensions":["semf"]},"application/vnd.shade-save-file":{"source":"iana"},"application/vnd.shana.informed.formdata":{"source":"iana","extensions":["ifm"]},"application/vnd.shana.informed.formtemplate":{"source":"iana","extensions":["itp"]},"application/vnd.shana.informed.interchange":{"source":"iana","extensions":["iif"]},"application/vnd.shana.informed.package":{"source":"iana","extensions":["ipk"]},"application/vnd.shootproof+json":{"source":"iana","compressible":true},"application/vnd.shopkick+json":{"source":"iana","compressible":true},"application/vnd.sigrok.session":{"source":"iana"},"application/vnd.simtech-mindmapper":{"source":"iana","extensions":["twd","twds"]},"application/vnd.siren+json":{"source":"iana","compressible":true},"application/vnd.smaf":{"source":"iana","extensions":["mmf"]},"application/vnd.smart.notebook":{"source":"iana"},"application/vnd.smart.teacher":{"source":"iana","extensions":["teacher"]},"application/vnd.software602.filler.form+xml":{"source":"iana","compressible":true,"extensions":["fo"]},"application/vnd.software602.filler.form-xml-zip":{"source":"iana"},"application/vnd.solent.sdkm+xml":{"source":"iana","compressible":true,"extensions":["sdkm","sdkd"]},"application/vnd.spotfire.dxp":{"source":"iana","extensions":["dxp"]},"application/vnd.spotfire.sfs":{"source":"iana","extensions":["sfs"]},"application/vnd.sqlite3":{"source":"iana"},"application/vnd.sss-cod":{"source":"iana"},"application/vnd.sss-dtf":{"source":"iana"},"application/vnd.sss-ntf":{"source":"iana"},"application/vnd.stardivision.calc":{"source":"apache","extensions":["sdc"]},"application/vnd.stardivision.draw":{"source":"apache","extensions":["sda"]},"application/vnd.stardivision.impress":{"source":"apache","extensions":["sdd"]},"application/vnd.stardivision.math":{"source":"apache","extensions":["smf"]},"application/vnd.stardivision.writer":{"source":"apache","extensions":["sdw","vor"]},"application/vnd.stardivision.writer-global":{"source":"apache","extensions":["sgl"]},"application/vnd.stepmania.package":{"source":"iana","extensions":["smzip"]},"application/vnd.stepmania.stepchart":{"source":"iana","extensions":["sm"]},"application/vnd.street-stream":{"source":"iana"},"application/vnd.sun.wadl+xml":{"source":"iana","compressible":true,"extensions":["wadl"]},"application/vnd.sun.xml.calc":{"source":"apache","extensions":["sxc"]},"application/vnd.sun.xml.calc.template":{"source":"apache","extensions":["stc"]},"application/vnd.sun.xml.draw":{"source":"apache","extensions":["sxd"]},"application/vnd.sun.xml.draw.template":{"source":"apache","extensions":["std"]},"application/vnd.sun.xml.impress":{"source":"apache","extensions":["sxi"]},"application/vnd.sun.xml.impress.template":{"source":"apache","extensions":["sti"]},"application/vnd.sun.xml.math":{"source":"apache","extensions":["sxm"]},"application/vnd.sun.xml.writer":{"source":"apache","extensions":["sxw"]},"application/vnd.sun.xml.writer.global":{"source":"apache","extensions":["sxg"]},"application/vnd.sun.xml.writer.template":{"source":"apache","extensions":["stw"]},"application/vnd.sus-calendar":{"source":"iana","extensions":["sus","susp"]},"application/vnd.svd":{"source":"iana","extensions":["svd"]},"application/vnd.swiftview-ics":{"source":"iana"},"application/vnd.symbian.install":{"source":"apache","extensions":["sis","sisx"]},"application/vnd.syncml+xml":{"source":"iana","compressible":true,"extensions":["xsm"]},"application/vnd.syncml.dm+wbxml":{"source":"iana","extensions":["bdm"]},"application/vnd.syncml.dm+xml":{"source":"iana","compressible":true,"extensions":["xdm"]},"application/vnd.syncml.dm.notification":{"source":"iana"},"application/vnd.syncml.dmddf+wbxml":{"source":"iana"},"application/vnd.syncml.dmddf+xml":{"source":"iana","compressible":true,"extensions":["ddf"]},"application/vnd.syncml.dmtnds+wbxml":{"source":"iana"},"application/vnd.syncml.dmtnds+xml":{"source":"iana","compressible":true},"application/vnd.syncml.ds.notification":{"source":"iana"},"application/vnd.tableschema+json":{"source":"iana","compressible":true},"application/vnd.tao.intent-module-archive":{"source":"iana","extensions":["tao"]},"application/vnd.tcpdump.pcap":{"source":"iana","extensions":["pcap","cap","dmp"]},"application/vnd.think-cell.ppttc+json":{"source":"iana","compressible":true},"application/vnd.tmd.mediaflex.api+xml":{"source":"iana","compressible":true},"application/vnd.tml":{"source":"iana"},"application/vnd.tmobile-livetv":{"source":"iana","extensions":["tmo"]},"application/vnd.tri.onesource":{"source":"iana"},"application/vnd.trid.tpt":{"source":"iana","extensions":["tpt"]},"application/vnd.triscape.mxs":{"source":"iana","extensions":["mxs"]},"application/vnd.trueapp":{"source":"iana","extensions":["tra"]},"application/vnd.truedoc":{"source":"iana"},"application/vnd.ubisoft.webplayer":{"source":"iana"},"application/vnd.ufdl":{"source":"iana","extensions":["ufd","ufdl"]},"application/vnd.uiq.theme":{"source":"iana","extensions":["utz"]},"application/vnd.umajin":{"source":"iana","extensions":["umj"]},"application/vnd.unity":{"source":"iana","extensions":["unityweb"]},"application/vnd.uoml+xml":{"source":"iana","compressible":true,"extensions":["uoml"]},"application/vnd.uplanet.alert":{"source":"iana"},"application/vnd.uplanet.alert-wbxml":{"source":"iana"},"application/vnd.uplanet.bearer-choice":{"source":"iana"},"application/vnd.uplanet.bearer-choice-wbxml":{"source":"iana"},"application/vnd.uplanet.cacheop":{"source":"iana"},"application/vnd.uplanet.cacheop-wbxml":{"source":"iana"},"application/vnd.uplanet.channel":{"source":"iana"},"application/vnd.uplanet.channel-wbxml":{"source":"iana"},"application/vnd.uplanet.list":{"source":"iana"},"application/vnd.uplanet.list-wbxml":{"source":"iana"},"application/vnd.uplanet.listcmd":{"source":"iana"},"application/vnd.uplanet.listcmd-wbxml":{"source":"iana"},"application/vnd.uplanet.signal":{"source":"iana"},"application/vnd.uri-map":{"source":"iana"},"application/vnd.valve.source.material":{"source":"iana"},"application/vnd.vcx":{"source":"iana","extensions":["vcx"]},"application/vnd.vd-study":{"source":"iana"},"application/vnd.vectorworks":{"source":"iana"},"application/vnd.vel+json":{"source":"iana","compressible":true},"application/vnd.verimatrix.vcas":{"source":"iana"},"application/vnd.veryant.thin":{"source":"iana"},"application/vnd.ves.encrypted":{"source":"iana"},"application/vnd.vidsoft.vidconference":{"source":"iana"},"application/vnd.visio":{"source":"iana","extensions":["vsd","vst","vss","vsw"]},"application/vnd.visionary":{"source":"iana","extensions":["vis"]},"application/vnd.vividence.scriptfile":{"source":"iana"},"application/vnd.vsf":{"source":"iana","extensions":["vsf"]},"application/vnd.wap.sic":{"source":"iana"},"application/vnd.wap.slc":{"source":"iana"},"application/vnd.wap.wbxml":{"source":"iana","extensions":["wbxml"]},"application/vnd.wap.wmlc":{"source":"iana","extensions":["wmlc"]},"application/vnd.wap.wmlscriptc":{"source":"iana","extensions":["wmlsc"]},"application/vnd.webturbo":{"source":"iana","extensions":["wtb"]},"application/vnd.wfa.p2p":{"source":"iana"},"application/vnd.wfa.wsc":{"source":"iana"},"application/vnd.windows.devicepairing":{"source":"iana"},"application/vnd.wmc":{"source":"iana"},"application/vnd.wmf.bootstrap":{"source":"iana"},"application/vnd.wolfram.mathematica":{"source":"iana"},"application/vnd.wolfram.mathematica.package":{"source":"iana"},"application/vnd.wolfram.player":{"source":"iana","extensions":["nbp"]},"application/vnd.wordperfect":{"source":"iana","extensions":["wpd"]},"application/vnd.wqd":{"source":"iana","extensions":["wqd"]},"application/vnd.wrq-hp3000-labelled":{"source":"iana"},"application/vnd.wt.stf":{"source":"iana","extensions":["stf"]},"application/vnd.wv.csp+wbxml":{"source":"iana"},"application/vnd.wv.csp+xml":{"source":"iana","compressible":true},"application/vnd.wv.ssp+xml":{"source":"iana","compressible":true},"application/vnd.xacml+json":{"source":"iana","compressible":true},"application/vnd.xara":{"source":"iana","extensions":["xar"]},"application/vnd.xfdl":{"source":"iana","extensions":["xfdl"]},"application/vnd.xfdl.webform":{"source":"iana"},"application/vnd.xmi+xml":{"source":"iana","compressible":true},"application/vnd.xmpie.cpkg":{"source":"iana"},"application/vnd.xmpie.dpkg":{"source":"iana"},"application/vnd.xmpie.plan":{"source":"iana"},"application/vnd.xmpie.ppkg":{"source":"iana"},"application/vnd.xmpie.xlim":{"source":"iana"},"application/vnd.yamaha.hv-dic":{"source":"iana","extensions":["hvd"]},"application/vnd.yamaha.hv-script":{"source":"iana","extensions":["hvs"]},"application/vnd.yamaha.hv-voice":{"source":"iana","extensions":["hvp"]},"application/vnd.yamaha.openscoreformat":{"source":"iana","extensions":["osf"]},"application/vnd.yamaha.openscoreformat.osfpvg+xml":{"source":"iana","compressible":true,"extensions":["osfpvg"]},"application/vnd.yamaha.remote-setup":{"source":"iana"},"application/vnd.yamaha.smaf-audio":{"source":"iana","extensions":["saf"]},"application/vnd.yamaha.smaf-phrase":{"source":"iana","extensions":["spf"]},"application/vnd.yamaha.through-ngn":{"source":"iana"},"application/vnd.yamaha.tunnel-udpencap":{"source":"iana"},"application/vnd.yaoweme":{"source":"iana"},"application/vnd.yellowriver-custom-menu":{"source":"iana","extensions":["cmp"]},"application/vnd.youtube.yt":{"source":"iana"},"application/vnd.zul":{"source":"iana","extensions":["zir","zirz"]},"application/vnd.zzazz.deck+xml":{"source":"iana","compressible":true,"extensions":["zaz"]},"application/voicexml+xml":{"source":"iana","compressible":true,"extensions":["vxml"]},"application/voucher-cms+json":{"source":"iana","compressible":true},"application/vq-rtcpxr":{"source":"iana"},"application/wasm":{"compressible":true,"extensions":["wasm"]},"application/watcherinfo+xml":{"source":"iana","compressible":true},"application/webpush-options+json":{"source":"iana","compressible":true},"application/whoispp-query":{"source":"iana"},"application/whoispp-response":{"source":"iana"},"application/widget":{"source":"iana","extensions":["wgt"]},"application/winhlp":{"source":"apache","extensions":["hlp"]},"application/wita":{"source":"iana"},"application/wordperfect5.1":{"source":"iana"},"application/wsdl+xml":{"source":"iana","compressible":true,"extensions":["wsdl"]},"application/wspolicy+xml":{"source":"iana","compressible":true,"extensions":["wspolicy"]},"application/x-7z-compressed":{"source":"apache","compressible":false,"extensions":["7z"]},"application/x-abiword":{"source":"apache","extensions":["abw"]},"application/x-ace-compressed":{"source":"apache","extensions":["ace"]},"application/x-amf":{"source":"apache"},"application/x-apple-diskimage":{"source":"apache","extensions":["dmg"]},"application/x-arj":{"compressible":false,"extensions":["arj"]},"application/x-authorware-bin":{"source":"apache","extensions":["aab","x32","u32","vox"]},"application/x-authorware-map":{"source":"apache","extensions":["aam"]},"application/x-authorware-seg":{"source":"apache","extensions":["aas"]},"application/x-bcpio":{"source":"apache","extensions":["bcpio"]},"application/x-bdoc":{"compressible":false,"extensions":["bdoc"]},"application/x-bittorrent":{"source":"apache","extensions":["torrent"]},"application/x-blorb":{"source":"apache","extensions":["blb","blorb"]},"application/x-bzip":{"source":"apache","compressible":false,"extensions":["bz"]},"application/x-bzip2":{"source":"apache","compressible":false,"extensions":["bz2","boz"]},"application/x-cbr":{"source":"apache","extensions":["cbr","cba","cbt","cbz","cb7"]},"application/x-cdlink":{"source":"apache","extensions":["vcd"]},"application/x-cfs-compressed":{"source":"apache","extensions":["cfs"]},"application/x-chat":{"source":"apache","extensions":["chat"]},"application/x-chess-pgn":{"source":"apache","extensions":["pgn"]},"application/x-chrome-extension":{"extensions":["crx"]},"application/x-cocoa":{"source":"nginx","extensions":["cco"]},"application/x-compress":{"source":"apache"},"application/x-conference":{"source":"apache","extensions":["nsc"]},"application/x-cpio":{"source":"apache","extensions":["cpio"]},"application/x-csh":{"source":"apache","extensions":["csh"]},"application/x-deb":{"compressible":false},"application/x-debian-package":{"source":"apache","extensions":["deb","udeb"]},"application/x-dgc-compressed":{"source":"apache","extensions":["dgc"]},"application/x-director":{"source":"apache","extensions":["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"]},"application/x-doom":{"source":"apache","extensions":["wad"]},"application/x-dtbncx+xml":{"source":"apache","compressible":true,"extensions":["ncx"]},"application/x-dtbook+xml":{"source":"apache","compressible":true,"extensions":["dtb"]},"application/x-dtbresource+xml":{"source":"apache","compressible":true,"extensions":["res"]},"application/x-dvi":{"source":"apache","compressible":false,"extensions":["dvi"]},"application/x-envoy":{"source":"apache","extensions":["evy"]},"application/x-eva":{"source":"apache","extensions":["eva"]},"application/x-font-bdf":{"source":"apache","extensions":["bdf"]},"application/x-font-dos":{"source":"apache"},"application/x-font-framemaker":{"source":"apache"},"application/x-font-ghostscript":{"source":"apache","extensions":["gsf"]},"application/x-font-libgrx":{"source":"apache"},"application/x-font-linux-psf":{"source":"apache","extensions":["psf"]},"application/x-font-pcf":{"source":"apache","extensions":["pcf"]},"application/x-font-snf":{"source":"apache","extensions":["snf"]},"application/x-font-speedo":{"source":"apache"},"application/x-font-sunos-news":{"source":"apache"},"application/x-font-type1":{"source":"apache","extensions":["pfa","pfb","pfm","afm"]},"application/x-font-vfont":{"source":"apache"},"application/x-freearc":{"source":"apache","extensions":["arc"]},"application/x-futuresplash":{"source":"apache","extensions":["spl"]},"application/x-gca-compressed":{"source":"apache","extensions":["gca"]},"application/x-glulx":{"source":"apache","extensions":["ulx"]},"application/x-gnumeric":{"source":"apache","extensions":["gnumeric"]},"application/x-gramps-xml":{"source":"apache","extensions":["gramps"]},"application/x-gtar":{"source":"apache","extensions":["gtar"]},"application/x-gzip":{"source":"apache"},"application/x-hdf":{"source":"apache","extensions":["hdf"]},"application/x-httpd-php":{"compressible":true,"extensions":["php"]},"application/x-install-instructions":{"source":"apache","extensions":["install"]},"application/x-iso9660-image":{"source":"apache","extensions":["iso"]},"application/x-java-archive-diff":{"source":"nginx","extensions":["jardiff"]},"application/x-java-jnlp-file":{"source":"apache","compressible":false,"extensions":["jnlp"]},"application/x-javascript":{"compressible":true},"application/x-keepass2":{"extensions":["kdbx"]},"application/x-latex":{"source":"apache","compressible":false,"extensions":["latex"]},"application/x-lua-bytecode":{"extensions":["luac"]},"application/x-lzh-compressed":{"source":"apache","extensions":["lzh","lha"]},"application/x-makeself":{"source":"nginx","extensions":["run"]},"application/x-mie":{"source":"apache","extensions":["mie"]},"application/x-mobipocket-ebook":{"source":"apache","extensions":["prc","mobi"]},"application/x-mpegurl":{"compressible":false},"application/x-ms-application":{"source":"apache","extensions":["application"]},"application/x-ms-shortcut":{"source":"apache","extensions":["lnk"]},"application/x-ms-wmd":{"source":"apache","extensions":["wmd"]},"application/x-ms-wmz":{"source":"apache","extensions":["wmz"]},"application/x-ms-xbap":{"source":"apache","extensions":["xbap"]},"application/x-msaccess":{"source":"apache","extensions":["mdb"]},"application/x-msbinder":{"source":"apache","extensions":["obd"]},"application/x-mscardfile":{"source":"apache","extensions":["crd"]},"application/x-msclip":{"source":"apache","extensions":["clp"]},"application/x-msdos-program":{"extensions":["exe"]},"application/x-msdownload":{"source":"apache","extensions":["exe","dll","com","bat","msi"]},"application/x-msmediaview":{"source":"apache","extensions":["mvb","m13","m14"]},"application/x-msmetafile":{"source":"apache","extensions":["wmf","wmz","emf","emz"]},"application/x-msmoney":{"source":"apache","extensions":["mny"]},"application/x-mspublisher":{"source":"apache","extensions":["pub"]},"application/x-msschedule":{"source":"apache","extensions":["scd"]},"application/x-msterminal":{"source":"apache","extensions":["trm"]},"application/x-mswrite":{"source":"apache","extensions":["wri"]},"application/x-netcdf":{"source":"apache","extensions":["nc","cdf"]},"application/x-ns-proxy-autoconfig":{"compressible":true,"extensions":["pac"]},"application/x-nzb":{"source":"apache","extensions":["nzb"]},"application/x-perl":{"source":"nginx","extensions":["pl","pm"]},"application/x-pilot":{"source":"nginx","extensions":["prc","pdb"]},"application/x-pkcs12":{"source":"apache","compressible":false,"extensions":["p12","pfx"]},"application/x-pkcs7-certificates":{"source":"apache","extensions":["p7b","spc"]},"application/x-pkcs7-certreqresp":{"source":"apache","extensions":["p7r"]},"application/x-rar-compressed":{"source":"apache","compressible":false,"extensions":["rar"]},"application/x-redhat-package-manager":{"source":"nginx","extensions":["rpm"]},"application/x-research-info-systems":{"source":"apache","extensions":["ris"]},"application/x-sea":{"source":"nginx","extensions":["sea"]},"application/x-sh":{"source":"apache","compressible":true,"extensions":["sh"]},"application/x-shar":{"source":"apache","extensions":["shar"]},"application/x-shockwave-flash":{"source":"apache","compressible":false,"extensions":["swf"]},"application/x-silverlight-app":{"source":"apache","extensions":["xap"]},"application/x-sql":{"source":"apache","extensions":["sql"]},"application/x-stuffit":{"source":"apache","compressible":false,"extensions":["sit"]},"application/x-stuffitx":{"source":"apache","extensions":["sitx"]},"application/x-subrip":{"source":"apache","extensions":["srt"]},"application/x-sv4cpio":{"source":"apache","extensions":["sv4cpio"]},"application/x-sv4crc":{"source":"apache","extensions":["sv4crc"]},"application/x-t3vm-image":{"source":"apache","extensions":["t3"]},"application/x-tads":{"source":"apache","extensions":["gam"]},"application/x-tar":{"source":"apache","compressible":true,"extensions":["tar"]},"application/x-tcl":{"source":"apache","extensions":["tcl","tk"]},"application/x-tex":{"source":"apache","extensions":["tex"]},"application/x-tex-tfm":{"source":"apache","extensions":["tfm"]},"application/x-texinfo":{"source":"apache","extensions":["texinfo","texi"]},"application/x-tgif":{"source":"apache","extensions":["obj"]},"application/x-ustar":{"source":"apache","extensions":["ustar"]},"application/x-virtualbox-hdd":{"compressible":true,"extensions":["hdd"]},"application/x-virtualbox-ova":{"compressible":true,"extensions":["ova"]},"application/x-virtualbox-ovf":{"compressible":true,"extensions":["ovf"]},"application/x-virtualbox-vbox":{"compressible":true,"extensions":["vbox"]},"application/x-virtualbox-vbox-extpack":{"compressible":false,"extensions":["vbox-extpack"]},"application/x-virtualbox-vdi":{"compressible":true,"extensions":["vdi"]},"application/x-virtualbox-vhd":{"compressible":true,"extensions":["vhd"]},"application/x-virtualbox-vmdk":{"compressible":true,"extensions":["vmdk"]},"application/x-wais-source":{"source":"apache","extensions":["src"]},"application/x-web-app-manifest+json":{"compressible":true,"extensions":["webapp"]},"application/x-www-form-urlencoded":{"source":"iana","compressible":true},"application/x-x509-ca-cert":{"source":"apache","extensions":["der","crt","pem"]},"application/x-xfig":{"source":"apache","extensions":["fig"]},"application/x-xliff+xml":{"source":"apache","compressible":true,"extensions":["xlf"]},"application/x-xpinstall":{"source":"apache","compressible":false,"extensions":["xpi"]},"application/x-xz":{"source":"apache","extensions":["xz"]},"application/x-zmachine":{"source":"apache","extensions":["z1","z2","z3","z4","z5","z6","z7","z8"]},"application/x400-bp":{"source":"iana"},"application/xacml+xml":{"source":"iana","compressible":true},"application/xaml+xml":{"source":"apache","compressible":true,"extensions":["xaml"]},"application/xcap-att+xml":{"source":"iana","compressible":true,"extensions":["xav"]},"application/xcap-caps+xml":{"source":"iana","compressible":true,"extensions":["xca"]},"application/xcap-diff+xml":{"source":"iana","compressible":true,"extensions":["xdf"]},"application/xcap-el+xml":{"source":"iana","compressible":true,"extensions":["xel"]},"application/xcap-error+xml":{"source":"iana","compressible":true,"extensions":["xer"]},"application/xcap-ns+xml":{"source":"iana","compressible":true,"extensions":["xns"]},"application/xcon-conference-info+xml":{"source":"iana","compressible":true},"application/xcon-conference-info-diff+xml":{"source":"iana","compressible":true},"application/xenc+xml":{"source":"iana","compressible":true,"extensions":["xenc"]},"application/xhtml+xml":{"source":"iana","compressible":true,"extensions":["xhtml","xht"]},"application/xhtml-voice+xml":{"source":"apache","compressible":true},"application/xliff+xml":{"source":"iana","compressible":true,"extensions":["xlf"]},"application/xml":{"source":"iana","compressible":true,"extensions":["xml","xsl","xsd","rng"]},"application/xml-dtd":{"source":"iana","compressible":true,"extensions":["dtd"]},"application/xml-external-parsed-entity":{"source":"iana"},"application/xml-patch+xml":{"source":"iana","compressible":true},"application/xmpp+xml":{"source":"iana","compressible":true},"application/xop+xml":{"source":"iana","compressible":true,"extensions":["xop"]},"application/xproc+xml":{"source":"apache","compressible":true,"extensions":["xpl"]},"application/xslt+xml":{"source":"iana","compressible":true,"extensions":["xslt"]},"application/xspf+xml":{"source":"apache","compressible":true,"extensions":["xspf"]},"application/xv+xml":{"source":"iana","compressible":true,"extensions":["mxml","xhvml","xvml","xvm"]},"application/yang":{"source":"iana","extensions":["yang"]},"application/yang-data+json":{"source":"iana","compressible":true},"application/yang-data+xml":{"source":"iana","compressible":true},"application/yang-patch+json":{"source":"iana","compressible":true},"application/yang-patch+xml":{"source":"iana","compressible":true},"application/yin+xml":{"source":"iana","compressible":true,"extensions":["yin"]},"application/zip":{"source":"iana","compressible":false,"extensions":["zip"]},"application/zlib":{"source":"iana"},"application/zstd":{"source":"iana"},"audio/1d-interleaved-parityfec":{"source":"iana"},"audio/32kadpcm":{"source":"iana"},"audio/3gpp":{"source":"iana","compressible":false,"extensions":["3gpp"]},"audio/3gpp2":{"source":"iana"},"audio/aac":{"source":"iana"},"audio/ac3":{"source":"iana"},"audio/adpcm":{"source":"apache","extensions":["adp"]},"audio/amr":{"source":"iana"},"audio/amr-wb":{"source":"iana"},"audio/amr-wb+":{"source":"iana"},"audio/aptx":{"source":"iana"},"audio/asc":{"source":"iana"},"audio/atrac-advanced-lossless":{"source":"iana"},"audio/atrac-x":{"source":"iana"},"audio/atrac3":{"source":"iana"},"audio/basic":{"source":"iana","compressible":false,"extensions":["au","snd"]},"audio/bv16":{"source":"iana"},"audio/bv32":{"source":"iana"},"audio/clearmode":{"source":"iana"},"audio/cn":{"source":"iana"},"audio/dat12":{"source":"iana"},"audio/dls":{"source":"iana"},"audio/dsr-es201108":{"source":"iana"},"audio/dsr-es202050":{"source":"iana"},"audio/dsr-es202211":{"source":"iana"},"audio/dsr-es202212":{"source":"iana"},"audio/dv":{"source":"iana"},"audio/dvi4":{"source":"iana"},"audio/eac3":{"source":"iana"},"audio/encaprtp":{"source":"iana"},"audio/evrc":{"source":"iana"},"audio/evrc-qcp":{"source":"iana"},"audio/evrc0":{"source":"iana"},"audio/evrc1":{"source":"iana"},"audio/evrcb":{"source":"iana"},"audio/evrcb0":{"source":"iana"},"audio/evrcb1":{"source":"iana"},"audio/evrcnw":{"source":"iana"},"audio/evrcnw0":{"source":"iana"},"audio/evrcnw1":{"source":"iana"},"audio/evrcwb":{"source":"iana"},"audio/evrcwb0":{"source":"iana"},"audio/evrcwb1":{"source":"iana"},"audio/evs":{"source":"iana"},"audio/flexfec":{"source":"iana"},"audio/fwdred":{"source":"iana"},"audio/g711-0":{"source":"iana"},"audio/g719":{"source":"iana"},"audio/g722":{"source":"iana"},"audio/g7221":{"source":"iana"},"audio/g723":{"source":"iana"},"audio/g726-16":{"source":"iana"},"audio/g726-24":{"source":"iana"},"audio/g726-32":{"source":"iana"},"audio/g726-40":{"source":"iana"},"audio/g728":{"source":"iana"},"audio/g729":{"source":"iana"},"audio/g7291":{"source":"iana"},"audio/g729d":{"source":"iana"},"audio/g729e":{"source":"iana"},"audio/gsm":{"source":"iana"},"audio/gsm-efr":{"source":"iana"},"audio/gsm-hr-08":{"source":"iana"},"audio/ilbc":{"source":"iana"},"audio/ip-mr_v2.5":{"source":"iana"},"audio/isac":{"source":"apache"},"audio/l16":{"source":"iana"},"audio/l20":{"source":"iana"},"audio/l24":{"source":"iana","compressible":false},"audio/l8":{"source":"iana"},"audio/lpc":{"source":"iana"},"audio/melp":{"source":"iana"},"audio/melp1200":{"source":"iana"},"audio/melp2400":{"source":"iana"},"audio/melp600":{"source":"iana"},"audio/midi":{"source":"apache","extensions":["mid","midi","kar","rmi"]},"audio/mobile-xmf":{"source":"iana","extensions":["mxmf"]},"audio/mp3":{"compressible":false,"extensions":["mp3"]},"audio/mp4":{"source":"iana","compressible":false,"extensions":["m4a","mp4a"]},"audio/mp4a-latm":{"source":"iana"},"audio/mpa":{"source":"iana"},"audio/mpa-robust":{"source":"iana"},"audio/mpeg":{"source":"iana","compressible":false,"extensions":["mpga","mp2","mp2a","mp3","m2a","m3a"]},"audio/mpeg4-generic":{"source":"iana"},"audio/musepack":{"source":"apache"},"audio/ogg":{"source":"iana","compressible":false,"extensions":["oga","ogg","spx"]},"audio/opus":{"source":"iana"},"audio/parityfec":{"source":"iana"},"audio/pcma":{"source":"iana"},"audio/pcma-wb":{"source":"iana"},"audio/pcmu":{"source":"iana"},"audio/pcmu-wb":{"source":"iana"},"audio/prs.sid":{"source":"iana"},"audio/qcelp":{"source":"iana"},"audio/raptorfec":{"source":"iana"},"audio/red":{"source":"iana"},"audio/rtp-enc-aescm128":{"source":"iana"},"audio/rtp-midi":{"source":"iana"},"audio/rtploopback":{"source":"iana"},"audio/rtx":{"source":"iana"},"audio/s3m":{"source":"apache","extensions":["s3m"]},"audio/silk":{"source":"apache","extensions":["sil"]},"audio/smv":{"source":"iana"},"audio/smv-qcp":{"source":"iana"},"audio/smv0":{"source":"iana"},"audio/sp-midi":{"source":"iana"},"audio/speex":{"source":"iana"},"audio/t140c":{"source":"iana"},"audio/t38":{"source":"iana"},"audio/telephone-event":{"source":"iana"},"audio/tetra_acelp":{"source":"iana"},"audio/tone":{"source":"iana"},"audio/uemclip":{"source":"iana"},"audio/ulpfec":{"source":"iana"},"audio/usac":{"source":"iana"},"audio/vdvi":{"source":"iana"},"audio/vmr-wb":{"source":"iana"},"audio/vnd.3gpp.iufp":{"source":"iana"},"audio/vnd.4sb":{"source":"iana"},"audio/vnd.audiokoz":{"source":"iana"},"audio/vnd.celp":{"source":"iana"},"audio/vnd.cisco.nse":{"source":"iana"},"audio/vnd.cmles.radio-events":{"source":"iana"},"audio/vnd.cns.anp1":{"source":"iana"},"audio/vnd.cns.inf1":{"source":"iana"},"audio/vnd.dece.audio":{"source":"iana","extensions":["uva","uvva"]},"audio/vnd.digital-winds":{"source":"iana","extensions":["eol"]},"audio/vnd.dlna.adts":{"source":"iana"},"audio/vnd.dolby.heaac.1":{"source":"iana"},"audio/vnd.dolby.heaac.2":{"source":"iana"},"audio/vnd.dolby.mlp":{"source":"iana"},"audio/vnd.dolby.mps":{"source":"iana"},"audio/vnd.dolby.pl2":{"source":"iana"},"audio/vnd.dolby.pl2x":{"source":"iana"},"audio/vnd.dolby.pl2z":{"source":"iana"},"audio/vnd.dolby.pulse.1":{"source":"iana"},"audio/vnd.dra":{"source":"iana","extensions":["dra"]},"audio/vnd.dts":{"source":"iana","extensions":["dts"]},"audio/vnd.dts.hd":{"source":"iana","extensions":["dtshd"]},"audio/vnd.dts.uhd":{"source":"iana"},"audio/vnd.dvb.file":{"source":"iana"},"audio/vnd.everad.plj":{"source":"iana"},"audio/vnd.hns.audio":{"source":"iana"},"audio/vnd.lucent.voice":{"source":"iana","extensions":["lvp"]},"audio/vnd.ms-playready.media.pya":{"source":"iana","extensions":["pya"]},"audio/vnd.nokia.mobile-xmf":{"source":"iana"},"audio/vnd.nortel.vbk":{"source":"iana"},"audio/vnd.nuera.ecelp4800":{"source":"iana","extensions":["ecelp4800"]},"audio/vnd.nuera.ecelp7470":{"source":"iana","extensions":["ecelp7470"]},"audio/vnd.nuera.ecelp9600":{"source":"iana","extensions":["ecelp9600"]},"audio/vnd.octel.sbc":{"source":"iana"},"audio/vnd.presonus.multitrack":{"source":"iana"},"audio/vnd.qcelp":{"source":"iana"},"audio/vnd.rhetorex.32kadpcm":{"source":"iana"},"audio/vnd.rip":{"source":"iana","extensions":["rip"]},"audio/vnd.rn-realaudio":{"compressible":false},"audio/vnd.sealedmedia.softseal.mpeg":{"source":"iana"},"audio/vnd.vmx.cvsd":{"source":"iana"},"audio/vnd.wave":{"compressible":false},"audio/vorbis":{"source":"iana","compressible":false},"audio/vorbis-config":{"source":"iana"},"audio/wav":{"compressible":false,"extensions":["wav"]},"audio/wave":{"compressible":false,"extensions":["wav"]},"audio/webm":{"source":"apache","compressible":false,"extensions":["weba"]},"audio/x-aac":{"source":"apache","compressible":false,"extensions":["aac"]},"audio/x-aiff":{"source":"apache","extensions":["aif","aiff","aifc"]},"audio/x-caf":{"source":"apache","compressible":false,"extensions":["caf"]},"audio/x-flac":{"source":"apache","extensions":["flac"]},"audio/x-m4a":{"source":"nginx","extensions":["m4a"]},"audio/x-matroska":{"source":"apache","extensions":["mka"]},"audio/x-mpegurl":{"source":"apache","extensions":["m3u"]},"audio/x-ms-wax":{"source":"apache","extensions":["wax"]},"audio/x-ms-wma":{"source":"apache","extensions":["wma"]},"audio/x-pn-realaudio":{"source":"apache","extensions":["ram","ra"]},"audio/x-pn-realaudio-plugin":{"source":"apache","extensions":["rmp"]},"audio/x-realaudio":{"source":"nginx","extensions":["ra"]},"audio/x-tta":{"source":"apache"},"audio/x-wav":{"source":"apache","extensions":["wav"]},"audio/xm":{"source":"apache","extensions":["xm"]},"chemical/x-cdx":{"source":"apache","extensions":["cdx"]},"chemical/x-cif":{"source":"apache","extensions":["cif"]},"chemical/x-cmdf":{"source":"apache","extensions":["cmdf"]},"chemical/x-cml":{"source":"apache","extensions":["cml"]},"chemical/x-csml":{"source":"apache","extensions":["csml"]},"chemical/x-pdb":{"source":"apache"},"chemical/x-xyz":{"source":"apache","extensions":["xyz"]},"font/collection":{"source":"iana","extensions":["ttc"]},"font/otf":{"source":"iana","compressible":true,"extensions":["otf"]},"font/sfnt":{"source":"iana"},"font/ttf":{"source":"iana","compressible":true,"extensions":["ttf"]},"font/woff":{"source":"iana","extensions":["woff"]},"font/woff2":{"source":"iana","extensions":["woff2"]},"image/aces":{"source":"iana","extensions":["exr"]},"image/apng":{"compressible":false,"extensions":["apng"]},"image/avci":{"source":"iana"},"image/avcs":{"source":"iana"},"image/bmp":{"source":"iana","compressible":true,"extensions":["bmp"]},"image/cgm":{"source":"iana","extensions":["cgm"]},"image/dicom-rle":{"source":"iana","extensions":["drle"]},"image/emf":{"source":"iana","extensions":["emf"]},"image/fits":{"source":"iana","extensions":["fits"]},"image/g3fax":{"source":"iana","extensions":["g3"]},"image/gif":{"source":"iana","compressible":false,"extensions":["gif"]},"image/heic":{"source":"iana","extensions":["heic"]},"image/heic-sequence":{"source":"iana","extensions":["heics"]},"image/heif":{"source":"iana","extensions":["heif"]},"image/heif-sequence":{"source":"iana","extensions":["heifs"]},"image/hej2k":{"source":"iana","extensions":["hej2"]},"image/hsj2":{"source":"iana","extensions":["hsj2"]},"image/ief":{"source":"iana","extensions":["ief"]},"image/jls":{"source":"iana","extensions":["jls"]},"image/jp2":{"source":"iana","compressible":false,"extensions":["jp2","jpg2"]},"image/jpeg":{"source":"iana","compressible":false,"extensions":["jpeg","jpg","jpe"]},"image/jph":{"source":"iana","extensions":["jph"]},"image/jphc":{"source":"iana","extensions":["jhc"]},"image/jpm":{"source":"iana","compressible":false,"extensions":["jpm"]},"image/jpx":{"source":"iana","compressible":false,"extensions":["jpx","jpf"]},"image/jxr":{"source":"iana","extensions":["jxr"]},"image/jxra":{"source":"iana","extensions":["jxra"]},"image/jxrs":{"source":"iana","extensions":["jxrs"]},"image/jxs":{"source":"iana","extensions":["jxs"]},"image/jxsc":{"source":"iana","extensions":["jxsc"]},"image/jxsi":{"source":"iana","extensions":["jxsi"]},"image/jxss":{"source":"iana","extensions":["jxss"]},"image/ktx":{"source":"iana","extensions":["ktx"]},"image/naplps":{"source":"iana"},"image/pjpeg":{"compressible":false},"image/png":{"source":"iana","compressible":false,"extensions":["png"]},"image/prs.btif":{"source":"iana","extensions":["btif"]},"image/prs.pti":{"source":"iana","extensions":["pti"]},"image/pwg-raster":{"source":"iana"},"image/sgi":{"source":"apache","extensions":["sgi"]},"image/svg+xml":{"source":"iana","compressible":true,"extensions":["svg","svgz"]},"image/t38":{"source":"iana","extensions":["t38"]},"image/tiff":{"source":"iana","compressible":false,"extensions":["tif","tiff"]},"image/tiff-fx":{"source":"iana","extensions":["tfx"]},"image/vnd.adobe.photoshop":{"source":"iana","compressible":true,"extensions":["psd"]},"image/vnd.airzip.accelerator.azv":{"source":"iana","extensions":["azv"]},"image/vnd.cns.inf2":{"source":"iana"},"image/vnd.dece.graphic":{"source":"iana","extensions":["uvi","uvvi","uvg","uvvg"]},"image/vnd.djvu":{"source":"iana","extensions":["djvu","djv"]},"image/vnd.dvb.subtitle":{"source":"iana","extensions":["sub"]},"image/vnd.dwg":{"source":"iana","extensions":["dwg"]},"image/vnd.dxf":{"source":"iana","extensions":["dxf"]},"image/vnd.fastbidsheet":{"source":"iana","extensions":["fbs"]},"image/vnd.fpx":{"source":"iana","extensions":["fpx"]},"image/vnd.fst":{"source":"iana","extensions":["fst"]},"image/vnd.fujixerox.edmics-mmr":{"source":"iana","extensions":["mmr"]},"image/vnd.fujixerox.edmics-rlc":{"source":"iana","extensions":["rlc"]},"image/vnd.globalgraphics.pgb":{"source":"iana"},"image/vnd.microsoft.icon":{"source":"iana","extensions":["ico"]},"image/vnd.mix":{"source":"iana"},"image/vnd.mozilla.apng":{"source":"iana"},"image/vnd.ms-dds":{"extensions":["dds"]},"image/vnd.ms-modi":{"source":"iana","extensions":["mdi"]},"image/vnd.ms-photo":{"source":"apache","extensions":["wdp"]},"image/vnd.net-fpx":{"source":"iana","extensions":["npx"]},"image/vnd.radiance":{"source":"iana"},"image/vnd.sealed.png":{"source":"iana"},"image/vnd.sealedmedia.softseal.gif":{"source":"iana"},"image/vnd.sealedmedia.softseal.jpg":{"source":"iana"},"image/vnd.svf":{"source":"iana"},"image/vnd.tencent.tap":{"source":"iana","extensions":["tap"]},"image/vnd.valve.source.texture":{"source":"iana","extensions":["vtf"]},"image/vnd.wap.wbmp":{"source":"iana","extensions":["wbmp"]},"image/vnd.xiff":{"source":"iana","extensions":["xif"]},"image/vnd.zbrush.pcx":{"source":"iana","extensions":["pcx"]},"image/webp":{"source":"apache","extensions":["webp"]},"image/wmf":{"source":"iana","extensions":["wmf"]},"image/x-3ds":{"source":"apache","extensions":["3ds"]},"image/x-cmu-raster":{"source":"apache","extensions":["ras"]},"image/x-cmx":{"source":"apache","extensions":["cmx"]},"image/x-freehand":{"source":"apache","extensions":["fh","fhc","fh4","fh5","fh7"]},"image/x-icon":{"source":"apache","compressible":true,"extensions":["ico"]},"image/x-jng":{"source":"nginx","extensions":["jng"]},"image/x-mrsid-image":{"source":"apache","extensions":["sid"]},"image/x-ms-bmp":{"source":"nginx","compressible":true,"extensions":["bmp"]},"image/x-pcx":{"source":"apache","extensions":["pcx"]},"image/x-pict":{"source":"apache","extensions":["pic","pct"]},"image/x-portable-anymap":{"source":"apache","extensions":["pnm"]},"image/x-portable-bitmap":{"source":"apache","extensions":["pbm"]},"image/x-portable-graymap":{"source":"apache","extensions":["pgm"]},"image/x-portable-pixmap":{"source":"apache","extensions":["ppm"]},"image/x-rgb":{"source":"apache","extensions":["rgb"]},"image/x-tga":{"source":"apache","extensions":["tga"]},"image/x-xbitmap":{"source":"apache","extensions":["xbm"]},"image/x-xcf":{"compressible":false},"image/x-xpixmap":{"source":"apache","extensions":["xpm"]},"image/x-xwindowdump":{"source":"apache","extensions":["xwd"]},"message/cpim":{"source":"iana"},"message/delivery-status":{"source":"iana"},"message/disposition-notification":{"source":"iana","extensions":["disposition-notification"]},"message/external-body":{"source":"iana"},"message/feedback-report":{"source":"iana"},"message/global":{"source":"iana","extensions":["u8msg"]},"message/global-delivery-status":{"source":"iana","extensions":["u8dsn"]},"message/global-disposition-notification":{"source":"iana","extensions":["u8mdn"]},"message/global-headers":{"source":"iana","extensions":["u8hdr"]},"message/http":{"source":"iana","compressible":false},"message/imdn+xml":{"source":"iana","compressible":true},"message/news":{"source":"iana"},"message/partial":{"source":"iana","compressible":false},"message/rfc822":{"source":"iana","compressible":true,"extensions":["eml","mime"]},"message/s-http":{"source":"iana"},"message/sip":{"source":"iana"},"message/sipfrag":{"source":"iana"},"message/tracking-status":{"source":"iana"},"message/vnd.si.simp":{"source":"iana"},"message/vnd.wfa.wsc":{"source":"iana","extensions":["wsc"]},"model/3mf":{"source":"iana","extensions":["3mf"]},"model/gltf+json":{"source":"iana","compressible":true,"extensions":["gltf"]},"model/gltf-binary":{"source":"iana","compressible":true,"extensions":["glb"]},"model/iges":{"source":"iana","compressible":false,"extensions":["igs","iges"]},"model/mesh":{"source":"iana","compressible":false,"extensions":["msh","mesh","silo"]},"model/stl":{"source":"iana","extensions":["stl"]},"model/vnd.collada+xml":{"source":"iana","compressible":true,"extensions":["dae"]},"model/vnd.dwf":{"source":"iana","extensions":["dwf"]},"model/vnd.flatland.3dml":{"source":"iana"},"model/vnd.gdl":{"source":"iana","extensions":["gdl"]},"model/vnd.gs-gdl":{"source":"apache"},"model/vnd.gs.gdl":{"source":"iana"},"model/vnd.gtw":{"source":"iana","extensions":["gtw"]},"model/vnd.moml+xml":{"source":"iana","compressible":true},"model/vnd.mts":{"source":"iana","extensions":["mts"]},"model/vnd.opengex":{"source":"iana","extensions":["ogex"]},"model/vnd.parasolid.transmit.binary":{"source":"iana","extensions":["x_b"]},"model/vnd.parasolid.transmit.text":{"source":"iana","extensions":["x_t"]},"model/vnd.rosette.annotated-data-model":{"source":"iana"},"model/vnd.usdz+zip":{"source":"iana","compressible":false,"extensions":["usdz"]},"model/vnd.valve.source.compiled-map":{"source":"iana","extensions":["bsp"]},"model/vnd.vtu":{"source":"iana","extensions":["vtu"]},"model/vrml":{"source":"iana","compressible":false,"extensions":["wrl","vrml"]},"model/x3d+binary":{"source":"apache","compressible":false,"extensions":["x3db","x3dbz"]},"model/x3d+fastinfoset":{"source":"iana","extensions":["x3db"]},"model/x3d+vrml":{"source":"apache","compressible":false,"extensions":["x3dv","x3dvz"]},"model/x3d+xml":{"source":"iana","compressible":true,"extensions":["x3d","x3dz"]},"model/x3d-vrml":{"source":"iana","extensions":["x3dv"]},"multipart/alternative":{"source":"iana","compressible":false},"multipart/appledouble":{"source":"iana"},"multipart/byteranges":{"source":"iana"},"multipart/digest":{"source":"iana"},"multipart/encrypted":{"source":"iana","compressible":false},"multipart/form-data":{"source":"iana","compressible":false},"multipart/header-set":{"source":"iana"},"multipart/mixed":{"source":"iana"},"multipart/multilingual":{"source":"iana"},"multipart/parallel":{"source":"iana"},"multipart/related":{"source":"iana","compressible":false},"multipart/report":{"source":"iana"},"multipart/signed":{"source":"iana","compressible":false},"multipart/vnd.bint.med-plus":{"source":"iana"},"multipart/voice-message":{"source":"iana"},"multipart/x-mixed-replace":{"source":"iana"},"text/1d-interleaved-parityfec":{"source":"iana"},"text/cache-manifest":{"source":"iana","compressible":true,"extensions":["appcache","manifest"]},"text/calendar":{"source":"iana","extensions":["ics","ifb"]},"text/calender":{"compressible":true},"text/cmd":{"compressible":true},"text/coffeescript":{"extensions":["coffee","litcoffee"]},"text/css":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["css"]},"text/csv":{"source":"iana","compressible":true,"extensions":["csv"]},"text/csv-schema":{"source":"iana"},"text/directory":{"source":"iana"},"text/dns":{"source":"iana"},"text/ecmascript":{"source":"iana"},"text/encaprtp":{"source":"iana"},"text/enriched":{"source":"iana"},"text/flexfec":{"source":"iana"},"text/fwdred":{"source":"iana"},"text/grammar-ref-list":{"source":"iana"},"text/html":{"source":"iana","compressible":true,"extensions":["html","htm","shtml"]},"text/jade":{"extensions":["jade"]},"text/javascript":{"source":"iana","compressible":true},"text/jcr-cnd":{"source":"iana"},"text/jsx":{"compressible":true,"extensions":["jsx"]},"text/less":{"compressible":true,"extensions":["less"]},"text/markdown":{"source":"iana","compressible":true,"extensions":["markdown","md"]},"text/mathml":{"source":"nginx","extensions":["mml"]},"text/mdx":{"compressible":true,"extensions":["mdx"]},"text/mizar":{"source":"iana"},"text/n3":{"source":"iana","compressible":true,"extensions":["n3"]},"text/parameters":{"source":"iana"},"text/parityfec":{"source":"iana"},"text/plain":{"source":"iana","compressible":true,"extensions":["txt","text","conf","def","list","log","in","ini"]},"text/provenance-notation":{"source":"iana"},"text/prs.fallenstein.rst":{"source":"iana"},"text/prs.lines.tag":{"source":"iana","extensions":["dsc"]},"text/prs.prop.logic":{"source":"iana"},"text/raptorfec":{"source":"iana"},"text/red":{"source":"iana"},"text/rfc822-headers":{"source":"iana"},"text/richtext":{"source":"iana","compressible":true,"extensions":["rtx"]},"text/rtf":{"source":"iana","compressible":true,"extensions":["rtf"]},"text/rtp-enc-aescm128":{"source":"iana"},"text/rtploopback":{"source":"iana"},"text/rtx":{"source":"iana"},"text/sgml":{"source":"iana","extensions":["sgml","sgm"]},"text/shex":{"extensions":["shex"]},"text/slim":{"extensions":["slim","slm"]},"text/strings":{"source":"iana"},"text/stylus":{"extensions":["stylus","styl"]},"text/t140":{"source":"iana"},"text/tab-separated-values":{"source":"iana","compressible":true,"extensions":["tsv"]},"text/troff":{"source":"iana","extensions":["t","tr","roff","man","me","ms"]},"text/turtle":{"source":"iana","charset":"UTF-8","extensions":["ttl"]},"text/ulpfec":{"source":"iana"},"text/uri-list":{"source":"iana","compressible":true,"extensions":["uri","uris","urls"]},"text/vcard":{"source":"iana","compressible":true,"extensions":["vcard"]},"text/vnd.a":{"source":"iana"},"text/vnd.abc":{"source":"iana"},"text/vnd.ascii-art":{"source":"iana"},"text/vnd.curl":{"source":"iana","extensions":["curl"]},"text/vnd.curl.dcurl":{"source":"apache","extensions":["dcurl"]},"text/vnd.curl.mcurl":{"source":"apache","extensions":["mcurl"]},"text/vnd.curl.scurl":{"source":"apache","extensions":["scurl"]},"text/vnd.debian.copyright":{"source":"iana"},"text/vnd.dmclientscript":{"source":"iana"},"text/vnd.dvb.subtitle":{"source":"iana","extensions":["sub"]},"text/vnd.esmertec.theme-descriptor":{"source":"iana"},"text/vnd.ficlab.flt":{"source":"iana"},"text/vnd.fly":{"source":"iana","extensions":["fly"]},"text/vnd.fmi.flexstor":{"source":"iana","extensions":["flx"]},"text/vnd.gml":{"source":"iana"},"text/vnd.graphviz":{"source":"iana","extensions":["gv"]},"text/vnd.hgl":{"source":"iana"},"text/vnd.in3d.3dml":{"source":"iana","extensions":["3dml"]},"text/vnd.in3d.spot":{"source":"iana","extensions":["spot"]},"text/vnd.iptc.newsml":{"source":"iana"},"text/vnd.iptc.nitf":{"source":"iana"},"text/vnd.latex-z":{"source":"iana"},"text/vnd.motorola.reflex":{"source":"iana"},"text/vnd.ms-mediapackage":{"source":"iana"},"text/vnd.net2phone.commcenter.command":{"source":"iana"},"text/vnd.radisys.msml-basic-layout":{"source":"iana"},"text/vnd.senx.warpscript":{"source":"iana"},"text/vnd.si.uricatalogue":{"source":"iana"},"text/vnd.sosi":{"source":"iana"},"text/vnd.sun.j2me.app-descriptor":{"source":"iana","extensions":["jad"]},"text/vnd.trolltech.linguist":{"source":"iana"},"text/vnd.wap.si":{"source":"iana"},"text/vnd.wap.sl":{"source":"iana"},"text/vnd.wap.wml":{"source":"iana","extensions":["wml"]},"text/vnd.wap.wmlscript":{"source":"iana","extensions":["wmls"]},"text/vtt":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["vtt"]},"text/x-asm":{"source":"apache","extensions":["s","asm"]},"text/x-c":{"source":"apache","extensions":["c","cc","cxx","cpp","h","hh","dic"]},"text/x-component":{"source":"nginx","extensions":["htc"]},"text/x-fortran":{"source":"apache","extensions":["f","for","f77","f90"]},"text/x-gwt-rpc":{"compressible":true},"text/x-handlebars-template":{"extensions":["hbs"]},"text/x-java-source":{"source":"apache","extensions":["java"]},"text/x-jquery-tmpl":{"compressible":true},"text/x-lua":{"extensions":["lua"]},"text/x-markdown":{"compressible":true,"extensions":["mkd"]},"text/x-nfo":{"source":"apache","extensions":["nfo"]},"text/x-opml":{"source":"apache","extensions":["opml"]},"text/x-org":{"compressible":true,"extensions":["org"]},"text/x-pascal":{"source":"apache","extensions":["p","pas"]},"text/x-processing":{"compressible":true,"extensions":["pde"]},"text/x-sass":{"extensions":["sass"]},"text/x-scss":{"extensions":["scss"]},"text/x-setext":{"source":"apache","extensions":["etx"]},"text/x-sfv":{"source":"apache","extensions":["sfv"]},"text/x-suse-ymp":{"compressible":true,"extensions":["ymp"]},"text/x-uuencode":{"source":"apache","extensions":["uu"]},"text/x-vcalendar":{"source":"apache","extensions":["vcs"]},"text/x-vcard":{"source":"apache","extensions":["vcf"]},"text/xml":{"source":"iana","compressible":true,"extensions":["xml"]},"text/xml-external-parsed-entity":{"source":"iana"},"text/yaml":{"extensions":["yaml","yml"]},"video/1d-interleaved-parityfec":{"source":"iana"},"video/3gpp":{"source":"iana","extensions":["3gp","3gpp"]},"video/3gpp-tt":{"source":"iana"},"video/3gpp2":{"source":"iana","extensions":["3g2"]},"video/bmpeg":{"source":"iana"},"video/bt656":{"source":"iana"},"video/celb":{"source":"iana"},"video/dv":{"source":"iana"},"video/encaprtp":{"source":"iana"},"video/flexfec":{"source":"iana"},"video/h261":{"source":"iana","extensions":["h261"]},"video/h263":{"source":"iana","extensions":["h263"]},"video/h263-1998":{"source":"iana"},"video/h263-2000":{"source":"iana"},"video/h264":{"source":"iana","extensions":["h264"]},"video/h264-rcdo":{"source":"iana"},"video/h264-svc":{"source":"iana"},"video/h265":{"source":"iana"},"video/iso.segment":{"source":"iana"},"video/jpeg":{"source":"iana","extensions":["jpgv"]},"video/jpeg2000":{"source":"iana"},"video/jpm":{"source":"apache","extensions":["jpm","jpgm"]},"video/mj2":{"source":"iana","extensions":["mj2","mjp2"]},"video/mp1s":{"source":"iana"},"video/mp2p":{"source":"iana"},"video/mp2t":{"source":"iana","extensions":["ts"]},"video/mp4":{"source":"iana","compressible":false,"extensions":["mp4","mp4v","mpg4"]},"video/mp4v-es":{"source":"iana"},"video/mpeg":{"source":"iana","compressible":false,"extensions":["mpeg","mpg","mpe","m1v","m2v"]},"video/mpeg4-generic":{"source":"iana"},"video/mpv":{"source":"iana"},"video/nv":{"source":"iana"},"video/ogg":{"source":"iana","compressible":false,"extensions":["ogv"]},"video/parityfec":{"source":"iana"},"video/pointer":{"source":"iana"},"video/quicktime":{"source":"iana","compressible":false,"extensions":["qt","mov"]},"video/raptorfec":{"source":"iana"},"video/raw":{"source":"iana"},"video/rtp-enc-aescm128":{"source":"iana"},"video/rtploopback":{"source":"iana"},"video/rtx":{"source":"iana"},"video/smpte291":{"source":"iana"},"video/smpte292m":{"source":"iana"},"video/ulpfec":{"source":"iana"},"video/vc1":{"source":"iana"},"video/vc2":{"source":"iana"},"video/vnd.cctv":{"source":"iana"},"video/vnd.dece.hd":{"source":"iana","extensions":["uvh","uvvh"]},"video/vnd.dece.mobile":{"source":"iana","extensions":["uvm","uvvm"]},"video/vnd.dece.mp4":{"source":"iana"},"video/vnd.dece.pd":{"source":"iana","extensions":["uvp","uvvp"]},"video/vnd.dece.sd":{"source":"iana","extensions":["uvs","uvvs"]},"video/vnd.dece.video":{"source":"iana","extensions":["uvv","uvvv"]},"video/vnd.directv.mpeg":{"source":"iana"},"video/vnd.directv.mpeg-tts":{"source":"iana"},"video/vnd.dlna.mpeg-tts":{"source":"iana"},"video/vnd.dvb.file":{"source":"iana","extensions":["dvb"]},"video/vnd.fvt":{"source":"iana","extensions":["fvt"]},"video/vnd.hns.video":{"source":"iana"},"video/vnd.iptvforum.1dparityfec-1010":{"source":"iana"},"video/vnd.iptvforum.1dparityfec-2005":{"source":"iana"},"video/vnd.iptvforum.2dparityfec-1010":{"source":"iana"},"video/vnd.iptvforum.2dparityfec-2005":{"source":"iana"},"video/vnd.iptvforum.ttsavc":{"source":"iana"},"video/vnd.iptvforum.ttsmpeg2":{"source":"iana"},"video/vnd.motorola.video":{"source":"iana"},"video/vnd.motorola.videop":{"source":"iana"},"video/vnd.mpegurl":{"source":"iana","extensions":["mxu","m4u"]},"video/vnd.ms-playready.media.pyv":{"source":"iana","extensions":["pyv"]},"video/vnd.nokia.interleaved-multimedia":{"source":"iana"},"video/vnd.nokia.mp4vr":{"source":"iana"},"video/vnd.nokia.videovoip":{"source":"iana"},"video/vnd.objectvideo":{"source":"iana"},"video/vnd.radgamettools.bink":{"source":"iana"},"video/vnd.radgamettools.smacker":{"source":"iana"},"video/vnd.sealed.mpeg1":{"source":"iana"},"video/vnd.sealed.mpeg4":{"source":"iana"},"video/vnd.sealed.swf":{"source":"iana"},"video/vnd.sealedmedia.softseal.mov":{"source":"iana"},"video/vnd.uvvu.mp4":{"source":"iana","extensions":["uvu","uvvu"]},"video/vnd.vivo":{"source":"iana","extensions":["viv"]},"video/vnd.youtube.yt":{"source":"iana"},"video/vp8":{"source":"iana"},"video/webm":{"source":"apache","compressible":false,"extensions":["webm"]},"video/x-f4v":{"source":"apache","extensions":["f4v"]},"video/x-fli":{"source":"apache","extensions":["fli"]},"video/x-flv":{"source":"apache","compressible":false,"extensions":["flv"]},"video/x-m4v":{"source":"apache","extensions":["m4v"]},"video/x-matroska":{"source":"apache","compressible":false,"extensions":["mkv","mk3d","mks"]},"video/x-mng":{"source":"apache","extensions":["mng"]},"video/x-ms-asf":{"source":"apache","extensions":["asf","asx"]},"video/x-ms-vob":{"source":"apache","extensions":["vob"]},"video/x-ms-wm":{"source":"apache","extensions":["wm"]},"video/x-ms-wmv":{"source":"apache","compressible":false,"extensions":["wmv"]},"video/x-ms-wmx":{"source":"apache","extensions":["wmx"]},"video/x-ms-wvx":{"source":"apache","extensions":["wvx"]},"video/x-msvideo":{"source":"apache","extensions":["avi"]},"video/x-sgi-movie":{"source":"apache","extensions":["movie"]},"video/x-smv":{"source":"apache","extensions":["smv"]},"x-conference/x-cooltalk":{"source":"apache","extensions":["ice"]},"x-shader/x-fragment":{"compressible":true},"x-shader/x-vertex":{"compressible":true}}; + +/***/ }), + +/***/ 514: +/***/ (function(module, __unusedexports, __webpack_require__) { + +"use strict"; + + +var compileSchema = __webpack_require__(805) + , resolve = __webpack_require__(867) + , Cache = __webpack_require__(921) + , SchemaObject = __webpack_require__(955) + , stableStringify = __webpack_require__(741) + , formats = __webpack_require__(881) + , rules = __webpack_require__(496) + , $dataMetaSchema = __webpack_require__(628) + , util = __webpack_require__(855); + +module.exports = Ajv; + +Ajv.prototype.validate = validate; +Ajv.prototype.compile = compile; +Ajv.prototype.addSchema = addSchema; +Ajv.prototype.addMetaSchema = addMetaSchema; +Ajv.prototype.validateSchema = validateSchema; +Ajv.prototype.getSchema = getSchema; +Ajv.prototype.removeSchema = removeSchema; +Ajv.prototype.addFormat = addFormat; +Ajv.prototype.errorsText = errorsText; + +Ajv.prototype._addSchema = _addSchema; +Ajv.prototype._compile = _compile; + +Ajv.prototype.compileAsync = __webpack_require__(890); +var customKeyword = __webpack_require__(45); +Ajv.prototype.addKeyword = customKeyword.add; +Ajv.prototype.getKeyword = customKeyword.get; +Ajv.prototype.removeKeyword = customKeyword.remove; +Ajv.prototype.validateKeyword = customKeyword.validate; + +var errorClasses = __webpack_require__(844); +Ajv.ValidationError = errorClasses.Validation; +Ajv.MissingRefError = errorClasses.MissingRef; +Ajv.$dataMetaSchema = $dataMetaSchema; + +var META_SCHEMA_ID = 'http://json-schema.org/draft-07/schema'; + +var META_IGNORE_OPTIONS = [ 'removeAdditional', 'useDefaults', 'coerceTypes', 'strictDefaults' ]; +var META_SUPPORT_DATA = ['/properties']; + +/** + * Creates validator instance. + * Usage: `Ajv(opts)` + * @param {Object} opts optional options + * @return {Object} ajv instance + */ +function Ajv(opts) { + if (!(this instanceof Ajv)) return new Ajv(opts); + opts = this._opts = util.copy(opts) || {}; + setLogger(this); + this._schemas = {}; + this._refs = {}; + this._fragments = {}; + this._formats = formats(opts.format); + + this._cache = opts.cache || new Cache; + this._loadingSchemas = {}; + this._compilations = []; + this.RULES = rules(); + this._getId = chooseGetId(opts); + + opts.loopRequired = opts.loopRequired || Infinity; + if (opts.errorDataPath == 'property') opts._errorDataPathProperty = true; + if (opts.serialize === undefined) opts.serialize = stableStringify; + this._metaOpts = getMetaSchemaOptions(this); + + if (opts.formats) addInitialFormats(this); + if (opts.keywords) addInitialKeywords(this); + addDefaultMetaSchema(this); + if (typeof opts.meta == 'object') this.addMetaSchema(opts.meta); + if (opts.nullable) this.addKeyword('nullable', {metaSchema: {type: 'boolean'}}); + addInitialSchemas(this); +} + + + +/** + * Validate data using schema + * Schema will be compiled and cached (using serialized JSON as key. [fast-json-stable-stringify](https://github.com/epoberezkin/fast-json-stable-stringify) is used to serialize. + * @this Ajv + * @param {String|Object} schemaKeyRef key, ref or schema object + * @param {Any} data to be validated + * @return {Boolean} validation result. Errors from the last validation will be available in `ajv.errors` (and also in compiled schema: `schema.errors`). + */ +function validate(schemaKeyRef, data) { + var v; + if (typeof schemaKeyRef == 'string') { + v = this.getSchema(schemaKeyRef); + if (!v) throw new Error('no schema with key or ref "' + schemaKeyRef + '"'); + } else { + var schemaObj = this._addSchema(schemaKeyRef); + v = schemaObj.validate || this._compile(schemaObj); + } + + var valid = v(data); + if (v.$async !== true) this.errors = v.errors; + return valid; +} + + +/** + * Create validating function for passed schema. + * @this Ajv + * @param {Object} schema schema object + * @param {Boolean} _meta true if schema is a meta-schema. Used internally to compile meta schemas of custom keywords. + * @return {Function} validating function + */ +function compile(schema, _meta) { + var schemaObj = this._addSchema(schema, undefined, _meta); + return schemaObj.validate || this._compile(schemaObj); +} + + +/** + * Adds schema to the instance. + * @this Ajv + * @param {Object|Array} schema schema or array of schemas. If array is passed, `key` and other parameters will be ignored. + * @param {String} key Optional schema key. Can be passed to `validate` method instead of schema object or id/ref. One schema per instance can have empty `id` and `key`. + * @param {Boolean} _skipValidation true to skip schema validation. Used internally, option validateSchema should be used instead. + * @param {Boolean} _meta true if schema is a meta-schema. Used internally, addMetaSchema should be used instead. + * @return {Ajv} this for method chaining + */ +function addSchema(schema, key, _skipValidation, _meta) { + if (Array.isArray(schema)){ + for (var i=0; i} errors optional array of validation errors, if not passed errors from the instance are used. + * @param {Object} options optional options with properties `separator` and `dataVar`. + * @return {String} human readable string with all errors descriptions + */ +function errorsText(errors, options) { + errors = errors || this.errors; + if (!errors) return 'No errors'; + options = options || {}; + var separator = options.separator === undefined ? ', ' : options.separator; + var dataVar = options.dataVar === undefined ? 'data' : options.dataVar; + + var text = ''; + for (var i=0; i= 1, + 'key must have at least one part'); + assert.ok(partial || sshbuf.atEnd(), + 'leftover bytes at end of key'); + + var Constructor = Key; + var algInfo = algs.info[key.type]; + if (type === 'private' || algInfo.parts.length !== parts.length) { + algInfo = algs.privInfo[key.type]; + Constructor = PrivateKey; + } + assert.strictEqual(algInfo.parts.length, parts.length); + + if (key.type === 'ecdsa') { + var res = /^ecdsa-sha2-(.+)$/.exec(alg); + assert.ok(res !== null); + assert.strictEqual(res[1], parts[0].data.toString()); + } + + var normalized = true; + for (var i = 0; i < algInfo.parts.length; ++i) { + var p = parts[i]; + p.name = algInfo.parts[i]; + /* + * OpenSSH stores ed25519 "private" keys as seed + public key + * concat'd together (k followed by A). We want to keep them + * separate for other formats that don't do this. + */ + if (key.type === 'ed25519' && p.name === 'k') + p.data = p.data.slice(0, 32); + + if (p.name !== 'curve' && algInfo.normalize !== false) { + var nd; + if (key.type === 'ed25519') { + nd = utils.zeroPadToLength(p.data, 32); + } else { + nd = utils.mpNormalize(p.data); + } + if (nd.toString('binary') !== + p.data.toString('binary')) { + p.data = nd; + normalized = false; + } + } + } + + if (normalized) + key._rfc4253Cache = sshbuf.toBuffer(); + + if (partial && typeof (partial) === 'object') { + partial.remainder = sshbuf.remainder(); + partial.consumed = sshbuf._offset; + } + + return (new Constructor(key)); +} + +function write(key, options) { + assert.object(key); + + var alg = keyTypeToAlg(key); + var i; + + var algInfo = algs.info[key.type]; + if (PrivateKey.isPrivateKey(key)) + algInfo = algs.privInfo[key.type]; + var parts = algInfo.parts; + + var buf = new SSHBuffer({}); + + buf.writeString(alg); + + for (i = 0; i < parts.length; ++i) { + var data = key.part[parts[i]].data; + if (algInfo.normalize !== false) { + if (key.type === 'ed25519') + data = utils.zeroPadToLength(data, 32); + else + data = utils.mpNormalize(data); + } + if (key.type === 'ed25519' && parts[i] === 'k') + data = Buffer.concat([data, key.part.A.data]); + buf.writeBuffer(data); + } + + return (buf.toBuffer()); +} + + +/***/ }), + +/***/ 542: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate_pattern(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $regexp = $isData ? '(new RegExp(' + $schemaValue + '))' : it.usePattern($schema); + out += 'if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || '; + } + out += ' !' + ($regexp) + '.test(' + ($data) + ') ) { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('pattern') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { pattern: '; + if ($isData) { + out += '' + ($schemaValue); + } else { + out += '' + (it.util.toQuotedString($schema)); + } + out += ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should match pattern "'; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + (it.util.escapeQuotes($schema)); + } + out += '"\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + (it.util.toQuotedString($schema)); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += '} '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} + + +/***/ }), + +/***/ 547: +/***/ (function(module, __unusedexports, __webpack_require__) { + +var util = __webpack_require__(669); +var Stream = __webpack_require__(413).Stream; +var DelayedStream = __webpack_require__(152); + +module.exports = CombinedStream; +function CombinedStream() { + this.writable = false; + this.readable = true; + this.dataSize = 0; + this.maxDataSize = 2 * 1024 * 1024; + this.pauseStreams = true; + + this._released = false; + this._streams = []; + this._currentStream = null; + this._insideLoop = false; + this._pendingNext = false; +} +util.inherits(CombinedStream, Stream); + +CombinedStream.create = function(options) { + var combinedStream = new this(); + + options = options || {}; + for (var option in options) { + combinedStream[option] = options[option]; + } + + return combinedStream; +}; + +CombinedStream.isStreamLike = function(stream) { + return (typeof stream !== 'function') + && (typeof stream !== 'string') + && (typeof stream !== 'boolean') + && (typeof stream !== 'number') + && (!Buffer.isBuffer(stream)); +}; + +CombinedStream.prototype.append = function(stream) { + var isStreamLike = CombinedStream.isStreamLike(stream); + + if (isStreamLike) { + if (!(stream instanceof DelayedStream)) { + var newStream = DelayedStream.create(stream, { + maxDataSize: Infinity, + pauseStream: this.pauseStreams, + }); + stream.on('data', this._checkDataSize.bind(this)); + stream = newStream; + } + + this._handleErrors(stream); + + if (this.pauseStreams) { + stream.pause(); + } + } + + this._streams.push(stream); + return this; +}; + +CombinedStream.prototype.pipe = function(dest, options) { + Stream.prototype.pipe.call(this, dest, options); + this.resume(); + return dest; +}; + +CombinedStream.prototype._getNext = function() { + this._currentStream = null; + + if (this._insideLoop) { + this._pendingNext = true; + return; // defer call + } + + this._insideLoop = true; + try { + do { + this._pendingNext = false; + this._realGetNext(); + } while (this._pendingNext); + } finally { + this._insideLoop = false; + } +}; + +CombinedStream.prototype._realGetNext = function() { + var stream = this._streams.shift(); + + + if (typeof stream == 'undefined') { + this.end(); + return; + } + + if (typeof stream !== 'function') { + this._pipeNext(stream); + return; + } + + var getStream = stream; + getStream(function(stream) { + var isStreamLike = CombinedStream.isStreamLike(stream); + if (isStreamLike) { + stream.on('data', this._checkDataSize.bind(this)); + this._handleErrors(stream); + } + + this._pipeNext(stream); + }.bind(this)); +}; + +CombinedStream.prototype._pipeNext = function(stream) { + this._currentStream = stream; + + var isStreamLike = CombinedStream.isStreamLike(stream); + if (isStreamLike) { + stream.on('end', this._getNext.bind(this)); + stream.pipe(this, {end: false}); + return; + } + + var value = stream; + this.write(value); + this._getNext(); +}; + +CombinedStream.prototype._handleErrors = function(stream) { + var self = this; + stream.on('error', function(err) { + self._emitError(err); + }); +}; + +CombinedStream.prototype.write = function(data) { + this.emit('data', data); +}; + +CombinedStream.prototype.pause = function() { + if (!this.pauseStreams) { + return; + } + + if(this.pauseStreams && this._currentStream && typeof(this._currentStream.pause) == 'function') this._currentStream.pause(); + this.emit('pause'); +}; + +CombinedStream.prototype.resume = function() { + if (!this._released) { + this._released = true; + this.writable = true; + this._getNext(); + } + + if(this.pauseStreams && this._currentStream && typeof(this._currentStream.resume) == 'function') this._currentStream.resume(); + this.emit('resume'); +}; + +CombinedStream.prototype.end = function() { + this._reset(); + this.emit('end'); +}; + +CombinedStream.prototype.destroy = function() { + this._reset(); + this.emit('close'); +}; + +CombinedStream.prototype._reset = function() { + this.writable = false; + this._streams = []; + this._currentStream = null; +}; + +CombinedStream.prototype._checkDataSize = function() { + this._updateDataSize(); + if (this.dataSize <= this.maxDataSize) { + return; + } + + var message = + 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.'; + this._emitError(new Error(message)); +}; + +CombinedStream.prototype._updateDataSize = function() { + this.dataSize = 0; + + var self = this; + this._streams.forEach(function(stream) { + if (!stream.dataSize) { + return; + } + + self.dataSize += stream.dataSize; + }); + + if (this._currentStream && this._currentStream.dataSize) { + this.dataSize += this._currentStream.dataSize; + } +}; + +CombinedStream.prototype._emitError = function(err) { + this._reset(); + this.emit('error', err); +}; + + +/***/ }), + +/***/ 552: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; @@ -20081,19 +17293,187 @@ exports.Redirect = Redirect /***/ }), -/***/ 588: -/***/ (function(module) { +/***/ 554: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +"use strict"; + + +var caseless = __webpack_require__(254) +var uuid = __webpack_require__(826) +var helpers = __webpack_require__(810) + +var md5 = helpers.md5 +var toBase64 = helpers.toBase64 + +function Auth (request) { + // define all public properties here + this.request = request + this.hasAuth = false + this.sentAuth = false + this.bearerToken = null + this.user = null + this.pass = null +} + +Auth.prototype.basic = function (user, pass, sendImmediately) { + var self = this + if (typeof user !== 'string' || (pass !== undefined && typeof pass !== 'string')) { + self.request.emit('error', new Error('auth() received invalid user or password')) + } + self.user = user + self.pass = pass + self.hasAuth = true + var header = user + ':' + (pass || '') + if (sendImmediately || typeof sendImmediately === 'undefined') { + var authHeader = 'Basic ' + toBase64(header) + self.sentAuth = true + return authHeader + } +} + +Auth.prototype.bearer = function (bearer, sendImmediately) { + var self = this + self.bearerToken = bearer + self.hasAuth = true + if (sendImmediately || typeof sendImmediately === 'undefined') { + if (typeof bearer === 'function') { + bearer = bearer() + } + var authHeader = 'Bearer ' + (bearer || '') + self.sentAuth = true + return authHeader + } +} + +Auth.prototype.digest = function (method, path, authHeader) { + // TODO: More complete implementation of RFC 2617. + // - handle challenge.domain + // - support qop="auth-int" only + // - handle Authentication-Info (not necessarily?) + // - check challenge.stale (not necessarily?) + // - increase nc (not necessarily?) + // For reference: + // http://tools.ietf.org/html/rfc2617#section-3 + // https://github.com/bagder/curl/blob/master/lib/http_digest.c + + var self = this + + var challenge = {} + var re = /([a-z0-9_-]+)=(?:"([^"]+)"|([a-z0-9_-]+))/gi + while (true) { + var match = re.exec(authHeader) + if (!match) { + break + } + challenge[match[1]] = match[2] || match[3] + } + + /** + * RFC 2617: handle both MD5 and MD5-sess algorithms. + * + * If the algorithm directive's value is "MD5" or unspecified, then HA1 is + * HA1=MD5(username:realm:password) + * If the algorithm directive's value is "MD5-sess", then HA1 is + * HA1=MD5(MD5(username:realm:password):nonce:cnonce) + */ + var ha1Compute = function (algorithm, user, realm, pass, nonce, cnonce) { + var ha1 = md5(user + ':' + realm + ':' + pass) + if (algorithm && algorithm.toLowerCase() === 'md5-sess') { + return md5(ha1 + ':' + nonce + ':' + cnonce) + } else { + return ha1 + } + } + + var qop = /(^|,)\s*auth\s*($|,)/.test(challenge.qop) && 'auth' + var nc = qop && '00000001' + var cnonce = qop && uuid().replace(/-/g, '') + var ha1 = ha1Compute(challenge.algorithm, self.user, challenge.realm, self.pass, challenge.nonce, cnonce) + var ha2 = md5(method + ':' + path) + var digestResponse = qop + ? md5(ha1 + ':' + challenge.nonce + ':' + nc + ':' + cnonce + ':' + qop + ':' + ha2) + : md5(ha1 + ':' + challenge.nonce + ':' + ha2) + var authValues = { + username: self.user, + realm: challenge.realm, + nonce: challenge.nonce, + uri: path, + qop: qop, + response: digestResponse, + nc: nc, + cnonce: cnonce, + algorithm: challenge.algorithm, + opaque: challenge.opaque + } + + authHeader = [] + for (var k in authValues) { + if (authValues[k]) { + if (k === 'qop' || k === 'nc' || k === 'algorithm') { + authHeader.push(k + '=' + authValues[k]) + } else { + authHeader.push(k + '="' + authValues[k] + '"') + } + } + } + authHeader = 'Digest ' + authHeader.join(', ') + self.sentAuth = true + return authHeader +} + +Auth.prototype.onRequest = function (user, pass, sendImmediately, bearer) { + var self = this + var request = self.request + + var authHeader + if (bearer === undefined && user === undefined) { + self.request.emit('error', new Error('no auth mechanism defined')) + } else if (bearer !== undefined) { + authHeader = self.bearer(bearer, sendImmediately) + } else { + authHeader = self.basic(user, pass, sendImmediately) + } + if (authHeader) { + request.setHeader('authorization', authHeader) + } +} + +Auth.prototype.onResponse = function (response) { + var self = this + var request = self.request + + if (!self.hasAuth || self.sentAuth) { return null } + + var c = caseless(response.headers) + + var authHeader = c.get('www-authenticate') + var authVerb = authHeader && authHeader.split(' ')[0].toLowerCase() + request.debug('reauth', authVerb) + + switch (authVerb) { + case 'basic': + return self.basic(self.user, self.pass, true) + + case 'bearer': + return self.bearer(self.bearerToken, true) + + case 'digest': + return self.digest(request.method, request.path, authHeader) + } +} + +exports.Auth = Auth -module.exports = {"$id":"browser.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","version"],"properties":{"name":{"type":"string"},"version":{"type":"string"},"comment":{"type":"string"}}}; /***/ }), -/***/ 595: +/***/ 560: /***/ (function(module) { "use strict"; -module.exports = function generate_enum(it, $keyword, $ruleType) { +module.exports = function generate__limitProperties(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; @@ -20101,8 +17481,8 @@ module.exports = function generate_enum(it, $keyword, $ruleType) { var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; + var $errorKeyword; var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { @@ -20111,30 +17491,41 @@ module.exports = function generate_enum(it, $keyword, $ruleType) { } else { $schemaValue = $schema; } - var $i = 'i' + $lvl, - $vSchema = 'schema' + $lvl; - if (!$isData) { - out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + ';'; - } - out += 'var ' + ($valid) + ';'; + var $op = $keyword == 'maxProperties' ? '>' : '<'; + out += 'if ( '; if ($isData) { - out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {'; + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; } - out += '' + ($valid) + ' = false;for (var ' + ($i) + '=0; ' + ($i) + '<' + ($vSchema) + '.length; ' + ($i) + '++) if (equal(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + '])) { ' + ($valid) + ' = true; break; }'; - if ($isData) { - out += ' } '; - } - out += ' if (!' + ($valid) + ') { '; + out += ' Object.keys(' + ($data) + ').length ' + ($op) + ' ' + ($schemaValue) + ') { '; + var $errorKeyword = $keyword; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { - out += ' { keyword: \'' + ('enum') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValues: schema' + ($lvl) + ' } '; + out += ' { keyword: \'' + ($errorKeyword || '_limitProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; if (it.opts.messages !== false) { - out += ' , message: \'should be equal to one of the allowed values\' '; + out += ' , message: \'should NOT have '; + if ($keyword == 'maxProperties') { + out += 'more'; + } else { + out += 'fewer'; + } + out += ' than '; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + ($schema); + } + out += ' properties\' '; } if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; } out += ' } '; } else { @@ -20152,7 +17543,7 @@ module.exports = function generate_enum(it, $keyword, $ruleType) { } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } - out += ' }'; + out += '} '; if ($breakOnError) { out += ' else { '; } @@ -20162,7 +17553,364 @@ module.exports = function generate_enum(it, $keyword, $ruleType) { /***/ }), -/***/ 601: +/***/ 566: +/***/ (function(module) { + +// API +module.exports = abort; + +/** + * Aborts leftover active jobs + * + * @param {object} state - current state object + */ +function abort(state) +{ + Object.keys(state.jobs).forEach(clean.bind(state)); + + // reset leftover jobs + state.jobs = {}; +} + +/** + * Cleans up leftover job by invoking abort function for the provided job id + * + * @this state + * @param {string|number} key - job id to abort + */ +function clean(key) +{ + if (typeof this.jobs[key] == 'function') + { + this.jobs[key](); + } +} + + +/***/ }), + +/***/ 575: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +module.exports = Signature; + +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var crypto = __webpack_require__(417); +var errs = __webpack_require__(753); +var utils = __webpack_require__(270); +var asn1 = __webpack_require__(62); +var SSHBuffer = __webpack_require__(940); + +var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var SignatureParseError = errs.SignatureParseError; + +function Signature(opts) { + assert.object(opts, 'options'); + assert.arrayOfObject(opts.parts, 'options.parts'); + assert.string(opts.type, 'options.type'); + + var partLookup = {}; + for (var i = 0; i < opts.parts.length; ++i) { + var part = opts.parts[i]; + partLookup[part.name] = part; + } + + this.type = opts.type; + this.hashAlgorithm = opts.hashAlgo; + this.curve = opts.curve; + this.parts = opts.parts; + this.part = partLookup; +} + +Signature.prototype.toBuffer = function (format) { + if (format === undefined) + format = 'asn1'; + assert.string(format, 'format'); + + var buf; + var stype = 'ssh-' + this.type; + + switch (this.type) { + case 'rsa': + switch (this.hashAlgorithm) { + case 'sha256': + stype = 'rsa-sha2-256'; + break; + case 'sha512': + stype = 'rsa-sha2-512'; + break; + case 'sha1': + case undefined: + break; + default: + throw (new Error('SSH signature ' + + 'format does not support hash ' + + 'algorithm ' + this.hashAlgorithm)); + } + if (format === 'ssh') { + buf = new SSHBuffer({}); + buf.writeString(stype); + buf.writePart(this.part.sig); + return (buf.toBuffer()); + } else { + return (this.part.sig.data); + } + break; + + case 'ed25519': + if (format === 'ssh') { + buf = new SSHBuffer({}); + buf.writeString(stype); + buf.writePart(this.part.sig); + return (buf.toBuffer()); + } else { + return (this.part.sig.data); + } + break; + + case 'dsa': + case 'ecdsa': + var r, s; + if (format === 'asn1') { + var der = new asn1.BerWriter(); + der.startSequence(); + r = utils.mpNormalize(this.part.r.data); + s = utils.mpNormalize(this.part.s.data); + der.writeBuffer(r, asn1.Ber.Integer); + der.writeBuffer(s, asn1.Ber.Integer); + der.endSequence(); + return (der.buffer); + } else if (format === 'ssh' && this.type === 'dsa') { + buf = new SSHBuffer({}); + buf.writeString('ssh-dss'); + r = this.part.r.data; + if (r.length > 20 && r[0] === 0x00) + r = r.slice(1); + s = this.part.s.data; + if (s.length > 20 && s[0] === 0x00) + s = s.slice(1); + if ((this.hashAlgorithm && + this.hashAlgorithm !== 'sha1') || + r.length + s.length !== 40) { + throw (new Error('OpenSSH only supports ' + + 'DSA signatures with SHA1 hash')); + } + buf.writeBuffer(Buffer.concat([r, s])); + return (buf.toBuffer()); + } else if (format === 'ssh' && this.type === 'ecdsa') { + var inner = new SSHBuffer({}); + r = this.part.r.data; + inner.writeBuffer(r); + inner.writePart(this.part.s); + + buf = new SSHBuffer({}); + /* XXX: find a more proper way to do this? */ + var curve; + if (r[0] === 0x00) + r = r.slice(1); + var sz = r.length * 8; + if (sz === 256) + curve = 'nistp256'; + else if (sz === 384) + curve = 'nistp384'; + else if (sz === 528) + curve = 'nistp521'; + buf.writeString('ecdsa-sha2-' + curve); + buf.writeBuffer(inner.toBuffer()); + return (buf.toBuffer()); + } + throw (new Error('Invalid signature format')); + default: + throw (new Error('Invalid signature data')); + } +}; + +Signature.prototype.toString = function (format) { + assert.optionalString(format, 'format'); + return (this.toBuffer(format).toString('base64')); +}; + +Signature.parse = function (data, type, format) { + if (typeof (data) === 'string') + data = Buffer.from(data, 'base64'); + assert.buffer(data, 'data'); + assert.string(format, 'format'); + assert.string(type, 'type'); + + var opts = {}; + opts.type = type.toLowerCase(); + opts.parts = []; + + try { + assert.ok(data.length > 0, 'signature must not be empty'); + switch (opts.type) { + case 'rsa': + return (parseOneNum(data, type, format, opts)); + case 'ed25519': + return (parseOneNum(data, type, format, opts)); + + case 'dsa': + case 'ecdsa': + if (format === 'asn1') + return (parseDSAasn1(data, type, format, opts)); + else if (opts.type === 'dsa') + return (parseDSA(data, type, format, opts)); + else + return (parseECDSA(data, type, format, opts)); + + default: + throw (new InvalidAlgorithmError(type)); + } + + } catch (e) { + if (e instanceof InvalidAlgorithmError) + throw (e); + throw (new SignatureParseError(type, format, e)); + } +}; + +function parseOneNum(data, type, format, opts) { + if (format === 'ssh') { + try { + var buf = new SSHBuffer({buffer: data}); + var head = buf.readString(); + } catch (e) { + /* fall through */ + } + if (buf !== undefined) { + var msg = 'SSH signature does not match expected ' + + 'type (expected ' + type + ', got ' + head + ')'; + switch (head) { + case 'ssh-rsa': + assert.strictEqual(type, 'rsa', msg); + opts.hashAlgo = 'sha1'; + break; + case 'rsa-sha2-256': + assert.strictEqual(type, 'rsa', msg); + opts.hashAlgo = 'sha256'; + break; + case 'rsa-sha2-512': + assert.strictEqual(type, 'rsa', msg); + opts.hashAlgo = 'sha512'; + break; + case 'ssh-ed25519': + assert.strictEqual(type, 'ed25519', msg); + opts.hashAlgo = 'sha512'; + break; + default: + throw (new Error('Unknown SSH signature ' + + 'type: ' + head)); + } + var sig = buf.readPart(); + assert.ok(buf.atEnd(), 'extra trailing bytes'); + sig.name = 'sig'; + opts.parts.push(sig); + return (new Signature(opts)); + } + } + opts.parts.push({name: 'sig', data: data}); + return (new Signature(opts)); +} + +function parseDSAasn1(data, type, format, opts) { + var der = new asn1.BerReader(data); + der.readSequence(); + var r = der.readString(asn1.Ber.Integer, true); + var s = der.readString(asn1.Ber.Integer, true); + + opts.parts.push({name: 'r', data: utils.mpNormalize(r)}); + opts.parts.push({name: 's', data: utils.mpNormalize(s)}); + + return (new Signature(opts)); +} + +function parseDSA(data, type, format, opts) { + if (data.length != 40) { + var buf = new SSHBuffer({buffer: data}); + var d = buf.readBuffer(); + if (d.toString('ascii') === 'ssh-dss') + d = buf.readBuffer(); + assert.ok(buf.atEnd(), 'extra trailing bytes'); + assert.strictEqual(d.length, 40, 'invalid inner length'); + data = d; + } + opts.parts.push({name: 'r', data: data.slice(0, 20)}); + opts.parts.push({name: 's', data: data.slice(20, 40)}); + return (new Signature(opts)); +} + +function parseECDSA(data, type, format, opts) { + var buf = new SSHBuffer({buffer: data}); + + var r, s; + var inner = buf.readBuffer(); + var stype = inner.toString('ascii'); + if (stype.slice(0, 6) === 'ecdsa-') { + var parts = stype.split('-'); + assert.strictEqual(parts[0], 'ecdsa'); + assert.strictEqual(parts[1], 'sha2'); + opts.curve = parts[2]; + switch (opts.curve) { + case 'nistp256': + opts.hashAlgo = 'sha256'; + break; + case 'nistp384': + opts.hashAlgo = 'sha384'; + break; + case 'nistp521': + opts.hashAlgo = 'sha512'; + break; + default: + throw (new Error('Unsupported ECDSA curve: ' + + opts.curve)); + } + inner = buf.readBuffer(); + assert.ok(buf.atEnd(), 'extra trailing bytes on outer'); + buf = new SSHBuffer({buffer: inner}); + r = buf.readPart(); + } else { + r = {data: inner}; + } + + s = buf.readPart(); + assert.ok(buf.atEnd(), 'extra trailing bytes'); + + r.name = 'r'; + s.name = 's'; + + opts.parts.push(r); + opts.parts.push(s); + return (new Signature(opts)); +} + +Signature.isSignature = function (obj, ver) { + return (utils.isCompatible(obj, Signature, ver)); +}; + +/* + * API versions for Signature: + * [1,0] -- initial ver + * [2,0] -- support for rsa in full ssh format, compat with sshpk-agent + * hashAlgorithm property + * [2,1] -- first tagged version + */ +Signature.prototype._sshpkApiVersion = [2, 1]; + +Signature._oldVersionDetect = function (obj) { + assert.func(obj.toBuffer); + if (obj.hasOwnProperty('hashAlgorithm')) + return ([2, 0]); + return ([1, 0]); +}; + + +/***/ }), + +/***/ 581: /***/ (function(module) { "use strict"; @@ -20383,136 +18131,198 @@ module.exports = { /***/ }), -/***/ 605: +/***/ 584: /***/ (function(module) { -module.exports = require("http"); +// Copyright 2011 Mark Cavage All rights reserved. + + +module.exports = { + + newInvalidAsn1Error: function (msg) { + var e = new Error(); + e.name = 'InvalidAsn1Error'; + e.message = msg || ''; + return e; + } + +}; + /***/ }), -/***/ 607: +/***/ 602: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; -var crypto = __webpack_require__(417) +var tough = __webpack_require__(701) -function randomString (size) { - var bits = (size + 1) * 6 - var buffer = crypto.randomBytes(Math.ceil(bits / 8)) - var string = buffer.toString('base64').replace(/\+/g, '-').replace(/\//g, '_').replace(/=/g, '') - return string.slice(0, size) +var Cookie = tough.Cookie +var CookieJar = tough.CookieJar + +exports.parse = function (str) { + if (str && str.uri) { + str = str.uri + } + if (typeof str !== 'string') { + throw new Error('The cookie function only accepts STRING as param') + } + return Cookie.parse(str, {loose: true}) } -function calculatePayloadHash (payload, algorithm, contentType) { - var hash = crypto.createHash(algorithm) - hash.update('hawk.1.payload\n') - hash.update((contentType ? contentType.split(';')[0].trim().toLowerCase() : '') + '\n') - hash.update(payload || '') - hash.update('\n') - return hash.digest('base64') +// Adapt the sometimes-Async api of tough.CookieJar to our requirements +function RequestJar (store) { + var self = this + self._jar = new CookieJar(store, {looseMode: true}) +} +RequestJar.prototype.setCookie = function (cookieOrStr, uri, options) { + var self = this + return self._jar.setCookieSync(cookieOrStr, uri, options || {}) +} +RequestJar.prototype.getCookieString = function (uri) { + var self = this + return self._jar.getCookieStringSync(uri) +} +RequestJar.prototype.getCookies = function (uri) { + var self = this + return self._jar.getCookiesSync(uri) } -exports.calculateMac = function (credentials, opts) { - var normalized = 'hawk.1.header\n' + - opts.ts + '\n' + - opts.nonce + '\n' + - (opts.method || '').toUpperCase() + '\n' + - opts.resource + '\n' + - opts.host.toLowerCase() + '\n' + - opts.port + '\n' + - (opts.hash || '') + '\n' - - if (opts.ext) { - normalized = normalized + opts.ext.replace('\\', '\\\\').replace('\n', '\\n') - } - - normalized = normalized + '\n' - - if (opts.app) { - normalized = normalized + opts.app + '\n' + (opts.dlg || '') + '\n' - } - - var hmac = crypto.createHmac(credentials.algorithm, credentials.key).update(normalized) - var digest = hmac.digest('base64') - return digest -} - -exports.header = function (uri, method, opts) { - var timestamp = opts.timestamp || Math.floor((Date.now() + (opts.localtimeOffsetMsec || 0)) / 1000) - var credentials = opts.credentials - if (!credentials || !credentials.id || !credentials.key || !credentials.algorithm) { - return '' - } - - if (['sha1', 'sha256'].indexOf(credentials.algorithm) === -1) { - return '' - } - - var artifacts = { - ts: timestamp, - nonce: opts.nonce || randomString(6), - method: method, - resource: uri.pathname + (uri.search || ''), - host: uri.hostname, - port: uri.port || (uri.protocol === 'http:' ? 80 : 443), - hash: opts.hash, - ext: opts.ext, - app: opts.app, - dlg: opts.dlg - } - - if (!artifacts.hash && (opts.payload || opts.payload === '')) { - artifacts.hash = calculatePayloadHash(opts.payload, credentials.algorithm, opts.contentType) - } - - var mac = exports.calculateMac(credentials, artifacts) - - var hasExt = artifacts.ext !== null && artifacts.ext !== undefined && artifacts.ext !== '' - var header = 'Hawk id="' + credentials.id + - '", ts="' + artifacts.ts + - '", nonce="' + artifacts.nonce + - (artifacts.hash ? '", hash="' + artifacts.hash : '') + - (hasExt ? '", ext="' + artifacts.ext.replace(/\\/g, '\\\\').replace(/"/g, '\\"') : '') + - '", mac="' + mac + '"' - - if (artifacts.app) { - header = header + ', app="' + artifacts.app + (artifacts.dlg ? '", dlg="' + artifacts.dlg : '') + '"' - } - - return header +exports.jar = function (store) { + return new RequestJar(store) } /***/ }), -/***/ 611: -/***/ (function(module) { +/***/ 603: +/***/ (function(module, __unusedexports, __webpack_require__) { -"use strict"; +// Copyright 2015 Joyent, Inc. -module.exports = function generate_comment(it, $keyword, $ruleType) { - var out = ' '; - var $schema = it.schema[$keyword]; - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $comment = it.util.toQuotedString($schema); - if (it.opts.$comment === true) { - out += ' console.log(' + ($comment) + ');'; - } else if (typeof it.opts.$comment == 'function') { - out += ' self._opts.$comment(' + ($comment) + ', ' + (it.util.toQuotedString($errSchemaPath)) + ', validate.root.schema);'; - } - return out; +module.exports = { + read: read, + write: write +}; + +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var rfc4253 = __webpack_require__(538); +var utils = __webpack_require__(270); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); + +var sshpriv = __webpack_require__(78); + +/*JSSTYLED*/ +var SSHKEY_RE = /^([a-z0-9-]+)[ \t]+([a-zA-Z0-9+\/]+[=]*)([ \t]+([^ \t][^\n]*[\n]*)?)?$/; +/*JSSTYLED*/ +var SSHKEY_RE2 = /^([a-z0-9-]+)[ \t\n]+([a-zA-Z0-9+\/][a-zA-Z0-9+\/ \t\n=]*)([^a-zA-Z0-9+\/ \t\n=].*)?$/; + +function read(buf, options) { + if (typeof (buf) !== 'string') { + assert.buffer(buf, 'buf'); + buf = buf.toString('ascii'); + } + + var trimmed = buf.trim().replace(/[\\\r]/g, ''); + var m = trimmed.match(SSHKEY_RE); + if (!m) + m = trimmed.match(SSHKEY_RE2); + assert.ok(m, 'key must match regex'); + + var type = rfc4253.algToKeyType(m[1]); + var kbuf = Buffer.from(m[2], 'base64'); + + /* + * This is a bit tricky. If we managed to parse the key and locate the + * key comment with the regex, then do a non-partial read and assert + * that we have consumed all bytes. If we couldn't locate the key + * comment, though, there may be whitespace shenanigans going on that + * have conjoined the comment to the rest of the key. We do a partial + * read in this case to try to make the best out of a sorry situation. + */ + var key; + var ret = {}; + if (m[4]) { + try { + key = rfc4253.read(kbuf); + + } catch (e) { + m = trimmed.match(SSHKEY_RE2); + assert.ok(m, 'key must match regex'); + kbuf = Buffer.from(m[2], 'base64'); + key = rfc4253.readInternal(ret, 'public', kbuf); + } + } else { + key = rfc4253.readInternal(ret, 'public', kbuf); + } + + assert.strictEqual(type, key.type); + + if (m[4] && m[4].length > 0) { + key.comment = m[4]; + + } else if (ret.consumed) { + /* + * Now the magic: trying to recover the key comment when it's + * gotten conjoined to the key or otherwise shenanigan'd. + * + * Work out how much base64 we used, then drop all non-base64 + * chars from the beginning up to this point in the the string. + * Then offset in this and try to make up for missing = chars. + */ + var data = m[2] + (m[3] ? m[3] : ''); + var realOffset = Math.ceil(ret.consumed / 3) * 4; + data = data.slice(0, realOffset - 2). /*JSSTYLED*/ + replace(/[^a-zA-Z0-9+\/=]/g, '') + + data.slice(realOffset - 2); + + var padding = ret.consumed % 3; + if (padding > 0 && + data.slice(realOffset - 1, realOffset) !== '=') + realOffset--; + while (data.slice(realOffset, realOffset + 1) === '=') + realOffset++; + + /* Finally, grab what we think is the comment & clean it up. */ + var trailer = data.slice(realOffset); + trailer = trailer.replace(/[\r\n]/g, ' '). + replace(/^\s+/, ''); + if (trailer.match(/^[a-zA-Z0-9]/)) + key.comment = trailer; + } + + return (key); +} + +function write(key, options) { + assert.object(key); + if (!Key.isKey(key)) + throw (new Error('Must be a public key')); + + var parts = []; + var alg = rfc4253.keyTypeToAlg(key); + parts.push(alg); + + var buf = rfc4253.write(key); + parts.push(buf.toString('base64')); + + if (key.comment) + parts.push(key.comment); + + return (Buffer.from(parts.join(' '))); } /***/ }), -/***/ 612: +/***/ 605: /***/ (function(module) { -module.exports = {"$id":"response.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["status","statusText","httpVersion","cookies","headers","content","redirectURL","headersSize","bodySize"],"properties":{"status":{"type":"integer"},"statusText":{"type":"string"},"httpVersion":{"type":"string"},"cookies":{"type":"array","items":{"$ref":"cookie.json#"}},"headers":{"type":"array","items":{"$ref":"header.json#"}},"content":{"$ref":"content.json#"},"redirectURL":{"type":"string"},"headersSize":{"type":"integer"},"bodySize":{"type":"integer"},"comment":{"type":"string"}}}; +module.exports = require("http"); /***/ }), @@ -20523,399 +18333,314 @@ module.exports = require("events"); /***/ }), -/***/ 616: +/***/ 622: /***/ (function(module) { -// Copyright 2011 Mark Cavage All rights reserved. - - -module.exports = { - EOC: 0, - Boolean: 1, - Integer: 2, - BitString: 3, - OctetString: 4, - Null: 5, - OID: 6, - ObjectDescriptor: 7, - External: 8, - Real: 9, // float - Enumeration: 10, - PDV: 11, - Utf8String: 12, - RelativeOID: 13, - Sequence: 16, - Set: 17, - NumericString: 18, - PrintableString: 19, - T61String: 20, - VideotexString: 21, - IA5String: 22, - UTCTime: 23, - GeneralizedTime: 24, - GraphicString: 25, - VisibleString: 26, - GeneralString: 28, - UniversalString: 29, - CharacterString: 30, - BMPString: 31, - Constructor: 32, - Context: 128 -}; - +module.exports = require("path"); /***/ }), -/***/ 619: +/***/ 624: /***/ (function(module, __unusedexports, __webpack_require__) { -"use strict"; +// Copyright 2018 Joyent, Inc. - -var utils = __webpack_require__(601); -var formats = __webpack_require__(167); - -var arrayPrefixGenerators = { - brackets: function brackets(prefix) { // eslint-disable-line func-name-matching - return prefix + '[]'; - }, - indices: function indices(prefix, key) { // eslint-disable-line func-name-matching - return prefix + '[' + key + ']'; - }, - repeat: function repeat(prefix) { // eslint-disable-line func-name-matching - return prefix; - } +module.exports = { + read: read, + write: write }; -var toISO = Date.prototype.toISOString; +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var rfc4253 = __webpack_require__(538); +var Key = __webpack_require__(852); -var defaults = { - delimiter: '&', - encode: true, - encoder: utils.encode, - encodeValuesOnly: false, - serializeDate: function serializeDate(date) { // eslint-disable-line func-name-matching - return toISO.call(date); - }, - skipNulls: false, - strictNullHandling: false -}; +var errors = __webpack_require__(753); -var stringify = function stringify( // eslint-disable-line func-name-matching - object, - prefix, - generateArrayPrefix, - strictNullHandling, - skipNulls, - encoder, - filter, - sort, - allowDots, - serializeDate, - formatter, - encodeValuesOnly -) { - var obj = object; - if (typeof filter === 'function') { - obj = filter(prefix, obj); - } else if (obj instanceof Date) { - obj = serializeDate(obj); - } else if (obj === null) { - if (strictNullHandling) { - return encoder && !encodeValuesOnly ? encoder(prefix, defaults.encoder) : prefix; - } +function read(buf, options) { + var lines = buf.toString('ascii').split(/[\r\n]+/); + var found = false; + var parts; + var si = 0; + while (si < lines.length) { + parts = splitHeader(lines[si++]); + if (parts && + parts[0].toLowerCase() === 'putty-user-key-file-2') { + found = true; + break; + } + } + if (!found) { + throw (new Error('No PuTTY format first line found')); + } + var alg = parts[1]; - obj = ''; - } + parts = splitHeader(lines[si++]); + assert.equal(parts[0].toLowerCase(), 'encryption'); - if (typeof obj === 'string' || typeof obj === 'number' || typeof obj === 'boolean' || utils.isBuffer(obj)) { - if (encoder) { - var keyValue = encodeValuesOnly ? prefix : encoder(prefix, defaults.encoder); - return [formatter(keyValue) + '=' + formatter(encoder(obj, defaults.encoder))]; - } - return [formatter(prefix) + '=' + formatter(String(obj))]; - } + parts = splitHeader(lines[si++]); + assert.equal(parts[0].toLowerCase(), 'comment'); + var comment = parts[1]; - var values = []; + parts = splitHeader(lines[si++]); + assert.equal(parts[0].toLowerCase(), 'public-lines'); + var publicLines = parseInt(parts[1], 10); + if (!isFinite(publicLines) || publicLines < 0 || + publicLines > lines.length) { + throw (new Error('Invalid public-lines count')); + } - if (typeof obj === 'undefined') { - return values; - } + var publicBuf = Buffer.from( + lines.slice(si, si + publicLines).join(''), 'base64'); + var keyType = rfc4253.algToKeyType(alg); + var key = rfc4253.read(publicBuf); + if (key.type !== keyType) { + throw (new Error('Outer key algorithm mismatch')); + } + key.comment = comment; + return (key); +} - var objKeys; - if (Array.isArray(filter)) { - objKeys = filter; - } else { - var keys = Object.keys(obj); - objKeys = sort ? keys.sort(sort) : keys; - } +function splitHeader(line) { + var idx = line.indexOf(':'); + if (idx === -1) + return (null); + var header = line.slice(0, idx); + ++idx; + while (line[idx] === ' ') + ++idx; + var rest = line.slice(idx); + return ([header, rest]); +} - for (var i = 0; i < objKeys.length; ++i) { - var key = objKeys[i]; +function write(key, options) { + assert.object(key); + if (!Key.isKey(key)) + throw (new Error('Must be a public key')); - if (skipNulls && obj[key] === null) { - continue; - } + var alg = rfc4253.keyTypeToAlg(key); + var buf = rfc4253.write(key); + var comment = key.comment || ''; - if (Array.isArray(obj)) { - values = values.concat(stringify( - obj[key], - generateArrayPrefix(prefix, key), - generateArrayPrefix, - strictNullHandling, - skipNulls, - encoder, - filter, - sort, - allowDots, - serializeDate, - formatter, - encodeValuesOnly - )); - } else { - values = values.concat(stringify( - obj[key], - prefix + (allowDots ? '.' + key : '[' + key + ']'), - generateArrayPrefix, - strictNullHandling, - skipNulls, - encoder, - filter, - sort, - allowDots, - serializeDate, - formatter, - encodeValuesOnly - )); - } - } + var b64 = buf.toString('base64'); + var lines = wrap(b64, 64); - return values; -}; + lines.unshift('Public-Lines: ' + lines.length); + lines.unshift('Comment: ' + comment); + lines.unshift('Encryption: none'); + lines.unshift('PuTTY-User-Key-File-2: ' + alg); -module.exports = function (object, opts) { - var obj = object; - var options = opts ? utils.assign({}, opts) : {}; + return (Buffer.from(lines.join('\n') + '\n')); +} - if (options.encoder !== null && options.encoder !== undefined && typeof options.encoder !== 'function') { - throw new TypeError('Encoder has to be a function.'); - } - - var delimiter = typeof options.delimiter === 'undefined' ? defaults.delimiter : options.delimiter; - var strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; - var skipNulls = typeof options.skipNulls === 'boolean' ? options.skipNulls : defaults.skipNulls; - var encode = typeof options.encode === 'boolean' ? options.encode : defaults.encode; - var encoder = typeof options.encoder === 'function' ? options.encoder : defaults.encoder; - var sort = typeof options.sort === 'function' ? options.sort : null; - var allowDots = typeof options.allowDots === 'undefined' ? false : options.allowDots; - var serializeDate = typeof options.serializeDate === 'function' ? options.serializeDate : defaults.serializeDate; - var encodeValuesOnly = typeof options.encodeValuesOnly === 'boolean' ? options.encodeValuesOnly : defaults.encodeValuesOnly; - if (typeof options.format === 'undefined') { - options.format = formats['default']; - } else if (!Object.prototype.hasOwnProperty.call(formats.formatters, options.format)) { - throw new TypeError('Unknown format option provided.'); - } - var formatter = formats.formatters[options.format]; - var objKeys; - var filter; - - if (typeof options.filter === 'function') { - filter = options.filter; - obj = filter('', obj); - } else if (Array.isArray(options.filter)) { - filter = options.filter; - objKeys = filter; - } - - var keys = []; - - if (typeof obj !== 'object' || obj === null) { - return ''; - } - - var arrayFormat; - if (options.arrayFormat in arrayPrefixGenerators) { - arrayFormat = options.arrayFormat; - } else if ('indices' in options) { - arrayFormat = options.indices ? 'indices' : 'repeat'; - } else { - arrayFormat = 'indices'; - } - - var generateArrayPrefix = arrayPrefixGenerators[arrayFormat]; - - if (!objKeys) { - objKeys = Object.keys(obj); - } - - if (sort) { - objKeys.sort(sort); - } - - for (var i = 0; i < objKeys.length; ++i) { - var key = objKeys[i]; - - if (skipNulls && obj[key] === null) { - continue; - } - - keys = keys.concat(stringify( - obj[key], - key, - generateArrayPrefix, - strictNullHandling, - skipNulls, - encode ? encoder : null, - filter, - sort, - allowDots, - serializeDate, - formatter, - encodeValuesOnly - )); - } - - var joined = keys.join(delimiter); - var prefix = options.addQueryPrefix === true ? '?' : ''; - - return joined.length > 0 ? prefix + joined : ''; -}; - - -/***/ }), - -/***/ 622: -/***/ (function(__unusedmodule, __unusedexports, __webpack_require__) { - -const core = __webpack_require__(827); -const exec = __webpack_require__(120); -const request = __webpack_require__(470); -const fs = __webpack_require__(747); - -let fail_ci; -try { - const name = core.getInput("name"); - const token = core.getInput("token"); - const flags = core.getInput("flags"); - const file = core.getInput("file"); - fail_ci = core.getInput("fail_ci_if_error").toLowerCase(); - - if ( - fail_ci === "yes" || - fail_ci === "y" || - fail_ci === "true" || - fail_ci === "t" || - fail_ci === "1" - ) { - fail_ci = true; - } else { - fail_ci = false; - } - - request("https://codecov.io/bash", (error, response, body) => { - if (error && fail_ci) { - throw error; - } else if (error) { - core.warning(`Codecov warning: ${error.message}`); - } - - fs.writeFile("codecov.sh", body, err => { - if (err && fail_ci) { - throw err; - } else if (err) { - core.warning(`Codecov warning: ${err.message}`); - } - - let output = ""; - let execError = ""; - const options = {}; - options.listeners = { - stdout: data => { - output += data.toString(); - }, - stderr: data => { - execError += data.toString(); - } - }; - - options.env = { - GITHUB_ACTION: process.env.GITHUB_ACTION, - GITHUB_RUN_ID: process.env.GITHUB_RUN_ID, - GITHUB_REF: process.env.GITHUB_REF, - GITHUB_REPOSITORY: process.env.GITHUB_REPOSITORY, - GITHUB_SHA: process.env.GITHUB_SHA, - GITHUB_HEAD_REF: process.env.GITHUB_HEAD_REF || '' - }; - - if(token){ - options.env.CODECOV_TOKEN = token - } - - const execArgs = ["codecov.sh"]; - if (file) { - execArgs.push( - "-f", `${file}` - ); - } - - execArgs.push( - "-n", `${name}`, - "-F", `${flags}` - ); - - if (fail_ci) { - execArgs.push( - "-Z" - ); - } - - exec.exec("bash", execArgs, options) - .catch(err => { - if (fail_ci) { - core.setFailed( - `Codecov failed with the following error: ${err.message}` - ); - } else { - core.warning(`Codecov warning: ${err.message}`); - } - }) - .then(() => { - unlinkFile(); - });; - - const unlinkFile = () => { - fs.unlink("codecov.sh", err => { - if (err && fail_ci) { - throw err; - } else if (err) { - core.warning(`Codecov warning: ${err.message}`); - } - }); - }; - }); - }); -} catch (error) { - if (fail_ci) { - core.setFailed(`Codecov failed with the following error: ${error.message}`); - } else { - core.warning(`Codecov warning: ${error.message}`); - } +function wrap(txt, len) { + var lines = []; + var pos = 0; + while (pos < txt.length) { + lines.push(txt.slice(pos, pos + 64)); + pos += 64; + } + return (lines); } /***/ }), -/***/ 625: -/***/ (function(module) { +/***/ 627: +/***/ (function(__unusedmodule, exports) { + +"use strict"; +/*! + * Copyright (c) 2015, Salesforce.com, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * 3. Neither the name of Salesforce.com nor the names of its contributors may + * be used to endorse or promote products derived from this software without + * specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +/*jshint unused:false */ + +function Store() { +} +exports.Store = Store; + +// Stores may be synchronous, but are still required to use a +// Continuation-Passing Style API. The CookieJar itself will expose a "*Sync" +// API that converts from synchronous-callbacks to imperative style. +Store.prototype.synchronous = false; + +Store.prototype.findCookie = function(domain, path, key, cb) { + throw new Error('findCookie is not implemented'); +}; + +Store.prototype.findCookies = function(domain, path, cb) { + throw new Error('findCookies is not implemented'); +}; + +Store.prototype.putCookie = function(cookie, cb) { + throw new Error('putCookie is not implemented'); +}; + +Store.prototype.updateCookie = function(oldCookie, newCookie, cb) { + // recommended default implementation: + // return this.putCookie(newCookie, cb); + throw new Error('updateCookie is not implemented'); +}; + +Store.prototype.removeCookie = function(domain, path, key, cb) { + throw new Error('removeCookie is not implemented'); +}; + +Store.prototype.removeCookies = function(domain, path, cb) { + throw new Error('removeCookies is not implemented'); +}; + +Store.prototype.removeAllCookies = function(cb) { + throw new Error('removeAllCookies is not implemented'); +} + +Store.prototype.getAllCookies = function(cb) { + throw new Error('getAllCookies is not implemented (therefore jar cannot be serialized)'); +}; -module.exports = {"$id":"entry.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["startedDateTime","time","request","response","cache","timings"],"properties":{"pageref":{"type":"string"},"startedDateTime":{"type":"string","format":"date-time","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))"},"time":{"type":"number","min":0},"request":{"$ref":"request.json#"},"response":{"$ref":"response.json#"},"cache":{"$ref":"cache.json#"},"timings":{"$ref":"timings.json#"},"serverIPAddress":{"type":"string","oneOf":[{"format":"ipv4"},{"format":"ipv6"}]},"connection":{"type":"string"},"comment":{"type":"string"}}}; /***/ }), -/***/ 630: +/***/ 628: /***/ (function(module) { -module.exports = {"$id":"cookie.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","value"],"properties":{"name":{"type":"string"},"value":{"type":"string"},"path":{"type":"string"},"domain":{"type":"string"},"expires":{"type":["string","null"],"format":"date-time"},"httpOnly":{"type":"boolean"},"secure":{"type":"boolean"},"comment":{"type":"string"}}}; +"use strict"; + + +var KEYWORDS = [ + 'multipleOf', + 'maximum', + 'exclusiveMaximum', + 'minimum', + 'exclusiveMinimum', + 'maxLength', + 'minLength', + 'pattern', + 'additionalItems', + 'maxItems', + 'minItems', + 'uniqueItems', + 'maxProperties', + 'minProperties', + 'required', + 'additionalProperties', + 'enum', + 'format', + 'const' +]; + +module.exports = function (metaSchema, keywordsJsonPointers) { + for (var i=0; i + */ + +/* + * The Blowfish portions are under the following license: + * + * Blowfish block cipher for OpenBSD + * Copyright 1997 Niels Provos + * All rights reserved. + * + * Implementation advice by David Mazieres . + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 3. The name of the author may not be used to endorse or promote products + * derived from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR + * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +/* + * The bcrypt_pbkdf portions are under the following license: + * + * Copyright (c) 2013 Ted Unangst + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ + +/* + * Performance improvements (Javascript-specific): + * + * Copyright 2016, Joyent Inc + * Author: Alex Wilson + * + * Permission to use, copy, modify, and distribute this software for any + * purpose with or without fee is hereby granted, provided that the above + * copyright notice and this permission notice appear in all copies. + * + * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES + * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF + * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR + * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES + * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN + * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF + * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + */ + +// Ported from OpenBSD bcrypt_pbkdf.c v1.9 + +var BLF_J = 0; + +var Blowfish = function() { + this.S = [ + new Uint32Array([ + 0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7, + 0xb8e1afed, 0x6a267e96, 0xba7c9045, 0xf12c7f99, + 0x24a19947, 0xb3916cf7, 0x0801f2e2, 0x858efc16, + 0x636920d8, 0x71574e69, 0xa458fea3, 0xf4933d7e, + 0x0d95748f, 0x728eb658, 0x718bcd58, 0x82154aee, + 0x7b54a41d, 0xc25a59b5, 0x9c30d539, 0x2af26013, + 0xc5d1b023, 0x286085f0, 0xca417918, 0xb8db38ef, + 0x8e79dcb0, 0x603a180e, 0x6c9e0e8b, 0xb01e8a3e, + 0xd71577c1, 0xbd314b27, 0x78af2fda, 0x55605c60, + 0xe65525f3, 0xaa55ab94, 0x57489862, 0x63e81440, + 0x55ca396a, 0x2aab10b6, 0xb4cc5c34, 0x1141e8ce, + 0xa15486af, 0x7c72e993, 0xb3ee1411, 0x636fbc2a, + 0x2ba9c55d, 0x741831f6, 0xce5c3e16, 0x9b87931e, + 0xafd6ba33, 0x6c24cf5c, 0x7a325381, 0x28958677, + 0x3b8f4898, 0x6b4bb9af, 0xc4bfe81b, 0x66282193, + 0x61d809cc, 0xfb21a991, 0x487cac60, 0x5dec8032, + 0xef845d5d, 0xe98575b1, 0xdc262302, 0xeb651b88, + 0x23893e81, 0xd396acc5, 0x0f6d6ff3, 0x83f44239, + 0x2e0b4482, 0xa4842004, 0x69c8f04a, 0x9e1f9b5e, + 0x21c66842, 0xf6e96c9a, 0x670c9c61, 0xabd388f0, + 0x6a51a0d2, 0xd8542f68, 0x960fa728, 0xab5133a3, + 0x6eef0b6c, 0x137a3be4, 0xba3bf050, 0x7efb2a98, + 0xa1f1651d, 0x39af0176, 0x66ca593e, 0x82430e88, + 0x8cee8619, 0x456f9fb4, 0x7d84a5c3, 0x3b8b5ebe, + 0xe06f75d8, 0x85c12073, 0x401a449f, 0x56c16aa6, + 0x4ed3aa62, 0x363f7706, 0x1bfedf72, 0x429b023d, + 0x37d0d724, 0xd00a1248, 0xdb0fead3, 0x49f1c09b, + 0x075372c9, 0x80991b7b, 0x25d479d8, 0xf6e8def7, + 0xe3fe501a, 0xb6794c3b, 0x976ce0bd, 0x04c006ba, + 0xc1a94fb6, 0x409f60c4, 0x5e5c9ec2, 0x196a2463, + 0x68fb6faf, 0x3e6c53b5, 0x1339b2eb, 0x3b52ec6f, + 0x6dfc511f, 0x9b30952c, 0xcc814544, 0xaf5ebd09, + 0xbee3d004, 0xde334afd, 0x660f2807, 0x192e4bb3, + 0xc0cba857, 0x45c8740f, 0xd20b5f39, 0xb9d3fbdb, + 0x5579c0bd, 0x1a60320a, 0xd6a100c6, 0x402c7279, + 0x679f25fe, 0xfb1fa3cc, 0x8ea5e9f8, 0xdb3222f8, + 0x3c7516df, 0xfd616b15, 0x2f501ec8, 0xad0552ab, + 0x323db5fa, 0xfd238760, 0x53317b48, 0x3e00df82, + 0x9e5c57bb, 0xca6f8ca0, 0x1a87562e, 0xdf1769db, + 0xd542a8f6, 0x287effc3, 0xac6732c6, 0x8c4f5573, + 0x695b27b0, 0xbbca58c8, 0xe1ffa35d, 0xb8f011a0, + 0x10fa3d98, 0xfd2183b8, 0x4afcb56c, 0x2dd1d35b, + 0x9a53e479, 0xb6f84565, 0xd28e49bc, 0x4bfb9790, + 0xe1ddf2da, 0xa4cb7e33, 0x62fb1341, 0xcee4c6e8, + 0xef20cada, 0x36774c01, 0xd07e9efe, 0x2bf11fb4, + 0x95dbda4d, 0xae909198, 0xeaad8e71, 0x6b93d5a0, + 0xd08ed1d0, 0xafc725e0, 0x8e3c5b2f, 0x8e7594b7, + 0x8ff6e2fb, 0xf2122b64, 0x8888b812, 0x900df01c, + 0x4fad5ea0, 0x688fc31c, 0xd1cff191, 0xb3a8c1ad, + 0x2f2f2218, 0xbe0e1777, 0xea752dfe, 0x8b021fa1, + 0xe5a0cc0f, 0xb56f74e8, 0x18acf3d6, 0xce89e299, + 0xb4a84fe0, 0xfd13e0b7, 0x7cc43b81, 0xd2ada8d9, + 0x165fa266, 0x80957705, 0x93cc7314, 0x211a1477, + 0xe6ad2065, 0x77b5fa86, 0xc75442f5, 0xfb9d35cf, + 0xebcdaf0c, 0x7b3e89a0, 0xd6411bd3, 0xae1e7e49, + 0x00250e2d, 0x2071b35e, 0x226800bb, 0x57b8e0af, + 0x2464369b, 0xf009b91e, 0x5563911d, 0x59dfa6aa, + 0x78c14389, 0xd95a537f, 0x207d5ba2, 0x02e5b9c5, + 0x83260376, 0x6295cfa9, 0x11c81968, 0x4e734a41, + 0xb3472dca, 0x7b14a94a, 0x1b510052, 0x9a532915, + 0xd60f573f, 0xbc9bc6e4, 0x2b60a476, 0x81e67400, + 0x08ba6fb5, 0x571be91f, 0xf296ec6b, 0x2a0dd915, + 0xb6636521, 0xe7b9f9b6, 0xff34052e, 0xc5855664, + 0x53b02d5d, 0xa99f8fa1, 0x08ba4799, 0x6e85076a]), + new Uint32Array([ + 0x4b7a70e9, 0xb5b32944, 0xdb75092e, 0xc4192623, + 0xad6ea6b0, 0x49a7df7d, 0x9cee60b8, 0x8fedb266, + 0xecaa8c71, 0x699a17ff, 0x5664526c, 0xc2b19ee1, + 0x193602a5, 0x75094c29, 0xa0591340, 0xe4183a3e, + 0x3f54989a, 0x5b429d65, 0x6b8fe4d6, 0x99f73fd6, + 0xa1d29c07, 0xefe830f5, 0x4d2d38e6, 0xf0255dc1, + 0x4cdd2086, 0x8470eb26, 0x6382e9c6, 0x021ecc5e, + 0x09686b3f, 0x3ebaefc9, 0x3c971814, 0x6b6a70a1, + 0x687f3584, 0x52a0e286, 0xb79c5305, 0xaa500737, + 0x3e07841c, 0x7fdeae5c, 0x8e7d44ec, 0x5716f2b8, + 0xb03ada37, 0xf0500c0d, 0xf01c1f04, 0x0200b3ff, + 0xae0cf51a, 0x3cb574b2, 0x25837a58, 0xdc0921bd, + 0xd19113f9, 0x7ca92ff6, 0x94324773, 0x22f54701, + 0x3ae5e581, 0x37c2dadc, 0xc8b57634, 0x9af3dda7, + 0xa9446146, 0x0fd0030e, 0xecc8c73e, 0xa4751e41, + 0xe238cd99, 0x3bea0e2f, 0x3280bba1, 0x183eb331, + 0x4e548b38, 0x4f6db908, 0x6f420d03, 0xf60a04bf, + 0x2cb81290, 0x24977c79, 0x5679b072, 0xbcaf89af, + 0xde9a771f, 0xd9930810, 0xb38bae12, 0xdccf3f2e, + 0x5512721f, 0x2e6b7124, 0x501adde6, 0x9f84cd87, + 0x7a584718, 0x7408da17, 0xbc9f9abc, 0xe94b7d8c, + 0xec7aec3a, 0xdb851dfa, 0x63094366, 0xc464c3d2, + 0xef1c1847, 0x3215d908, 0xdd433b37, 0x24c2ba16, + 0x12a14d43, 0x2a65c451, 0x50940002, 0x133ae4dd, + 0x71dff89e, 0x10314e55, 0x81ac77d6, 0x5f11199b, + 0x043556f1, 0xd7a3c76b, 0x3c11183b, 0x5924a509, + 0xf28fe6ed, 0x97f1fbfa, 0x9ebabf2c, 0x1e153c6e, + 0x86e34570, 0xeae96fb1, 0x860e5e0a, 0x5a3e2ab3, + 0x771fe71c, 0x4e3d06fa, 0x2965dcb9, 0x99e71d0f, + 0x803e89d6, 0x5266c825, 0x2e4cc978, 0x9c10b36a, + 0xc6150eba, 0x94e2ea78, 0xa5fc3c53, 0x1e0a2df4, + 0xf2f74ea7, 0x361d2b3d, 0x1939260f, 0x19c27960, + 0x5223a708, 0xf71312b6, 0xebadfe6e, 0xeac31f66, + 0xe3bc4595, 0xa67bc883, 0xb17f37d1, 0x018cff28, + 0xc332ddef, 0xbe6c5aa5, 0x65582185, 0x68ab9802, + 0xeecea50f, 0xdb2f953b, 0x2aef7dad, 0x5b6e2f84, + 0x1521b628, 0x29076170, 0xecdd4775, 0x619f1510, + 0x13cca830, 0xeb61bd96, 0x0334fe1e, 0xaa0363cf, + 0xb5735c90, 0x4c70a239, 0xd59e9e0b, 0xcbaade14, + 0xeecc86bc, 0x60622ca7, 0x9cab5cab, 0xb2f3846e, + 0x648b1eaf, 0x19bdf0ca, 0xa02369b9, 0x655abb50, + 0x40685a32, 0x3c2ab4b3, 0x319ee9d5, 0xc021b8f7, + 0x9b540b19, 0x875fa099, 0x95f7997e, 0x623d7da8, + 0xf837889a, 0x97e32d77, 0x11ed935f, 0x16681281, + 0x0e358829, 0xc7e61fd6, 0x96dedfa1, 0x7858ba99, + 0x57f584a5, 0x1b227263, 0x9b83c3ff, 0x1ac24696, + 0xcdb30aeb, 0x532e3054, 0x8fd948e4, 0x6dbc3128, + 0x58ebf2ef, 0x34c6ffea, 0xfe28ed61, 0xee7c3c73, + 0x5d4a14d9, 0xe864b7e3, 0x42105d14, 0x203e13e0, + 0x45eee2b6, 0xa3aaabea, 0xdb6c4f15, 0xfacb4fd0, + 0xc742f442, 0xef6abbb5, 0x654f3b1d, 0x41cd2105, + 0xd81e799e, 0x86854dc7, 0xe44b476a, 0x3d816250, + 0xcf62a1f2, 0x5b8d2646, 0xfc8883a0, 0xc1c7b6a3, + 0x7f1524c3, 0x69cb7492, 0x47848a0b, 0x5692b285, + 0x095bbf00, 0xad19489d, 0x1462b174, 0x23820e00, + 0x58428d2a, 0x0c55f5ea, 0x1dadf43e, 0x233f7061, + 0x3372f092, 0x8d937e41, 0xd65fecf1, 0x6c223bdb, + 0x7cde3759, 0xcbee7460, 0x4085f2a7, 0xce77326e, + 0xa6078084, 0x19f8509e, 0xe8efd855, 0x61d99735, + 0xa969a7aa, 0xc50c06c2, 0x5a04abfc, 0x800bcadc, + 0x9e447a2e, 0xc3453484, 0xfdd56705, 0x0e1e9ec9, + 0xdb73dbd3, 0x105588cd, 0x675fda79, 0xe3674340, + 0xc5c43465, 0x713e38d8, 0x3d28f89e, 0xf16dff20, + 0x153e21e7, 0x8fb03d4a, 0xe6e39f2b, 0xdb83adf7]), + new Uint32Array([ + 0xe93d5a68, 0x948140f7, 0xf64c261c, 0x94692934, + 0x411520f7, 0x7602d4f7, 0xbcf46b2e, 0xd4a20068, + 0xd4082471, 0x3320f46a, 0x43b7d4b7, 0x500061af, + 0x1e39f62e, 0x97244546, 0x14214f74, 0xbf8b8840, + 0x4d95fc1d, 0x96b591af, 0x70f4ddd3, 0x66a02f45, + 0xbfbc09ec, 0x03bd9785, 0x7fac6dd0, 0x31cb8504, + 0x96eb27b3, 0x55fd3941, 0xda2547e6, 0xabca0a9a, + 0x28507825, 0x530429f4, 0x0a2c86da, 0xe9b66dfb, + 0x68dc1462, 0xd7486900, 0x680ec0a4, 0x27a18dee, + 0x4f3ffea2, 0xe887ad8c, 0xb58ce006, 0x7af4d6b6, + 0xaace1e7c, 0xd3375fec, 0xce78a399, 0x406b2a42, + 0x20fe9e35, 0xd9f385b9, 0xee39d7ab, 0x3b124e8b, + 0x1dc9faf7, 0x4b6d1856, 0x26a36631, 0xeae397b2, + 0x3a6efa74, 0xdd5b4332, 0x6841e7f7, 0xca7820fb, + 0xfb0af54e, 0xd8feb397, 0x454056ac, 0xba489527, + 0x55533a3a, 0x20838d87, 0xfe6ba9b7, 0xd096954b, + 0x55a867bc, 0xa1159a58, 0xcca92963, 0x99e1db33, + 0xa62a4a56, 0x3f3125f9, 0x5ef47e1c, 0x9029317c, + 0xfdf8e802, 0x04272f70, 0x80bb155c, 0x05282ce3, + 0x95c11548, 0xe4c66d22, 0x48c1133f, 0xc70f86dc, + 0x07f9c9ee, 0x41041f0f, 0x404779a4, 0x5d886e17, + 0x325f51eb, 0xd59bc0d1, 0xf2bcc18f, 0x41113564, + 0x257b7834, 0x602a9c60, 0xdff8e8a3, 0x1f636c1b, + 0x0e12b4c2, 0x02e1329e, 0xaf664fd1, 0xcad18115, + 0x6b2395e0, 0x333e92e1, 0x3b240b62, 0xeebeb922, + 0x85b2a20e, 0xe6ba0d99, 0xde720c8c, 0x2da2f728, + 0xd0127845, 0x95b794fd, 0x647d0862, 0xe7ccf5f0, + 0x5449a36f, 0x877d48fa, 0xc39dfd27, 0xf33e8d1e, + 0x0a476341, 0x992eff74, 0x3a6f6eab, 0xf4f8fd37, + 0xa812dc60, 0xa1ebddf8, 0x991be14c, 0xdb6e6b0d, + 0xc67b5510, 0x6d672c37, 0x2765d43b, 0xdcd0e804, + 0xf1290dc7, 0xcc00ffa3, 0xb5390f92, 0x690fed0b, + 0x667b9ffb, 0xcedb7d9c, 0xa091cf0b, 0xd9155ea3, + 0xbb132f88, 0x515bad24, 0x7b9479bf, 0x763bd6eb, + 0x37392eb3, 0xcc115979, 0x8026e297, 0xf42e312d, + 0x6842ada7, 0xc66a2b3b, 0x12754ccc, 0x782ef11c, + 0x6a124237, 0xb79251e7, 0x06a1bbe6, 0x4bfb6350, + 0x1a6b1018, 0x11caedfa, 0x3d25bdd8, 0xe2e1c3c9, + 0x44421659, 0x0a121386, 0xd90cec6e, 0xd5abea2a, + 0x64af674e, 0xda86a85f, 0xbebfe988, 0x64e4c3fe, + 0x9dbc8057, 0xf0f7c086, 0x60787bf8, 0x6003604d, + 0xd1fd8346, 0xf6381fb0, 0x7745ae04, 0xd736fccc, + 0x83426b33, 0xf01eab71, 0xb0804187, 0x3c005e5f, + 0x77a057be, 0xbde8ae24, 0x55464299, 0xbf582e61, + 0x4e58f48f, 0xf2ddfda2, 0xf474ef38, 0x8789bdc2, + 0x5366f9c3, 0xc8b38e74, 0xb475f255, 0x46fcd9b9, + 0x7aeb2661, 0x8b1ddf84, 0x846a0e79, 0x915f95e2, + 0x466e598e, 0x20b45770, 0x8cd55591, 0xc902de4c, + 0xb90bace1, 0xbb8205d0, 0x11a86248, 0x7574a99e, + 0xb77f19b6, 0xe0a9dc09, 0x662d09a1, 0xc4324633, + 0xe85a1f02, 0x09f0be8c, 0x4a99a025, 0x1d6efe10, + 0x1ab93d1d, 0x0ba5a4df, 0xa186f20f, 0x2868f169, + 0xdcb7da83, 0x573906fe, 0xa1e2ce9b, 0x4fcd7f52, + 0x50115e01, 0xa70683fa, 0xa002b5c4, 0x0de6d027, + 0x9af88c27, 0x773f8641, 0xc3604c06, 0x61a806b5, + 0xf0177a28, 0xc0f586e0, 0x006058aa, 0x30dc7d62, + 0x11e69ed7, 0x2338ea63, 0x53c2dd94, 0xc2c21634, + 0xbbcbee56, 0x90bcb6de, 0xebfc7da1, 0xce591d76, + 0x6f05e409, 0x4b7c0188, 0x39720a3d, 0x7c927c24, + 0x86e3725f, 0x724d9db9, 0x1ac15bb4, 0xd39eb8fc, + 0xed545578, 0x08fca5b5, 0xd83d7cd3, 0x4dad0fc4, + 0x1e50ef5e, 0xb161e6f8, 0xa28514d9, 0x6c51133c, + 0x6fd5c7e7, 0x56e14ec4, 0x362abfce, 0xddc6c837, + 0xd79a3234, 0x92638212, 0x670efa8e, 0x406000e0]), + new Uint32Array([ + 0x3a39ce37, 0xd3faf5cf, 0xabc27737, 0x5ac52d1b, + 0x5cb0679e, 0x4fa33742, 0xd3822740, 0x99bc9bbe, + 0xd5118e9d, 0xbf0f7315, 0xd62d1c7e, 0xc700c47b, + 0xb78c1b6b, 0x21a19045, 0xb26eb1be, 0x6a366eb4, + 0x5748ab2f, 0xbc946e79, 0xc6a376d2, 0x6549c2c8, + 0x530ff8ee, 0x468dde7d, 0xd5730a1d, 0x4cd04dc6, + 0x2939bbdb, 0xa9ba4650, 0xac9526e8, 0xbe5ee304, + 0xa1fad5f0, 0x6a2d519a, 0x63ef8ce2, 0x9a86ee22, + 0xc089c2b8, 0x43242ef6, 0xa51e03aa, 0x9cf2d0a4, + 0x83c061ba, 0x9be96a4d, 0x8fe51550, 0xba645bd6, + 0x2826a2f9, 0xa73a3ae1, 0x4ba99586, 0xef5562e9, + 0xc72fefd3, 0xf752f7da, 0x3f046f69, 0x77fa0a59, + 0x80e4a915, 0x87b08601, 0x9b09e6ad, 0x3b3ee593, + 0xe990fd5a, 0x9e34d797, 0x2cf0b7d9, 0x022b8b51, + 0x96d5ac3a, 0x017da67d, 0xd1cf3ed6, 0x7c7d2d28, + 0x1f9f25cf, 0xadf2b89b, 0x5ad6b472, 0x5a88f54c, + 0xe029ac71, 0xe019a5e6, 0x47b0acfd, 0xed93fa9b, + 0xe8d3c48d, 0x283b57cc, 0xf8d56629, 0x79132e28, + 0x785f0191, 0xed756055, 0xf7960e44, 0xe3d35e8c, + 0x15056dd4, 0x88f46dba, 0x03a16125, 0x0564f0bd, + 0xc3eb9e15, 0x3c9057a2, 0x97271aec, 0xa93a072a, + 0x1b3f6d9b, 0x1e6321f5, 0xf59c66fb, 0x26dcf319, + 0x7533d928, 0xb155fdf5, 0x03563482, 0x8aba3cbb, + 0x28517711, 0xc20ad9f8, 0xabcc5167, 0xccad925f, + 0x4de81751, 0x3830dc8e, 0x379d5862, 0x9320f991, + 0xea7a90c2, 0xfb3e7bce, 0x5121ce64, 0x774fbe32, + 0xa8b6e37e, 0xc3293d46, 0x48de5369, 0x6413e680, + 0xa2ae0810, 0xdd6db224, 0x69852dfd, 0x09072166, + 0xb39a460a, 0x6445c0dd, 0x586cdecf, 0x1c20c8ae, + 0x5bbef7dd, 0x1b588d40, 0xccd2017f, 0x6bb4e3bb, + 0xdda26a7e, 0x3a59ff45, 0x3e350a44, 0xbcb4cdd5, + 0x72eacea8, 0xfa6484bb, 0x8d6612ae, 0xbf3c6f47, + 0xd29be463, 0x542f5d9e, 0xaec2771b, 0xf64e6370, + 0x740e0d8d, 0xe75b1357, 0xf8721671, 0xaf537d5d, + 0x4040cb08, 0x4eb4e2cc, 0x34d2466a, 0x0115af84, + 0xe1b00428, 0x95983a1d, 0x06b89fb4, 0xce6ea048, + 0x6f3f3b82, 0x3520ab82, 0x011a1d4b, 0x277227f8, + 0x611560b1, 0xe7933fdc, 0xbb3a792b, 0x344525bd, + 0xa08839e1, 0x51ce794b, 0x2f32c9b7, 0xa01fbac9, + 0xe01cc87e, 0xbcc7d1f6, 0xcf0111c3, 0xa1e8aac7, + 0x1a908749, 0xd44fbd9a, 0xd0dadecb, 0xd50ada38, + 0x0339c32a, 0xc6913667, 0x8df9317c, 0xe0b12b4f, + 0xf79e59b7, 0x43f5bb3a, 0xf2d519ff, 0x27d9459c, + 0xbf97222c, 0x15e6fc2a, 0x0f91fc71, 0x9b941525, + 0xfae59361, 0xceb69ceb, 0xc2a86459, 0x12baa8d1, + 0xb6c1075e, 0xe3056a0c, 0x10d25065, 0xcb03a442, + 0xe0ec6e0e, 0x1698db3b, 0x4c98a0be, 0x3278e964, + 0x9f1f9532, 0xe0d392df, 0xd3a0342b, 0x8971f21e, + 0x1b0a7441, 0x4ba3348c, 0xc5be7120, 0xc37632d8, + 0xdf359f8d, 0x9b992f2e, 0xe60b6f47, 0x0fe3f11d, + 0xe54cda54, 0x1edad891, 0xce6279cf, 0xcd3e7e6f, + 0x1618b166, 0xfd2c1d05, 0x848fd2c5, 0xf6fb2299, + 0xf523f357, 0xa6327623, 0x93a83531, 0x56cccd02, + 0xacf08162, 0x5a75ebb5, 0x6e163697, 0x88d273cc, + 0xde966292, 0x81b949d0, 0x4c50901b, 0x71c65614, + 0xe6c6c7bd, 0x327a140a, 0x45e1d006, 0xc3f27b9a, + 0xc9aa53fd, 0x62a80f00, 0xbb25bfe2, 0x35bdd2f6, + 0x71126905, 0xb2040222, 0xb6cbcf7c, 0xcd769c2b, + 0x53113ec0, 0x1640e3d3, 0x38abbd60, 0x2547adf0, + 0xba38209c, 0xf746ce76, 0x77afa1c5, 0x20756060, + 0x85cbfe4e, 0x8ae88dd8, 0x7aaaf9b0, 0x4cf9aa7e, + 0x1948c25c, 0x02fb8a8c, 0x01c36ae4, 0xd6ebe1f9, + 0x90d4f869, 0xa65cdea0, 0x3f09252d, 0xc208e69f, + 0xb74e6132, 0xce77e25b, 0x578fdfe3, 0x3ac372e6]) + ]; + this.P = new Uint32Array([ + 0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344, + 0xa4093822, 0x299f31d0, 0x082efa98, 0xec4e6c89, + 0x452821e6, 0x38d01377, 0xbe5466cf, 0x34e90c6c, + 0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5, 0xb5470917, + 0x9216d5d9, 0x8979fb1b]); +}; + +function F(S, x8, i) { + return (((S[0][x8[i+3]] + + S[1][x8[i+2]]) ^ + S[2][x8[i+1]]) + + S[3][x8[i]]); +}; + +Blowfish.prototype.encipher = function(x, x8) { + if (x8 === undefined) { + x8 = new Uint8Array(x.buffer); + if (x.byteOffset !== 0) + x8 = x8.subarray(x.byteOffset); + } + x[0] ^= this.P[0]; + for (var i = 1; i < 16; i += 2) { + x[1] ^= F(this.S, x8, 0) ^ this.P[i]; + x[0] ^= F(this.S, x8, 4) ^ this.P[i+1]; + } + var t = x[0]; + x[0] = x[1] ^ this.P[17]; + x[1] = t; +}; + +Blowfish.prototype.decipher = function(x) { + var x8 = new Uint8Array(x.buffer); + if (x.byteOffset !== 0) + x8 = x8.subarray(x.byteOffset); + x[0] ^= this.P[17]; + for (var i = 16; i > 0; i -= 2) { + x[1] ^= F(this.S, x8, 0) ^ this.P[i]; + x[0] ^= F(this.S, x8, 4) ^ this.P[i-1]; + } + var t = x[0]; + x[0] = x[1] ^ this.P[0]; + x[1] = t; +}; + +function stream2word(data, databytes){ + var i, temp = 0; + for (i = 0; i < 4; i++, BLF_J++) { + if (BLF_J >= databytes) BLF_J = 0; + temp = (temp << 8) | data[BLF_J]; + } + return temp; +}; + +Blowfish.prototype.expand0state = function(key, keybytes) { + var d = new Uint32Array(2), i, k; + var d8 = new Uint8Array(d.buffer); + + for (i = 0, BLF_J = 0; i < 18; i++) { + this.P[i] ^= stream2word(key, keybytes); + } + BLF_J = 0; + + for (i = 0; i < 18; i += 2) { + this.encipher(d, d8); + this.P[i] = d[0]; + this.P[i+1] = d[1]; + } + + for (i = 0; i < 4; i++) { + for (k = 0; k < 256; k += 2) { + this.encipher(d, d8); + this.S[i][k] = d[0]; + this.S[i][k+1] = d[1]; + } + } +}; + +Blowfish.prototype.expandstate = function(data, databytes, key, keybytes) { + var d = new Uint32Array(2), i, k; + + for (i = 0, BLF_J = 0; i < 18; i++) { + this.P[i] ^= stream2word(key, keybytes); + } + + for (i = 0, BLF_J = 0; i < 18; i += 2) { + d[0] ^= stream2word(data, databytes); + d[1] ^= stream2word(data, databytes); + this.encipher(d); + this.P[i] = d[0]; + this.P[i+1] = d[1]; + } + + for (i = 0; i < 4; i++) { + for (k = 0; k < 256; k += 2) { + d[0] ^= stream2word(data, databytes); + d[1] ^= stream2word(data, databytes); + this.encipher(d); + this.S[i][k] = d[0]; + this.S[i][k+1] = d[1]; + } + } + BLF_J = 0; +}; + +Blowfish.prototype.enc = function(data, blocks) { + for (var i = 0; i < blocks; i++) { + this.encipher(data.subarray(i*2)); + } +}; + +Blowfish.prototype.dec = function(data, blocks) { + for (var i = 0; i < blocks; i++) { + this.decipher(data.subarray(i*2)); + } +}; + +var BCRYPT_BLOCKS = 8, + BCRYPT_HASHSIZE = 32; + +function bcrypt_hash(sha2pass, sha2salt, out) { + var state = new Blowfish(), + cdata = new Uint32Array(BCRYPT_BLOCKS), i, + ciphertext = new Uint8Array([79,120,121,99,104,114,111,109,97,116,105, + 99,66,108,111,119,102,105,115,104,83,119,97,116,68,121,110,97,109, + 105,116,101]); //"OxychromaticBlowfishSwatDynamite" + + state.expandstate(sha2salt, 64, sha2pass, 64); + for (i = 0; i < 64; i++) { + state.expand0state(sha2salt, 64); + state.expand0state(sha2pass, 64); + } + + for (i = 0; i < BCRYPT_BLOCKS; i++) + cdata[i] = stream2word(ciphertext, ciphertext.byteLength); + for (i = 0; i < 64; i++) + state.enc(cdata, cdata.byteLength / 8); + + for (i = 0; i < BCRYPT_BLOCKS; i++) { + out[4*i+3] = cdata[i] >>> 24; + out[4*i+2] = cdata[i] >>> 16; + out[4*i+1] = cdata[i] >>> 8; + out[4*i+0] = cdata[i]; + } +}; + +function bcrypt_pbkdf(pass, passlen, salt, saltlen, key, keylen, rounds) { + var sha2pass = new Uint8Array(64), + sha2salt = new Uint8Array(64), + out = new Uint8Array(BCRYPT_HASHSIZE), + tmpout = new Uint8Array(BCRYPT_HASHSIZE), + countsalt = new Uint8Array(saltlen+4), + i, j, amt, stride, dest, count, + origkeylen = keylen; + + if (rounds < 1) + return -1; + if (passlen === 0 || saltlen === 0 || keylen === 0 || + keylen > (out.byteLength * out.byteLength) || saltlen > (1<<20)) + return -1; + + stride = Math.floor((keylen + out.byteLength - 1) / out.byteLength); + amt = Math.floor((keylen + stride - 1) / stride); + + for (i = 0; i < saltlen; i++) + countsalt[i] = salt[i]; + + crypto_hash_sha512(sha2pass, pass, passlen); + + for (count = 1; keylen > 0; count++) { + countsalt[saltlen+0] = count >>> 24; + countsalt[saltlen+1] = count >>> 16; + countsalt[saltlen+2] = count >>> 8; + countsalt[saltlen+3] = count; + + crypto_hash_sha512(sha2salt, countsalt, saltlen + 4); + bcrypt_hash(sha2pass, sha2salt, tmpout); + for (i = out.byteLength; i--;) + out[i] = tmpout[i]; + + for (i = 1; i < rounds; i++) { + crypto_hash_sha512(sha2salt, tmpout, tmpout.byteLength); + bcrypt_hash(sha2pass, sha2salt, tmpout); + for (j = 0; j < out.byteLength; j++) + out[j] ^= tmpout[j]; + } + + amt = Math.min(amt, keylen); + for (i = 0; i < amt; i++) { + dest = i * stride + (count - 1); + if (dest >= origkeylen) + break; + key[dest] = out[i]; + } + keylen -= i; + } + + return 0; +}; + +module.exports = { + BLOCKS: BCRYPT_BLOCKS, + HASHSIZE: BCRYPT_HASHSIZE, + hash: bcrypt_hash, + pbkdf: bcrypt_pbkdf +}; + + +/***/ }), + +/***/ 643: /***/ (function(module) { "use strict"; -module.exports = function generate_custom(it, $keyword, $ruleType) { +module.exports = function generate_items(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; @@ -20939,10 +19228,637 @@ module.exports = function generate_custom(it, $keyword, $ruleType) { var $schemaPath = it.schemaPath + it.util.getProperty($keyword); var $errSchemaPath = it.errSchemaPath + '/' + $keyword; var $breakOnError = !it.opts.allErrors; - var $errorKeyword; var $data = 'data' + ($dataLvl || ''); var $valid = 'valid' + $lvl; var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $idx = 'i' + $lvl, + $dataNxt = $it.dataLevel = it.dataLevel + 1, + $nextData = 'data' + $dataNxt, + $currentBaseId = it.baseId; + out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; + if (Array.isArray($schema)) { + var $additionalItems = it.schema.additionalItems; + if ($additionalItems === false) { + out += ' ' + ($valid) + ' = ' + ($data) + '.length <= ' + ($schema.length) + '; '; + var $currErrSchemaPath = $errSchemaPath; + $errSchemaPath = it.errSchemaPath + '/additionalItems'; + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('additionalItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schema.length) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT have more than ' + ($schema.length) + ' items\' '; + } + if (it.opts.verbose) { + out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + $errSchemaPath = $currErrSchemaPath; + if ($breakOnError) { + $closingBraces += '}'; + out += ' else { '; + } + } + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { + out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($i) + ') { '; + var $passData = $data + '[' + $i + ']'; + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + $it.errorPath = it.util.getPathExpr(it.errorPath, $i, it.opts.jsonPointers, true); + $it.dataPathArr[$dataNxt] = $i; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + out += ' } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } + } + if (typeof $additionalItems == 'object' && (it.opts.strictKeywords ? typeof $additionalItems == 'object' && Object.keys($additionalItems).length > 0 : it.util.schemaHasRules($additionalItems, it.RULES.all))) { + $it.schema = $additionalItems; + $it.schemaPath = it.schemaPath + '.additionalItems'; + $it.errSchemaPath = it.errSchemaPath + '/additionalItems'; + out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($schema.length) + ') { for (var ' + ($idx) + ' = ' + ($schema.length) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; + $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); + var $passData = $data + '[' + $idx + ']'; + $it.dataPathArr[$dataNxt] = $idx; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + out += ' } } '; + if ($breakOnError) { + out += ' if (' + ($nextValid) + ') { '; + $closingBraces += '}'; + } + } + } else if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + out += ' for (var ' + ($idx) + ' = ' + (0) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { '; + $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true); + var $passData = $data + '[' + $idx + ']'; + $it.dataPathArr[$dataNxt] = $idx; + var $code = it.validate($it); + $it.baseId = $currentBaseId; + if (it.util.varOccurences($code, $nextData) < 2) { + out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + } else { + out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + } + if ($breakOnError) { + out += ' if (!' + ($nextValid) + ') break; '; + } + out += ' }'; + } + if ($breakOnError) { + out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; + } + out = it.util.cleanUpCode(out); + return out; +} + + +/***/ }), + +/***/ 650: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +var Key = __webpack_require__(852); +var Fingerprint = __webpack_require__(400); +var Signature = __webpack_require__(575); +var PrivateKey = __webpack_require__(502); +var Certificate = __webpack_require__(752); +var Identity = __webpack_require__(378); +var errs = __webpack_require__(753); + +module.exports = { + /* top-level classes */ + Key: Key, + parseKey: Key.parse, + Fingerprint: Fingerprint, + parseFingerprint: Fingerprint.parse, + Signature: Signature, + parseSignature: Signature.parse, + PrivateKey: PrivateKey, + parsePrivateKey: PrivateKey.parse, + generatePrivateKey: PrivateKey.generate, + Certificate: Certificate, + parseCertificate: Certificate.parse, + createSelfSignedCertificate: Certificate.createSelfSigned, + createCertificate: Certificate.create, + Identity: Identity, + identityFromDN: Identity.parseDN, + identityForHost: Identity.forHost, + identityForUser: Identity.forUser, + identityForEmail: Identity.forEmail, + identityFromArray: Identity.fromArray, + + /* errors */ + FingerprintFormatError: errs.FingerprintFormatError, + InvalidAlgorithmError: errs.InvalidAlgorithmError, + KeyParseError: errs.KeyParseError, + SignatureParseError: errs.SignatureParseError, + KeyEncryptedError: errs.KeyEncryptedError, + CertificateParseError: errs.CertificateParseError +}; + + +/***/ }), + +/***/ 653: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate_oneOf(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + var $closingBraces = ''; + $it.level++; + var $nextValid = 'valid' + $it.level; + var $currentBaseId = $it.baseId, + $prevValid = 'prevValid' + $lvl, + $passingSchemas = 'passingSchemas' + $lvl; + out += 'var ' + ($errs) + ' = errors , ' + ($prevValid) + ' = false , ' + ($valid) + ' = false , ' + ($passingSchemas) + ' = null; '; + var $wasComposite = it.compositeRule; + it.compositeRule = $it.compositeRule = true; + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + } else { + out += ' var ' + ($nextValid) + ' = true; '; + } + if ($i) { + out += ' if (' + ($nextValid) + ' && ' + ($prevValid) + ') { ' + ($valid) + ' = false; ' + ($passingSchemas) + ' = [' + ($passingSchemas) + ', ' + ($i) + ']; } else { '; + $closingBraces += '}'; + } + out += ' if (' + ($nextValid) + ') { ' + ($valid) + ' = ' + ($prevValid) + ' = true; ' + ($passingSchemas) + ' = ' + ($i) + '; }'; + } + } + it.compositeRule = $it.compositeRule = $wasComposite; + out += '' + ($closingBraces) + 'if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('oneOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { passingSchemas: ' + ($passingSchemas) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should match exactly one schema in oneOf\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError(vErrors); '; + } else { + out += ' validate.errors = vErrors; return false; '; + } + } + out += '} else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; }'; + if (it.opts.allErrors) { + out += ' } '; + } + return out; +} + + +/***/ }), + +/***/ 658: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +var aws4 = exports, + url = __webpack_require__(835), + querystring = __webpack_require__(191), + crypto = __webpack_require__(417), + lru = __webpack_require__(985), + credentialsCache = lru(1000) + +// http://docs.amazonwebservices.com/general/latest/gr/signature-version-4.html + +function hmac(key, string, encoding) { + return crypto.createHmac('sha256', key).update(string, 'utf8').digest(encoding) +} + +function hash(string, encoding) { + return crypto.createHash('sha256').update(string, 'utf8').digest(encoding) +} + +// This function assumes the string has already been percent encoded +function encodeRfc3986(urlEncodedString) { + return urlEncodedString.replace(/[!'()*]/g, function(c) { + return '%' + c.charCodeAt(0).toString(16).toUpperCase() + }) +} + +function encodeRfc3986Full(str) { + return encodeRfc3986(encodeURIComponent(str)) +} + +// request: { path | body, [host], [method], [headers], [service], [region] } +// credentials: { accessKeyId, secretAccessKey, [sessionToken] } +function RequestSigner(request, credentials) { + + if (typeof request === 'string') request = url.parse(request) + + var headers = request.headers = (request.headers || {}), + hostParts = this.matchHost(request.hostname || request.host || headers.Host || headers.host) + + this.request = request + this.credentials = credentials || this.defaultCredentials() + + this.service = request.service || hostParts[0] || '' + this.region = request.region || hostParts[1] || 'us-east-1' + + // SES uses a different domain from the service name + if (this.service === 'email') this.service = 'ses' + + if (!request.method && request.body) + request.method = 'POST' + + if (!headers.Host && !headers.host) { + headers.Host = request.hostname || request.host || this.createHost() + + // If a port is specified explicitly, use it as is + if (request.port) + headers.Host += ':' + request.port + } + if (!request.hostname && !request.host) + request.hostname = headers.Host || headers.host + + this.isCodeCommitGit = this.service === 'codecommit' && request.method === 'GIT' +} + +RequestSigner.prototype.matchHost = function(host) { + var match = (host || '').match(/([^\.]+)\.(?:([^\.]*)\.)?amazonaws\.com(\.cn)?$/) + var hostParts = (match || []).slice(1, 3) + + // ES's hostParts are sometimes the other way round, if the value that is expected + // to be region equals ‘es’ switch them back + // e.g. search-cluster-name-aaaa00aaaa0aaa0aaaaaaa0aaa.us-east-1.es.amazonaws.com + if (hostParts[1] === 'es') + hostParts = hostParts.reverse() + + return hostParts +} + +// http://docs.aws.amazon.com/general/latest/gr/rande.html +RequestSigner.prototype.isSingleRegion = function() { + // Special case for S3 and SimpleDB in us-east-1 + if (['s3', 'sdb'].indexOf(this.service) >= 0 && this.region === 'us-east-1') return true + + return ['cloudfront', 'ls', 'route53', 'iam', 'importexport', 'sts'] + .indexOf(this.service) >= 0 +} + +RequestSigner.prototype.createHost = function() { + var region = this.isSingleRegion() ? '' : + (this.service === 's3' && this.region !== 'us-east-1' ? '-' : '.') + this.region, + service = this.service === 'ses' ? 'email' : this.service + return service + region + '.amazonaws.com' +} + +RequestSigner.prototype.prepareRequest = function() { + this.parsePath() + + var request = this.request, headers = request.headers, query + + if (request.signQuery) { + + this.parsedPath.query = query = this.parsedPath.query || {} + + if (this.credentials.sessionToken) + query['X-Amz-Security-Token'] = this.credentials.sessionToken + + if (this.service === 's3' && !query['X-Amz-Expires']) + query['X-Amz-Expires'] = 86400 + + if (query['X-Amz-Date']) + this.datetime = query['X-Amz-Date'] + else + query['X-Amz-Date'] = this.getDateTime() + + query['X-Amz-Algorithm'] = 'AWS4-HMAC-SHA256' + query['X-Amz-Credential'] = this.credentials.accessKeyId + '/' + this.credentialString() + query['X-Amz-SignedHeaders'] = this.signedHeaders() + + } else { + + if (!request.doNotModifyHeaders && !this.isCodeCommitGit) { + if (request.body && !headers['Content-Type'] && !headers['content-type']) + headers['Content-Type'] = 'application/x-www-form-urlencoded; charset=utf-8' + + if (request.body && !headers['Content-Length'] && !headers['content-length']) + headers['Content-Length'] = Buffer.byteLength(request.body) + + if (this.credentials.sessionToken && !headers['X-Amz-Security-Token'] && !headers['x-amz-security-token']) + headers['X-Amz-Security-Token'] = this.credentials.sessionToken + + if (this.service === 's3' && !headers['X-Amz-Content-Sha256'] && !headers['x-amz-content-sha256']) + headers['X-Amz-Content-Sha256'] = hash(this.request.body || '', 'hex') + + if (headers['X-Amz-Date'] || headers['x-amz-date']) + this.datetime = headers['X-Amz-Date'] || headers['x-amz-date'] + else + headers['X-Amz-Date'] = this.getDateTime() + } + + delete headers.Authorization + delete headers.authorization + } +} + +RequestSigner.prototype.sign = function() { + if (!this.parsedPath) this.prepareRequest() + + if (this.request.signQuery) { + this.parsedPath.query['X-Amz-Signature'] = this.signature() + } else { + this.request.headers.Authorization = this.authHeader() + } + + this.request.path = this.formatPath() + + return this.request +} + +RequestSigner.prototype.getDateTime = function() { + if (!this.datetime) { + var headers = this.request.headers, + date = new Date(headers.Date || headers.date || new Date) + + this.datetime = date.toISOString().replace(/[:\-]|\.\d{3}/g, '') + + // Remove the trailing 'Z' on the timestamp string for CodeCommit git access + if (this.isCodeCommitGit) this.datetime = this.datetime.slice(0, -1) + } + return this.datetime +} + +RequestSigner.prototype.getDate = function() { + return this.getDateTime().substr(0, 8) +} + +RequestSigner.prototype.authHeader = function() { + return [ + 'AWS4-HMAC-SHA256 Credential=' + this.credentials.accessKeyId + '/' + this.credentialString(), + 'SignedHeaders=' + this.signedHeaders(), + 'Signature=' + this.signature(), + ].join(', ') +} + +RequestSigner.prototype.signature = function() { + var date = this.getDate(), + cacheKey = [this.credentials.secretAccessKey, date, this.region, this.service].join(), + kDate, kRegion, kService, kCredentials = credentialsCache.get(cacheKey) + if (!kCredentials) { + kDate = hmac('AWS4' + this.credentials.secretAccessKey, date) + kRegion = hmac(kDate, this.region) + kService = hmac(kRegion, this.service) + kCredentials = hmac(kService, 'aws4_request') + credentialsCache.set(cacheKey, kCredentials) + } + return hmac(kCredentials, this.stringToSign(), 'hex') +} + +RequestSigner.prototype.stringToSign = function() { + return [ + 'AWS4-HMAC-SHA256', + this.getDateTime(), + this.credentialString(), + hash(this.canonicalString(), 'hex'), + ].join('\n') +} + +RequestSigner.prototype.canonicalString = function() { + if (!this.parsedPath) this.prepareRequest() + + var pathStr = this.parsedPath.path, + query = this.parsedPath.query, + headers = this.request.headers, + queryStr = '', + normalizePath = this.service !== 's3', + decodePath = this.service === 's3' || this.request.doNotEncodePath, + decodeSlashesInPath = this.service === 's3', + firstValOnly = this.service === 's3', + bodyHash + + if (this.service === 's3' && this.request.signQuery) { + bodyHash = 'UNSIGNED-PAYLOAD' + } else if (this.isCodeCommitGit) { + bodyHash = '' + } else { + bodyHash = headers['X-Amz-Content-Sha256'] || headers['x-amz-content-sha256'] || + hash(this.request.body || '', 'hex') + } + + if (query) { + var reducedQuery = Object.keys(query).reduce(function(obj, key) { + if (!key) return obj + obj[encodeRfc3986Full(key)] = !Array.isArray(query[key]) ? query[key] : + (firstValOnly ? query[key][0] : query[key]) + return obj + }, {}) + var encodedQueryPieces = [] + Object.keys(reducedQuery).sort().forEach(function(key) { + if (!Array.isArray(reducedQuery[key])) { + encodedQueryPieces.push(key + '=' + encodeRfc3986Full(reducedQuery[key])) + } else { + reducedQuery[key].map(encodeRfc3986Full).sort() + .forEach(function(val) { encodedQueryPieces.push(key + '=' + val) }) + } + }) + queryStr = encodedQueryPieces.join('&') + } + if (pathStr !== '/') { + if (normalizePath) pathStr = pathStr.replace(/\/{2,}/g, '/') + pathStr = pathStr.split('/').reduce(function(path, piece) { + if (normalizePath && piece === '..') { + path.pop() + } else if (!normalizePath || piece !== '.') { + if (decodePath) piece = decodeURIComponent(piece).replace(/\+/g, ' ') + path.push(encodeRfc3986Full(piece)) + } + return path + }, []).join('/') + if (pathStr[0] !== '/') pathStr = '/' + pathStr + if (decodeSlashesInPath) pathStr = pathStr.replace(/%2F/g, '/') + } + + return [ + this.request.method || 'GET', + pathStr, + queryStr, + this.canonicalHeaders() + '\n', + this.signedHeaders(), + bodyHash, + ].join('\n') +} + +RequestSigner.prototype.canonicalHeaders = function() { + var headers = this.request.headers + function trimAll(header) { + return header.toString().trim().replace(/\s+/g, ' ') + } + return Object.keys(headers) + .sort(function(a, b) { return a.toLowerCase() < b.toLowerCase() ? -1 : 1 }) + .map(function(key) { return key.toLowerCase() + ':' + trimAll(headers[key]) }) + .join('\n') +} + +RequestSigner.prototype.signedHeaders = function() { + return Object.keys(this.request.headers) + .map(function(key) { return key.toLowerCase() }) + .sort() + .join(';') +} + +RequestSigner.prototype.credentialString = function() { + return [ + this.getDate(), + this.region, + this.service, + 'aws4_request', + ].join('/') +} + +RequestSigner.prototype.defaultCredentials = function() { + var env = process.env + return { + accessKeyId: env.AWS_ACCESS_KEY_ID || env.AWS_ACCESS_KEY, + secretAccessKey: env.AWS_SECRET_ACCESS_KEY || env.AWS_SECRET_KEY, + sessionToken: env.AWS_SESSION_TOKEN, + } +} + +RequestSigner.prototype.parsePath = function() { + var path = this.request.path || '/' + + // S3 doesn't always encode characters > 127 correctly and + // all services don't encode characters > 255 correctly + // So if there are non-reserved chars (and it's not already all % encoded), just encode them all + if (/[^0-9A-Za-z;,/?:@&=+$\-_.!~*'()#%]/.test(path)) { + path = encodeURI(decodeURI(path)) + } + + var queryIx = path.indexOf('?'), + query = null + + if (queryIx >= 0) { + query = querystring.parse(path.slice(queryIx + 1)) + path = path.slice(0, queryIx) + } + + this.parsedPath = { + path: path, + query: query, + } +} + +RequestSigner.prototype.formatPath = function() { + var path = this.parsedPath.path, + query = this.parsedPath.query + + if (!query) return path + + // Services don't support empty query string keys + if (query[''] != null) delete query[''] + + return path + '?' + encodeRfc3986(querystring.stringify(query)) +} + +aws4.RequestSigner = RequestSigner + +aws4.sign = function(request, credentials) { + return new RequestSigner(request, credentials).sign() +} + + +/***/ }), + +/***/ 662: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate_const(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; var $isData = it.opts.$data && $schema && $schema.$data, $schemaValue; if ($isData) { @@ -20951,130 +19867,329 @@ module.exports = function generate_custom(it, $keyword, $ruleType) { } else { $schemaValue = $schema; } - var $rule = this, - $definition = 'definition' + $lvl, - $rDef = $rule.definition, - $closingBraces = ''; - var $compile, $inline, $macro, $ruleValidate, $validateCode; - if ($isData && $rDef.$data) { - $validateCode = 'keywordValidate' + $lvl; - var $validateSchema = $rDef.validateSchema; - out += ' var ' + ($definition) + ' = RULES.custom[\'' + ($keyword) + '\'].definition; var ' + ($validateCode) + ' = ' + ($definition) + '.validate;'; + if (!$isData) { + out += ' var schema' + ($lvl) + ' = validate.schema' + ($schemaPath) + ';'; + } + out += 'var ' + ($valid) + ' = equal(' + ($data) + ', schema' + ($lvl) + '); if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('const') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValue: schema' + ($lvl) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be equal to constant\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; } else { - $ruleValidate = it.useCustomRule($rule, $schema, it.schema, it); - if (!$ruleValidate) return; - $schemaValue = 'validate.schema' + $schemaPath; - $validateCode = $ruleValidate.code; - $compile = $rDef.compile; - $inline = $rDef.inline; - $macro = $rDef.macro; + out += ' {} '; } - var $ruleErrs = $validateCode + '.errors', - $i = 'i' + $lvl, - $ruleErr = 'ruleErr' + $lvl, - $asyncKeyword = $rDef.async; - if ($asyncKeyword && !it.async) throw new Error('async keyword in sync schema'); - if (!($inline || $macro)) { - out += '' + ($ruleErrs) + ' = null;'; - } - out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';'; - if ($isData && $rDef.$data) { - $closingBraces += '}'; - out += ' if (' + ($schemaValue) + ' === undefined) { ' + ($valid) + ' = true; } else { '; - if ($validateSchema) { - $closingBraces += '}'; - out += ' ' + ($valid) + ' = ' + ($definition) + '.validateSchema(' + ($schemaValue) + '); if (' + ($valid) + ') { '; - } - } - if ($inline) { - if ($rDef.statements) { - out += ' ' + ($ruleValidate.validate) + ' '; + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; } else { - out += ' ' + ($valid) + ' = ' + ($ruleValidate.validate) + '; '; + out += ' validate.errors = [' + (__err) + ']; return false; '; } - } else if ($macro) { - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - $it.schema = $ruleValidate.validate; - $it.schemaPath = ''; + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' }'; + if ($breakOnError) { + out += ' else { '; + } + return out; +} + + +/***/ }), + +/***/ 669: +/***/ (function(module) { + +module.exports = require("util"); + +/***/ }), + +/***/ 671: +/***/ (function(module, __unusedexports, __webpack_require__) { + +"use strict"; + + +module.exports = { + afterRequest: __webpack_require__(140), + beforeRequest: __webpack_require__(820), + browser: __webpack_require__(222), + cache: __webpack_require__(993), + content: __webpack_require__(162), + cookie: __webpack_require__(326), + creator: __webpack_require__(776), + entry: __webpack_require__(919), + har: __webpack_require__(41), + header: __webpack_require__(883), + log: __webpack_require__(319), + page: __webpack_require__(744), + pageTimings: __webpack_require__(181), + postData: __webpack_require__(740), + query: __webpack_require__(813), + request: __webpack_require__(380), + response: __webpack_require__(226), + timings: __webpack_require__(758) +} + + +/***/ }), + +/***/ 672: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +"use strict"; + +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +var _a; +Object.defineProperty(exports, "__esModule", { value: true }); +const assert_1 = __webpack_require__(357); +const fs = __webpack_require__(747); +const path = __webpack_require__(622); +_a = fs.promises, exports.chmod = _a.chmod, exports.copyFile = _a.copyFile, exports.lstat = _a.lstat, exports.mkdir = _a.mkdir, exports.readdir = _a.readdir, exports.readlink = _a.readlink, exports.rename = _a.rename, exports.rmdir = _a.rmdir, exports.stat = _a.stat, exports.symlink = _a.symlink, exports.unlink = _a.unlink; +exports.IS_WINDOWS = process.platform === 'win32'; +function exists(fsPath) { + return __awaiter(this, void 0, void 0, function* () { + try { + yield exports.stat(fsPath); + } + catch (err) { + if (err.code === 'ENOENT') { + return false; + } + throw err; + } + return true; + }); +} +exports.exists = exists; +function isDirectory(fsPath, useStat = false) { + return __awaiter(this, void 0, void 0, function* () { + const stats = useStat ? yield exports.stat(fsPath) : yield exports.lstat(fsPath); + return stats.isDirectory(); + }); +} +exports.isDirectory = isDirectory; +/** + * On OSX/Linux, true if path starts with '/'. On Windows, true for paths like: + * \, \hello, \\hello\share, C:, and C:\hello (and corresponding alternate separator cases). + */ +function isRooted(p) { + p = normalizeSeparators(p); + if (!p) { + throw new Error('isRooted() parameter "p" cannot be empty'); + } + if (exports.IS_WINDOWS) { + return (p.startsWith('\\') || /^[A-Z]:/i.test(p) // e.g. \ or \hello or \\hello + ); // e.g. C: or C:\hello + } + return p.startsWith('/'); +} +exports.isRooted = isRooted; +/** + * Recursively create a directory at `fsPath`. + * + * This implementation is optimistic, meaning it attempts to create the full + * path first, and backs up the path stack from there. + * + * @param fsPath The path to create + * @param maxDepth The maximum recursion depth + * @param depth The current recursion depth + */ +function mkdirP(fsPath, maxDepth = 1000, depth = 1) { + return __awaiter(this, void 0, void 0, function* () { + assert_1.ok(fsPath, 'a path argument must be provided'); + fsPath = path.resolve(fsPath); + if (depth >= maxDepth) + return exports.mkdir(fsPath); + try { + yield exports.mkdir(fsPath); + return; + } + catch (err) { + switch (err.code) { + case 'ENOENT': { + yield mkdirP(path.dirname(fsPath), maxDepth, depth + 1); + yield exports.mkdir(fsPath); + return; + } + default: { + let stats; + try { + stats = yield exports.stat(fsPath); + } + catch (err2) { + throw err; + } + if (!stats.isDirectory()) + throw err; + } + } + } + }); +} +exports.mkdirP = mkdirP; +/** + * Best effort attempt to determine whether a file exists and is executable. + * @param filePath file path to check + * @param extensions additional file extensions to try + * @return if file exists and is executable, returns the file path. otherwise empty string. + */ +function tryGetExecutablePath(filePath, extensions) { + return __awaiter(this, void 0, void 0, function* () { + let stats = undefined; + try { + // test file exists + stats = yield exports.stat(filePath); + } + catch (err) { + if (err.code !== 'ENOENT') { + // eslint-disable-next-line no-console + console.log(`Unexpected error attempting to determine if executable file exists '${filePath}': ${err}`); + } + } + if (stats && stats.isFile()) { + if (exports.IS_WINDOWS) { + // on Windows, test for valid extension + const upperExt = path.extname(filePath).toUpperCase(); + if (extensions.some(validExt => validExt.toUpperCase() === upperExt)) { + return filePath; + } + } + else { + if (isUnixExecutable(stats)) { + return filePath; + } + } + } + // try each extension + const originalFilePath = filePath; + for (const extension of extensions) { + filePath = originalFilePath + extension; + stats = undefined; + try { + stats = yield exports.stat(filePath); + } + catch (err) { + if (err.code !== 'ENOENT') { + // eslint-disable-next-line no-console + console.log(`Unexpected error attempting to determine if executable file exists '${filePath}': ${err}`); + } + } + if (stats && stats.isFile()) { + if (exports.IS_WINDOWS) { + // preserve the case of the actual file (since an extension was appended) + try { + const directory = path.dirname(filePath); + const upperName = path.basename(filePath).toUpperCase(); + for (const actualName of yield exports.readdir(directory)) { + if (upperName === actualName.toUpperCase()) { + filePath = path.join(directory, actualName); + break; + } + } + } + catch (err) { + // eslint-disable-next-line no-console + console.log(`Unexpected error attempting to determine the actual case of the file '${filePath}': ${err}`); + } + return filePath; + } + else { + if (isUnixExecutable(stats)) { + return filePath; + } + } + } + } + return ''; + }); +} +exports.tryGetExecutablePath = tryGetExecutablePath; +function normalizeSeparators(p) { + p = p || ''; + if (exports.IS_WINDOWS) { + // convert slashes on Windows + p = p.replace(/\//g, '\\'); + // remove redundant slashes + return p.replace(/\\\\+/g, '\\'); + } + // remove redundant slashes + return p.replace(/\/\/+/g, '/'); +} +// on Mac/Linux, test the execute bit +// R W X R W X R W X +// 256 128 64 32 16 8 4 2 1 +function isUnixExecutable(stats) { + return ((stats.mode & 1) > 0 || + ((stats.mode & 8) > 0 && stats.gid === process.getgid()) || + ((stats.mode & 64) > 0 && stats.uid === process.getuid())); +} +//# sourceMappingURL=io-util.js.map + +/***/ }), + +/***/ 673: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate_not(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $errs = 'errs__' + $lvl; + var $it = it.util.copy(it); + $it.level++; + var $nextValid = 'valid' + $it.level; + if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { + $it.schema = $schema; + $it.schemaPath = $schemaPath; + $it.errSchemaPath = $errSchemaPath; + out += ' var ' + ($errs) + ' = errors; '; var $wasComposite = it.compositeRule; it.compositeRule = $it.compositeRule = true; - var $code = it.validate($it).replace(/validate\.schema/g, $validateCode); + $it.createErrors = false; + var $allErrorsOption; + if ($it.opts.allErrors) { + $allErrorsOption = $it.opts.allErrors; + $it.opts.allErrors = false; + } + out += ' ' + (it.validate($it)) + ' '; + $it.createErrors = true; + if ($allErrorsOption) $it.opts.allErrors = $allErrorsOption; it.compositeRule = $it.compositeRule = $wasComposite; - out += ' ' + ($code); - } else { - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; - out += ' ' + ($validateCode) + '.call( '; - if (it.opts.passContext) { - out += 'this'; - } else { - out += 'self'; - } - if ($compile || $rDef.schema === false) { - out += ' , ' + ($data) + ' '; - } else { - out += ' , ' + ($schemaValue) + ' , ' + ($data) + ' , validate.schema' + (it.schemaPath) + ' '; - } - out += ' , (dataPath || \'\')'; - if (it.errorPath != '""') { - out += ' + ' + (it.errorPath); - } - var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', - $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; - out += ' , ' + ($parentData) + ' , ' + ($parentDataProperty) + ' , rootData ) '; - var def_callRuleValidate = out; - out = $$outStack.pop(); - if ($rDef.errors === false) { - out += ' ' + ($valid) + ' = '; - if ($asyncKeyword) { - out += 'await '; - } - out += '' + (def_callRuleValidate) + '; '; - } else { - if ($asyncKeyword) { - $ruleErrs = 'customErrors' + $lvl; - out += ' var ' + ($ruleErrs) + ' = null; try { ' + ($valid) + ' = await ' + (def_callRuleValidate) + '; } catch (e) { ' + ($valid) + ' = false; if (e instanceof ValidationError) ' + ($ruleErrs) + ' = e.errors; else throw e; } '; - } else { - out += ' ' + ($ruleErrs) + ' = null; ' + ($valid) + ' = ' + (def_callRuleValidate) + '; '; - } - } - } - if ($rDef.modifying) { - out += ' if (' + ($parentData) + ') ' + ($data) + ' = ' + ($parentData) + '[' + ($parentDataProperty) + '];'; - } - out += '' + ($closingBraces); - if ($rDef.valid) { - if ($breakOnError) { - out += ' if (true) { '; - } - } else { - out += ' if ( '; - if ($rDef.valid === undefined) { - out += ' !'; - if ($macro) { - out += '' + ($nextValid); - } else { - out += '' + ($valid); - } - } else { - out += ' ' + (!$rDef.valid) + ' '; - } - out += ') { '; - $errorKeyword = $rule.keyword; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; + out += ' if (' + ($nextValid) + ') { '; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || 'custom') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { keyword: \'' + ($rule.keyword) + '\' } '; + out += ' { keyword: \'' + ('not') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; if (it.opts.messages !== false) { - out += ' , message: \'should pass "' + ($rule.keyword) + '" keyword validation\' '; + out += ' , message: \'should NOT be valid\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; @@ -21095,676 +20210,16 @@ module.exports = function generate_custom(it, $keyword, $ruleType) { } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } - var def_customError = out; - out = $$outStack.pop(); - if ($inline) { - if ($rDef.errors) { - if ($rDef.errors != 'full') { - out += ' for (var ' + ($i) + '=' + ($errs) + '; ' + ($i) + ' read file till the end - // - // TODO: Looks like there is bug in Node fs.createReadStream - // it doesn't respect `end` options without `start` options - // Fix it when node fixes it. - // https://github.com/joyent/node/issues/7819 - if (value.end != undefined && value.end != Infinity && value.start != undefined) { - - // when end specified - // no need to calculate range - // inclusive, starts with 0 - callback(null, value.end + 1 - (value.start ? value.start : 0)); - - // not that fast snoopy - } else { - // still need to fetch file size from fs - fs.stat(value.path, function(err, stat) { - - var fileSize; - - if (err) { - callback(err); - return; - } - - // update final size based on the range options - fileSize = stat.size - (value.start ? value.start : 0); - callback(null, fileSize); - }); - } - - // or http response - } else if (value.hasOwnProperty('httpVersion')) { - callback(null, +value.headers['content-length']); - - // or request stream http://github.com/mikeal/request - } else if (value.hasOwnProperty('httpModule')) { - // wait till response come back - value.on('response', function(response) { - value.pause(); - callback(null, +response.headers['content-length']); - }); - value.resume(); - - // something else } else { - callback('Unknown stream'); - } -}; - -FormData.prototype._multiPartHeader = function(field, value, options) { - // custom header specified (as string)? - // it becomes responsible for boundary - // (e.g. to handle extra CRLFs on .NET servers) - if (typeof options.header == 'string') { - return options.header; - } - - var contentDisposition = this._getContentDisposition(value, options); - var contentType = this._getContentType(value, options); - - var contents = ''; - var headers = { - // add custom disposition as third element or keep it two elements if not - 'Content-Disposition': ['form-data', 'name="' + field + '"'].concat(contentDisposition || []), - // if no content type. allow it to be empty array - 'Content-Type': [].concat(contentType || []) - }; - - // allow custom headers. - if (typeof options.header == 'object') { - populate(headers, options.header); - } - - var header; - for (var prop in headers) { - if (!headers.hasOwnProperty(prop)) continue; - header = headers[prop]; - - // skip nullish headers. - if (header == null) { - continue; - } - - // convert all headers to arrays. - if (!Array.isArray(header)) { - header = [header]; - } - - // add non-empty headers. - if (header.length) { - contents += prop + ': ' + header.join('; ') + FormData.LINE_BREAK; - } - } - - return '--' + this.getBoundary() + FormData.LINE_BREAK + contents + FormData.LINE_BREAK; -}; - -FormData.prototype._getContentDisposition = function(value, options) { - - var filename - , contentDisposition - ; - - if (typeof options.filepath === 'string') { - // custom filepath for relative paths - filename = path.normalize(options.filepath).replace(/\\/g, '/'); - } else if (options.filename || value.name || value.path) { - // custom filename take precedence - // formidable and the browser add a name property - // fs- and request- streams have path property - filename = path.basename(options.filename || value.name || value.path); - } else if (value.readable && value.hasOwnProperty('httpVersion')) { - // or try http response - filename = path.basename(value.client._httpMessage.path); - } - - if (filename) { - contentDisposition = 'filename="' + filename + '"'; - } - - return contentDisposition; -}; - -FormData.prototype._getContentType = function(value, options) { - - // use custom content-type above all - var contentType = options.contentType; - - // or try `name` from formidable, browser - if (!contentType && value.name) { - contentType = mime.lookup(value.name); - } - - // or try `path` from fs-, request- streams - if (!contentType && value.path) { - contentType = mime.lookup(value.path); - } - - // or if it's http-reponse - if (!contentType && value.readable && value.hasOwnProperty('httpVersion')) { - contentType = value.headers['content-type']; - } - - // or guess it from the filepath or filename - if (!contentType && (options.filepath || options.filename)) { - contentType = mime.lookup(options.filepath || options.filename); - } - - // fallback to the default content type if `value` is not simple value - if (!contentType && typeof value == 'object') { - contentType = FormData.DEFAULT_CONTENT_TYPE; - } - - return contentType; -}; - -FormData.prototype._multiPartFooter = function() { - return function(next) { - var footer = FormData.LINE_BREAK; - - var lastPart = (this._streams.length === 0); - if (lastPart) { - footer += this._lastBoundary(); - } - - next(footer); - }.bind(this); -}; - -FormData.prototype._lastBoundary = function() { - return '--' + this.getBoundary() + '--' + FormData.LINE_BREAK; -}; - -FormData.prototype.getHeaders = function(userHeaders) { - var header; - var formHeaders = { - 'content-type': 'multipart/form-data; boundary=' + this.getBoundary() - }; - - for (header in userHeaders) { - if (userHeaders.hasOwnProperty(header)) { - formHeaders[header.toLowerCase()] = userHeaders[header]; - } - } - - return formHeaders; -}; - -FormData.prototype.getBoundary = function() { - if (!this._boundary) { - this._generateBoundary(); - } - - return this._boundary; -}; - -FormData.prototype._generateBoundary = function() { - // This generates a 50 character boundary similar to those used by Firefox. - // They are optimized for boyer-moore parsing. - var boundary = '--------------------------'; - for (var i = 0; i < 24; i++) { - boundary += Math.floor(Math.random() * 10).toString(16); - } - - this._boundary = boundary; -}; - -// Note: getLengthSync DOESN'T calculate streams length -// As workaround one can calculate file size manually -// and add it as knownLength option -FormData.prototype.getLengthSync = function() { - var knownLength = this._overheadLength + this._valueLength; - - // Don't get confused, there are 3 "internal" streams for each keyval pair - // so it basically checks if there is any value added to the form - if (this._streams.length) { - knownLength += this._lastBoundary().length; - } - - // https://github.com/form-data/form-data/issues/40 - if (!this.hasKnownLength()) { - // Some async length retrievers are present - // therefore synchronous length calculation is false. - // Please use getLength(callback) to get proper length - this._error(new Error('Cannot calculate proper length in synchronous way.')); - } - - return knownLength; -}; - -// Public API to check if length of added values is known -// https://github.com/form-data/form-data/issues/196 -// https://github.com/form-data/form-data/issues/262 -FormData.prototype.hasKnownLength = function() { - var hasKnownLength = true; - - if (this._valuesToMeasure.length) { - hasKnownLength = false; - } - - return hasKnownLength; -}; - -FormData.prototype.getLength = function(cb) { - var knownLength = this._overheadLength + this._valueLength; - - if (this._streams.length) { - knownLength += this._lastBoundary().length; - } - - if (!this._valuesToMeasure.length) { - process.nextTick(cb.bind(this, null, knownLength)); - return; - } - - asynckit.parallel(this._valuesToMeasure, this._lengthRetriever, function(err, values) { - if (err) { - cb(err); - return; - } - - values.forEach(function(length) { - knownLength += length; - }); - - cb(null, knownLength); - }); -}; - -FormData.prototype.submit = function(params, cb) { - var request - , options - , defaults = {method: 'post'} - ; - - // parse provided url if it's string - // or treat it as options object - if (typeof params == 'string') { - - params = parseUrl(params); - options = populate({ - port: params.port, - path: params.pathname, - host: params.hostname, - protocol: params.protocol - }, defaults); - - // use custom params - } else { - - options = populate(params, defaults); - // if no port provided use default one - if (!options.port) { - options.port = options.protocol == 'https:' ? 443 : 80; - } - } - - // put that good code in getHeaders to some use - options.headers = this.getHeaders(params.headers); - - // https if specified, fallback to http in any other case - if (options.protocol == 'https:') { - request = https.request(options); - } else { - request = http.request(options); - } - - // get content length and fire away - this.getLength(function(err, length) { - if (err) { - this._error(err); - return; - } - - // add content length - request.setHeader('Content-Length', length); - - this.pipe(request); - if (cb) { - request.on('error', cb); - request.on('response', cb.bind(this, null)); - } - }.bind(this)); - - return request; -}; - -FormData.prototype._error = function(err) { - if (!this.error) { - this.error = err; - this.pause(); - this.emit('error', err); - } -}; - -FormData.prototype.toString = function () { - return '[object FormData]'; -}; - - -/***/ }), - -/***/ 643: -/***/ (function(module) { - -module.exports = {"$id":"beforeRequest.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["lastAccess","eTag","hitCount"],"properties":{"expires":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"lastAccess":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"eTag":{"type":"string"},"hitCount":{"type":"integer"},"comment":{"type":"string"}}}; - -/***/ }), - -/***/ 648: -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_propertyNames(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - out += 'var ' + ($errs) + ' = errors;'; - if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { - $it.schema = $schema; - $it.schemaPath = $schemaPath; - $it.errSchemaPath = $errSchemaPath; - var $key = 'key' + $lvl, - $idx = 'idx' + $lvl, - $i = 'i' + $lvl, - $invalidName = '\' + ' + $key + ' + \'', - $dataNxt = $it.dataLevel = it.dataLevel + 1, - $nextData = 'data' + $dataNxt, - $dataProperties = 'dataProperties' + $lvl, - $ownProperties = it.opts.ownProperties, - $currentBaseId = it.baseId; - if ($ownProperties) { - out += ' var ' + ($dataProperties) + ' = undefined; '; - } - if ($ownProperties) { - out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; - } else { - out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; - } - out += ' var startErrs' + ($lvl) + ' = errors; '; - var $passData = $key; - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; - } - it.compositeRule = $it.compositeRule = $wasComposite; - out += ' if (!' + ($nextValid) + ') { for (var ' + ($i) + '=startErrs' + ($lvl) + '; ' + ($i) + ' 0) { + m2 = lines[--ei].match(/*JSSTYLED*/ + /[-]+[ ]*END CERTIFICATE[ ]*[-]+/); + } + assert.ok(m2, 'invalid PEM footer'); + + lines = lines.slice(si, ei + 1); + + var headers = {}; + while (true) { + lines = lines.slice(1); + m = lines[0].match(/*JSSTYLED*/ + /^([A-Za-z0-9-]+): (.+)$/); + if (!m) + break; + headers[m[1].toLowerCase()] = m[2]; + } + + /* Chop off the first and last lines */ + lines = lines.slice(0, -1).join(''); + buf = Buffer.from(lines, 'base64'); + + return (x509.read(buf, options)); +} + +function write(cert, options) { + var dbuf = x509.write(cert, options); + + var header = 'CERTIFICATE'; + var tmp = dbuf.toString('base64'); + var len = tmp.length + (tmp.length / 64) + + 18 + 16 + header.length*2 + 10; + var buf = Buffer.alloc(len); + var o = 0; + o += buf.write('-----BEGIN ' + header + '-----\n', o); + for (var i = 0; i < tmp.length; ) { + var limit = i + 64; + if (limit > tmp.length) + limit = tmp.length; + o += buf.write(tmp.slice(i, limit), o); + buf[o++] = 10; + i = limit; + } + o += buf.write('-----END ' + header + '-----\n', o); + + return (buf.slice(0, o)); +} + + +/***/ }), + +/***/ 687: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate_format(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + if (it.opts.format === false) { + if ($breakOnError) { + out += ' if (true) { '; + } + return out; + } + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + var $unknownFormats = it.opts.unknownFormats, + $allowUnknown = Array.isArray($unknownFormats); + if ($isData) { + var $format = 'format' + $lvl, + $isObject = 'isObject' + $lvl, + $formatType = 'formatType' + $lvl; + out += ' var ' + ($format) + ' = formats[' + ($schemaValue) + ']; var ' + ($isObject) + ' = typeof ' + ($format) + ' == \'object\' && !(' + ($format) + ' instanceof RegExp) && ' + ($format) + '.validate; var ' + ($formatType) + ' = ' + ($isObject) + ' && ' + ($format) + '.type || \'string\'; if (' + ($isObject) + ') { '; + if (it.async) { + out += ' var async' + ($lvl) + ' = ' + ($format) + '.async; '; + } + out += ' ' + ($format) + ' = ' + ($format) + '.validate; } if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || '; + } + out += ' ('; + if ($unknownFormats != 'ignore') { + out += ' (' + ($schemaValue) + ' && !' + ($format) + ' '; + if ($allowUnknown) { + out += ' && self._opts.unknownFormats.indexOf(' + ($schemaValue) + ') == -1 '; + } + out += ') || '; + } + out += ' (' + ($format) + ' && ' + ($formatType) + ' == \'' + ($ruleType) + '\' && !(typeof ' + ($format) + ' == \'function\' ? '; + if (it.async) { + out += ' (async' + ($lvl) + ' ? await ' + ($format) + '(' + ($data) + ') : ' + ($format) + '(' + ($data) + ')) '; + } else { + out += ' ' + ($format) + '(' + ($data) + ') '; + } + out += ' : ' + ($format) + '.test(' + ($data) + '))))) {'; + } else { + var $format = it.formats[$schema]; + if (!$format) { + if ($unknownFormats == 'ignore') { + it.logger.warn('unknown format "' + $schema + '" ignored in schema at path "' + it.errSchemaPath + '"'); + if ($breakOnError) { + out += ' if (true) { '; + } + return out; + } else if ($allowUnknown && $unknownFormats.indexOf($schema) >= 0) { + if ($breakOnError) { + out += ' if (true) { '; + } + return out; + } else { + throw new Error('unknown format "' + $schema + '" is used in schema at path "' + it.errSchemaPath + '"'); + } + } + var $isObject = typeof $format == 'object' && !($format instanceof RegExp) && $format.validate; + var $formatType = $isObject && $format.type || 'string'; + if ($isObject) { + var $async = $format.async === true; + $format = $format.validate; + } + if ($formatType != $ruleType) { + if ($breakOnError) { + out += ' if (true) { '; + } + return out; + } + if ($async) { + if (!it.async) throw new Error('async format in sync schema'); + var $formatRef = 'formats' + it.util.getProperty($schema) + '.validate'; + out += ' if (!(await ' + ($formatRef) + '(' + ($data) + '))) { '; + } else { + out += ' if (! '; + var $formatRef = 'formats' + it.util.getProperty($schema); + if ($isObject) $formatRef += '.validate'; + if (typeof $format == 'function') { + out += ' ' + ($formatRef) + '(' + ($data) + ') '; + } else { + out += ' ' + ($formatRef) + '.test(' + ($data) + ') '; + } + out += ') { '; + } + } + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('format') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { format: '; + if ($isData) { + out += '' + ($schemaValue); + } else { + out += '' + (it.util.toQuotedString($schema)); + } + out += ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should match format "'; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + (it.util.escapeQuotes($schema)); + } + out += '"\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + (it.util.toQuotedString($schema)); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + if ($breakOnError) { + out += ' else { '; + } + return out; +} + + +/***/ }), + +/***/ 691: +/***/ (function(module) { + +"use strict"; + + +// https://mathiasbynens.be/notes/javascript-encoding +// https://github.com/bestiejs/punycode.js - punycode.ucs2.decode +module.exports = function ucs2length(str) { + var length = 0 + , len = str.length + , pos = 0 + , value; + while (pos < len) { + length++; + value = str.charCodeAt(pos++); + if (value >= 0xD800 && value <= 0xDBFF && pos < len) { + // high surrogate, and there is a next character + value = str.charCodeAt(pos); + if ((value & 0xFC00) == 0xDC00) pos++; // low surrogate + } + } + return length; +}; + + +/***/ }), + +/***/ 697: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +/* + * extsprintf.js: extended POSIX-style sprintf + */ + +var mod_assert = __webpack_require__(357); +var mod_util = __webpack_require__(669); + +/* + * Public interface + */ +exports.sprintf = jsSprintf; +exports.printf = jsPrintf; +exports.fprintf = jsFprintf; + +/* + * Stripped down version of s[n]printf(3c). We make a best effort to throw an + * exception when given a format string we don't understand, rather than + * ignoring it, so that we won't break existing programs if/when we go implement + * the rest of this. + * + * This implementation currently supports specifying + * - field alignment ('-' flag), + * - zero-pad ('0' flag) + * - always show numeric sign ('+' flag), + * - field width + * - conversions for strings, decimal integers, and floats (numbers). + * - argument size specifiers. These are all accepted but ignored, since + * Javascript has no notion of the physical size of an argument. + * + * Everything else is currently unsupported, most notably precision, unsigned + * numbers, non-decimal numbers, and characters. + */ +function jsSprintf(fmt) +{ + var regex = [ + '([^%]*)', /* normal text */ + '%', /* start of format */ + '([\'\\-+ #0]*?)', /* flags (optional) */ + '([1-9]\\d*)?', /* width (optional) */ + '(\\.([1-9]\\d*))?', /* precision (optional) */ + '[lhjztL]*?', /* length mods (ignored) */ + '([diouxXfFeEgGaAcCsSp%jr])' /* conversion */ + ].join(''); + + var re = new RegExp(regex); + var args = Array.prototype.slice.call(arguments, 1); + var flags, width, precision, conversion; + var left, pad, sign, arg, match; + var ret = ''; + var argn = 1; + + mod_assert.equal('string', typeof (fmt)); + + while ((match = re.exec(fmt)) !== null) { + ret += match[1]; + fmt = fmt.substring(match[0].length); + + flags = match[2] || ''; + width = match[3] || 0; + precision = match[4] || ''; + conversion = match[6]; + left = false; + sign = false; + pad = ' '; + + if (conversion == '%') { + ret += '%'; + continue; + } + + if (args.length === 0) + throw (new Error('too few args to sprintf')); + + arg = args.shift(); + argn++; + + if (flags.match(/[\' #]/)) + throw (new Error( + 'unsupported flags: ' + flags)); + + if (precision.length > 0) + throw (new Error( + 'non-zero precision not supported')); + + if (flags.match(/-/)) + left = true; + + if (flags.match(/0/)) + pad = '0'; + + if (flags.match(/\+/)) + sign = true; + + switch (conversion) { + case 's': + if (arg === undefined || arg === null) + throw (new Error('argument ' + argn + + ': attempted to print undefined or null ' + + 'as a string')); + ret += doPad(pad, width, left, arg.toString()); + break; + + case 'd': + arg = Math.floor(arg); + /*jsl:fallthru*/ + case 'f': + sign = sign && arg > 0 ? '+' : ''; + ret += sign + doPad(pad, width, left, + arg.toString()); + break; + + case 'x': + ret += doPad(pad, width, left, arg.toString(16)); + break; + + case 'j': /* non-standard */ + if (width === 0) + width = 10; + ret += mod_util.inspect(arg, false, width); + break; + + case 'r': /* non-standard */ + ret += dumpException(arg); + break; + + default: + throw (new Error('unsupported conversion: ' + + conversion)); + } + } + + ret += fmt; + return (ret); +} + +function jsPrintf() { + var args = Array.prototype.slice.call(arguments); + args.unshift(process.stdout); + jsFprintf.apply(null, args); +} + +function jsFprintf(stream) { + var args = Array.prototype.slice.call(arguments, 1); + return (stream.write(jsSprintf.apply(this, args))); +} + +function doPad(chr, width, left, str) +{ + var ret = str; + + while (ret.length < width) { + if (left) + ret += chr; + else + ret = chr + ret; + } + + return (ret); +} + +/* + * This function dumps long stack traces for exceptions having a cause() method. + * See node-verror for an example. + */ +function dumpException(ex) +{ + var ret; + + if (!(ex instanceof Error)) + throw (new Error(jsSprintf('invalid type for %%r: %j', ex))); + + /* Note that V8 prepends "ex.stack" with ex.toString(). */ + ret = 'EXCEPTION: ' + ex.constructor.name + ': ' + ex.stack; + + if (ex.cause && typeof (ex.cause) === 'function') { + var cex = ex.cause(); + if (cex) { + ret += '\nCaused by: ' + dumpException(cex); + } + } + + return (ret); +} + + +/***/ }), + +/***/ 701: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +"use strict"; +/*! + * Copyright (c) 2015, Salesforce.com, Inc. + * All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are met: + * + * 1. Redistributions of source code must retain the above copyright notice, + * this list of conditions and the following disclaimer. + * + * 2. Redistributions in binary form must reproduce the above copyright notice, + * this list of conditions and the following disclaimer in the documentation + * and/or other materials provided with the distribution. + * + * 3. Neither the name of Salesforce.com nor the names of its contributors may + * be used to endorse or promote products derived from this software without + * specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" + * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE + * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR + * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN + * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) + * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE + * POSSIBILITY OF SUCH DAMAGE. + */ + +var net = __webpack_require__(631); +var urlParse = __webpack_require__(835).parse; +var util = __webpack_require__(669); +var pubsuffix = __webpack_require__(519); +var Store = __webpack_require__(627).Store; +var MemoryCookieStore = __webpack_require__(349).MemoryCookieStore; +var pathMatch = __webpack_require__(54).pathMatch; +var VERSION = __webpack_require__(459); + +var punycode; +try { + punycode = __webpack_require__(213); +} catch(e) { + console.warn("tough-cookie: can't load punycode; won't use punycode for domain normalization"); +} + +// From RFC6265 S4.1.1 +// note that it excludes \x3B ";" +var COOKIE_OCTETS = /^[\x21\x23-\x2B\x2D-\x3A\x3C-\x5B\x5D-\x7E]+$/; + +var CONTROL_CHARS = /[\x00-\x1F]/; + +// From Chromium // '\r', '\n' and '\0' should be treated as a terminator in +// the "relaxed" mode, see: +// https://github.com/ChromiumWebApps/chromium/blob/b3d3b4da8bb94c1b2e061600df106d590fda3620/net/cookies/parsed_cookie.cc#L60 +var TERMINATORS = ['\n', '\r', '\0']; + +// RFC6265 S4.1.1 defines path value as 'any CHAR except CTLs or ";"' +// Note ';' is \x3B +var PATH_VALUE = /[\x20-\x3A\x3C-\x7E]+/; + +// date-time parsing constants (RFC6265 S5.1.1) + +var DATE_DELIM = /[\x09\x20-\x2F\x3B-\x40\x5B-\x60\x7B-\x7E]/; + +var MONTH_TO_NUM = { + jan:0, feb:1, mar:2, apr:3, may:4, jun:5, + jul:6, aug:7, sep:8, oct:9, nov:10, dec:11 +}; +var NUM_TO_MONTH = [ + 'Jan','Feb','Mar','Apr','May','Jun','Jul','Aug','Sep','Oct','Nov','Dec' +]; +var NUM_TO_DAY = [ + 'Sun','Mon','Tue','Wed','Thu','Fri','Sat' +]; + +var MAX_TIME = 2147483647000; // 31-bit max +var MIN_TIME = 0; // 31-bit min + +/* + * Parses a Natural number (i.e., non-negative integer) with either the + * *DIGIT ( non-digit *OCTET ) + * or + * *DIGIT + * grammar (RFC6265 S5.1.1). + * + * The "trailingOK" boolean controls if the grammar accepts a + * "( non-digit *OCTET )" trailer. + */ +function parseDigits(token, minDigits, maxDigits, trailingOK) { + var count = 0; + while (count < token.length) { + var c = token.charCodeAt(count); + // "non-digit = %x00-2F / %x3A-FF" + if (c <= 0x2F || c >= 0x3A) { + break; + } + count++; + } + + // constrain to a minimum and maximum number of digits. + if (count < minDigits || count > maxDigits) { + return null; + } + + if (!trailingOK && count != token.length) { + return null; + } + + return parseInt(token.substr(0,count), 10); +} + +function parseTime(token) { + var parts = token.split(':'); + var result = [0,0,0]; + + /* RF6256 S5.1.1: + * time = hms-time ( non-digit *OCTET ) + * hms-time = time-field ":" time-field ":" time-field + * time-field = 1*2DIGIT + */ + + if (parts.length !== 3) { + return null; + } + + for (var i = 0; i < 3; i++) { + // "time-field" must be strictly "1*2DIGIT", HOWEVER, "hms-time" can be + // followed by "( non-digit *OCTET )" so therefore the last time-field can + // have a trailer + var trailingOK = (i == 2); + var num = parseDigits(parts[i], 1, 2, trailingOK); + if (num === null) { + return null; + } + result[i] = num; + } + + return result; +} + +function parseMonth(token) { + token = String(token).substr(0,3).toLowerCase(); + var num = MONTH_TO_NUM[token]; + return num >= 0 ? num : null; +} + +/* + * RFC6265 S5.1.1 date parser (see RFC for full grammar) + */ +function parseDate(str) { + if (!str) { + return; + } + + /* RFC6265 S5.1.1: + * 2. Process each date-token sequentially in the order the date-tokens + * appear in the cookie-date + */ + var tokens = str.split(DATE_DELIM); + if (!tokens) { + return; + } + + var hour = null; + var minute = null; + var second = null; + var dayOfMonth = null; + var month = null; + var year = null; + + for (var i=0; i= 70 && year <= 99) { + year += 1900; + } else if (year >= 0 && year <= 69) { + year += 2000; + } + } + } + } + + /* RFC 6265 S5.1.1 + * "5. Abort these steps and fail to parse the cookie-date if: + * * at least one of the found-day-of-month, found-month, found- + * year, or found-time flags is not set, + * * the day-of-month-value is less than 1 or greater than 31, + * * the year-value is less than 1601, + * * the hour-value is greater than 23, + * * the minute-value is greater than 59, or + * * the second-value is greater than 59. + * (Note that leap seconds cannot be represented in this syntax.)" + * + * So, in order as above: + */ + if ( + dayOfMonth === null || month === null || year === null || second === null || + dayOfMonth < 1 || dayOfMonth > 31 || + year < 1601 || + hour > 23 || + minute > 59 || + second > 59 + ) { + return; + } + + return new Date(Date.UTC(year, month, dayOfMonth, hour, minute, second)); +} + +function formatDate(date) { + var d = date.getUTCDate(); d = d >= 10 ? d : '0'+d; + var h = date.getUTCHours(); h = h >= 10 ? h : '0'+h; + var m = date.getUTCMinutes(); m = m >= 10 ? m : '0'+m; + var s = date.getUTCSeconds(); s = s >= 10 ? s : '0'+s; + return NUM_TO_DAY[date.getUTCDay()] + ', ' + + d+' '+ NUM_TO_MONTH[date.getUTCMonth()] +' '+ date.getUTCFullYear() +' '+ + h+':'+m+':'+s+' GMT'; +} + +// S5.1.2 Canonicalized Host Names +function canonicalDomain(str) { + if (str == null) { + return null; + } + str = str.trim().replace(/^\./,''); // S4.1.2.3 & S5.2.3: ignore leading . + + // convert to IDN if any non-ASCII characters + if (punycode && /[^\u0001-\u007f]/.test(str)) { + str = punycode.toASCII(str); + } + + return str.toLowerCase(); +} + +// S5.1.3 Domain Matching +function domainMatch(str, domStr, canonicalize) { + if (str == null || domStr == null) { + return null; + } + if (canonicalize !== false) { + str = canonicalDomain(str); + domStr = canonicalDomain(domStr); + } + + /* + * "The domain string and the string are identical. (Note that both the + * domain string and the string will have been canonicalized to lower case at + * this point)" + */ + if (str == domStr) { + return true; + } + + /* "All of the following [three] conditions hold:" (order adjusted from the RFC) */ + + /* "* The string is a host name (i.e., not an IP address)." */ + if (net.isIP(str)) { + return false; + } + + /* "* The domain string is a suffix of the string" */ + var idx = str.indexOf(domStr); + if (idx <= 0) { + return false; // it's a non-match (-1) or prefix (0) + } + + // e.g "a.b.c".indexOf("b.c") === 2 + // 5 === 3+2 + if (str.length !== domStr.length + idx) { // it's not a suffix + return false; + } + + /* "* The last character of the string that is not included in the domain + * string is a %x2E (".") character." */ + if (str.substr(idx-1,1) !== '.') { + return false; + } + + return true; +} + + +// RFC6265 S5.1.4 Paths and Path-Match + +/* + * "The user agent MUST use an algorithm equivalent to the following algorithm + * to compute the default-path of a cookie:" + * + * Assumption: the path (and not query part or absolute uri) is passed in. + */ +function defaultPath(path) { + // "2. If the uri-path is empty or if the first character of the uri-path is not + // a %x2F ("/") character, output %x2F ("/") and skip the remaining steps. + if (!path || path.substr(0,1) !== "/") { + return "/"; + } + + // "3. If the uri-path contains no more than one %x2F ("/") character, output + // %x2F ("/") and skip the remaining step." + if (path === "/") { + return path; + } + + var rightSlash = path.lastIndexOf("/"); + if (rightSlash === 0) { + return "/"; + } + + // "4. Output the characters of the uri-path from the first character up to, + // but not including, the right-most %x2F ("/")." + return path.slice(0, rightSlash); +} + +function trimTerminator(str) { + for (var t = 0; t < TERMINATORS.length; t++) { + var terminatorIdx = str.indexOf(TERMINATORS[t]); + if (terminatorIdx !== -1) { + str = str.substr(0,terminatorIdx); + } + } + + return str; +} + +function parseCookiePair(cookiePair, looseMode) { + cookiePair = trimTerminator(cookiePair); + + var firstEq = cookiePair.indexOf('='); + if (looseMode) { + if (firstEq === 0) { // '=' is immediately at start + cookiePair = cookiePair.substr(1); + firstEq = cookiePair.indexOf('='); // might still need to split on '=' + } + } else { // non-loose mode + if (firstEq <= 0) { // no '=' or is at start + return; // needs to have non-empty "cookie-name" + } + } + + var cookieName, cookieValue; + if (firstEq <= 0) { + cookieName = ""; + cookieValue = cookiePair.trim(); + } else { + cookieName = cookiePair.substr(0, firstEq).trim(); + cookieValue = cookiePair.substr(firstEq+1).trim(); + } + + if (CONTROL_CHARS.test(cookieName) || CONTROL_CHARS.test(cookieValue)) { + return; + } + + var c = new Cookie(); + c.key = cookieName; + c.value = cookieValue; + return c; +} + +function parse(str, options) { + if (!options || typeof options !== 'object') { + options = {}; + } + str = str.trim(); + + // We use a regex to parse the "name-value-pair" part of S5.2 + var firstSemi = str.indexOf(';'); // S5.2 step 1 + var cookiePair = (firstSemi === -1) ? str : str.substr(0, firstSemi); + var c = parseCookiePair(cookiePair, !!options.loose); + if (!c) { + return; + } + + if (firstSemi === -1) { + return c; + } + + // S5.2.3 "unparsed-attributes consist of the remainder of the set-cookie-string + // (including the %x3B (";") in question)." plus later on in the same section + // "discard the first ";" and trim". + var unparsed = str.slice(firstSemi + 1).trim(); + + // "If the unparsed-attributes string is empty, skip the rest of these + // steps." + if (unparsed.length === 0) { + return c; + } + + /* + * S5.2 says that when looping over the items "[p]rocess the attribute-name + * and attribute-value according to the requirements in the following + * subsections" for every item. Plus, for many of the individual attributes + * in S5.3 it says to use the "attribute-value of the last attribute in the + * cookie-attribute-list". Therefore, in this implementation, we overwrite + * the previous value. + */ + var cookie_avs = unparsed.split(';'); + while (cookie_avs.length) { + var av = cookie_avs.shift().trim(); + if (av.length === 0) { // happens if ";;" appears + continue; + } + var av_sep = av.indexOf('='); + var av_key, av_value; + + if (av_sep === -1) { + av_key = av; + av_value = null; + } else { + av_key = av.substr(0,av_sep); + av_value = av.substr(av_sep+1); + } + + av_key = av_key.trim().toLowerCase(); + + if (av_value) { + av_value = av_value.trim(); + } + + switch(av_key) { + case 'expires': // S5.2.1 + if (av_value) { + var exp = parseDate(av_value); + // "If the attribute-value failed to parse as a cookie date, ignore the + // cookie-av." + if (exp) { + // over and underflow not realistically a concern: V8's getTime() seems to + // store something larger than a 32-bit time_t (even with 32-bit node) + c.expires = exp; + } + } + break; + + case 'max-age': // S5.2.2 + if (av_value) { + // "If the first character of the attribute-value is not a DIGIT or a "-" + // character ...[or]... If the remainder of attribute-value contains a + // non-DIGIT character, ignore the cookie-av." + if (/^-?[0-9]+$/.test(av_value)) { + var delta = parseInt(av_value, 10); + // "If delta-seconds is less than or equal to zero (0), let expiry-time + // be the earliest representable date and time." + c.setMaxAge(delta); + } + } + break; + + case 'domain': // S5.2.3 + // "If the attribute-value is empty, the behavior is undefined. However, + // the user agent SHOULD ignore the cookie-av entirely." + if (av_value) { + // S5.2.3 "Let cookie-domain be the attribute-value without the leading %x2E + // (".") character." + var domain = av_value.trim().replace(/^\./, ''); + if (domain) { + // "Convert the cookie-domain to lower case." + c.domain = domain.toLowerCase(); + } + } + break; + + case 'path': // S5.2.4 + /* + * "If the attribute-value is empty or if the first character of the + * attribute-value is not %x2F ("/"): + * Let cookie-path be the default-path. + * Otherwise: + * Let cookie-path be the attribute-value." + * + * We'll represent the default-path as null since it depends on the + * context of the parsing. + */ + c.path = av_value && av_value[0] === "/" ? av_value : null; + break; + + case 'secure': // S5.2.5 + /* + * "If the attribute-name case-insensitively matches the string "Secure", + * the user agent MUST append an attribute to the cookie-attribute-list + * with an attribute-name of Secure and an empty attribute-value." + */ + c.secure = true; + break; + + case 'httponly': // S5.2.6 -- effectively the same as 'secure' + c.httpOnly = true; + break; + + default: + c.extensions = c.extensions || []; + c.extensions.push(av); + break; + } + } + + return c; +} + +// avoid the V8 deoptimization monster! +function jsonParse(str) { + var obj; + try { + obj = JSON.parse(str); + } catch (e) { + return e; + } + return obj; +} + +function fromJSON(str) { + if (!str) { + return null; + } + + var obj; + if (typeof str === 'string') { + obj = jsonParse(str); + if (obj instanceof Error) { + return null; + } + } else { + // assume it's an Object + obj = str; + } + + var c = new Cookie(); + for (var i=0; i 1) { + var lindex = path.lastIndexOf('/'); + if (lindex === 0) { + break; + } + path = path.substr(0,lindex); + permutations.push(path); + } + permutations.push('/'); + return permutations; +} + +function getCookieContext(url) { + if (url instanceof Object) { + return url; + } + // NOTE: decodeURI will throw on malformed URIs (see GH-32). + // Therefore, we will just skip decoding for such URIs. + try { + url = decodeURI(url); + } + catch(err) { + // Silently swallow error + } + + return urlParse(url); +} + +function Cookie(options) { + options = options || {}; + + Object.keys(options).forEach(function(prop) { + if (Cookie.prototype.hasOwnProperty(prop) && + Cookie.prototype[prop] !== options[prop] && + prop.substr(0,1) !== '_') + { + this[prop] = options[prop]; + } + }, this); + + this.creation = this.creation || new Date(); + + // used to break creation ties in cookieCompare(): + Object.defineProperty(this, 'creationIndex', { + configurable: false, + enumerable: false, // important for assert.deepEqual checks + writable: true, + value: ++Cookie.cookiesCreated + }); +} + +Cookie.cookiesCreated = 0; // incremented each time a cookie is created + +Cookie.parse = parse; +Cookie.fromJSON = fromJSON; + +Cookie.prototype.key = ""; +Cookie.prototype.value = ""; + +// the order in which the RFC has them: +Cookie.prototype.expires = "Infinity"; // coerces to literal Infinity +Cookie.prototype.maxAge = null; // takes precedence over expires for TTL +Cookie.prototype.domain = null; +Cookie.prototype.path = null; +Cookie.prototype.secure = false; +Cookie.prototype.httpOnly = false; +Cookie.prototype.extensions = null; + +// set by the CookieJar: +Cookie.prototype.hostOnly = null; // boolean when set +Cookie.prototype.pathIsDefault = null; // boolean when set +Cookie.prototype.creation = null; // Date when set; defaulted by Cookie.parse +Cookie.prototype.lastAccessed = null; // Date when set +Object.defineProperty(Cookie.prototype, 'creationIndex', { + configurable: true, + enumerable: false, + writable: true, + value: 0 +}); + +Cookie.serializableProperties = Object.keys(Cookie.prototype) + .filter(function(prop) { + return !( + Cookie.prototype[prop] instanceof Function || + prop === 'creationIndex' || + prop.substr(0,1) === '_' + ); + }); + +Cookie.prototype.inspect = function inspect() { + var now = Date.now(); + return 'Cookie="'+this.toString() + + '; hostOnly='+(this.hostOnly != null ? this.hostOnly : '?') + + '; aAge='+(this.lastAccessed ? (now-this.lastAccessed.getTime())+'ms' : '?') + + '; cAge='+(this.creation ? (now-this.creation.getTime())+'ms' : '?') + + '"'; +}; + +// Use the new custom inspection symbol to add the custom inspect function if +// available. +if (util.inspect.custom) { + Cookie.prototype[util.inspect.custom] = Cookie.prototype.inspect; +} + +Cookie.prototype.toJSON = function() { + var obj = {}; + + var props = Cookie.serializableProperties; + for (var i=0; i schema.maxItems){ + addError("There must be a maximum of " + schema.maxItems + " in the array"); + } + }else if(schema.properties || schema.additionalProperties){ + errors.concat(checkObj(value, schema.properties, path, schema.additionalProperties)); + } + if(schema.pattern && typeof value == 'string' && !value.match(schema.pattern)){ + addError("does not match the regex pattern " + schema.pattern); + } + if(schema.maxLength && typeof value == 'string' && value.length > schema.maxLength){ + addError("may only be " + schema.maxLength + " characters long"); + } + if(schema.minLength && typeof value == 'string' && value.length < schema.minLength){ + addError("must be at least " + schema.minLength + " characters long"); + } + if(typeof schema.minimum !== undefined && typeof value == typeof schema.minimum && + schema.minimum > value){ + addError("must have a minimum value of " + schema.minimum); + } + if(typeof schema.maximum !== undefined && typeof value == typeof schema.maximum && + schema.maximum < value){ + addError("must have a maximum value of " + schema.maximum); + } + if(schema['enum']){ + var enumer = schema['enum']; + l = enumer.length; + var found; + for(var j = 0; j < l; j++){ + if(enumer[j]===value){ + found=1; + break; + } + } + if(!found){ + addError("does not have a value in the enumeration " + enumer.join(", ")); + } + } + if(typeof schema.maxDecimal == 'number' && + (value.toString().match(new RegExp("\\.[0-9]{" + (schema.maxDecimal + 1) + ",}")))){ + addError("may only have " + schema.maxDecimal + " digits of decimal places"); + } + } + } + return null; + } + // validate an object against a schema + function checkObj(instance,objTypeDef,path,additionalProp){ + + if(typeof objTypeDef =='object'){ + if(typeof instance != 'object' || instance instanceof Array){ + errors.push({property:path,message:"an object is required"}); + } + + for(var i in objTypeDef){ + if(objTypeDef.hasOwnProperty(i)){ + var value = instance[i]; + // skip _not_ specified properties + if (value === undefined && options.existingOnly) continue; + var propDef = objTypeDef[i]; + // set default + if(value === undefined && propDef["default"]){ + value = instance[i] = propDef["default"]; + } + if(options.coerce && i in instance){ + value = instance[i] = options.coerce(value, propDef); + } + checkProp(value,propDef,path,i); + } + } + } + for(i in instance){ + if(instance.hasOwnProperty(i) && !(i.charAt(0) == '_' && i.charAt(1) == '_') && objTypeDef && !objTypeDef[i] && additionalProp===false){ + if (options.filter) { + delete instance[i]; + continue; + } else { + errors.push({property:path,message:(typeof value) + "The property " + i + + " is not defined in the schema and the schema does not allow additional properties"}); + } + } + var requires = objTypeDef && objTypeDef[i] && objTypeDef[i].requires; + if(requires && !(requires in instance)){ + errors.push({property:path,message:"the presence of the property " + i + " requires that " + requires + " also be present"}); + } + value = instance[i]; + if(additionalProp && (!(objTypeDef && typeof objTypeDef == 'object') || !(i in objTypeDef))){ + if(options.coerce){ + value = instance[i] = options.coerce(value, additionalProp); + } + checkProp(value,additionalProp,path,i); + } + if(!_changing && value && value.$schema){ + errors = errors.concat(checkProp(value,value.$schema,path,i)); + } + } + return errors; + } + if(schema){ + checkProp(instance,schema,'',_changing || ''); + } + if(!_changing && instance && instance.$schema){ + checkProp(instance,instance.$schema,'',''); + } + return {valid:!errors.length,errors:errors}; +}; +exports.mustBeValid = function(result){ + // summary: + // This checks to ensure that the result is valid and will throw an appropriate error message if it is not + // result: the result returned from checkPropertyChange or validate + if(!result.valid){ + throw new TypeError(result.errors.map(function(error){return "for property " + error.property + ': ' + error.message;}).join(", \n")); + } +} + +return exports; +})); + + +/***/ }), + +/***/ 704: +/***/ (function(module, exports) { + +exports = module.exports = stringify +exports.getSerialize = serializer + +function stringify(obj, replacer, spaces, cycleReplacer) { + return JSON.stringify(obj, serializer(replacer, cycleReplacer), spaces) +} + +function serializer(replacer, cycleReplacer) { + var stack = [], keys = [] + + if (cycleReplacer == null) cycleReplacer = function(key, value) { + if (stack[0] === value) return "[Circular ~]" + return "[Circular ~." + keys.slice(0, stack.indexOf(value)).join(".") + "]" + } + + return function(key, value) { + if (stack.length > 0) { + var thisPos = stack.indexOf(this) + ~thisPos ? stack.splice(thisPos + 1) : stack.push(this) + ~thisPos ? keys.splice(thisPos, Infinity, key) : keys.push(key) + if (~stack.indexOf(value)) value = cycleReplacer.call(this, key, value) + } + else stack.push(value) + + return replacer == null ? value : replacer.call(this, key, value) + } +} + + +/***/ }), + +/***/ 707: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2018 Joyent, Inc. -module.exports = Fingerprint; +module.exports = { + read: read, + readPkcs8: readPkcs8, + write: write, + writePkcs8: writePkcs8, + pkcs8ToBuffer: pkcs8ToBuffer, -var assert = __webpack_require__(283); -var Buffer = __webpack_require__(375).Buffer; -var algs = __webpack_require__(936); -var crypto = __webpack_require__(417); -var errs = __webpack_require__(266); -var Key = __webpack_require__(820); -var PrivateKey = __webpack_require__(463); -var Certificate = __webpack_require__(219); -var utils = __webpack_require__(757); + readECDSACurve: readECDSACurve, + writeECDSACurve: writeECDSACurve +}; -var FingerprintFormatError = errs.FingerprintFormatError; -var InvalidAlgorithmError = errs.InvalidAlgorithmError; +var assert = __webpack_require__(477); +var asn1 = __webpack_require__(62); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var utils = __webpack_require__(270); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var pem = __webpack_require__(268); -function Fingerprint(opts) { - assert.object(opts, 'options'); - assert.string(opts.type, 'options.type'); - assert.buffer(opts.hash, 'options.hash'); - assert.string(opts.algorithm, 'options.algorithm'); - - this.algorithm = opts.algorithm.toLowerCase(); - if (algs.hashAlgs[this.algorithm] !== true) - throw (new InvalidAlgorithmError(this.algorithm)); - - this.hash = opts.hash; - this.type = opts.type; - this.hashType = opts.hashType; +function read(buf, options) { + return (pem.read(buf, options, 'pkcs8')); } -Fingerprint.prototype.toString = function (format) { - if (format === undefined) { - if (this.algorithm === 'md5' || this.hashType === 'spki') - format = 'hex'; +function write(key, options) { + return (pem.write(key, options, 'pkcs8')); +} + +/* Helper to read in a single mpint */ +function readMPInt(der, nm) { + assert.strictEqual(der.peek(), asn1.Ber.Integer, + nm + ' is not an Integer'); + return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); +} + +function readPkcs8(alg, type, der) { + /* Private keys in pkcs#8 format have a weird extra int */ + if (der.peek() === asn1.Ber.Integer) { + assert.strictEqual(type, 'private', + 'unexpected Integer at start of public key'); + der.readString(asn1.Ber.Integer, true); + } + + der.readSequence(); + var next = der.offset + der.length; + + var oid = der.readOID(); + switch (oid) { + case '1.2.840.113549.1.1.1': + der._offset = next; + if (type === 'public') + return (readPkcs8RSAPublic(der)); else - format = 'base64'; - } - assert.string(format); - - switch (format) { - case 'hex': - if (this.hashType === 'spki') - return (this.hash.toString('hex')); - return (addColons(this.hash.toString('hex'))); - case 'base64': - if (this.hashType === 'spki') - return (this.hash.toString('base64')); - return (sshBase64Format(this.algorithm, - this.hash.toString('base64'))); - default: - throw (new FingerprintFormatError(undefined, format)); - } -}; - -Fingerprint.prototype.matches = function (other) { - assert.object(other, 'key or certificate'); - if (this.type === 'key' && this.hashType !== 'ssh') { - utils.assertCompatible(other, Key, [1, 7], 'key with spki'); - if (PrivateKey.isPrivateKey(other)) { - utils.assertCompatible(other, PrivateKey, [1, 6], - 'privatekey with spki support'); + return (readPkcs8RSAPrivate(der)); + case '1.2.840.10040.4.1': + if (type === 'public') + return (readPkcs8DSAPublic(der)); + else + return (readPkcs8DSAPrivate(der)); + case '1.2.840.10045.2.1': + if (type === 'public') + return (readPkcs8ECDSAPublic(der)); + else + return (readPkcs8ECDSAPrivate(der)); + case '1.3.101.112': + if (type === 'public') { + return (readPkcs8EdDSAPublic(der)); + } else { + return (readPkcs8EdDSAPrivate(der)); } - } else if (this.type === 'key') { - utils.assertCompatible(other, Key, [1, 0], 'key'); + case '1.3.101.110': + if (type === 'public') { + return (readPkcs8X25519Public(der)); + } else { + return (readPkcs8X25519Private(der)); + } + default: + throw (new Error('Unknown key type OID ' + oid)); + } +} + +function readPkcs8RSAPublic(der) { + // bit string sequence + der.readSequence(asn1.Ber.BitString); + der.readByte(); + der.readSequence(); + + // modulus + var n = readMPInt(der, 'modulus'); + var e = readMPInt(der, 'exponent'); + + // now, make the key + var key = { + type: 'rsa', + source: der.originalInput, + parts: [ + { name: 'e', data: e }, + { name: 'n', data: n } + ] + }; + + return (new Key(key)); +} + +function readPkcs8RSAPrivate(der) { + der.readSequence(asn1.Ber.OctetString); + der.readSequence(); + + var ver = readMPInt(der, 'version'); + assert.equal(ver[0], 0x0, 'unknown RSA private key version'); + + // modulus then public exponent + var n = readMPInt(der, 'modulus'); + var e = readMPInt(der, 'public exponent'); + var d = readMPInt(der, 'private exponent'); + var p = readMPInt(der, 'prime1'); + var q = readMPInt(der, 'prime2'); + var dmodp = readMPInt(der, 'exponent1'); + var dmodq = readMPInt(der, 'exponent2'); + var iqmp = readMPInt(der, 'iqmp'); + + // now, make the key + var key = { + type: 'rsa', + parts: [ + { name: 'n', data: n }, + { name: 'e', data: e }, + { name: 'd', data: d }, + { name: 'iqmp', data: iqmp }, + { name: 'p', data: p }, + { name: 'q', data: q }, + { name: 'dmodp', data: dmodp }, + { name: 'dmodq', data: dmodq } + ] + }; + + return (new PrivateKey(key)); +} + +function readPkcs8DSAPublic(der) { + der.readSequence(); + + var p = readMPInt(der, 'p'); + var q = readMPInt(der, 'q'); + var g = readMPInt(der, 'g'); + + // bit string sequence + der.readSequence(asn1.Ber.BitString); + der.readByte(); + + var y = readMPInt(der, 'y'); + + // now, make the key + var key = { + type: 'dsa', + parts: [ + { name: 'p', data: p }, + { name: 'q', data: q }, + { name: 'g', data: g }, + { name: 'y', data: y } + ] + }; + + return (new Key(key)); +} + +function readPkcs8DSAPrivate(der) { + der.readSequence(); + + var p = readMPInt(der, 'p'); + var q = readMPInt(der, 'q'); + var g = readMPInt(der, 'g'); + + der.readSequence(asn1.Ber.OctetString); + var x = readMPInt(der, 'x'); + + /* The pkcs#8 format does not include the public key */ + var y = utils.calculateDSAPublic(g, p, x); + + var key = { + type: 'dsa', + parts: [ + { name: 'p', data: p }, + { name: 'q', data: q }, + { name: 'g', data: g }, + { name: 'y', data: y }, + { name: 'x', data: x } + ] + }; + + return (new PrivateKey(key)); +} + +function readECDSACurve(der) { + var curveName, curveNames; + var j, c, cd; + + if (der.peek() === asn1.Ber.OID) { + var oid = der.readOID(); + + curveNames = Object.keys(algs.curves); + for (j = 0; j < curveNames.length; ++j) { + c = curveNames[j]; + cd = algs.curves[c]; + if (cd.pkcs8oid === oid) { + curveName = c; + break; + } + } + } else { - utils.assertCompatible(other, Certificate, [1, 0], - 'certificate'); + // ECParameters sequence + der.readSequence(); + var version = der.readString(asn1.Ber.Integer, true); + assert.strictEqual(version[0], 1, 'ECDSA key not version 1'); + + var curve = {}; + + // FieldID sequence + der.readSequence(); + var fieldTypeOid = der.readOID(); + assert.strictEqual(fieldTypeOid, '1.2.840.10045.1.1', + 'ECDSA key is not from a prime-field'); + var p = curve.p = utils.mpNormalize( + der.readString(asn1.Ber.Integer, true)); + /* + * p always starts with a 1 bit, so count the zeros to get its + * real size. + */ + curve.size = p.length * 8 - utils.countZeros(p); + + // Curve sequence + der.readSequence(); + curve.a = utils.mpNormalize( + der.readString(asn1.Ber.OctetString, true)); + curve.b = utils.mpNormalize( + der.readString(asn1.Ber.OctetString, true)); + if (der.peek() === asn1.Ber.BitString) + curve.s = der.readString(asn1.Ber.BitString, true); + + // Combined Gx and Gy + curve.G = der.readString(asn1.Ber.OctetString, true); + assert.strictEqual(curve.G[0], 0x4, + 'uncompressed G is required'); + + curve.n = utils.mpNormalize( + der.readString(asn1.Ber.Integer, true)); + curve.h = utils.mpNormalize( + der.readString(asn1.Ber.Integer, true)); + assert.strictEqual(curve.h[0], 0x1, 'a cofactor=1 curve is ' + + 'required'); + + curveNames = Object.keys(algs.curves); + var ks = Object.keys(curve); + for (j = 0; j < curveNames.length; ++j) { + c = curveNames[j]; + cd = algs.curves[c]; + var equal = true; + for (var i = 0; i < ks.length; ++i) { + var k = ks[i]; + if (cd[k] === undefined) + continue; + if (typeof (cd[k]) === 'object' && + cd[k].equals !== undefined) { + if (!cd[k].equals(curve[k])) { + equal = false; + break; + } + } else if (Buffer.isBuffer(cd[k])) { + if (cd[k].toString('binary') + !== curve[k].toString('binary')) { + equal = false; + break; + } + } else { + if (cd[k] !== curve[k]) { + equal = false; + break; + } + } + } + if (equal) { + curveName = c; + break; + } + } + } + return (curveName); +} + +function readPkcs8ECDSAPrivate(der) { + var curveName = readECDSACurve(der); + assert.string(curveName, 'a known elliptic curve'); + + der.readSequence(asn1.Ber.OctetString); + der.readSequence(); + + var version = readMPInt(der, 'version'); + assert.equal(version[0], 1, 'unknown version of ECDSA key'); + + var d = der.readString(asn1.Ber.OctetString, true); + var Q; + + if (der.peek() == 0xa0) { + der.readSequence(0xa0); + der._offset += der.length; + } + if (der.peek() == 0xa1) { + der.readSequence(0xa1); + Q = der.readString(asn1.Ber.BitString, true); + Q = utils.ecNormalize(Q); } - var theirHash = other.hash(this.algorithm, this.hashType); - var theirHash2 = crypto.createHash(this.algorithm). - update(theirHash).digest('base64'); + if (Q === undefined) { + var pub = utils.publicFromPrivateECDSA(curveName, d); + Q = pub.part.Q.data; + } - if (this.hash2 === undefined) - this.hash2 = crypto.createHash(this.algorithm). - update(this.hash).digest('base64'); + var key = { + type: 'ecdsa', + parts: [ + { name: 'curve', data: Buffer.from(curveName) }, + { name: 'Q', data: Q }, + { name: 'd', data: d } + ] + }; - return (this.hash2 === theirHash2); + return (new PrivateKey(key)); +} + +function readPkcs8ECDSAPublic(der) { + var curveName = readECDSACurve(der); + assert.string(curveName, 'a known elliptic curve'); + + var Q = der.readString(asn1.Ber.BitString, true); + Q = utils.ecNormalize(Q); + + var key = { + type: 'ecdsa', + parts: [ + { name: 'curve', data: Buffer.from(curveName) }, + { name: 'Q', data: Q } + ] + }; + + return (new Key(key)); +} + +function readPkcs8EdDSAPublic(der) { + if (der.peek() === 0x00) + der.readByte(); + + var A = utils.readBitString(der); + + var key = { + type: 'ed25519', + parts: [ + { name: 'A', data: utils.zeroPadToLength(A, 32) } + ] + }; + + return (new Key(key)); +} + +function readPkcs8X25519Public(der) { + var A = utils.readBitString(der); + + var key = { + type: 'curve25519', + parts: [ + { name: 'A', data: utils.zeroPadToLength(A, 32) } + ] + }; + + return (new Key(key)); +} + +function readPkcs8EdDSAPrivate(der) { + if (der.peek() === 0x00) + der.readByte(); + + der.readSequence(asn1.Ber.OctetString); + var k = der.readString(asn1.Ber.OctetString, true); + k = utils.zeroPadToLength(k, 32); + + var A; + if (der.peek() === asn1.Ber.BitString) { + A = utils.readBitString(der); + A = utils.zeroPadToLength(A, 32); + } else { + A = utils.calculateED25519Public(k); + } + + var key = { + type: 'ed25519', + parts: [ + { name: 'A', data: utils.zeroPadToLength(A, 32) }, + { name: 'k', data: utils.zeroPadToLength(k, 32) } + ] + }; + + return (new PrivateKey(key)); +} + +function readPkcs8X25519Private(der) { + if (der.peek() === 0x00) + der.readByte(); + + der.readSequence(asn1.Ber.OctetString); + var k = der.readString(asn1.Ber.OctetString, true); + k = utils.zeroPadToLength(k, 32); + + var A = utils.calculateX25519Public(k); + + var key = { + type: 'curve25519', + parts: [ + { name: 'A', data: utils.zeroPadToLength(A, 32) }, + { name: 'k', data: utils.zeroPadToLength(k, 32) } + ] + }; + + return (new PrivateKey(key)); +} + +function pkcs8ToBuffer(key) { + var der = new asn1.BerWriter(); + writePkcs8(der, key); + return (der.buffer); +} + +function writePkcs8(der, key) { + der.startSequence(); + + if (PrivateKey.isPrivateKey(key)) { + var sillyInt = Buffer.from([0]); + der.writeBuffer(sillyInt, asn1.Ber.Integer); + } + + der.startSequence(); + switch (key.type) { + case 'rsa': + der.writeOID('1.2.840.113549.1.1.1'); + if (PrivateKey.isPrivateKey(key)) + writePkcs8RSAPrivate(key, der); + else + writePkcs8RSAPublic(key, der); + break; + case 'dsa': + der.writeOID('1.2.840.10040.4.1'); + if (PrivateKey.isPrivateKey(key)) + writePkcs8DSAPrivate(key, der); + else + writePkcs8DSAPublic(key, der); + break; + case 'ecdsa': + der.writeOID('1.2.840.10045.2.1'); + if (PrivateKey.isPrivateKey(key)) + writePkcs8ECDSAPrivate(key, der); + else + writePkcs8ECDSAPublic(key, der); + break; + case 'ed25519': + der.writeOID('1.3.101.112'); + if (PrivateKey.isPrivateKey(key)) + throw (new Error('Ed25519 private keys in pkcs8 ' + + 'format are not supported')); + writePkcs8EdDSAPublic(key, der); + break; + default: + throw (new Error('Unsupported key type: ' + key.type)); + } + + der.endSequence(); +} + +function writePkcs8RSAPrivate(key, der) { + der.writeNull(); + der.endSequence(); + + der.startSequence(asn1.Ber.OctetString); + der.startSequence(); + + var version = Buffer.from([0]); + der.writeBuffer(version, asn1.Ber.Integer); + + der.writeBuffer(key.part.n.data, asn1.Ber.Integer); + der.writeBuffer(key.part.e.data, asn1.Ber.Integer); + der.writeBuffer(key.part.d.data, asn1.Ber.Integer); + der.writeBuffer(key.part.p.data, asn1.Ber.Integer); + der.writeBuffer(key.part.q.data, asn1.Ber.Integer); + if (!key.part.dmodp || !key.part.dmodq) + utils.addRSAMissing(key); + der.writeBuffer(key.part.dmodp.data, asn1.Ber.Integer); + der.writeBuffer(key.part.dmodq.data, asn1.Ber.Integer); + der.writeBuffer(key.part.iqmp.data, asn1.Ber.Integer); + + der.endSequence(); + der.endSequence(); +} + +function writePkcs8RSAPublic(key, der) { + der.writeNull(); + der.endSequence(); + + der.startSequence(asn1.Ber.BitString); + der.writeByte(0x00); + + der.startSequence(); + der.writeBuffer(key.part.n.data, asn1.Ber.Integer); + der.writeBuffer(key.part.e.data, asn1.Ber.Integer); + der.endSequence(); + + der.endSequence(); +} + +function writePkcs8DSAPrivate(key, der) { + der.startSequence(); + der.writeBuffer(key.part.p.data, asn1.Ber.Integer); + der.writeBuffer(key.part.q.data, asn1.Ber.Integer); + der.writeBuffer(key.part.g.data, asn1.Ber.Integer); + der.endSequence(); + + der.endSequence(); + + der.startSequence(asn1.Ber.OctetString); + der.writeBuffer(key.part.x.data, asn1.Ber.Integer); + der.endSequence(); +} + +function writePkcs8DSAPublic(key, der) { + der.startSequence(); + der.writeBuffer(key.part.p.data, asn1.Ber.Integer); + der.writeBuffer(key.part.q.data, asn1.Ber.Integer); + der.writeBuffer(key.part.g.data, asn1.Ber.Integer); + der.endSequence(); + der.endSequence(); + + der.startSequence(asn1.Ber.BitString); + der.writeByte(0x00); + der.writeBuffer(key.part.y.data, asn1.Ber.Integer); + der.endSequence(); +} + +function writeECDSACurve(key, der) { + var curve = algs.curves[key.curve]; + if (curve.pkcs8oid) { + /* This one has a name in pkcs#8, so just write the oid */ + der.writeOID(curve.pkcs8oid); + + } else { + // ECParameters sequence + der.startSequence(); + + var version = Buffer.from([1]); + der.writeBuffer(version, asn1.Ber.Integer); + + // FieldID sequence + der.startSequence(); + der.writeOID('1.2.840.10045.1.1'); // prime-field + der.writeBuffer(curve.p, asn1.Ber.Integer); + der.endSequence(); + + // Curve sequence + der.startSequence(); + var a = curve.p; + if (a[0] === 0x0) + a = a.slice(1); + der.writeBuffer(a, asn1.Ber.OctetString); + der.writeBuffer(curve.b, asn1.Ber.OctetString); + der.writeBuffer(curve.s, asn1.Ber.BitString); + der.endSequence(); + + der.writeBuffer(curve.G, asn1.Ber.OctetString); + der.writeBuffer(curve.n, asn1.Ber.Integer); + var h = curve.h; + if (!h) { + h = Buffer.from([1]); + } + der.writeBuffer(h, asn1.Ber.Integer); + + // ECParameters + der.endSequence(); + } +} + +function writePkcs8ECDSAPublic(key, der) { + writeECDSACurve(key, der); + der.endSequence(); + + var Q = utils.ecNormalize(key.part.Q.data, true); + der.writeBuffer(Q, asn1.Ber.BitString); +} + +function writePkcs8ECDSAPrivate(key, der) { + writeECDSACurve(key, der); + der.endSequence(); + + der.startSequence(asn1.Ber.OctetString); + der.startSequence(); + + var version = Buffer.from([1]); + der.writeBuffer(version, asn1.Ber.Integer); + + der.writeBuffer(key.part.d.data, asn1.Ber.OctetString); + + der.startSequence(0xa1); + var Q = utils.ecNormalize(key.part.Q.data, true); + der.writeBuffer(Q, asn1.Ber.BitString); + der.endSequence(); + + der.endSequence(); + der.endSequence(); +} + +function writePkcs8EdDSAPublic(key, der) { + der.endSequence(); + + utils.writeBitString(der, key.part.A.data); +} + +function writePkcs8EdDSAPrivate(key, der) { + der.endSequence(); + + var k = utils.mpNormalize(key.part.k.data, true); + der.startSequence(asn1.Ber.OctetString); + der.writeBuffer(k, asn1.Ber.OctetString); + der.endSequence(); +} + + +/***/ }), + +/***/ 721: +/***/ (function(module) { + +"use strict"; + + +function formatHostname (hostname) { + // canonicalize the hostname, so that 'oogle.com' won't match 'google.com' + return hostname.replace(/^\.*/, '.').toLowerCase() +} + +function parseNoProxyZone (zone) { + zone = zone.trim().toLowerCase() + + var zoneParts = zone.split(':', 2) + var zoneHost = formatHostname(zoneParts[0]) + var zonePort = zoneParts[1] + var hasPort = zone.indexOf(':') > -1 + + return {hostname: zoneHost, port: zonePort, hasPort: hasPort} +} + +function uriInNoProxy (uri, noProxy) { + var port = uri.port || (uri.protocol === 'https:' ? '443' : '80') + var hostname = formatHostname(uri.hostname) + var noProxyList = noProxy.split(',') + + // iterate through the noProxyList until it finds a match. + return noProxyList.map(parseNoProxyZone).some(function (noProxyZone) { + var isMatchedAt = hostname.indexOf(noProxyZone.hostname) + var hostnameMatched = ( + isMatchedAt > -1 && + (isMatchedAt === hostname.length - noProxyZone.hostname.length) + ) + + if (noProxyZone.hasPort) { + return (port === noProxyZone.port) && hostnameMatched + } + + return hostnameMatched + }) +} + +function getProxyFromURI (uri) { + // Decide the proper request proxy to use based on the request URI object and the + // environmental variables (NO_PROXY, HTTP_PROXY, etc.) + // respect NO_PROXY environment variables (see: https://lynx.invisible-island.net/lynx2.8.7/breakout/lynx_help/keystrokes/environments.html) + + var noProxy = process.env.NO_PROXY || process.env.no_proxy || '' + + // if the noProxy is a wildcard then return null + + if (noProxy === '*') { + return null + } + + // if the noProxy is not empty and the uri is found return null + + if (noProxy !== '' && uriInNoProxy(uri, noProxy)) { + return null + } + + // Check for HTTP or HTTPS Proxy in environment Else default to null + + if (uri.protocol === 'http:') { + return process.env.HTTP_PROXY || + process.env.http_proxy || null + } + + if (uri.protocol === 'https:') { + return process.env.HTTPS_PROXY || + process.env.https_proxy || + process.env.HTTP_PROXY || + process.env.http_proxy || null + } + + // if none of that works, return null + // (What uri protocol are you using then?) + + return null +} + +module.exports = getProxyFromURI + + +/***/ }), + +/***/ 722: +/***/ (function(module) { + +/** + * Convert array of 16 byte values to UUID string format of the form: + * XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX + */ +var byteToHex = []; +for (var i = 0; i < 256; ++i) { + byteToHex[i] = (i + 0x100).toString(16).substr(1); +} + +function bytesToUuid(buf, offset) { + var i = offset || 0; + var bth = byteToHex; + // join used to fix memory issue caused by concatenation: https://bugs.chromium.org/p/v8/issues/detail?id=3175#c4 + return ([ + bth[buf[i++]], bth[buf[i++]], + bth[buf[i++]], bth[buf[i++]], '-', + bth[buf[i++]], bth[buf[i++]], '-', + bth[buf[i++]], bth[buf[i++]], '-', + bth[buf[i++]], bth[buf[i++]], '-', + bth[buf[i++]], bth[buf[i++]], + bth[buf[i++]], bth[buf[i++]], + bth[buf[i++]], bth[buf[i++]] + ]).join(''); +} + +module.exports = bytesToUuid; + + +/***/ }), + +/***/ 729: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Basic Javascript Elliptic Curve implementation +// Ported loosely from BouncyCastle's Java EC code +// Only Fp curves implemented for now + +// Requires jsbn.js and jsbn2.js +var BigInteger = __webpack_require__(242).BigInteger +var Barrett = BigInteger.prototype.Barrett + +// ---------------- +// ECFieldElementFp + +// constructor +function ECFieldElementFp(q,x) { + this.x = x; + // TODO if(x.compareTo(q) >= 0) error + this.q = q; +} + +function feFpEquals(other) { + if(other == this) return true; + return (this.q.equals(other.q) && this.x.equals(other.x)); +} + +function feFpToBigInteger() { + return this.x; +} + +function feFpNegate() { + return new ECFieldElementFp(this.q, this.x.negate().mod(this.q)); +} + +function feFpAdd(b) { + return new ECFieldElementFp(this.q, this.x.add(b.toBigInteger()).mod(this.q)); +} + +function feFpSubtract(b) { + return new ECFieldElementFp(this.q, this.x.subtract(b.toBigInteger()).mod(this.q)); +} + +function feFpMultiply(b) { + return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger()).mod(this.q)); +} + +function feFpSquare() { + return new ECFieldElementFp(this.q, this.x.square().mod(this.q)); +} + +function feFpDivide(b) { + return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger().modInverse(this.q)).mod(this.q)); +} + +ECFieldElementFp.prototype.equals = feFpEquals; +ECFieldElementFp.prototype.toBigInteger = feFpToBigInteger; +ECFieldElementFp.prototype.negate = feFpNegate; +ECFieldElementFp.prototype.add = feFpAdd; +ECFieldElementFp.prototype.subtract = feFpSubtract; +ECFieldElementFp.prototype.multiply = feFpMultiply; +ECFieldElementFp.prototype.square = feFpSquare; +ECFieldElementFp.prototype.divide = feFpDivide; + +// ---------------- +// ECPointFp + +// constructor +function ECPointFp(curve,x,y,z) { + this.curve = curve; + this.x = x; + this.y = y; + // Projective coordinates: either zinv == null or z * zinv == 1 + // z and zinv are just BigIntegers, not fieldElements + if(z == null) { + this.z = BigInteger.ONE; + } + else { + this.z = z; + } + this.zinv = null; + //TODO: compression flag +} + +function pointFpGetX() { + if(this.zinv == null) { + this.zinv = this.z.modInverse(this.curve.q); + } + var r = this.x.toBigInteger().multiply(this.zinv); + this.curve.reduce(r); + return this.curve.fromBigInteger(r); +} + +function pointFpGetY() { + if(this.zinv == null) { + this.zinv = this.z.modInverse(this.curve.q); + } + var r = this.y.toBigInteger().multiply(this.zinv); + this.curve.reduce(r); + return this.curve.fromBigInteger(r); +} + +function pointFpEquals(other) { + if(other == this) return true; + if(this.isInfinity()) return other.isInfinity(); + if(other.isInfinity()) return this.isInfinity(); + var u, v; + // u = Y2 * Z1 - Y1 * Z2 + u = other.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(other.z)).mod(this.curve.q); + if(!u.equals(BigInteger.ZERO)) return false; + // v = X2 * Z1 - X1 * Z2 + v = other.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(other.z)).mod(this.curve.q); + return v.equals(BigInteger.ZERO); +} + +function pointFpIsInfinity() { + if((this.x == null) && (this.y == null)) return true; + return this.z.equals(BigInteger.ZERO) && !this.y.toBigInteger().equals(BigInteger.ZERO); +} + +function pointFpNegate() { + return new ECPointFp(this.curve, this.x, this.y.negate(), this.z); +} + +function pointFpAdd(b) { + if(this.isInfinity()) return b; + if(b.isInfinity()) return this; + + // u = Y2 * Z1 - Y1 * Z2 + var u = b.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(b.z)).mod(this.curve.q); + // v = X2 * Z1 - X1 * Z2 + var v = b.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(b.z)).mod(this.curve.q); + + if(BigInteger.ZERO.equals(v)) { + if(BigInteger.ZERO.equals(u)) { + return this.twice(); // this == b, so double + } + return this.curve.getInfinity(); // this = -b, so infinity + } + + var THREE = new BigInteger("3"); + var x1 = this.x.toBigInteger(); + var y1 = this.y.toBigInteger(); + var x2 = b.x.toBigInteger(); + var y2 = b.y.toBigInteger(); + + var v2 = v.square(); + var v3 = v2.multiply(v); + var x1v2 = x1.multiply(v2); + var zu2 = u.square().multiply(this.z); + + // x3 = v * (z2 * (z1 * u^2 - 2 * x1 * v^2) - v^3) + var x3 = zu2.subtract(x1v2.shiftLeft(1)).multiply(b.z).subtract(v3).multiply(v).mod(this.curve.q); + // y3 = z2 * (3 * x1 * u * v^2 - y1 * v^3 - z1 * u^3) + u * v^3 + var y3 = x1v2.multiply(THREE).multiply(u).subtract(y1.multiply(v3)).subtract(zu2.multiply(u)).multiply(b.z).add(u.multiply(v3)).mod(this.curve.q); + // z3 = v^3 * z1 * z2 + var z3 = v3.multiply(this.z).multiply(b.z).mod(this.curve.q); + + return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); +} + +function pointFpTwice() { + if(this.isInfinity()) return this; + if(this.y.toBigInteger().signum() == 0) return this.curve.getInfinity(); + + // TODO: optimized handling of constants + var THREE = new BigInteger("3"); + var x1 = this.x.toBigInteger(); + var y1 = this.y.toBigInteger(); + + var y1z1 = y1.multiply(this.z); + var y1sqz1 = y1z1.multiply(y1).mod(this.curve.q); + var a = this.curve.a.toBigInteger(); + + // w = 3 * x1^2 + a * z1^2 + var w = x1.square().multiply(THREE); + if(!BigInteger.ZERO.equals(a)) { + w = w.add(this.z.square().multiply(a)); + } + w = w.mod(this.curve.q); + //this.curve.reduce(w); + // x3 = 2 * y1 * z1 * (w^2 - 8 * x1 * y1^2 * z1) + var x3 = w.square().subtract(x1.shiftLeft(3).multiply(y1sqz1)).shiftLeft(1).multiply(y1z1).mod(this.curve.q); + // y3 = 4 * y1^2 * z1 * (3 * w * x1 - 2 * y1^2 * z1) - w^3 + var y3 = w.multiply(THREE).multiply(x1).subtract(y1sqz1.shiftLeft(1)).shiftLeft(2).multiply(y1sqz1).subtract(w.square().multiply(w)).mod(this.curve.q); + // z3 = 8 * (y1 * z1)^3 + var z3 = y1z1.square().multiply(y1z1).shiftLeft(3).mod(this.curve.q); + + return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); +} + +// Simple NAF (Non-Adjacent Form) multiplication algorithm +// TODO: modularize the multiplication algorithm +function pointFpMultiply(k) { + if(this.isInfinity()) return this; + if(k.signum() == 0) return this.curve.getInfinity(); + + var e = k; + var h = e.multiply(new BigInteger("3")); + + var neg = this.negate(); + var R = this; + + var i; + for(i = h.bitLength() - 2; i > 0; --i) { + R = R.twice(); + + var hBit = h.testBit(i); + var eBit = e.testBit(i); + + if (hBit != eBit) { + R = R.add(hBit ? this : neg); + } + } + + return R; +} + +// Compute this*j + x*k (simultaneous multiplication) +function pointFpMultiplyTwo(j,x,k) { + var i; + if(j.bitLength() > k.bitLength()) + i = j.bitLength() - 1; + else + i = k.bitLength() - 1; + + var R = this.curve.getInfinity(); + var both = this.add(x); + while(i >= 0) { + R = R.twice(); + if(j.testBit(i)) { + if(k.testBit(i)) { + R = R.add(both); + } + else { + R = R.add(this); + } + } + else { + if(k.testBit(i)) { + R = R.add(x); + } + } + --i; + } + + return R; +} + +ECPointFp.prototype.getX = pointFpGetX; +ECPointFp.prototype.getY = pointFpGetY; +ECPointFp.prototype.equals = pointFpEquals; +ECPointFp.prototype.isInfinity = pointFpIsInfinity; +ECPointFp.prototype.negate = pointFpNegate; +ECPointFp.prototype.add = pointFpAdd; +ECPointFp.prototype.twice = pointFpTwice; +ECPointFp.prototype.multiply = pointFpMultiply; +ECPointFp.prototype.multiplyTwo = pointFpMultiplyTwo; + +// ---------------- +// ECCurveFp + +// constructor +function ECCurveFp(q,a,b) { + this.q = q; + this.a = this.fromBigInteger(a); + this.b = this.fromBigInteger(b); + this.infinity = new ECPointFp(this, null, null); + this.reducer = new Barrett(this.q); +} + +function curveFpGetQ() { + return this.q; +} + +function curveFpGetA() { + return this.a; +} + +function curveFpGetB() { + return this.b; +} + +function curveFpEquals(other) { + if(other == this) return true; + return(this.q.equals(other.q) && this.a.equals(other.a) && this.b.equals(other.b)); +} + +function curveFpGetInfinity() { + return this.infinity; +} + +function curveFpFromBigInteger(x) { + return new ECFieldElementFp(this.q, x); +} + +function curveReduce(x) { + this.reducer.reduce(x); +} + +// for now, work with hex strings because they're easier in JS +function curveFpDecodePointHex(s) { + switch(parseInt(s.substr(0,2), 16)) { // first byte + case 0: + return this.infinity; + case 2: + case 3: + // point compression not supported yet + return null; + case 4: + case 6: + case 7: + var len = (s.length - 2) / 2; + var xHex = s.substr(2, len); + var yHex = s.substr(len+2, len); + + return new ECPointFp(this, + this.fromBigInteger(new BigInteger(xHex, 16)), + this.fromBigInteger(new BigInteger(yHex, 16))); + + default: // unsupported + return null; + } +} + +function curveFpEncodePointHex(p) { + if (p.isInfinity()) return "00"; + var xHex = p.getX().toBigInteger().toString(16); + var yHex = p.getY().toBigInteger().toString(16); + var oLen = this.getQ().toString(16).length; + if ((oLen % 2) != 0) oLen++; + while (xHex.length < oLen) { + xHex = "0" + xHex; + } + while (yHex.length < oLen) { + yHex = "0" + yHex; + } + return "04" + xHex + yHex; +} + +ECCurveFp.prototype.getQ = curveFpGetQ; +ECCurveFp.prototype.getA = curveFpGetA; +ECCurveFp.prototype.getB = curveFpGetB; +ECCurveFp.prototype.equals = curveFpEquals; +ECCurveFp.prototype.getInfinity = curveFpGetInfinity; +ECCurveFp.prototype.fromBigInteger = curveFpFromBigInteger; +ECCurveFp.prototype.reduce = curveReduce; +//ECCurveFp.prototype.decodePointHex = curveFpDecodePointHex; +ECCurveFp.prototype.encodePointHex = curveFpEncodePointHex; + +// from: https://github.com/kaielvin/jsbn-ec-point-compression +ECCurveFp.prototype.decodePointHex = function(s) +{ + var yIsEven; + switch(parseInt(s.substr(0,2), 16)) { // first byte + case 0: + return this.infinity; + case 2: + yIsEven = false; + case 3: + if(yIsEven == undefined) yIsEven = true; + var len = s.length - 2; + var xHex = s.substr(2, len); + var x = this.fromBigInteger(new BigInteger(xHex,16)); + var alpha = x.multiply(x.square().add(this.getA())).add(this.getB()); + var beta = alpha.sqrt(); + + if (beta == null) throw "Invalid point compression"; + + var betaValue = beta.toBigInteger(); + if (betaValue.testBit(0) != yIsEven) + { + // Use the other root + beta = this.fromBigInteger(this.getQ().subtract(betaValue)); + } + return new ECPointFp(this,x,beta); + case 4: + case 6: + case 7: + var len = (s.length - 2) / 2; + var xHex = s.substr(2, len); + var yHex = s.substr(len+2, len); + + return new ECPointFp(this, + this.fromBigInteger(new BigInteger(xHex, 16)), + this.fromBigInteger(new BigInteger(yHex, 16))); + + default: // unsupported + return null; + } +} +ECCurveFp.prototype.encodeCompressedPointHex = function(p) +{ + if (p.isInfinity()) return "00"; + var xHex = p.getX().toBigInteger().toString(16); + var oLen = this.getQ().toString(16).length; + if ((oLen % 2) != 0) oLen++; + while (xHex.length < oLen) + xHex = "0" + xHex; + var yPrefix; + if(p.getY().toBigInteger().isEven()) yPrefix = "02"; + else yPrefix = "03"; + + return yPrefix + xHex; +} + + +ECFieldElementFp.prototype.getR = function() +{ + if(this.r != undefined) return this.r; + + this.r = null; + var bitLength = this.q.bitLength(); + if (bitLength > 128) + { + var firstWord = this.q.shiftRight(bitLength - 64); + if (firstWord.intValue() == -1) + { + this.r = BigInteger.ONE.shiftLeft(bitLength).subtract(this.q); + } + } + return this.r; +} +ECFieldElementFp.prototype.modMult = function(x1,x2) +{ + return this.modReduce(x1.multiply(x2)); +} +ECFieldElementFp.prototype.modReduce = function(x) +{ + if (this.getR() != null) + { + var qLen = q.bitLength(); + while (x.bitLength() > (qLen + 1)) + { + var u = x.shiftRight(qLen); + var v = x.subtract(u.shiftLeft(qLen)); + if (!this.getR().equals(BigInteger.ONE)) + { + u = u.multiply(this.getR()); + } + x = u.add(v); + } + while (x.compareTo(q) >= 0) + { + x = x.subtract(q); + } + } + else + { + x = x.mod(q); + } + return x; +} +ECFieldElementFp.prototype.sqrt = function() +{ + if (!this.q.testBit(0)) throw "unsupported"; + + // p mod 4 == 3 + if (this.q.testBit(1)) + { + var z = new ECFieldElementFp(this.q,this.x.modPow(this.q.shiftRight(2).add(BigInteger.ONE),this.q)); + return z.square().equals(this) ? z : null; + } + + // p mod 4 == 1 + var qMinusOne = this.q.subtract(BigInteger.ONE); + + var legendreExponent = qMinusOne.shiftRight(1); + if (!(this.x.modPow(legendreExponent, this.q).equals(BigInteger.ONE))) + { + return null; + } + + var u = qMinusOne.shiftRight(2); + var k = u.shiftLeft(1).add(BigInteger.ONE); + + var Q = this.x; + var fourQ = modDouble(modDouble(Q)); + + var U, V; + do + { + var P; + do + { + P = new BigInteger(this.q.bitLength(), new SecureRandom()); + } + while (P.compareTo(this.q) >= 0 + || !(P.multiply(P).subtract(fourQ).modPow(legendreExponent, this.q).equals(qMinusOne))); + + var result = this.lucasSequence(P, Q, k); + U = result[0]; + V = result[1]; + + if (this.modMult(V, V).equals(fourQ)) + { + // Integer division by 2, mod q + if (V.testBit(0)) + { + V = V.add(q); + } + + V = V.shiftRight(1); + + return new ECFieldElementFp(q,V); + } + } + while (U.equals(BigInteger.ONE) || U.equals(qMinusOne)); + + return null; +} +ECFieldElementFp.prototype.lucasSequence = function(P,Q,k) +{ + var n = k.bitLength(); + var s = k.getLowestSetBit(); + + var Uh = BigInteger.ONE; + var Vl = BigInteger.TWO; + var Vh = P; + var Ql = BigInteger.ONE; + var Qh = BigInteger.ONE; + + for (var j = n - 1; j >= s + 1; --j) + { + Ql = this.modMult(Ql, Qh); + + if (k.testBit(j)) + { + Qh = this.modMult(Ql, Q); + Uh = this.modMult(Uh, Vh); + Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); + Vh = this.modReduce(Vh.multiply(Vh).subtract(Qh.shiftLeft(1))); + } + else + { + Qh = Ql; + Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); + Vh = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); + Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); + } + } + + Ql = this.modMult(Ql, Qh); + Qh = this.modMult(Ql, Q); + Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); + Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); + Ql = this.modMult(Ql, Qh); + + for (var j = 1; j <= s; ++j) + { + Uh = this.modMult(Uh, Vl); + Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); + Ql = this.modMult(Ql, Ql); + } + + return [ Uh, Vl ]; +} + +var exports = { + ECCurveFp: ECCurveFp, + ECPointFp: ECPointFp, + ECFieldElementFp: ECFieldElementFp +} + +module.exports = exports + + +/***/ }), + +/***/ 733: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2011 Mark Cavage All rights reserved. + +var assert = __webpack_require__(357); +var Buffer = __webpack_require__(215).Buffer; + +var ASN1 = __webpack_require__(362); +var errors = __webpack_require__(584); + + +// --- Globals + +var newInvalidAsn1Error = errors.newInvalidAsn1Error; + + + +// --- API + +function Reader(data) { + if (!data || !Buffer.isBuffer(data)) + throw new TypeError('data must be a node Buffer'); + + this._buf = data; + this._size = data.length; + + // These hold the "current" state + this._len = 0; + this._offset = 0; +} + +Object.defineProperty(Reader.prototype, 'length', { + enumerable: true, + get: function () { return (this._len); } +}); + +Object.defineProperty(Reader.prototype, 'offset', { + enumerable: true, + get: function () { return (this._offset); } +}); + +Object.defineProperty(Reader.prototype, 'remain', { + get: function () { return (this._size - this._offset); } +}); + +Object.defineProperty(Reader.prototype, 'buffer', { + get: function () { return (this._buf.slice(this._offset)); } +}); + + +/** + * Reads a single byte and advances offset; you can pass in `true` to make this + * a "peek" operation (i.e., get the byte, but don't advance the offset). + * + * @param {Boolean} peek true means don't move offset. + * @return {Number} the next byte, null if not enough data. + */ +Reader.prototype.readByte = function (peek) { + if (this._size - this._offset < 1) + return null; + + var b = this._buf[this._offset] & 0xff; + + if (!peek) + this._offset += 1; + + return b; }; -/*JSSTYLED*/ -var base64RE = /^[A-Za-z0-9+\/=]+$/; -/*JSSTYLED*/ -var hexRE = /^[a-fA-F0-9]+$/; -Fingerprint.parse = function (fp, options) { - assert.string(fp, 'fingerprint'); +Reader.prototype.peek = function () { + return this.readByte(true); +}; - var alg, hash, enAlgs; - if (Array.isArray(options)) { - enAlgs = options; - options = {}; + +/** + * Reads a (potentially) variable length off the BER buffer. This call is + * not really meant to be called directly, as callers have to manipulate + * the internal buffer afterwards. + * + * As a result of this call, you can call `Reader.length`, until the + * next thing called that does a readLength. + * + * @return {Number} the amount of offset to advance the buffer. + * @throws {InvalidAsn1Error} on bad ASN.1 + */ +Reader.prototype.readLength = function (offset) { + if (offset === undefined) + offset = this._offset; + + if (offset >= this._size) + return null; + + var lenB = this._buf[offset++] & 0xff; + if (lenB === null) + return null; + + if ((lenB & 0x80) === 0x80) { + lenB &= 0x7f; + + if (lenB === 0) + throw newInvalidAsn1Error('Indefinite length not supported'); + + if (lenB > 4) + throw newInvalidAsn1Error('encoding too long'); + + if (this._size - offset < lenB) + return null; + + this._len = 0; + for (var i = 0; i < lenB; i++) + this._len = (this._len << 8) + (this._buf[offset++] & 0xff); + + } else { + // Wasn't a variable length + this._len = lenB; + } + + return offset; +}; + + +/** + * Parses the next sequence in this BER buffer. + * + * To get the length of the sequence, call `Reader.length`. + * + * @return {Number} the sequence's tag. + */ +Reader.prototype.readSequence = function (tag) { + var seq = this.peek(); + if (seq === null) + return null; + if (tag !== undefined && tag !== seq) + throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) + + ': got 0x' + seq.toString(16)); + + var o = this.readLength(this._offset + 1); // stored in `length` + if (o === null) + return null; + + this._offset = o; + return seq; +}; + + +Reader.prototype.readInt = function () { + return this._readTag(ASN1.Integer); +}; + + +Reader.prototype.readBoolean = function () { + return (this._readTag(ASN1.Boolean) === 0 ? false : true); +}; + + +Reader.prototype.readEnumeration = function () { + return this._readTag(ASN1.Enumeration); +}; + + +Reader.prototype.readString = function (tag, retbuf) { + if (!tag) + tag = ASN1.OctetString; + + var b = this.peek(); + if (b === null) + return null; + + if (b !== tag) + throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) + + ': got 0x' + b.toString(16)); + + var o = this.readLength(this._offset + 1); // stored in `length` + + if (o === null) + return null; + + if (this.length > this._size - o) + return null; + + this._offset = o; + + if (this.length === 0) + return retbuf ? Buffer.alloc(0) : ''; + + var str = this._buf.slice(this._offset, this._offset + this.length); + this._offset += this.length; + + return retbuf ? str : str.toString('utf8'); +}; + +Reader.prototype.readOID = function (tag) { + if (!tag) + tag = ASN1.OID; + + var b = this.readString(tag, true); + if (b === null) + return null; + + var values = []; + var value = 0; + + for (var i = 0; i < b.length; i++) { + var byte = b[i] & 0xff; + + value <<= 7; + value += byte & 0x7f; + if ((byte & 0x80) === 0) { + values.push(value); + value = 0; + } + } + + value = values.shift(); + values.unshift(value % 40); + values.unshift((value / 40) >> 0); + + return values.join('.'); +}; + + +Reader.prototype._readTag = function (tag) { + assert.ok(tag !== undefined); + + var b = this.peek(); + + if (b === null) + return null; + + if (b !== tag) + throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) + + ': got 0x' + b.toString(16)); + + var o = this.readLength(this._offset + 1); // stored in `length` + if (o === null) + return null; + + if (this.length > 4) + throw newInvalidAsn1Error('Integer too long: ' + this.length); + + if (this.length > this._size - o) + return null; + this._offset = o; + + var fb = this._buf[this._offset]; + var value = 0; + + for (var i = 0; i < this.length; i++) { + value <<= 8; + value |= (this._buf[this._offset++] & 0xff); + } + + if ((fb & 0x80) === 0x80 && i !== 4) + value -= (1 << (i * 8)); + + return value >> 0; +}; + + + +// --- Exported API + +module.exports = Reader; + + +/***/ }), + +/***/ 740: +/***/ (function(module) { + +module.exports = {"$id":"postData.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["mimeType"],"properties":{"mimeType":{"type":"string"},"text":{"type":"string"},"params":{"type":"array","required":["name"],"properties":{"name":{"type":"string"},"value":{"type":"string"},"fileName":{"type":"string"},"contentType":{"type":"string"},"comment":{"type":"string"}}},"comment":{"type":"string"}}}; + +/***/ }), + +/***/ 741: +/***/ (function(module) { + +"use strict"; + + +module.exports = function (data, opts) { + if (!opts) opts = {}; + if (typeof opts === 'function') opts = { cmp: opts }; + var cycles = (typeof opts.cycles === 'boolean') ? opts.cycles : false; + + var cmp = opts.cmp && (function (f) { + return function (node) { + return function (a, b) { + var aobj = { key: a, value: node[a] }; + var bobj = { key: b, value: node[b] }; + return f(aobj, bobj); + }; + }; + })(opts.cmp); + + var seen = []; + return (function stringify (node) { + if (node && node.toJSON && typeof node.toJSON === 'function') { + node = node.toJSON(); + } + + if (node === undefined) return; + if (typeof node == 'number') return isFinite(node) ? '' + node : 'null'; + if (typeof node !== 'object') return JSON.stringify(node); + + var i, out; + if (Array.isArray(node)) { + out = '['; + for (i = 0; i < node.length; i++) { + if (i) out += ','; + out += stringify(node[i]) || 'null'; + } + return out + ']'; + } + + if (node === null) return 'null'; + + if (seen.indexOf(node) !== -1) { + if (cycles) return JSON.stringify('__cycle__'); + throw new TypeError('Converting circular structure to JSON'); + } + + var seenIndex = seen.push(node) - 1; + var keys = Object.keys(node).sort(cmp && cmp(node)); + out = ''; + for (i = 0; i < keys.length; i++) { + var key = keys[i]; + var value = stringify(node[key]); + + if (!value) continue; + if (out) out += ','; + out += JSON.stringify(key) + ':' + value; + } + seen.splice(seenIndex, 1); + return '{' + out + '}'; + })(data); +}; + + +/***/ }), + +/***/ 742: +/***/ (function(module) { + +// Generated by CoffeeScript 1.12.2 +(function() { + var getNanoSeconds, hrtime, loadTime, moduleLoadTime, nodeLoadTime, upTime; + + if ((typeof performance !== "undefined" && performance !== null) && performance.now) { + module.exports = function() { + return performance.now(); + }; + } else if ((typeof process !== "undefined" && process !== null) && process.hrtime) { + module.exports = function() { + return (getNanoSeconds() - nodeLoadTime) / 1e6; + }; + hrtime = process.hrtime; + getNanoSeconds = function() { + var hr; + hr = hrtime(); + return hr[0] * 1e9 + hr[1]; + }; + moduleLoadTime = getNanoSeconds(); + upTime = process.uptime() * 1e9; + nodeLoadTime = moduleLoadTime - upTime; + } else if (Date.now) { + module.exports = function() { + return Date.now() - loadTime; + }; + loadTime = Date.now(); + } else { + module.exports = function() { + return new Date().getTime() - loadTime; + }; + loadTime = new Date().getTime(); + } + +}).call(this); + +//# sourceMappingURL=performance-now.js.map + + +/***/ }), + +/***/ 744: +/***/ (function(module) { + +module.exports = {"$id":"page.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["startedDateTime","id","title","pageTimings"],"properties":{"startedDateTime":{"type":"string","format":"date-time","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))"},"id":{"type":"string","unique":true},"title":{"type":"string"},"pageTimings":{"$ref":"pageTimings.json#"},"comment":{"type":"string"}}}; + +/***/ }), + +/***/ 747: +/***/ (function(module) { + +module.exports = require("fs"); + +/***/ }), + +/***/ 750: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +"use strict"; +/*eslint no-var:0, prefer-arrow-callback: 0, object-shorthand: 0 */ + + + +var Punycode = __webpack_require__(213); + + +var internals = {}; + + +// +// Read rules from file. +// +internals.rules = __webpack_require__(50).map(function (rule) { + + return { + rule: rule, + suffix: rule.replace(/^(\*\.|\!)/, ''), + punySuffix: -1, + wildcard: rule.charAt(0) === '*', + exception: rule.charAt(0) === '!' + }; +}); + + +// +// Check is given string ends with `suffix`. +// +internals.endsWith = function (str, suffix) { + + return str.indexOf(suffix, str.length - suffix.length) !== -1; +}; + + +// +// Find rule for a given domain. +// +internals.findRule = function (domain) { + + var punyDomain = Punycode.toASCII(domain); + return internals.rules.reduce(function (memo, rule) { + + if (rule.punySuffix === -1){ + rule.punySuffix = Punycode.toASCII(rule.suffix); + } + if (!internals.endsWith(punyDomain, '.' + rule.punySuffix) && punyDomain !== rule.punySuffix) { + return memo; + } + // This has been commented out as it never seems to run. This is because + // sub tlds always appear after their parents and we never find a shorter + // match. + //if (memo) { + // var memoSuffix = Punycode.toASCII(memo.suffix); + // if (memoSuffix.length >= punySuffix.length) { + // return memo; + // } + //} + return rule; + }, null); +}; + + +// +// Error codes and messages. +// +exports.errorCodes = { + DOMAIN_TOO_SHORT: 'Domain name too short.', + DOMAIN_TOO_LONG: 'Domain name too long. It should be no more than 255 chars.', + LABEL_STARTS_WITH_DASH: 'Domain name label can not start with a dash.', + LABEL_ENDS_WITH_DASH: 'Domain name label can not end with a dash.', + LABEL_TOO_LONG: 'Domain name label should be at most 63 chars long.', + LABEL_TOO_SHORT: 'Domain name label should be at least 1 character long.', + LABEL_INVALID_CHARS: 'Domain name label can only contain alphanumeric characters or dashes.' +}; + + +// +// Validate domain name and throw if not valid. +// +// From wikipedia: +// +// Hostnames are composed of series of labels concatenated with dots, as are all +// domain names. Each label must be between 1 and 63 characters long, and the +// entire hostname (including the delimiting dots) has a maximum of 255 chars. +// +// Allowed chars: +// +// * `a-z` +// * `0-9` +// * `-` but not as a starting or ending character +// * `.` as a separator for the textual portions of a domain name +// +// * http://en.wikipedia.org/wiki/Domain_name +// * http://en.wikipedia.org/wiki/Hostname +// +internals.validate = function (input) { + + // Before we can validate we need to take care of IDNs with unicode chars. + var ascii = Punycode.toASCII(input); + + if (ascii.length < 1) { + return 'DOMAIN_TOO_SHORT'; + } + if (ascii.length > 255) { + return 'DOMAIN_TOO_LONG'; + } + + // Check each part's length and allowed chars. + var labels = ascii.split('.'); + var label; + + for (var i = 0; i < labels.length; ++i) { + label = labels[i]; + if (!label.length) { + return 'LABEL_TOO_SHORT'; + } + if (label.length > 63) { + return 'LABEL_TOO_LONG'; + } + if (label.charAt(0) === '-') { + return 'LABEL_STARTS_WITH_DASH'; + } + if (label.charAt(label.length - 1) === '-') { + return 'LABEL_ENDS_WITH_DASH'; + } + if (!/^[a-z0-9\-]+$/.test(label)) { + return 'LABEL_INVALID_CHARS'; + } + } +}; + + +// +// Public API +// + + +// +// Parse domain. +// +exports.parse = function (input) { + + if (typeof input !== 'string') { + throw new TypeError('Domain name must be a string.'); + } + + // Force domain to lowercase. + var domain = input.slice(0).toLowerCase(); + + // Handle FQDN. + // TODO: Simply remove trailing dot? + if (domain.charAt(domain.length - 1) === '.') { + domain = domain.slice(0, domain.length - 1); + } + + // Validate and sanitise input. + var error = internals.validate(domain); + if (error) { + return { + input: input, + error: { + message: exports.errorCodes[error], + code: error + } + }; + } + + var parsed = { + input: input, + tld: null, + sld: null, + domain: null, + subdomain: null, + listed: false + }; + + var domainParts = domain.split('.'); + + // Non-Internet TLD + if (domainParts[domainParts.length - 1] === 'local') { + return parsed; + } + + var handlePunycode = function () { + + if (!/xn--/.test(domain)) { + return parsed; + } + if (parsed.domain) { + parsed.domain = Punycode.toASCII(parsed.domain); + } + if (parsed.subdomain) { + parsed.subdomain = Punycode.toASCII(parsed.subdomain); + } + return parsed; + }; + + var rule = internals.findRule(domain); + + // Unlisted tld. + if (!rule) { + if (domainParts.length < 2) { + return parsed; + } + parsed.tld = domainParts.pop(); + parsed.sld = domainParts.pop(); + parsed.domain = [parsed.sld, parsed.tld].join('.'); + if (domainParts.length) { + parsed.subdomain = domainParts.pop(); + } + return handlePunycode(); + } + + // At this point we know the public suffix is listed. + parsed.listed = true; + + var tldParts = rule.suffix.split('.'); + var privateParts = domainParts.slice(0, domainParts.length - tldParts.length); + + if (rule.exception) { + privateParts.push(tldParts.shift()); + } + + parsed.tld = tldParts.join('.'); + + if (!privateParts.length) { + return handlePunycode(); + } + + if (rule.wildcard) { + tldParts.unshift(privateParts.pop()); + parsed.tld = tldParts.join('.'); + } + + if (!privateParts.length) { + return handlePunycode(); + } + + parsed.sld = privateParts.pop(); + parsed.domain = [parsed.sld, parsed.tld].join('.'); + + if (privateParts.length) { + parsed.subdomain = privateParts.join('.'); + } + + return handlePunycode(); +}; + + +// +// Get domain. +// +exports.get = function (domain) { + + if (!domain) { + return null; + } + return exports.parse(domain).domain || null; +}; + + +// +// Check whether domain belongs to a known public suffix. +// +exports.isValid = function (domain) { + + var parsed = exports.parse(domain); + return Boolean(parsed.domain && parsed.listed); +}; + + +/***/ }), + +/***/ 751: +/***/ (function(module, __unusedexports, __webpack_require__) { + +var defer = __webpack_require__(500); + +// API +module.exports = async; + +/** + * Runs provided callback asynchronously + * even if callback itself is not + * + * @param {function} callback - callback to invoke + * @returns {function} - augmented callback + */ +function async(callback) +{ + var isAsync = false; + + // check if async happened + defer(function() { isAsync = true; }); + + return function async_callback(err, result) + { + if (isAsync) + { + callback(err, result); + } + else + { + defer(function nextTick_callback() + { + callback(err, result); + }); + } + }; +} + + +/***/ }), + +/***/ 752: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2016 Joyent, Inc. + +module.exports = Certificate; + +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var crypto = __webpack_require__(417); +var Fingerprint = __webpack_require__(400); +var Signature = __webpack_require__(575); +var errs = __webpack_require__(753); +var util = __webpack_require__(669); +var utils = __webpack_require__(270); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var Identity = __webpack_require__(378); + +var formats = {}; +formats['openssh'] = __webpack_require__(893); +formats['x509'] = __webpack_require__(866); +formats['pem'] = __webpack_require__(680); + +var CertificateParseError = errs.CertificateParseError; +var InvalidAlgorithmError = errs.InvalidAlgorithmError; + +function Certificate(opts) { + assert.object(opts, 'options'); + assert.arrayOfObject(opts.subjects, 'options.subjects'); + utils.assertCompatible(opts.subjects[0], Identity, [1, 0], + 'options.subjects'); + utils.assertCompatible(opts.subjectKey, Key, [1, 0], + 'options.subjectKey'); + utils.assertCompatible(opts.issuer, Identity, [1, 0], 'options.issuer'); + if (opts.issuerKey !== undefined) { + utils.assertCompatible(opts.issuerKey, Key, [1, 0], + 'options.issuerKey'); } + assert.object(opts.signatures, 'options.signatures'); + assert.buffer(opts.serial, 'options.serial'); + assert.date(opts.validFrom, 'options.validFrom'); + assert.date(opts.validUntil, 'optons.validUntil'); + + assert.optionalArrayOfString(opts.purposes, 'options.purposes'); + + this._hashCache = {}; + + this.subjects = opts.subjects; + this.issuer = opts.issuer; + this.subjectKey = opts.subjectKey; + this.issuerKey = opts.issuerKey; + this.signatures = opts.signatures; + this.serial = opts.serial; + this.validFrom = opts.validFrom; + this.validUntil = opts.validUntil; + this.purposes = opts.purposes; +} + +Certificate.formats = formats; + +Certificate.prototype.toBuffer = function (format, options) { + if (format === undefined) + format = 'x509'; + assert.string(format, 'format'); + assert.object(formats[format], 'formats[format]'); + assert.optionalObject(options, 'options'); + + return (formats[format].write(this, options)); +}; + +Certificate.prototype.toString = function (format, options) { + if (format === undefined) + format = 'pem'; + return (this.toBuffer(format, options).toString()); +}; + +Certificate.prototype.fingerprint = function (algo) { + if (algo === undefined) + algo = 'sha256'; + assert.string(algo, 'algorithm'); + var opts = { + type: 'certificate', + hash: this.hash(algo), + algorithm: algo + }; + return (new Fingerprint(opts)); +}; + +Certificate.prototype.hash = function (algo) { + assert.string(algo, 'algorithm'); + algo = algo.toLowerCase(); + if (algs.hashAlgs[algo] === undefined) + throw (new InvalidAlgorithmError(algo)); + + if (this._hashCache[algo]) + return (this._hashCache[algo]); + + var hash = crypto.createHash(algo). + update(this.toBuffer('x509')).digest(); + this._hashCache[algo] = hash; + return (hash); +}; + +Certificate.prototype.isExpired = function (when) { + if (when === undefined) + when = new Date(); + return (!((when.getTime() >= this.validFrom.getTime()) && + (when.getTime() < this.validUntil.getTime()))); +}; + +Certificate.prototype.isSignedBy = function (issuerCert) { + utils.assertCompatible(issuerCert, Certificate, [1, 0], 'issuer'); + + if (!this.issuer.equals(issuerCert.subjects[0])) + return (false); + if (this.issuer.purposes && this.issuer.purposes.length > 0 && + this.issuer.purposes.indexOf('ca') === -1) { + return (false); + } + + return (this.isSignedByKey(issuerCert.subjectKey)); +}; + +Certificate.prototype.getExtension = function (keyOrOid) { + assert.string(keyOrOid, 'keyOrOid'); + var ext = this.getExtensions().filter(function (maybeExt) { + if (maybeExt.format === 'x509') + return (maybeExt.oid === keyOrOid); + if (maybeExt.format === 'openssh') + return (maybeExt.name === keyOrOid); + return (false); + })[0]; + return (ext); +}; + +Certificate.prototype.getExtensions = function () { + var exts = []; + var x509 = this.signatures.x509; + if (x509 && x509.extras && x509.extras.exts) { + x509.extras.exts.forEach(function (ext) { + ext.format = 'x509'; + exts.push(ext); + }); + } + var openssh = this.signatures.openssh; + if (openssh && openssh.exts) { + openssh.exts.forEach(function (ext) { + ext.format = 'openssh'; + exts.push(ext); + }); + } + return (exts); +}; + +Certificate.prototype.isSignedByKey = function (issuerKey) { + utils.assertCompatible(issuerKey, Key, [1, 2], 'issuerKey'); + + if (this.issuerKey !== undefined) { + return (this.issuerKey. + fingerprint('sha512').matches(issuerKey)); + } + + var fmt = Object.keys(this.signatures)[0]; + var valid = formats[fmt].verify(this, issuerKey); + if (valid) + this.issuerKey = issuerKey; + return (valid); +}; + +Certificate.prototype.signWith = function (key) { + utils.assertCompatible(key, PrivateKey, [1, 2], 'key'); + var fmts = Object.keys(formats); + var didOne = false; + for (var i = 0; i < fmts.length; ++i) { + if (fmts[i] !== 'pem') { + var ret = formats[fmts[i]].sign(this, key); + if (ret === true) + didOne = true; + } + } + if (!didOne) { + throw (new Error('Failed to sign the certificate for any ' + + 'available certificate formats')); + } +}; + +Certificate.createSelfSigned = function (subjectOrSubjects, key, options) { + var subjects; + if (Array.isArray(subjectOrSubjects)) + subjects = subjectOrSubjects; + else + subjects = [subjectOrSubjects]; + + assert.arrayOfObject(subjects); + subjects.forEach(function (subject) { + utils.assertCompatible(subject, Identity, [1, 0], 'subject'); + }); + + utils.assertCompatible(key, PrivateKey, [1, 2], 'private key'); + assert.optionalObject(options, 'options'); if (options === undefined) options = {}; - if (options.enAlgs !== undefined) - enAlgs = options.enAlgs; - if (options.algorithms !== undefined) - enAlgs = options.algorithms; - assert.optionalArrayOfString(enAlgs, 'algorithms'); + assert.optionalObject(options.validFrom, 'options.validFrom'); + assert.optionalObject(options.validUntil, 'options.validUntil'); + var validFrom = options.validFrom; + var validUntil = options.validUntil; + if (validFrom === undefined) + validFrom = new Date(); + if (validUntil === undefined) { + assert.optionalNumber(options.lifetime, 'options.lifetime'); + var lifetime = options.lifetime; + if (lifetime === undefined) + lifetime = 10*365*24*3600; + validUntil = new Date(); + validUntil.setTime(validUntil.getTime() + lifetime*1000); + } + assert.optionalBuffer(options.serial, 'options.serial'); + var serial = options.serial; + if (serial === undefined) + serial = Buffer.from('0000000000000001', 'hex'); - var hashType = 'ssh'; - if (options.hashType !== undefined) - hashType = options.hashType; - assert.string(hashType, 'options.hashType'); + var purposes = options.purposes; + if (purposes === undefined) + purposes = []; - var parts = fp.split(':'); - if (parts.length == 2) { - alg = parts[0].toLowerCase(); - if (!base64RE.test(parts[1])) - throw (new FingerprintFormatError(fp)); - try { - hash = Buffer.from(parts[1], 'base64'); - } catch (e) { - throw (new FingerprintFormatError(fp)); - } - } else if (parts.length > 2) { - alg = 'md5'; - if (parts[0].toLowerCase() === 'md5') - parts = parts.slice(1); - parts = parts.map(function (p) { - while (p.length < 2) - p = '0' + p; - if (p.length > 2) - throw (new FingerprintFormatError(fp)); - return (p); + if (purposes.indexOf('signature') === -1) + purposes.push('signature'); + + /* Self-signed certs are always CAs. */ + if (purposes.indexOf('ca') === -1) + purposes.push('ca'); + if (purposes.indexOf('crl') === -1) + purposes.push('crl'); + + /* + * If we weren't explicitly given any other purposes, do the sensible + * thing and add some basic ones depending on the subject type. + */ + if (purposes.length <= 3) { + var hostSubjects = subjects.filter(function (subject) { + return (subject.type === 'host'); }); - parts = parts.join(''); - if (!hexRE.test(parts) || parts.length % 2 !== 0) - throw (new FingerprintFormatError(fp)); - try { - hash = Buffer.from(parts, 'hex'); - } catch (e) { - throw (new FingerprintFormatError(fp)); + var userSubjects = subjects.filter(function (subject) { + return (subject.type === 'user'); + }); + if (hostSubjects.length > 0) { + if (purposes.indexOf('serverAuth') === -1) + purposes.push('serverAuth'); } - } else { - if (hexRE.test(fp)) { - hash = Buffer.from(fp, 'hex'); - } else if (base64RE.test(fp)) { - hash = Buffer.from(fp, 'base64'); - } else { - throw (new FingerprintFormatError(fp)); + if (userSubjects.length > 0) { + if (purposes.indexOf('clientAuth') === -1) + purposes.push('clientAuth'); } - - switch (hash.length) { - case 32: - alg = 'sha256'; - break; - case 16: - alg = 'md5'; - break; - case 20: - alg = 'sha1'; - break; - case 64: - alg = 'sha512'; - break; - default: - throw (new FingerprintFormatError(fp)); + if (userSubjects.length > 0 || hostSubjects.length > 0) { + if (purposes.indexOf('keyAgreement') === -1) + purposes.push('keyAgreement'); + if (key.type === 'rsa' && + purposes.indexOf('encryption') === -1) + purposes.push('encryption'); } - - /* Plain hex/base64: guess it's probably SPKI unless told. */ - if (options.hashType === undefined) - hashType = 'spki'; } - if (alg === undefined) - throw (new FingerprintFormatError(fp)); + var cert = new Certificate({ + subjects: subjects, + issuer: subjects[0], + subjectKey: key.toPublic(), + issuerKey: key.toPublic(), + signatures: {}, + serial: serial, + validFrom: validFrom, + validUntil: validUntil, + purposes: purposes + }); + cert.signWith(key); - if (algs.hashAlgs[alg] === undefined) - throw (new InvalidAlgorithmError(alg)); - - if (enAlgs !== undefined) { - enAlgs = enAlgs.map(function (a) { return a.toLowerCase(); }); - if (enAlgs.indexOf(alg) === -1) - throw (new InvalidAlgorithmError(alg)); - } - - return (new Fingerprint({ - algorithm: alg, - hash: hash, - type: options.type || 'key', - hashType: hashType - })); + return (cert); }; -function addColons(s) { - /*JSSTYLED*/ - return (s.replace(/(.{2})(?=.)/g, '$1:')); -} +Certificate.create = + function (subjectOrSubjects, key, issuer, issuerKey, options) { + var subjects; + if (Array.isArray(subjectOrSubjects)) + subjects = subjectOrSubjects; + else + subjects = [subjectOrSubjects]; -function base64Strip(s) { - /*JSSTYLED*/ - return (s.replace(/=*$/, '')); -} + assert.arrayOfObject(subjects); + subjects.forEach(function (subject) { + utils.assertCompatible(subject, Identity, [1, 0], 'subject'); + }); -function sshBase64Format(alg, h) { - return (alg.toUpperCase() + ':' + base64Strip(h)); -} + utils.assertCompatible(key, Key, [1, 0], 'key'); + if (PrivateKey.isPrivateKey(key)) + key = key.toPublic(); + utils.assertCompatible(issuer, Identity, [1, 0], 'issuer'); + utils.assertCompatible(issuerKey, PrivateKey, [1, 2], 'issuer key'); -Fingerprint.isFingerprint = function (obj, ver) { - return (utils.isCompatible(obj, Fingerprint, ver)); + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalObject(options.validFrom, 'options.validFrom'); + assert.optionalObject(options.validUntil, 'options.validUntil'); + var validFrom = options.validFrom; + var validUntil = options.validUntil; + if (validFrom === undefined) + validFrom = new Date(); + if (validUntil === undefined) { + assert.optionalNumber(options.lifetime, 'options.lifetime'); + var lifetime = options.lifetime; + if (lifetime === undefined) + lifetime = 10*365*24*3600; + validUntil = new Date(); + validUntil.setTime(validUntil.getTime() + lifetime*1000); + } + assert.optionalBuffer(options.serial, 'options.serial'); + var serial = options.serial; + if (serial === undefined) + serial = Buffer.from('0000000000000001', 'hex'); + + var purposes = options.purposes; + if (purposes === undefined) + purposes = []; + + if (purposes.indexOf('signature') === -1) + purposes.push('signature'); + + if (options.ca === true) { + if (purposes.indexOf('ca') === -1) + purposes.push('ca'); + if (purposes.indexOf('crl') === -1) + purposes.push('crl'); + } + + var hostSubjects = subjects.filter(function (subject) { + return (subject.type === 'host'); + }); + var userSubjects = subjects.filter(function (subject) { + return (subject.type === 'user'); + }); + if (hostSubjects.length > 0) { + if (purposes.indexOf('serverAuth') === -1) + purposes.push('serverAuth'); + } + if (userSubjects.length > 0) { + if (purposes.indexOf('clientAuth') === -1) + purposes.push('clientAuth'); + } + if (userSubjects.length > 0 || hostSubjects.length > 0) { + if (purposes.indexOf('keyAgreement') === -1) + purposes.push('keyAgreement'); + if (key.type === 'rsa' && + purposes.indexOf('encryption') === -1) + purposes.push('encryption'); + } + + var cert = new Certificate({ + subjects: subjects, + issuer: issuer, + subjectKey: key, + issuerKey: issuerKey.toPublic(), + signatures: {}, + serial: serial, + validFrom: validFrom, + validUntil: validUntil, + purposes: purposes + }); + cert.signWith(issuerKey); + + return (cert); +}; + +Certificate.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; + + assert.object(formats[format], 'formats[format]'); + + try { + var k = formats[format].read(data, options); + return (k); + } catch (e) { + throw (new CertificateParseError(options.filename, format, e)); + } +}; + +Certificate.isCertificate = function (obj, ver) { + return (utils.isCompatible(obj, Certificate, ver)); }; /* - * API versions for Fingerprint: + * API versions for Certificate: * [1,0] -- initial ver - * [1,1] -- first tagged ver - * [1,2] -- hashType and spki support + * [1,1] -- openssh format now unpacks extensions */ -Fingerprint.prototype._sshpkApiVersion = [1, 2]; +Certificate.prototype._sshpkApiVersion = [1, 1]; -Fingerprint._oldVersionDetect = function (obj) { - assert.func(obj.toString); - assert.func(obj.matches); +Certificate._oldVersionDetect = function (obj) { return ([1, 0]); }; /***/ }), -/***/ 660: +/***/ 753: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +var assert = __webpack_require__(477); +var util = __webpack_require__(669); + +function FingerprintFormatError(fp, format) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, FingerprintFormatError); + this.name = 'FingerprintFormatError'; + this.fingerprint = fp; + this.format = format; + this.message = 'Fingerprint format is not supported, or is invalid: '; + if (fp !== undefined) + this.message += ' fingerprint = ' + fp; + if (format !== undefined) + this.message += ' format = ' + format; +} +util.inherits(FingerprintFormatError, Error); + +function InvalidAlgorithmError(alg) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, InvalidAlgorithmError); + this.name = 'InvalidAlgorithmError'; + this.algorithm = alg; + this.message = 'Algorithm "' + alg + '" is not supported'; +} +util.inherits(InvalidAlgorithmError, Error); + +function KeyParseError(name, format, innerErr) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, KeyParseError); + this.name = 'KeyParseError'; + this.format = format; + this.keyName = name; + this.innerErr = innerErr; + this.message = 'Failed to parse ' + name + ' as a valid ' + format + + ' format key: ' + innerErr.message; +} +util.inherits(KeyParseError, Error); + +function SignatureParseError(type, format, innerErr) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, SignatureParseError); + this.name = 'SignatureParseError'; + this.type = type; + this.format = format; + this.innerErr = innerErr; + this.message = 'Failed to parse the given data as a ' + type + + ' signature in ' + format + ' format: ' + innerErr.message; +} +util.inherits(SignatureParseError, Error); + +function CertificateParseError(name, format, innerErr) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, CertificateParseError); + this.name = 'CertificateParseError'; + this.format = format; + this.certName = name; + this.innerErr = innerErr; + this.message = 'Failed to parse ' + name + ' as a valid ' + format + + ' format certificate: ' + innerErr.message; +} +util.inherits(CertificateParseError, Error); + +function KeyEncryptedError(name, format) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, KeyEncryptedError); + this.name = 'KeyEncryptedError'; + this.format = format; + this.keyName = name; + this.message = 'The ' + format + ' format key ' + name + ' is ' + + 'encrypted (password-protected), and no passphrase was ' + + 'provided in `options`'; +} +util.inherits(KeyEncryptedError, Error); + +module.exports = { + FingerprintFormatError: FingerprintFormatError, + InvalidAlgorithmError: InvalidAlgorithmError, + KeyParseError: KeyParseError, + SignatureParseError: SignatureParseError, + KeyEncryptedError: KeyEncryptedError, + CertificateParseError: CertificateParseError +}; + + +/***/ }), + +/***/ 755: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; -var util = __webpack_require__(435); +var utils = __webpack_require__(581); -module.exports = SchemaObject; +var has = Object.prototype.hasOwnProperty; -function SchemaObject(obj) { - util.copy(obj, this); -} +var defaults = { + allowDots: false, + allowPrototypes: false, + arrayLimit: 20, + decoder: utils.decode, + delimiter: '&', + depth: 5, + parameterLimit: 1000, + plainObjects: false, + strictNullHandling: false +}; + +var parseValues = function parseQueryStringValues(str, options) { + var obj = {}; + var cleanStr = options.ignoreQueryPrefix ? str.replace(/^\?/, '') : str; + var limit = options.parameterLimit === Infinity ? undefined : options.parameterLimit; + var parts = cleanStr.split(options.delimiter, limit); + + for (var i = 0; i < parts.length; ++i) { + var part = parts[i]; + + var bracketEqualsPos = part.indexOf(']='); + var pos = bracketEqualsPos === -1 ? part.indexOf('=') : bracketEqualsPos + 1; + + var key, val; + if (pos === -1) { + key = options.decoder(part, defaults.decoder); + val = options.strictNullHandling ? null : ''; + } else { + key = options.decoder(part.slice(0, pos), defaults.decoder); + val = options.decoder(part.slice(pos + 1), defaults.decoder); + } + if (has.call(obj, key)) { + obj[key] = [].concat(obj[key]).concat(val); + } else { + obj[key] = val; + } + } + + return obj; +}; + +var parseObject = function (chain, val, options) { + var leaf = val; + + for (var i = chain.length - 1; i >= 0; --i) { + var obj; + var root = chain[i]; + + if (root === '[]') { + obj = []; + obj = obj.concat(leaf); + } else { + obj = options.plainObjects ? Object.create(null) : {}; + var cleanRoot = root.charAt(0) === '[' && root.charAt(root.length - 1) === ']' ? root.slice(1, -1) : root; + var index = parseInt(cleanRoot, 10); + if ( + !isNaN(index) + && root !== cleanRoot + && String(index) === cleanRoot + && index >= 0 + && (options.parseArrays && index <= options.arrayLimit) + ) { + obj = []; + obj[index] = leaf; + } else { + obj[cleanRoot] = leaf; + } + } + + leaf = obj; + } + + return leaf; +}; + +var parseKeys = function parseQueryStringKeys(givenKey, val, options) { + if (!givenKey) { + return; + } + + // Transform dot notation to bracket notation + var key = options.allowDots ? givenKey.replace(/\.([^.[]+)/g, '[$1]') : givenKey; + + // The regex chunks + + var brackets = /(\[[^[\]]*])/; + var child = /(\[[^[\]]*])/g; + + // Get the parent + + var segment = brackets.exec(key); + var parent = segment ? key.slice(0, segment.index) : key; + + // Stash the parent if it exists + + var keys = []; + if (parent) { + // If we aren't using plain objects, optionally prefix keys + // that would overwrite object prototype properties + if (!options.plainObjects && has.call(Object.prototype, parent)) { + if (!options.allowPrototypes) { + return; + } + } + + keys.push(parent); + } + + // Loop through children appending to the array until we hit depth + + var i = 0; + while ((segment = child.exec(key)) !== null && i < options.depth) { + i += 1; + if (!options.plainObjects && has.call(Object.prototype, segment[1].slice(1, -1))) { + if (!options.allowPrototypes) { + return; + } + } + keys.push(segment[1]); + } + + // If there's a remainder, just add whatever is left + + if (segment) { + keys.push('[' + key.slice(segment.index) + ']'); + } + + return parseObject(keys, val, options); +}; + +module.exports = function (str, opts) { + var options = opts ? utils.assign({}, opts) : {}; + + if (options.decoder !== null && options.decoder !== undefined && typeof options.decoder !== 'function') { + throw new TypeError('Decoder has to be a function.'); + } + + options.ignoreQueryPrefix = options.ignoreQueryPrefix === true; + options.delimiter = typeof options.delimiter === 'string' || utils.isRegExp(options.delimiter) ? options.delimiter : defaults.delimiter; + options.depth = typeof options.depth === 'number' ? options.depth : defaults.depth; + options.arrayLimit = typeof options.arrayLimit === 'number' ? options.arrayLimit : defaults.arrayLimit; + options.parseArrays = options.parseArrays !== false; + options.decoder = typeof options.decoder === 'function' ? options.decoder : defaults.decoder; + options.allowDots = typeof options.allowDots === 'boolean' ? options.allowDots : defaults.allowDots; + options.plainObjects = typeof options.plainObjects === 'boolean' ? options.plainObjects : defaults.plainObjects; + options.allowPrototypes = typeof options.allowPrototypes === 'boolean' ? options.allowPrototypes : defaults.allowPrototypes; + options.parameterLimit = typeof options.parameterLimit === 'number' ? options.parameterLimit : defaults.parameterLimit; + options.strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; + + if (str === '' || str === null || typeof str === 'undefined') { + return options.plainObjects ? Object.create(null) : {}; + } + + var tempObj = typeof str === 'string' ? parseValues(str, options) : str; + var obj = options.plainObjects ? Object.create(null) : {}; + + // Iterate over the keys and setup the new object + + var keys = Object.keys(tempObj); + for (var i = 0; i < keys.length; ++i) { + var key = keys[i]; + var newObj = parseKeys(key, tempObj[key], options); + obj = utils.merge(obj, newObj, options); + } + + return utils.compact(obj); +}; /***/ }), -/***/ 669: +/***/ 758: /***/ (function(module) { -module.exports = require("util"); +module.exports = {"$id":"timings.json#","$schema":"http://json-schema.org/draft-06/schema#","required":["send","wait","receive"],"properties":{"dns":{"type":"number","min":-1},"connect":{"type":"number","min":-1},"blocked":{"type":"number","min":-1},"send":{"type":"number","min":-1},"wait":{"type":"number","min":-1},"receive":{"type":"number","min":-1},"ssl":{"type":"number","min":-1},"comment":{"type":"string"}}}; /***/ }), -/***/ 674: -/***/ (function(module, exports, __webpack_require__) { +/***/ 761: +/***/ (function(module) { -/* eslint-disable node/no-deprecated-api */ -var buffer = __webpack_require__(293) -var Buffer = buffer.Buffer +module.exports = require("zlib"); -// alternative to using Object.keys for old browsers -function copyProps (src, dst) { - for (var key in src) { - dst[key] = src[key] +/***/ }), + +/***/ 772: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate__limitLength(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; } -} -if (Buffer.from && Buffer.alloc && Buffer.allocUnsafe && Buffer.allocUnsafeSlow) { - module.exports = buffer -} else { - // Copy properties from require('buffer') - copyProps(buffer, exports) - exports.Buffer = SafeBuffer -} - -function SafeBuffer (arg, encodingOrOffset, length) { - return Buffer(arg, encodingOrOffset, length) -} - -SafeBuffer.prototype = Object.create(Buffer.prototype) - -// Copy static methods from Buffer -copyProps(Buffer, SafeBuffer) - -SafeBuffer.from = function (arg, encodingOrOffset, length) { - if (typeof arg === 'number') { - throw new TypeError('Argument must not be a number') + var $op = $keyword == 'maxLength' ? '>' : '<'; + out += 'if ( '; + if ($isData) { + out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; } - return Buffer(arg, encodingOrOffset, length) -} - -SafeBuffer.alloc = function (size, fill, encoding) { - if (typeof size !== 'number') { - throw new TypeError('Argument must be a number') + if (it.opts.unicode === false) { + out += ' ' + ($data) + '.length '; + } else { + out += ' ucs2length(' + ($data) + ') '; } - var buf = Buffer(size) - if (fill !== undefined) { - if (typeof encoding === 'string') { - buf.fill(fill, encoding) + out += ' ' + ($op) + ' ' + ($schemaValue) + ') { '; + var $errorKeyword = $keyword; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || '_limitLength') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT be '; + if ($keyword == 'maxLength') { + out += 'longer'; + } else { + out += 'shorter'; + } + out += ' than '; + if ($isData) { + out += '\' + ' + ($schemaValue) + ' + \''; + } else { + out += '' + ($schema); + } + out += ' characters\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; } else { - buf.fill(fill) + out += ' validate.errors = [' + (__err) + ']; return false; '; } } else { - buf.fill(0) + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } - return buf -} - -SafeBuffer.allocUnsafe = function (size) { - if (typeof size !== 'number') { - throw new TypeError('Argument must be a number') + out += '} '; + if ($breakOnError) { + out += ' else { '; } - return Buffer(size) -} - -SafeBuffer.allocUnsafeSlow = function (size) { - if (typeof size !== 'number') { - throw new TypeError('Argument must be a number') - } - return buffer.SlowBuffer(size) + return out; } /***/ }), -/***/ 675: +/***/ 776: +/***/ (function(module) { + +module.exports = {"$id":"creator.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","version"],"properties":{"name":{"type":"string"},"version":{"type":"string"},"comment":{"type":"string"}}}; + +/***/ }), + +/***/ 779: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +"use strict"; +/*! + * mime-types + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + + + +/** + * Module dependencies. + * @private + */ + +var db = __webpack_require__(972) +var extname = __webpack_require__(622).extname + +/** + * Module variables. + * @private + */ + +var EXTRACT_TYPE_REGEXP = /^\s*([^;\s]*)(?:;|\s|$)/ +var TEXT_TYPE_REGEXP = /^text\//i + +/** + * Module exports. + * @public + */ + +exports.charset = charset +exports.charsets = { lookup: charset } +exports.contentType = contentType +exports.extension = extension +exports.extensions = Object.create(null) +exports.lookup = lookup +exports.types = Object.create(null) + +// Populate the extensions/types maps +populateMaps(exports.extensions, exports.types) + +/** + * Get the default charset for a MIME type. + * + * @param {string} type + * @return {boolean|string} + */ + +function charset (type) { + if (!type || typeof type !== 'string') { + return false + } + + // TODO: use media-typer + var match = EXTRACT_TYPE_REGEXP.exec(type) + var mime = match && db[match[1].toLowerCase()] + + if (mime && mime.charset) { + return mime.charset + } + + // default text/* to utf-8 + if (match && TEXT_TYPE_REGEXP.test(match[1])) { + return 'UTF-8' + } + + return false +} + +/** + * Create a full Content-Type header given a MIME type or extension. + * + * @param {string} str + * @return {boolean|string} + */ + +function contentType (str) { + // TODO: should this even be in this module? + if (!str || typeof str !== 'string') { + return false + } + + var mime = str.indexOf('/') === -1 + ? exports.lookup(str) + : str + + if (!mime) { + return false + } + + // TODO: use content-type or other module + if (mime.indexOf('charset') === -1) { + var charset = exports.charset(mime) + if (charset) mime += '; charset=' + charset.toLowerCase() + } + + return mime +} + +/** + * Get the default extension for a MIME type. + * + * @param {string} type + * @return {boolean|string} + */ + +function extension (type) { + if (!type || typeof type !== 'string') { + return false + } + + // TODO: use media-typer + var match = EXTRACT_TYPE_REGEXP.exec(type) + + // get extensions + var exts = match && exports.extensions[match[1].toLowerCase()] + + if (!exts || !exts.length) { + return false + } + + return exts[0] +} + +/** + * Lookup the MIME type for a file path/extension. + * + * @param {string} path + * @return {boolean|string} + */ + +function lookup (path) { + if (!path || typeof path !== 'string') { + return false + } + + // get the extension ("ext" or ".ext" or full path) + var extension = extname('x.' + path) + .toLowerCase() + .substr(1) + + if (!extension) { + return false + } + + return exports.types[extension] || false +} + +/** + * Populate the extensions and types maps. + * @private + */ + +function populateMaps (extensions, types) { + // source preference (least -> most) + var preference = ['nginx', 'apache', undefined, 'iana'] + + Object.keys(db).forEach(function forEachMimeType (type) { + var mime = db[type] + var exts = mime.extensions + + if (!exts || !exts.length) { + return + } + + // mime -> extensions + extensions[type] = exts + + // extension -> mime + for (var i = 0; i < exts.length; i++) { + var extension = exts[i] + + if (types[extension]) { + var from = preference.indexOf(db[types[extension]].source) + var to = preference.indexOf(mime.source) + + if (types[extension] !== 'application/octet-stream' && + (from > to || (from === to && types[extension].substr(0, 12) === 'application/'))) { + // skip the remapping + continue + } + } + + // set the extension -> mime + types[extension] = type + } + }) +} + + +/***/ }), + +/***/ 789: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +var parser = __webpack_require__(342); +var signer = __webpack_require__(64); +var verify = __webpack_require__(428); +var utils = __webpack_require__(909); + + + +///--- API + +module.exports = { + + parse: parser.parseRequest, + parseRequest: parser.parseRequest, + + sign: signer.signRequest, + signRequest: signer.signRequest, + createSigner: signer.createSigner, + isSigner: signer.isSigner, + + sshKeyToPEM: utils.sshKeyToPEM, + sshKeyFingerprint: utils.fingerprint, + pemToRsaSSHKey: utils.pemToRsaSSHKey, + + verify: verify.verifySignature, + verifySignature: verify.verifySignature, + verifyHMAC: verify.verifyHMAC +}; + + +/***/ }), + +/***/ 792: +/***/ (function(module, __unusedexports, __webpack_require__) { + +module.exports = ForeverAgent +ForeverAgent.SSL = ForeverAgentSSL + +var util = __webpack_require__(669) + , Agent = __webpack_require__(605).Agent + , net = __webpack_require__(631) + , tls = __webpack_require__(16) + , AgentSSL = __webpack_require__(211).Agent + +function getConnectionName(host, port) { + var name = '' + if (typeof host === 'string') { + name = host + ':' + port + } else { + // For node.js v012.0 and iojs-v1.5.1, host is an object. And any existing localAddress is part of the connection name. + name = host.host + ':' + host.port + ':' + (host.localAddress ? (host.localAddress + ':') : ':') + } + return name +} + +function ForeverAgent(options) { + var self = this + self.options = options || {} + self.requests = {} + self.sockets = {} + self.freeSockets = {} + self.maxSockets = self.options.maxSockets || Agent.defaultMaxSockets + self.minSockets = self.options.minSockets || ForeverAgent.defaultMinSockets + self.on('free', function(socket, host, port) { + var name = getConnectionName(host, port) + + if (self.requests[name] && self.requests[name].length) { + self.requests[name].shift().onSocket(socket) + } else if (self.sockets[name].length < self.minSockets) { + if (!self.freeSockets[name]) self.freeSockets[name] = [] + self.freeSockets[name].push(socket) + + // if an error happens while we don't use the socket anyway, meh, throw the socket away + var onIdleError = function() { + socket.destroy() + } + socket._onIdleError = onIdleError + socket.on('error', onIdleError) + } else { + // If there are no pending requests just destroy the + // socket and it will get removed from the pool. This + // gets us out of timeout issues and allows us to + // default to Connection:keep-alive. + socket.destroy() + } + }) + +} +util.inherits(ForeverAgent, Agent) + +ForeverAgent.defaultMinSockets = 5 + + +ForeverAgent.prototype.createConnection = net.createConnection +ForeverAgent.prototype.addRequestNoreuse = Agent.prototype.addRequest +ForeverAgent.prototype.addRequest = function(req, host, port) { + var name = getConnectionName(host, port) + + if (typeof host !== 'string') { + var options = host + port = options.port + host = options.host + } + + if (this.freeSockets[name] && this.freeSockets[name].length > 0 && !req.useChunkedEncodingByDefault) { + var idleSocket = this.freeSockets[name].pop() + idleSocket.removeListener('error', idleSocket._onIdleError) + delete idleSocket._onIdleError + req._reusedSocket = true + req.onSocket(idleSocket) + } else { + this.addRequestNoreuse(req, host, port) + } +} + +ForeverAgent.prototype.removeSocket = function(s, name, host, port) { + if (this.sockets[name]) { + var index = this.sockets[name].indexOf(s) + if (index !== -1) { + this.sockets[name].splice(index, 1) + } + } else if (this.sockets[name] && this.sockets[name].length === 0) { + // don't leak + delete this.sockets[name] + delete this.requests[name] + } + + if (this.freeSockets[name]) { + var index = this.freeSockets[name].indexOf(s) + if (index !== -1) { + this.freeSockets[name].splice(index, 1) + if (this.freeSockets[name].length === 0) { + delete this.freeSockets[name] + } + } + } + + if (this.requests[name] && this.requests[name].length) { + // If we have pending requests and a socket gets closed a new one + // needs to be created to take over in the pool for the one that closed. + this.createSocket(name, host, port).emit('free') + } +} + +function ForeverAgentSSL (options) { + ForeverAgent.call(this, options) +} +util.inherits(ForeverAgentSSL, ForeverAgent) + +ForeverAgentSSL.prototype.createConnection = createConnectionSSL +ForeverAgentSSL.prototype.addRequestNoreuse = AgentSSL.prototype.addRequest + +function createConnectionSSL (port, host, options) { + if (typeof port === 'object') { + options = port; + } else if (typeof host === 'object') { + options = host; + } else if (typeof options === 'object') { + options = options; + } else { + options = {}; + } + + if (typeof port === 'number') { + options.port = port; + } + + if (typeof host === 'string') { + options.host = host; + } + + return tls.connect(options); +} + + +/***/ }), + +/***/ 805: +/***/ (function(module, __unusedexports, __webpack_require__) { + +"use strict"; + + +var resolve = __webpack_require__(867) + , util = __webpack_require__(855) + , errorClasses = __webpack_require__(844) + , stableStringify = __webpack_require__(741); + +var validateGenerator = __webpack_require__(967); + +/** + * Functions below are used inside compiled validations function + */ + +var ucs2length = util.ucs2length; +var equal = __webpack_require__(832); + +// this error is thrown by async schemas to return validation errors via exception +var ValidationError = errorClasses.Validation; + +module.exports = compile; + + +/** + * Compiles schema to validation function + * @this Ajv + * @param {Object} schema schema object + * @param {Object} root object with information about the root schema for this schema + * @param {Object} localRefs the hash of local references inside the schema (created by resolve.id), used for inline resolution + * @param {String} baseId base ID for IDs in the schema + * @return {Function} validation function + */ +function compile(schema, root, localRefs, baseId) { + /* jshint validthis: true, evil: true */ + /* eslint no-shadow: 0 */ + var self = this + , opts = this._opts + , refVal = [ undefined ] + , refs = {} + , patterns = [] + , patternsHash = {} + , defaults = [] + , defaultsHash = {} + , customRules = []; + + root = root || { schema: schema, refVal: refVal, refs: refs }; + + var c = checkCompiling.call(this, schema, root, baseId); + var compilation = this._compilations[c.index]; + if (c.compiling) return (compilation.callValidate = callValidate); + + var formats = this._formats; + var RULES = this.RULES; + + try { + var v = localCompile(schema, root, localRefs, baseId); + compilation.validate = v; + var cv = compilation.callValidate; + if (cv) { + cv.schema = v.schema; + cv.errors = null; + cv.refs = v.refs; + cv.refVal = v.refVal; + cv.root = v.root; + cv.$async = v.$async; + if (opts.sourceCode) cv.source = v.source; + } + return v; + } finally { + endCompiling.call(this, schema, root, baseId); + } + + /* @this {*} - custom context, see passContext option */ + function callValidate() { + /* jshint validthis: true */ + var validate = compilation.validate; + var result = validate.apply(this, arguments); + callValidate.errors = validate.errors; + return result; + } + + function localCompile(_schema, _root, localRefs, baseId) { + var isRoot = !_root || (_root && _root.schema == _schema); + if (_root.schema != root.schema) + return compile.call(self, _schema, _root, localRefs, baseId); + + var $async = _schema.$async === true; + + var sourceCode = validateGenerator({ + isTop: true, + schema: _schema, + isRoot: isRoot, + baseId: baseId, + root: _root, + schemaPath: '', + errSchemaPath: '#', + errorPath: '""', + MissingRefError: errorClasses.MissingRef, + RULES: RULES, + validate: validateGenerator, + util: util, + resolve: resolve, + resolveRef: resolveRef, + usePattern: usePattern, + useDefault: useDefault, + useCustomRule: useCustomRule, + opts: opts, + formats: formats, + logger: self.logger, + self: self + }); + + sourceCode = vars(refVal, refValCode) + vars(patterns, patternCode) + + vars(defaults, defaultCode) + vars(customRules, customRuleCode) + + sourceCode; + + if (opts.processCode) sourceCode = opts.processCode(sourceCode); + // console.log('\n\n\n *** \n', JSON.stringify(sourceCode)); + var validate; + try { + var makeValidate = new Function( + 'self', + 'RULES', + 'formats', + 'root', + 'refVal', + 'defaults', + 'customRules', + 'equal', + 'ucs2length', + 'ValidationError', + sourceCode + ); + + validate = makeValidate( + self, + RULES, + formats, + root, + refVal, + defaults, + customRules, + equal, + ucs2length, + ValidationError + ); + + refVal[0] = validate; + } catch(e) { + self.logger.error('Error compiling schema, function code:', sourceCode); + throw e; + } + + validate.schema = _schema; + validate.errors = null; + validate.refs = refs; + validate.refVal = refVal; + validate.root = isRoot ? validate : _root; + if ($async) validate.$async = true; + if (opts.sourceCode === true) { + validate.source = { + code: sourceCode, + patterns: patterns, + defaults: defaults + }; + } + + return validate; + } + + function resolveRef(baseId, ref, isRoot) { + ref = resolve.url(baseId, ref); + var refIndex = refs[ref]; + var _refVal, refCode; + if (refIndex !== undefined) { + _refVal = refVal[refIndex]; + refCode = 'refVal[' + refIndex + ']'; + return resolvedRef(_refVal, refCode); + } + if (!isRoot && root.refs) { + var rootRefId = root.refs[ref]; + if (rootRefId !== undefined) { + _refVal = root.refVal[rootRefId]; + refCode = addLocalRef(ref, _refVal); + return resolvedRef(_refVal, refCode); + } + } + + refCode = addLocalRef(ref); + var v = resolve.call(self, localCompile, root, ref); + if (v === undefined) { + var localSchema = localRefs && localRefs[ref]; + if (localSchema) { + v = resolve.inlineRef(localSchema, opts.inlineRefs) + ? localSchema + : compile.call(self, localSchema, root, localRefs, baseId); + } + } + + if (v === undefined) { + removeLocalRef(ref); + } else { + replaceLocalRef(ref, v); + return resolvedRef(v, refCode); + } + } + + function addLocalRef(ref, v) { + var refId = refVal.length; + refVal[refId] = v; + refs[ref] = refId; + return 'refVal' + refId; + } + + function removeLocalRef(ref) { + delete refs[ref]; + } + + function replaceLocalRef(ref, v) { + var refId = refs[ref]; + refVal[refId] = v; + } + + function resolvedRef(refVal, code) { + return typeof refVal == 'object' || typeof refVal == 'boolean' + ? { code: code, schema: refVal, inline: true } + : { code: code, $async: refVal && !!refVal.$async }; + } + + function usePattern(regexStr) { + var index = patternsHash[regexStr]; + if (index === undefined) { + index = patternsHash[regexStr] = patterns.length; + patterns[index] = regexStr; + } + return 'pattern' + index; + } + + function useDefault(value) { + switch (typeof value) { + case 'boolean': + case 'number': + return '' + value; + case 'string': + return util.toQuotedString(value); + case 'object': + if (value === null) return 'null'; + var valueStr = stableStringify(value); + var index = defaultsHash[valueStr]; + if (index === undefined) { + index = defaultsHash[valueStr] = defaults.length; + defaults[index] = value; + } + return 'default' + index; + } + } + + function useCustomRule(rule, schema, parentSchema, it) { + if (self._opts.validateSchema !== false) { + var deps = rule.definition.dependencies; + if (deps && !deps.every(function(keyword) { + return Object.prototype.hasOwnProperty.call(parentSchema, keyword); + })) + throw new Error('parent schema must have all required keywords: ' + deps.join(',')); + + var validateSchema = rule.definition.validateSchema; + if (validateSchema) { + var valid = validateSchema(schema); + if (!valid) { + var message = 'keyword schema is invalid: ' + self.errorsText(validateSchema.errors); + if (self._opts.validateSchema == 'log') self.logger.error(message); + else throw new Error(message); + } + } + } + + var compile = rule.definition.compile + , inline = rule.definition.inline + , macro = rule.definition.macro; + + var validate; + if (compile) { + validate = compile.call(self, schema, parentSchema, it); + } else if (macro) { + validate = macro.call(self, schema, parentSchema, it); + if (opts.validateSchema !== false) self.validateSchema(validate, true); + } else if (inline) { + validate = inline.call(self, it, rule.keyword, schema, parentSchema); + } else { + validate = rule.definition.validate; + if (!validate) return; + } + + if (validate === undefined) + throw new Error('custom keyword "' + rule.keyword + '"failed to compile'); + + var index = customRules.length; + customRules[index] = validate; + + return { + code: 'customRule' + index, + validate: validate + }; + } +} + + +/** + * Checks if the schema is currently compiled + * @this Ajv + * @param {Object} schema schema to compile + * @param {Object} root root object + * @param {String} baseId base schema ID + * @return {Object} object with properties "index" (compilation index) and "compiling" (boolean) + */ +function checkCompiling(schema, root, baseId) { + /* jshint validthis: true */ + var index = compIndex.call(this, schema, root, baseId); + if (index >= 0) return { index: index, compiling: true }; + index = this._compilations.length; + this._compilations[index] = { + schema: schema, + root: root, + baseId: baseId + }; + return { index: index, compiling: false }; +} + + +/** + * Removes the schema from the currently compiled list + * @this Ajv + * @param {Object} schema schema to compile + * @param {Object} root root object + * @param {String} baseId base schema ID + */ +function endCompiling(schema, root, baseId) { + /* jshint validthis: true */ + var i = compIndex.call(this, schema, root, baseId); + if (i >= 0) this._compilations.splice(i, 1); +} + + +/** + * Index of schema compilation in the currently compiled list + * @this Ajv + * @param {Object} schema schema to compile + * @param {Object} root root object + * @param {String} baseId base schema ID + * @return {Integer} compilation index + */ +function compIndex(schema, root, baseId) { + /* jshint validthis: true */ + for (var i=0; i 1024) + hashAlgo = 'sha256'; + if (this.type === 'ed25519') + hashAlgo = 'sha512'; + if (this.type === 'ecdsa') { + if (this.size <= 256) + hashAlgo = 'sha256'; + else if (this.size <= 384) + hashAlgo = 'sha384'; + else + hashAlgo = 'sha512'; + } + return (hashAlgo); +}; + +Key.prototype.createVerify = function (hashAlgo) { + if (hashAlgo === undefined) + hashAlgo = this.defaultHashAlgorithm(); + assert.string(hashAlgo, 'hash algorithm'); + + /* ED25519 is not supported by OpenSSL, use a javascript impl. */ + if (this.type === 'ed25519' && edCompat !== undefined) + return (new edCompat.Verifier(this, hashAlgo)); + if (this.type === 'curve25519') + throw (new Error('Curve25519 keys are not suitable for ' + + 'signing or verification')); + + var v, nm, err; + try { + nm = hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); + } catch (e) { + err = e; + } + if (v === undefined || (err instanceof Error && + err.message.match(/Unknown message digest/))) { + nm = 'RSA-'; + nm += hashAlgo.toUpperCase(); + v = crypto.createVerify(nm); + } + assert.ok(v, 'failed to create verifier'); + var oldVerify = v.verify.bind(v); + var key = this.toBuffer('pkcs8'); + var curve = this.curve; + var self = this; + v.verify = function (signature, fmt) { + if (Signature.isSignature(signature, [2, 0])) { + if (signature.type !== self.type) + return (false); + if (signature.hashAlgorithm && + signature.hashAlgorithm !== hashAlgo) + return (false); + if (signature.curve && self.type === 'ecdsa' && + signature.curve !== curve) + return (false); + return (oldVerify(key, signature.toBuffer('asn1'))); + + } else if (typeof (signature) === 'string' || + Buffer.isBuffer(signature)) { + return (oldVerify(key, signature, fmt)); + + /* + * Avoid doing this on valid arguments, walking the prototype + * chain can be quite slow. + */ + } else if (Signature.isSignature(signature, [1, 0])) { + throw (new Error('signature was created by too old ' + + 'a version of sshpk and cannot be verified')); + + } else { + throw (new TypeError('signature must be a string, ' + + 'Buffer, or Signature object')); + } + }; + return (v); +}; + +Key.prototype.createDiffieHellman = function () { + if (this.type === 'rsa') + throw (new Error('RSA keys do not support Diffie-Hellman')); + + return (new DiffieHellman(this)); +}; +Key.prototype.createDH = Key.prototype.createDiffieHellman; + +Key.parse = function (data, format, options) { + if (typeof (data) !== 'string') + assert.buffer(data, 'data'); + if (format === undefined) + format = 'auto'; + assert.string(format, 'format'); + if (typeof (options) === 'string') + options = { filename: options }; + assert.optionalObject(options, 'options'); + if (options === undefined) + options = {}; + assert.optionalString(options.filename, 'options.filename'); + if (options.filename === undefined) + options.filename = '(unnamed)'; + + assert.object(formats[format], 'formats[format]'); + + try { + var k = formats[format].read(data, options); + if (k instanceof PrivateKey) + k = k.toPublic(); + if (!k.comment) + k.comment = options.filename; + return (k); + } catch (e) { + if (e.name === 'KeyEncryptedError') + throw (e); + throw (new KeyParseError(options.filename, format, e)); + } +}; + +Key.isKey = function (obj, ver) { + return (utils.isCompatible(obj, Key, ver)); +}; + +/* + * API versions for Key: + * [1,0] -- initial ver, may take Signature for createVerify or may not + * [1,1] -- added pkcs1, pkcs8 formats + * [1,2] -- added auto, ssh-private, openssh formats + * [1,3] -- added defaultHashAlgorithm + * [1,4] -- added ed support, createDH + * [1,5] -- first explicitly tagged version + * [1,6] -- changed ed25519 part names + * [1,7] -- spki hash types + */ +Key.prototype._sshpkApiVersion = [1, 7]; + +Key._oldVersionDetect = function (obj) { + assert.func(obj.toBuffer); + assert.func(obj.fingerprint); + if (obj.createDH) + return ([1, 4]); + if (obj.defaultHashAlgorithm) + return ([1, 3]); + if (obj.formats['auto']) + return ([1, 2]); + if (obj.formats['pkcs1']) + return ([1, 1]); + return ([1, 0]); +}; + + +/***/ }), + +/***/ 853: /***/ (function(__unusedmodule, exports) { /** @license URI.js v4.2.1 (c) 2011 Gary Court. License: http://github.com/garycourt/uri-js */ @@ -23514,354 +28350,294 @@ Object.defineProperty(exports, '__esModule', { value: true }); /***/ }), -/***/ 681: +/***/ 855: /***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; -var stringify = __webpack_require__(619); -var parse = __webpack_require__(583); -var formats = __webpack_require__(167); module.exports = { - formats: formats, - parse: parse, - stringify: stringify + copy: copy, + checkDataType: checkDataType, + checkDataTypes: checkDataTypes, + coerceToTypes: coerceToTypes, + toHash: toHash, + getProperty: getProperty, + escapeQuotes: escapeQuotes, + equal: __webpack_require__(832), + ucs2length: __webpack_require__(691), + varOccurences: varOccurences, + varReplace: varReplace, + cleanUpCode: cleanUpCode, + finalCleanUpCode: finalCleanUpCode, + schemaHasRules: schemaHasRules, + schemaHasRulesExcept: schemaHasRulesExcept, + schemaUnknownRules: schemaUnknownRules, + toQuotedString: toQuotedString, + getPathExpr: getPathExpr, + getPath: getPath, + getData: getData, + unescapeFragment: unescapeFragment, + unescapeJsonPointer: unescapeJsonPointer, + escapeFragment: escapeFragment, + escapeJsonPointer: escapeJsonPointer }; -/***/ }), - -/***/ 683: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Unique ID creation requires a high quality random # generator. In node.js -// this is pretty straight-forward - we use the crypto API. - -var crypto = __webpack_require__(417); - -module.exports = function nodeRNG() { - return crypto.randomBytes(16); -}; +function copy(o, to) { + to = to || {}; + for (var key in o) to[key] = o[key]; + return to; +} -/***/ }), - -/***/ 690: -/***/ (function(module) { - -// Copyright 2011 Mark Cavage All rights reserved. - - -module.exports = { - - newInvalidAsn1Error: function (msg) { - var e = new Error(); - e.name = 'InvalidAsn1Error'; - e.message = msg || ''; - return e; +function checkDataType(dataType, data, negate) { + var EQUAL = negate ? ' !== ' : ' === ' + , AND = negate ? ' || ' : ' && ' + , OK = negate ? '!' : '' + , NOT = negate ? '' : '!'; + switch (dataType) { + case 'null': return data + EQUAL + 'null'; + case 'array': return OK + 'Array.isArray(' + data + ')'; + case 'object': return '(' + OK + data + AND + + 'typeof ' + data + EQUAL + '"object"' + AND + + NOT + 'Array.isArray(' + data + '))'; + case 'integer': return '(typeof ' + data + EQUAL + '"number"' + AND + + NOT + '(' + data + ' % 1)' + + AND + data + EQUAL + data + ')'; + default: return 'typeof ' + data + EQUAL + '"' + dataType + '"'; } - -}; - - -/***/ }), - -/***/ 692: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -var net = __webpack_require__(631) - , tls = __webpack_require__(16) - , http = __webpack_require__(605) - , https = __webpack_require__(211) - , events = __webpack_require__(614) - , assert = __webpack_require__(357) - , util = __webpack_require__(669) - , Buffer = __webpack_require__(674).Buffer - ; - -exports.httpOverHttp = httpOverHttp -exports.httpsOverHttp = httpsOverHttp -exports.httpOverHttps = httpOverHttps -exports.httpsOverHttps = httpsOverHttps - - -function httpOverHttp(options) { - var agent = new TunnelingAgent(options) - agent.request = http.request - return agent -} - -function httpsOverHttp(options) { - var agent = new TunnelingAgent(options) - agent.request = http.request - agent.createSocket = createSecureSocket - agent.defaultPort = 443 - return agent -} - -function httpOverHttps(options) { - var agent = new TunnelingAgent(options) - agent.request = https.request - return agent -} - -function httpsOverHttps(options) { - var agent = new TunnelingAgent(options) - agent.request = https.request - agent.createSocket = createSecureSocket - agent.defaultPort = 443 - return agent } -function TunnelingAgent(options) { - var self = this - self.options = options || {} - self.proxyOptions = self.options.proxy || {} - self.maxSockets = self.options.maxSockets || http.Agent.defaultMaxSockets - self.requests = [] - self.sockets = [] - - self.on('free', function onFree(socket, host, port) { - for (var i = 0, len = self.requests.length; i < len; ++i) { - var pending = self.requests[i] - if (pending.host === host && pending.port === port) { - // Detect the request to connect same origin server, - // reuse the connection. - self.requests.splice(i, 1) - pending.request.onSocket(socket) - return +function checkDataTypes(dataTypes, data) { + switch (dataTypes.length) { + case 1: return checkDataType(dataTypes[0], data, true); + default: + var code = ''; + var types = toHash(dataTypes); + if (types.array && types.object) { + code = types.null ? '(': '(!' + data + ' || '; + code += 'typeof ' + data + ' !== "object")'; + delete types.null; + delete types.array; + delete types.object; } + if (types.number) delete types.integer; + for (var t in types) + code += (code ? ' && ' : '' ) + checkDataType(t, data, true); + + return code; + } +} + + +var COERCE_TO_TYPES = toHash([ 'string', 'number', 'integer', 'boolean', 'null' ]); +function coerceToTypes(optionCoerceTypes, dataTypes) { + if (Array.isArray(dataTypes)) { + var types = []; + for (var i=0; i= this.maxSockets) { - // We are over limit so we'll add it to the queue. - self.requests.push({host: options.host, port: options.port, request: req}) - return - } - - // If we are under maxSockets create a new one. - self.createConnection({host: options.host, port: options.port, request: req}) } -TunnelingAgent.prototype.createConnection = function createConnection(pending) { - var self = this - self.createSocket(pending, function(socket) { - socket.on('free', onFree) - socket.on('close', onCloseOrRemove) - socket.on('agentRemove', onCloseOrRemove) - pending.request.onSocket(socket) +function toHash(arr) { + var hash = {}; + for (var i=0; i= lvl) throw new Error('Cannot access property/index ' + up + ' levels up, current level is ' + lvl); + return paths[lvl - up]; } - function onCloseOrRemove(err) { - self.removeSocket(socket) - socket.removeListener('free', onFree) - socket.removeListener('close', onCloseOrRemove) - socket.removeListener('agentRemove', onCloseOrRemove) - } - }) -} - -TunnelingAgent.prototype.createSocket = function createSocket(options, cb) { - var self = this - var placeholder = {} - self.sockets.push(placeholder) - - var connectOptions = mergeOptions({}, self.proxyOptions, - { method: 'CONNECT' - , path: options.host + ':' + options.port - , agent: false - } - ) - if (connectOptions.proxyAuth) { - connectOptions.headers = connectOptions.headers || {} - connectOptions.headers['Proxy-Authorization'] = 'Basic ' + - Buffer.from(connectOptions.proxyAuth).toString('base64') + if (up > lvl) throw new Error('Cannot access data ' + up + ' levels up, current level is ' + lvl); + data = 'data' + ((lvl - up) || ''); + if (!jsonPointer) return data; } - debug('making CONNECT request') - var connectReq = self.request(connectOptions) - connectReq.useChunkedEncodingByDefault = false // for v0.6 - connectReq.once('response', onResponse) // for v0.6 - connectReq.once('upgrade', onUpgrade) // for v0.6 - connectReq.once('connect', onConnect) // for v0.7 or later - connectReq.once('error', onError) - connectReq.end() - - function onResponse(res) { - // Very hacky. This is necessary to avoid http-parser leaks. - res.upgrade = true - } - - function onUpgrade(res, socket, head) { - // Hacky. - process.nextTick(function() { - onConnect(res, socket, head) - }) - } - - function onConnect(res, socket, head) { - connectReq.removeAllListeners() - socket.removeAllListeners() - - if (res.statusCode === 200) { - assert.equal(head.length, 0) - debug('tunneling connection has established') - self.sockets[self.sockets.indexOf(placeholder)] = socket - cb(socket) - } else { - debug('tunneling socket could not be established, statusCode=%d', res.statusCode) - var error = new Error('tunneling socket could not be established, ' + 'statusCode=' + res.statusCode) - error.code = 'ECONNRESET' - options.request.emit('error', error) - self.removeSocket(placeholder) + var expr = data; + var segments = jsonPointer.split('/'); + for (var i=0; i 0 : it.util.schemaHasRules($propertySch, it.RULES.all)))) { + $required[$required.length] = $property; + } + } + } } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; + var $required = $schema; } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } - out += ' }'; - if ($breakOnError) { - out += ' else { '; + if ($isData || $required.length) { + var $currentErrorPath = it.errorPath, + $loopRequired = $isData || $required.length >= it.opts.loopRequired, + $ownProperties = it.opts.ownProperties; + if ($breakOnError) { + out += ' var missing' + ($lvl) + '; '; + if ($loopRequired) { + if (!$isData) { + out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; '; + } + var $i = 'i' + $lvl, + $propertyPath = 'schema' + $lvl + '[' + $i + ']', + $missingProperty = '\' + ' + $propertyPath + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers); + } + out += ' var ' + ($valid) + ' = true; '; + if ($isData) { + out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {'; + } + out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { ' + ($valid) + ' = ' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] !== undefined '; + if ($ownProperties) { + out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) '; + } + out += '; if (!' + ($valid) + ') break; } '; + if ($isData) { + out += ' } '; + } + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { '; + } else { + out += ' if ( '; + var arr2 = $required; + if (arr2) { + var $propertyKey, $i = -1, + l2 = arr2.length - 1; + while ($i < l2) { + $propertyKey = arr2[$i += 1]; + if ($i) { + out += ' || '; + } + var $prop = it.util.getProperty($propertyKey), + $useData = $data + $prop; + out += ' ( ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') && (missing' + ($lvl) + ' = ' + (it.util.toQuotedString(it.opts.jsonPointers ? $propertyKey : $prop)) + ') ) '; + } + } + out += ') { '; + var $propertyPath = 'missing' + $lvl, + $missingProperty = '\' + ' + $propertyPath + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.opts.jsonPointers ? it.util.getPathExpr($currentErrorPath, $propertyPath, true) : $currentErrorPath + ' + ' + $propertyPath; + } + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { '; + } + } else { + if ($loopRequired) { + if (!$isData) { + out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; '; + } + var $i = 'i' + $lvl, + $propertyPath = 'schema' + $lvl + '[' + $i + ']', + $missingProperty = '\' + ' + $propertyPath + ' + \''; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers); + } + if ($isData) { + out += ' if (' + ($vSchema) + ' && !Array.isArray(' + ($vSchema) + ')) { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } else if (' + ($vSchema) + ' !== undefined) { '; + } + out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { if (' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) '; + } + out += ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } } '; + if ($isData) { + out += ' } '; + } + } else { + var arr3 = $required; + if (arr3) { + var $propertyKey, i3 = -1, + l3 = arr3.length - 1; + while (i3 < l3) { + $propertyKey = arr3[i3 += 1]; + var $prop = it.util.getProperty($propertyKey), + $missingProperty = it.util.escapeQuotes($propertyKey), + $useData = $data + $prop; + if (it.opts._errorDataPathProperty) { + it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); + } + out += ' if ( ' + ($useData) + ' === undefined '; + if ($ownProperties) { + out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + } + out += ') { var err = '; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \''; + if (it.opts._errorDataPathProperty) { + out += 'is a required property'; + } else { + out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } '; + } + } + } + } + it.errorPath = $currentErrorPath; + } else if ($breakOnError) { + out += ' if (true) {'; } return out; } @@ -23920,3672 +28910,1266 @@ module.exports = function generate_const(it, $keyword, $ruleType) { /***/ }), -/***/ 702: +/***/ 866: /***/ (function(module, __unusedexports, __webpack_require__) { -"use strict"; - - -var resolve = __webpack_require__(386); - -module.exports = { - Validation: errorSubclass(ValidationError), - MissingRef: errorSubclass(MissingRefError) -}; - - -function ValidationError(errors) { - this.message = 'validation failed'; - this.errors = errors; - this.ajv = this.validation = true; -} - - -MissingRefError.message = function (baseId, ref) { - return 'can\'t resolve reference ' + ref + ' from id ' + baseId; -}; - - -function MissingRefError(baseId, ref, message) { - this.message = message || MissingRefError.message(baseId, ref); - this.missingRef = resolve.url(baseId, ref); - this.missingSchema = resolve.normalizeId(resolve.fullPath(this.missingRef)); -} - - -function errorSubclass(Subclass) { - Subclass.prototype = Object.create(Error.prototype); - Subclass.prototype.constructor = Subclass; - return Subclass; -} - - -/***/ }), - -/***/ 706: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -var parser = __webpack_require__(738); -var signer = __webpack_require__(6); -var verify = __webpack_require__(95); -var utils = __webpack_require__(517); - - - -///--- API - -module.exports = { - - parse: parser.parseRequest, - parseRequest: parser.parseRequest, - - sign: signer.signRequest, - signRequest: signer.signRequest, - createSigner: signer.createSigner, - isSigner: signer.isSigner, - - sshKeyToPEM: utils.sshKeyToPEM, - sshKeyFingerprint: utils.fingerprint, - pemToRsaSSHKey: utils.pemToRsaSSHKey, - - verify: verify.verifySignature, - verifySignature: verify.verifySignature, - verifyHMAC: verify.verifyHMAC -}; - - -/***/ }), - -/***/ 711: -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -module.exports = { - afterRequest: __webpack_require__(843), - beforeRequest: __webpack_require__(643), - browser: __webpack_require__(588), - cache: __webpack_require__(794), - content: __webpack_require__(754), - cookie: __webpack_require__(630), - creator: __webpack_require__(388), - entry: __webpack_require__(625), - har: __webpack_require__(948), - header: __webpack_require__(746), - log: __webpack_require__(93), - page: __webpack_require__(877), - pageTimings: __webpack_require__(252), - postData: __webpack_require__(408), - query: __webpack_require__(536), - request: __webpack_require__(32), - response: __webpack_require__(612), - timings: __webpack_require__(116) -} - - -/***/ }), - -/***/ 719: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = Signature; - -var assert = __webpack_require__(283); -var Buffer = __webpack_require__(375).Buffer; -var algs = __webpack_require__(936); -var crypto = __webpack_require__(417); -var errs = __webpack_require__(266); -var utils = __webpack_require__(757); -var asn1 = __webpack_require__(214); -var SSHBuffer = __webpack_require__(907); - -var InvalidAlgorithmError = errs.InvalidAlgorithmError; -var SignatureParseError = errs.SignatureParseError; - -function Signature(opts) { - assert.object(opts, 'options'); - assert.arrayOfObject(opts.parts, 'options.parts'); - assert.string(opts.type, 'options.type'); - - var partLookup = {}; - for (var i = 0; i < opts.parts.length; ++i) { - var part = opts.parts[i]; - partLookup[part.name] = part; - } - - this.type = opts.type; - this.hashAlgorithm = opts.hashAlgo; - this.curve = opts.curve; - this.parts = opts.parts; - this.part = partLookup; -} - -Signature.prototype.toBuffer = function (format) { - if (format === undefined) - format = 'asn1'; - assert.string(format, 'format'); - - var buf; - var stype = 'ssh-' + this.type; - - switch (this.type) { - case 'rsa': - switch (this.hashAlgorithm) { - case 'sha256': - stype = 'rsa-sha2-256'; - break; - case 'sha512': - stype = 'rsa-sha2-512'; - break; - case 'sha1': - case undefined: - break; - default: - throw (new Error('SSH signature ' + - 'format does not support hash ' + - 'algorithm ' + this.hashAlgorithm)); - } - if (format === 'ssh') { - buf = new SSHBuffer({}); - buf.writeString(stype); - buf.writePart(this.part.sig); - return (buf.toBuffer()); - } else { - return (this.part.sig.data); - } - break; - - case 'ed25519': - if (format === 'ssh') { - buf = new SSHBuffer({}); - buf.writeString(stype); - buf.writePart(this.part.sig); - return (buf.toBuffer()); - } else { - return (this.part.sig.data); - } - break; - - case 'dsa': - case 'ecdsa': - var r, s; - if (format === 'asn1') { - var der = new asn1.BerWriter(); - der.startSequence(); - r = utils.mpNormalize(this.part.r.data); - s = utils.mpNormalize(this.part.s.data); - der.writeBuffer(r, asn1.Ber.Integer); - der.writeBuffer(s, asn1.Ber.Integer); - der.endSequence(); - return (der.buffer); - } else if (format === 'ssh' && this.type === 'dsa') { - buf = new SSHBuffer({}); - buf.writeString('ssh-dss'); - r = this.part.r.data; - if (r.length > 20 && r[0] === 0x00) - r = r.slice(1); - s = this.part.s.data; - if (s.length > 20 && s[0] === 0x00) - s = s.slice(1); - if ((this.hashAlgorithm && - this.hashAlgorithm !== 'sha1') || - r.length + s.length !== 40) { - throw (new Error('OpenSSH only supports ' + - 'DSA signatures with SHA1 hash')); - } - buf.writeBuffer(Buffer.concat([r, s])); - return (buf.toBuffer()); - } else if (format === 'ssh' && this.type === 'ecdsa') { - var inner = new SSHBuffer({}); - r = this.part.r.data; - inner.writeBuffer(r); - inner.writePart(this.part.s); - - buf = new SSHBuffer({}); - /* XXX: find a more proper way to do this? */ - var curve; - if (r[0] === 0x00) - r = r.slice(1); - var sz = r.length * 8; - if (sz === 256) - curve = 'nistp256'; - else if (sz === 384) - curve = 'nistp384'; - else if (sz === 528) - curve = 'nistp521'; - buf.writeString('ecdsa-sha2-' + curve); - buf.writeBuffer(inner.toBuffer()); - return (buf.toBuffer()); - } - throw (new Error('Invalid signature format')); - default: - throw (new Error('Invalid signature data')); - } -}; - -Signature.prototype.toString = function (format) { - assert.optionalString(format, 'format'); - return (this.toBuffer(format).toString('base64')); -}; - -Signature.parse = function (data, type, format) { - if (typeof (data) === 'string') - data = Buffer.from(data, 'base64'); - assert.buffer(data, 'data'); - assert.string(format, 'format'); - assert.string(type, 'type'); - - var opts = {}; - opts.type = type.toLowerCase(); - opts.parts = []; - - try { - assert.ok(data.length > 0, 'signature must not be empty'); - switch (opts.type) { - case 'rsa': - return (parseOneNum(data, type, format, opts)); - case 'ed25519': - return (parseOneNum(data, type, format, opts)); - - case 'dsa': - case 'ecdsa': - if (format === 'asn1') - return (parseDSAasn1(data, type, format, opts)); - else if (opts.type === 'dsa') - return (parseDSA(data, type, format, opts)); - else - return (parseECDSA(data, type, format, opts)); - - default: - throw (new InvalidAlgorithmError(type)); - } - - } catch (e) { - if (e instanceof InvalidAlgorithmError) - throw (e); - throw (new SignatureParseError(type, format, e)); - } -}; - -function parseOneNum(data, type, format, opts) { - if (format === 'ssh') { - try { - var buf = new SSHBuffer({buffer: data}); - var head = buf.readString(); - } catch (e) { - /* fall through */ - } - if (buf !== undefined) { - var msg = 'SSH signature does not match expected ' + - 'type (expected ' + type + ', got ' + head + ')'; - switch (head) { - case 'ssh-rsa': - assert.strictEqual(type, 'rsa', msg); - opts.hashAlgo = 'sha1'; - break; - case 'rsa-sha2-256': - assert.strictEqual(type, 'rsa', msg); - opts.hashAlgo = 'sha256'; - break; - case 'rsa-sha2-512': - assert.strictEqual(type, 'rsa', msg); - opts.hashAlgo = 'sha512'; - break; - case 'ssh-ed25519': - assert.strictEqual(type, 'ed25519', msg); - opts.hashAlgo = 'sha512'; - break; - default: - throw (new Error('Unknown SSH signature ' + - 'type: ' + head)); - } - var sig = buf.readPart(); - assert.ok(buf.atEnd(), 'extra trailing bytes'); - sig.name = 'sig'; - opts.parts.push(sig); - return (new Signature(opts)); - } - } - opts.parts.push({name: 'sig', data: data}); - return (new Signature(opts)); -} - -function parseDSAasn1(data, type, format, opts) { - var der = new asn1.BerReader(data); - der.readSequence(); - var r = der.readString(asn1.Ber.Integer, true); - var s = der.readString(asn1.Ber.Integer, true); - - opts.parts.push({name: 'r', data: utils.mpNormalize(r)}); - opts.parts.push({name: 's', data: utils.mpNormalize(s)}); - - return (new Signature(opts)); -} - -function parseDSA(data, type, format, opts) { - if (data.length != 40) { - var buf = new SSHBuffer({buffer: data}); - var d = buf.readBuffer(); - if (d.toString('ascii') === 'ssh-dss') - d = buf.readBuffer(); - assert.ok(buf.atEnd(), 'extra trailing bytes'); - assert.strictEqual(d.length, 40, 'invalid inner length'); - data = d; - } - opts.parts.push({name: 'r', data: data.slice(0, 20)}); - opts.parts.push({name: 's', data: data.slice(20, 40)}); - return (new Signature(opts)); -} - -function parseECDSA(data, type, format, opts) { - var buf = new SSHBuffer({buffer: data}); - - var r, s; - var inner = buf.readBuffer(); - var stype = inner.toString('ascii'); - if (stype.slice(0, 6) === 'ecdsa-') { - var parts = stype.split('-'); - assert.strictEqual(parts[0], 'ecdsa'); - assert.strictEqual(parts[1], 'sha2'); - opts.curve = parts[2]; - switch (opts.curve) { - case 'nistp256': - opts.hashAlgo = 'sha256'; - break; - case 'nistp384': - opts.hashAlgo = 'sha384'; - break; - case 'nistp521': - opts.hashAlgo = 'sha512'; - break; - default: - throw (new Error('Unsupported ECDSA curve: ' + - opts.curve)); - } - inner = buf.readBuffer(); - assert.ok(buf.atEnd(), 'extra trailing bytes on outer'); - buf = new SSHBuffer({buffer: inner}); - r = buf.readPart(); - } else { - r = {data: inner}; - } - - s = buf.readPart(); - assert.ok(buf.atEnd(), 'extra trailing bytes'); - - r.name = 'r'; - s.name = 's'; - - opts.parts.push(r); - opts.parts.push(s); - return (new Signature(opts)); -} - -Signature.isSignature = function (obj, ver) { - return (utils.isCompatible(obj, Signature, ver)); -}; - -/* - * API versions for Signature: - * [1,0] -- initial ver - * [2,0] -- support for rsa in full ssh format, compat with sshpk-agent - * hashAlgorithm property - * [2,1] -- first tagged version - */ -Signature.prototype._sshpkApiVersion = [2, 1]; - -Signature._oldVersionDetect = function (obj) { - assert.func(obj.toBuffer); - if (obj.hasOwnProperty('hashAlgorithm')) - return ([2, 0]); - return ([1, 0]); -}; - - -/***/ }), - -/***/ 723: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; - - -var url = __webpack_require__(835) -var tunnel = __webpack_require__(692) - -var defaultProxyHeaderWhiteList = [ - 'accept', - 'accept-charset', - 'accept-encoding', - 'accept-language', - 'accept-ranges', - 'cache-control', - 'content-encoding', - 'content-language', - 'content-location', - 'content-md5', - 'content-range', - 'content-type', - 'connection', - 'date', - 'expect', - 'max-forwards', - 'pragma', - 'referer', - 'te', - 'user-agent', - 'via' -] - -var defaultProxyHeaderExclusiveList = [ - 'proxy-authorization' -] - -function constructProxyHost (uriObject) { - var port = uriObject.port - var protocol = uriObject.protocol - var proxyHost = uriObject.hostname + ':' - - if (port) { - proxyHost += port - } else if (protocol === 'https:') { - proxyHost += '443' - } else { - proxyHost += '80' - } - - return proxyHost -} - -function constructProxyHeaderWhiteList (headers, proxyHeaderWhiteList) { - var whiteList = proxyHeaderWhiteList - .reduce(function (set, header) { - set[header.toLowerCase()] = true - return set - }, {}) - - return Object.keys(headers) - .filter(function (header) { - return whiteList[header.toLowerCase()] - }) - .reduce(function (set, header) { - set[header] = headers[header] - return set - }, {}) -} - -function constructTunnelOptions (request, proxyHeaders) { - var proxy = request.proxy - - var tunnelOptions = { - proxy: { - host: proxy.hostname, - port: +proxy.port, - proxyAuth: proxy.auth, - headers: proxyHeaders - }, - headers: request.headers, - ca: request.ca, - cert: request.cert, - key: request.key, - passphrase: request.passphrase, - pfx: request.pfx, - ciphers: request.ciphers, - rejectUnauthorized: request.rejectUnauthorized, - secureOptions: request.secureOptions, - secureProtocol: request.secureProtocol - } - - return tunnelOptions -} - -function constructTunnelFnName (uri, proxy) { - var uriProtocol = (uri.protocol === 'https:' ? 'https' : 'http') - var proxyProtocol = (proxy.protocol === 'https:' ? 'Https' : 'Http') - return [uriProtocol, proxyProtocol].join('Over') -} - -function getTunnelFn (request) { - var uri = request.uri - var proxy = request.proxy - var tunnelFnName = constructTunnelFnName(uri, proxy) - return tunnel[tunnelFnName] -} - -function Tunnel (request) { - this.request = request - this.proxyHeaderWhiteList = defaultProxyHeaderWhiteList - this.proxyHeaderExclusiveList = [] - if (typeof request.tunnel !== 'undefined') { - this.tunnelOverride = request.tunnel - } -} - -Tunnel.prototype.isEnabled = function () { - var self = this - var request = self.request - // Tunnel HTTPS by default. Allow the user to override this setting. - - // If self.tunnelOverride is set (the user specified a value), use it. - if (typeof self.tunnelOverride !== 'undefined') { - return self.tunnelOverride - } - - // If the destination is HTTPS, tunnel. - if (request.uri.protocol === 'https:') { - return true - } - - // Otherwise, do not use tunnel. - return false -} - -Tunnel.prototype.setup = function (options) { - var self = this - var request = self.request - - options = options || {} - - if (typeof request.proxy === 'string') { - request.proxy = url.parse(request.proxy) - } - - if (!request.proxy || !request.tunnel) { - return false - } - - // Setup Proxy Header Exclusive List and White List - if (options.proxyHeaderWhiteList) { - self.proxyHeaderWhiteList = options.proxyHeaderWhiteList - } - if (options.proxyHeaderExclusiveList) { - self.proxyHeaderExclusiveList = options.proxyHeaderExclusiveList - } - - var proxyHeaderExclusiveList = self.proxyHeaderExclusiveList.concat(defaultProxyHeaderExclusiveList) - var proxyHeaderWhiteList = self.proxyHeaderWhiteList.concat(proxyHeaderExclusiveList) - - // Setup Proxy Headers and Proxy Headers Host - // Only send the Proxy White Listed Header names - var proxyHeaders = constructProxyHeaderWhiteList(request.headers, proxyHeaderWhiteList) - proxyHeaders.host = constructProxyHost(request.uri) - - proxyHeaderExclusiveList.forEach(request.removeHeader, request) - - // Set Agent from Tunnel Data - var tunnelFn = getTunnelFn(request) - var tunnelOptions = constructTunnelOptions(request, proxyHeaders) - request.agent = tunnelFn(tunnelOptions) - - return true -} - -Tunnel.defaultProxyHeaderWhiteList = defaultProxyHeaderWhiteList -Tunnel.defaultProxyHeaderExclusiveList = defaultProxyHeaderExclusiveList -exports.Tunnel = Tunnel - - -/***/ }), - -/***/ 725: -/***/ (function(module, __unusedexports, __webpack_require__) { - -var abort = __webpack_require__(696) - , async = __webpack_require__(401) - ; - -// API -module.exports = terminator; - -/** - * Terminates jobs in the attached state context - * - * @this AsyncKitState# - * @param {function} callback - final callback to invoke after termination - */ -function terminator(callback) -{ - if (!Object.keys(this.jobs).length) - { - return; - } - - // fast forward iteration index - this.index = this.size; - - // abort jobs - abort(this); - - // send back results we have so far - async(callback)(null, this.results); -} - - -/***/ }), - -/***/ 728: -/***/ (function(module) { - -"use strict"; - -module.exports = function generate__limitProperties(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $errorKeyword; - var $data = 'data' + ($dataLvl || ''); - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - var $op = $keyword == 'maxProperties' ? '>' : '<'; - out += 'if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; - } - out += ' Object.keys(' + ($data) + ').length ' + ($op) + ' ' + ($schemaValue) + ') { '; - var $errorKeyword = $keyword; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || '_limitProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should NOT have '; - if ($keyword == 'maxProperties') { - out += 'more'; - } else { - out += 'fewer'; - } - out += ' than '; - if ($isData) { - out += '\' + ' + ($schemaValue) + ' + \''; - } else { - out += '' + ($schema); - } - out += ' properties\' '; - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + ($schema); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += '} '; - if ($breakOnError) { - out += ' else { '; - } - return out; -} - - -/***/ }), - -/***/ 729: -/***/ (function(module, __unusedexports, __webpack_require__) { - -var iterate = __webpack_require__(82) - , initState = __webpack_require__(947) - , terminator = __webpack_require__(725) - ; - -// Public API -module.exports = parallel; - -/** - * Runs iterator over provided array elements in parallel - * - * @param {array|object} list - array or object (named list) to iterate over - * @param {function} iterator - iterator to run - * @param {function} callback - invoked when all elements processed - * @returns {function} - jobs terminator - */ -function parallel(list, iterator, callback) -{ - var state = initState(list); - - while (state.index < (state['keyedList'] || list).length) - { - iterate(list, iterator, state, function(error, result) - { - if (error) - { - callback(error, result); - return; - } - - // looks like it's the last one - if (Object.keys(state.jobs).length === 0) - { - callback(null, state.results); - return; - } - }); - - state.index++; - } - - return terminator.bind(state, callback); -} - - -/***/ }), - -/***/ 737: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2018 Joyent, Inc. +// Copyright 2017 Joyent, Inc. module.exports = { read: read, + verify: verify, + sign: sign, + signAsync: signAsync, write: write }; -var assert = __webpack_require__(283); -var Buffer = __webpack_require__(375).Buffer; -var utils = __webpack_require__(757); -var Key = __webpack_require__(820); -var PrivateKey = __webpack_require__(463); +var assert = __webpack_require__(477); +var asn1 = __webpack_require__(62); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var utils = __webpack_require__(270); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var pem = __webpack_require__(268); +var Identity = __webpack_require__(378); +var Signature = __webpack_require__(575); +var Certificate = __webpack_require__(752); +var pkcs8 = __webpack_require__(707); -var pem = __webpack_require__(502); -var ssh = __webpack_require__(33); -var rfc4253 = __webpack_require__(533); -var dnssec = __webpack_require__(554); -var putty = __webpack_require__(777); +/* + * This file is based on RFC5280 (X.509). + */ -var DNSSEC_PRIVKEY_HEADER_PREFIX = 'Private-key-format: v1'; +/* Helper to read in a single mpint */ +function readMPInt(der, nm) { + assert.strictEqual(der.peek(), asn1.Ber.Integer, + nm + ' is not an Integer'); + return (utils.mpNormalize(der.readString(asn1.Ber.Integer, true))); +} + +function verify(cert, key) { + var sig = cert.signatures.x509; + assert.object(sig, 'x509 signature'); + + var algParts = sig.algo.split('-'); + if (algParts[0] !== key.type) + return (false); + + var blob = sig.cache; + if (blob === undefined) { + var der = new asn1.BerWriter(); + writeTBSCert(cert, der); + blob = der.buffer; + } + + var verifier = key.createVerify(algParts[1]); + verifier.write(blob); + return (verifier.verify(sig.signature)); +} + +function Local(i) { + return (asn1.Ber.Context | asn1.Ber.Constructor | i); +} + +function Context(i) { + return (asn1.Ber.Context | i); +} + +var SIGN_ALGS = { + 'rsa-md5': '1.2.840.113549.1.1.4', + 'rsa-sha1': '1.2.840.113549.1.1.5', + 'rsa-sha256': '1.2.840.113549.1.1.11', + 'rsa-sha384': '1.2.840.113549.1.1.12', + 'rsa-sha512': '1.2.840.113549.1.1.13', + 'dsa-sha1': '1.2.840.10040.4.3', + 'dsa-sha256': '2.16.840.1.101.3.4.3.2', + 'ecdsa-sha1': '1.2.840.10045.4.1', + 'ecdsa-sha256': '1.2.840.10045.4.3.2', + 'ecdsa-sha384': '1.2.840.10045.4.3.3', + 'ecdsa-sha512': '1.2.840.10045.4.3.4', + 'ed25519-sha512': '1.3.101.112' +}; +Object.keys(SIGN_ALGS).forEach(function (k) { + SIGN_ALGS[SIGN_ALGS[k]] = k; +}); +SIGN_ALGS['1.3.14.3.2.3'] = 'rsa-md5'; +SIGN_ALGS['1.3.14.3.2.29'] = 'rsa-sha1'; + +var EXTS = { + 'issuerKeyId': '2.5.29.35', + 'altName': '2.5.29.17', + 'basicConstraints': '2.5.29.19', + 'keyUsage': '2.5.29.15', + 'extKeyUsage': '2.5.29.37' +}; function read(buf, options) { if (typeof (buf) === 'string') { - if (buf.trim().match(/^[-]+[ ]*BEGIN/)) - return (pem.read(buf, options)); - if (buf.match(/^\s*ssh-[a-z]/)) - return (ssh.read(buf, options)); - if (buf.match(/^\s*ecdsa-/)) - return (ssh.read(buf, options)); - if (buf.match(/^putty-user-key-file-2:/i)) - return (putty.read(buf, options)); - if (findDNSSECHeader(buf)) - return (dnssec.read(buf, options)); buf = Buffer.from(buf, 'binary'); - } else { - assert.buffer(buf); - if (findPEMHeader(buf)) - return (pem.read(buf, options)); - if (findSSHHeader(buf)) - return (ssh.read(buf, options)); - if (findPuTTYHeader(buf)) - return (putty.read(buf, options)); - if (findDNSSECHeader(buf)) - return (dnssec.read(buf, options)); } - if (buf.readUInt32BE(0) < buf.length) - return (rfc4253.read(buf, options)); - throw (new Error('Failed to auto-detect format of key')); + assert.buffer(buf, 'buf'); + + var der = new asn1.BerReader(buf); + + der.readSequence(); + if (Math.abs(der.length - der.remain) > 1) { + throw (new Error('DER sequence does not contain whole byte ' + + 'stream')); + } + + var tbsStart = der.offset; + der.readSequence(); + var sigOffset = der.offset + der.length; + var tbsEnd = sigOffset; + + if (der.peek() === Local(0)) { + der.readSequence(Local(0)); + var version = der.readInt(); + assert.ok(version <= 3, + 'only x.509 versions up to v3 supported'); + } + + var cert = {}; + cert.signatures = {}; + var sig = (cert.signatures.x509 = {}); + sig.extras = {}; + + cert.serial = readMPInt(der, 'serial'); + + der.readSequence(); + var after = der.offset + der.length; + var certAlgOid = der.readOID(); + var certAlg = SIGN_ALGS[certAlgOid]; + if (certAlg === undefined) + throw (new Error('unknown signature algorithm ' + certAlgOid)); + + der._offset = after; + cert.issuer = Identity.parseAsn1(der); + + der.readSequence(); + cert.validFrom = readDate(der); + cert.validUntil = readDate(der); + + cert.subjects = [Identity.parseAsn1(der)]; + + der.readSequence(); + after = der.offset + der.length; + cert.subjectKey = pkcs8.readPkcs8(undefined, 'public', der); + der._offset = after; + + /* issuerUniqueID */ + if (der.peek() === Local(1)) { + der.readSequence(Local(1)); + sig.extras.issuerUniqueID = + buf.slice(der.offset, der.offset + der.length); + der._offset += der.length; + } + + /* subjectUniqueID */ + if (der.peek() === Local(2)) { + der.readSequence(Local(2)); + sig.extras.subjectUniqueID = + buf.slice(der.offset, der.offset + der.length); + der._offset += der.length; + } + + /* extensions */ + if (der.peek() === Local(3)) { + der.readSequence(Local(3)); + var extEnd = der.offset + der.length; + der.readSequence(); + + while (der.offset < extEnd) + readExtension(cert, buf, der); + + assert.strictEqual(der.offset, extEnd); + } + + assert.strictEqual(der.offset, sigOffset); + + der.readSequence(); + after = der.offset + der.length; + var sigAlgOid = der.readOID(); + var sigAlg = SIGN_ALGS[sigAlgOid]; + if (sigAlg === undefined) + throw (new Error('unknown signature algorithm ' + sigAlgOid)); + der._offset = after; + + var sigData = der.readString(asn1.Ber.BitString, true); + if (sigData[0] === 0) + sigData = sigData.slice(1); + var algParts = sigAlg.split('-'); + + sig.signature = Signature.parse(sigData, algParts[0], 'asn1'); + sig.signature.hashAlgorithm = algParts[1]; + sig.algo = sigAlg; + sig.cache = buf.slice(tbsStart, tbsEnd); + + return (new Certificate(cert)); } -function findPuTTYHeader(buf) { - var offset = 0; - while (offset < buf.length && - (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9)) - ++offset; - if (offset + 22 <= buf.length && - buf.slice(offset, offset + 22).toString('ascii').toLowerCase() === - 'putty-user-key-file-2:') - return (true); - return (false); +function readDate(der) { + if (der.peek() === asn1.Ber.UTCTime) { + return (utcTimeToDate(der.readString(asn1.Ber.UTCTime))); + } else if (der.peek() === asn1.Ber.GeneralizedTime) { + return (gTimeToDate(der.readString(asn1.Ber.GeneralizedTime))); + } else { + throw (new Error('Unsupported date format')); + } } -function findSSHHeader(buf) { - var offset = 0; - while (offset < buf.length && - (buf[offset] === 32 || buf[offset] === 10 || buf[offset] === 9)) - ++offset; - if (offset + 4 <= buf.length && - buf.slice(offset, offset + 4).toString('ascii') === 'ssh-') - return (true); - if (offset + 6 <= buf.length && - buf.slice(offset, offset + 6).toString('ascii') === 'ecdsa-') - return (true); - return (false); +function writeDate(der, date) { + if (date.getUTCFullYear() >= 2050 || date.getUTCFullYear() < 1950) { + der.writeString(dateToGTime(date), asn1.Ber.GeneralizedTime); + } else { + der.writeString(dateToUTCTime(date), asn1.Ber.UTCTime); + } } -function findPEMHeader(buf) { - var offset = 0; - while (offset < buf.length && - (buf[offset] === 32 || buf[offset] === 10)) - ++offset; - if (buf[offset] !== 45) - return (false); - while (offset < buf.length && - (buf[offset] === 45)) - ++offset; - while (offset < buf.length && - (buf[offset] === 32)) - ++offset; - if (offset + 5 > buf.length || - buf.slice(offset, offset + 5).toString('ascii') !== 'BEGIN') +/* RFC5280, section 4.2.1.6 (GeneralName type) */ +var ALTNAME = { + OtherName: Local(0), + RFC822Name: Context(1), + DNSName: Context(2), + X400Address: Local(3), + DirectoryName: Local(4), + EDIPartyName: Local(5), + URI: Context(6), + IPAddress: Context(7), + OID: Context(8) +}; + +/* RFC5280, section 4.2.1.12 (KeyPurposeId) */ +var EXTPURPOSE = { + 'serverAuth': '1.3.6.1.5.5.7.3.1', + 'clientAuth': '1.3.6.1.5.5.7.3.2', + 'codeSigning': '1.3.6.1.5.5.7.3.3', + + /* See https://github.com/joyent/oid-docs/blob/master/root.md */ + 'joyentDocker': '1.3.6.1.4.1.38678.1.4.1', + 'joyentCmon': '1.3.6.1.4.1.38678.1.4.2' +}; +var EXTPURPOSE_REV = {}; +Object.keys(EXTPURPOSE).forEach(function (k) { + EXTPURPOSE_REV[EXTPURPOSE[k]] = k; +}); + +var KEYUSEBITS = [ + 'signature', 'identity', 'keyEncryption', + 'encryption', 'keyAgreement', 'ca', 'crl' +]; + +function readExtension(cert, buf, der) { + der.readSequence(); + var after = der.offset + der.length; + var extId = der.readOID(); + var id; + var sig = cert.signatures.x509; + if (!sig.extras.exts) + sig.extras.exts = []; + + var critical; + if (der.peek() === asn1.Ber.Boolean) + critical = der.readBoolean(); + + switch (extId) { + case (EXTS.basicConstraints): + der.readSequence(asn1.Ber.OctetString); + der.readSequence(); + var bcEnd = der.offset + der.length; + var ca = false; + if (der.peek() === asn1.Ber.Boolean) + ca = der.readBoolean(); + if (cert.purposes === undefined) + cert.purposes = []; + if (ca === true) + cert.purposes.push('ca'); + var bc = { oid: extId, critical: critical }; + if (der.offset < bcEnd && der.peek() === asn1.Ber.Integer) + bc.pathLen = der.readInt(); + sig.extras.exts.push(bc); + break; + case (EXTS.extKeyUsage): + der.readSequence(asn1.Ber.OctetString); + der.readSequence(); + if (cert.purposes === undefined) + cert.purposes = []; + var ekEnd = der.offset + der.length; + while (der.offset < ekEnd) { + var oid = der.readOID(); + cert.purposes.push(EXTPURPOSE_REV[oid] || oid); + } + /* + * This is a bit of a hack: in the case where we have a cert + * that's only allowed to do serverAuth or clientAuth (and not + * the other), we want to make sure all our Subjects are of + * the right type. But we already parsed our Subjects and + * decided if they were hosts or users earlier (since it appears + * first in the cert). + * + * So we go through and mutate them into the right kind here if + * it doesn't match. This might not be hugely beneficial, as it + * seems that single-purpose certs are not often seen in the + * wild. + */ + if (cert.purposes.indexOf('serverAuth') !== -1 && + cert.purposes.indexOf('clientAuth') === -1) { + cert.subjects.forEach(function (ide) { + if (ide.type !== 'host') { + ide.type = 'host'; + ide.hostname = ide.uid || + ide.email || + ide.components[0].value; + } + }); + } else if (cert.purposes.indexOf('clientAuth') !== -1 && + cert.purposes.indexOf('serverAuth') === -1) { + cert.subjects.forEach(function (ide) { + if (ide.type !== 'user') { + ide.type = 'user'; + ide.uid = ide.hostname || + ide.email || + ide.components[0].value; + } + }); + } + sig.extras.exts.push({ oid: extId, critical: critical }); + break; + case (EXTS.keyUsage): + der.readSequence(asn1.Ber.OctetString); + var bits = der.readString(asn1.Ber.BitString, true); + var setBits = readBitField(bits, KEYUSEBITS); + setBits.forEach(function (bit) { + if (cert.purposes === undefined) + cert.purposes = []; + if (cert.purposes.indexOf(bit) === -1) + cert.purposes.push(bit); + }); + sig.extras.exts.push({ oid: extId, critical: critical, + bits: bits }); + break; + case (EXTS.altName): + der.readSequence(asn1.Ber.OctetString); + der.readSequence(); + var aeEnd = der.offset + der.length; + while (der.offset < aeEnd) { + switch (der.peek()) { + case ALTNAME.OtherName: + case ALTNAME.EDIPartyName: + der.readSequence(); + der._offset += der.length; + break; + case ALTNAME.OID: + der.readOID(ALTNAME.OID); + break; + case ALTNAME.RFC822Name: + /* RFC822 specifies email addresses */ + var email = der.readString(ALTNAME.RFC822Name); + id = Identity.forEmail(email); + if (!cert.subjects[0].equals(id)) + cert.subjects.push(id); + break; + case ALTNAME.DirectoryName: + der.readSequence(ALTNAME.DirectoryName); + id = Identity.parseAsn1(der); + if (!cert.subjects[0].equals(id)) + cert.subjects.push(id); + break; + case ALTNAME.DNSName: + var host = der.readString( + ALTNAME.DNSName); + id = Identity.forHost(host); + if (!cert.subjects[0].equals(id)) + cert.subjects.push(id); + break; + default: + der.readString(der.peek()); + break; + } + } + sig.extras.exts.push({ oid: extId, critical: critical }); + break; + default: + sig.extras.exts.push({ + oid: extId, + critical: critical, + data: der.readString(asn1.Ber.OctetString, true) + }); + break; + } + + der._offset = after; +} + +var UTCTIME_RE = + /^([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; +function utcTimeToDate(t) { + var m = t.match(UTCTIME_RE); + assert.ok(m, 'timestamps must be in UTC'); + var d = new Date(); + + var thisYear = d.getUTCFullYear(); + var century = Math.floor(thisYear / 100) * 100; + + var year = parseInt(m[1], 10); + if (thisYear % 100 < 50 && year >= 60) + year += (century - 1); + else + year += century; + d.setUTCFullYear(year, parseInt(m[2], 10) - 1, parseInt(m[3], 10)); + d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); + if (m[6] && m[6].length > 0) + d.setUTCSeconds(parseInt(m[6], 10)); + return (d); +} + +var GTIME_RE = + /^([0-9]{4})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})([0-9]{2})?Z$/; +function gTimeToDate(t) { + var m = t.match(GTIME_RE); + assert.ok(m); + var d = new Date(); + + d.setUTCFullYear(parseInt(m[1], 10), parseInt(m[2], 10) - 1, + parseInt(m[3], 10)); + d.setUTCHours(parseInt(m[4], 10), parseInt(m[5], 10)); + if (m[6] && m[6].length > 0) + d.setUTCSeconds(parseInt(m[6], 10)); + return (d); +} + +function zeroPad(n, m) { + if (m === undefined) + m = 2; + var s = '' + n; + while (s.length < m) + s = '0' + s; + return (s); +} + +function dateToUTCTime(d) { + var s = ''; + s += zeroPad(d.getUTCFullYear() % 100); + s += zeroPad(d.getUTCMonth() + 1); + s += zeroPad(d.getUTCDate()); + s += zeroPad(d.getUTCHours()); + s += zeroPad(d.getUTCMinutes()); + s += zeroPad(d.getUTCSeconds()); + s += 'Z'; + return (s); +} + +function dateToGTime(d) { + var s = ''; + s += zeroPad(d.getUTCFullYear(), 4); + s += zeroPad(d.getUTCMonth() + 1); + s += zeroPad(d.getUTCDate()); + s += zeroPad(d.getUTCHours()); + s += zeroPad(d.getUTCMinutes()); + s += zeroPad(d.getUTCSeconds()); + s += 'Z'; + return (s); +} + +function sign(cert, key) { + if (cert.signatures.x509 === undefined) + cert.signatures.x509 = {}; + var sig = cert.signatures.x509; + + sig.algo = key.type + '-' + key.defaultHashAlgorithm(); + if (SIGN_ALGS[sig.algo] === undefined) return (false); + + var der = new asn1.BerWriter(); + writeTBSCert(cert, der); + var blob = der.buffer; + sig.cache = blob; + + var signer = key.createSign(); + signer.write(blob); + cert.signatures.x509.signature = signer.sign(); + return (true); } -function findDNSSECHeader(buf) { - // private case first - if (buf.length <= DNSSEC_PRIVKEY_HEADER_PREFIX.length) - return (false); - var headerCheck = buf.slice(0, DNSSEC_PRIVKEY_HEADER_PREFIX.length); - if (headerCheck.toString('ascii') === DNSSEC_PRIVKEY_HEADER_PREFIX) - return (true); +function signAsync(cert, signer, done) { + if (cert.signatures.x509 === undefined) + cert.signatures.x509 = {}; + var sig = cert.signatures.x509; - // public-key RFC3110 ? - // 'domain.com. IN KEY ...' or 'domain.com. IN DNSKEY ...' - // skip any comment-lines - if (typeof (buf) !== 'string') { - buf = buf.toString('ascii'); - } - var lines = buf.split('\n'); - var line = 0; - /* JSSTYLED */ - while (lines[line].match(/^\;/)) - line++; - if (lines[line].toString('ascii').match(/\. IN KEY /)) - return (true); - if (lines[line].toString('ascii').match(/\. IN DNSKEY /)) - return (true); - return (false); + var der = new asn1.BerWriter(); + writeTBSCert(cert, der); + var blob = der.buffer; + sig.cache = blob; + + signer(blob, function (err, signature) { + if (err) { + done(err); + return; + } + sig.algo = signature.type + '-' + signature.hashAlgorithm; + if (SIGN_ALGS[sig.algo] === undefined) { + done(new Error('Invalid signing algorithm "' + + sig.algo + '"')); + return; + } + sig.signature = signature; + done(); + }); } -function write(key, options) { - throw (new Error('"auto" format cannot be used for writing')); +function write(cert, options) { + var sig = cert.signatures.x509; + assert.object(sig, 'x509 signature'); + + var der = new asn1.BerWriter(); + der.startSequence(); + if (sig.cache) { + der._ensure(sig.cache.length); + sig.cache.copy(der._buf, der._offset); + der._offset += sig.cache.length; + } else { + writeTBSCert(cert, der); + } + + der.startSequence(); + der.writeOID(SIGN_ALGS[sig.algo]); + if (sig.algo.match(/^rsa-/)) + der.writeNull(); + der.endSequence(); + + var sigData = sig.signature.toBuffer('asn1'); + var data = Buffer.alloc(sigData.length + 1); + data[0] = 0; + sigData.copy(data, 1); + der.writeBuffer(data, asn1.Ber.BitString); + der.endSequence(); + + return (der.buffer); +} + +function writeTBSCert(cert, der) { + var sig = cert.signatures.x509; + assert.object(sig, 'x509 signature'); + + der.startSequence(); + + der.startSequence(Local(0)); + der.writeInt(2); + der.endSequence(); + + der.writeBuffer(utils.mpNormalize(cert.serial), asn1.Ber.Integer); + + der.startSequence(); + der.writeOID(SIGN_ALGS[sig.algo]); + if (sig.algo.match(/^rsa-/)) + der.writeNull(); + der.endSequence(); + + cert.issuer.toAsn1(der); + + der.startSequence(); + writeDate(der, cert.validFrom); + writeDate(der, cert.validUntil); + der.endSequence(); + + var subject = cert.subjects[0]; + var altNames = cert.subjects.slice(1); + subject.toAsn1(der); + + pkcs8.writePkcs8(der, cert.subjectKey); + + if (sig.extras && sig.extras.issuerUniqueID) { + der.writeBuffer(sig.extras.issuerUniqueID, Local(1)); + } + + if (sig.extras && sig.extras.subjectUniqueID) { + der.writeBuffer(sig.extras.subjectUniqueID, Local(2)); + } + + if (altNames.length > 0 || subject.type === 'host' || + (cert.purposes !== undefined && cert.purposes.length > 0) || + (sig.extras && sig.extras.exts)) { + der.startSequence(Local(3)); + der.startSequence(); + + var exts = []; + if (cert.purposes !== undefined && cert.purposes.length > 0) { + exts.push({ + oid: EXTS.basicConstraints, + critical: true + }); + exts.push({ + oid: EXTS.keyUsage, + critical: true + }); + exts.push({ + oid: EXTS.extKeyUsage, + critical: true + }); + } + exts.push({ oid: EXTS.altName }); + if (sig.extras && sig.extras.exts) + exts = sig.extras.exts; + + for (var i = 0; i < exts.length; ++i) { + der.startSequence(); + der.writeOID(exts[i].oid); + + if (exts[i].critical !== undefined) + der.writeBoolean(exts[i].critical); + + if (exts[i].oid === EXTS.altName) { + der.startSequence(asn1.Ber.OctetString); + der.startSequence(); + if (subject.type === 'host') { + der.writeString(subject.hostname, + Context(2)); + } + for (var j = 0; j < altNames.length; ++j) { + if (altNames[j].type === 'host') { + der.writeString( + altNames[j].hostname, + ALTNAME.DNSName); + } else if (altNames[j].type === + 'email') { + der.writeString( + altNames[j].email, + ALTNAME.RFC822Name); + } else { + /* + * Encode anything else as a + * DN style name for now. + */ + der.startSequence( + ALTNAME.DirectoryName); + altNames[j].toAsn1(der); + der.endSequence(); + } + } + der.endSequence(); + der.endSequence(); + } else if (exts[i].oid === EXTS.basicConstraints) { + der.startSequence(asn1.Ber.OctetString); + der.startSequence(); + var ca = (cert.purposes.indexOf('ca') !== -1); + var pathLen = exts[i].pathLen; + der.writeBoolean(ca); + if (pathLen !== undefined) + der.writeInt(pathLen); + der.endSequence(); + der.endSequence(); + } else if (exts[i].oid === EXTS.extKeyUsage) { + der.startSequence(asn1.Ber.OctetString); + der.startSequence(); + cert.purposes.forEach(function (purpose) { + if (purpose === 'ca') + return; + if (KEYUSEBITS.indexOf(purpose) !== -1) + return; + var oid = purpose; + if (EXTPURPOSE[purpose] !== undefined) + oid = EXTPURPOSE[purpose]; + der.writeOID(oid); + }); + der.endSequence(); + der.endSequence(); + } else if (exts[i].oid === EXTS.keyUsage) { + der.startSequence(asn1.Ber.OctetString); + /* + * If we parsed this certificate from a byte + * stream (i.e. we didn't generate it in sshpk) + * then we'll have a ".bits" property on the + * ext with the original raw byte contents. + * + * If we have this, use it here instead of + * regenerating it. This guarantees we output + * the same data we parsed, so signatures still + * validate. + */ + if (exts[i].bits !== undefined) { + der.writeBuffer(exts[i].bits, + asn1.Ber.BitString); + } else { + var bits = writeBitField(cert.purposes, + KEYUSEBITS); + der.writeBuffer(bits, + asn1.Ber.BitString); + } + der.endSequence(); + } else { + der.writeBuffer(exts[i].data, + asn1.Ber.OctetString); + } + + der.endSequence(); + } + + der.endSequence(); + der.endSequence(); + } + + der.endSequence(); +} + +/* + * Reads an ASN.1 BER bitfield out of the Buffer produced by doing + * `BerReader#readString(asn1.Ber.BitString)`. That function gives us the raw + * contents of the BitString tag, which is a count of unused bits followed by + * the bits as a right-padded byte string. + * + * `bits` is the Buffer, `bitIndex` should contain an array of string names + * for the bits in the string, ordered starting with bit #0 in the ASN.1 spec. + * + * Returns an array of Strings, the names of the bits that were set to 1. + */ +function readBitField(bits, bitIndex) { + var bitLen = 8 * (bits.length - 1) - bits[0]; + var setBits = {}; + for (var i = 0; i < bitLen; ++i) { + var byteN = 1 + Math.floor(i / 8); + var bit = 7 - (i % 8); + var mask = 1 << bit; + var bitVal = ((bits[byteN] & mask) !== 0); + var name = bitIndex[i]; + if (bitVal && typeof (name) === 'string') { + setBits[name] = true; + } + } + return (Object.keys(setBits)); +} + +/* + * `setBits` is an array of strings, containing the names for each bit that + * sould be set to 1. `bitIndex` is same as in `readBitField()`. + * + * Returns a Buffer, ready to be written out with `BerWriter#writeString()`. + */ +function writeBitField(setBits, bitIndex) { + var bitLen = bitIndex.length; + var blen = Math.ceil(bitLen / 8); + var unused = blen * 8 - bitLen; + var bits = Buffer.alloc(1 + blen); // zero-filled + bits[0] = unused; + for (var i = 0; i < bitLen; ++i) { + var byteN = 1 + Math.floor(i / 8); + var bit = 7 - (i % 8); + var mask = 1 << bit; + var name = bitIndex[i]; + if (name === undefined) + continue; + var bitVal = (setBits.indexOf(name) !== -1); + if (bitVal) { + bits[byteN] |= mask; + } + } + return (bits); } /***/ }), -/***/ 738: +/***/ 867: /***/ (function(module, __unusedexports, __webpack_require__) { -// Copyright 2012 Joyent, Inc. All rights reserved. - -var assert = __webpack_require__(283); -var util = __webpack_require__(669); -var utils = __webpack_require__(517); +"use strict"; +var URI = __webpack_require__(853) + , equal = __webpack_require__(832) + , util = __webpack_require__(855) + , SchemaObject = __webpack_require__(955) + , traverse = __webpack_require__(340); -///--- Globals +module.exports = resolve; -var HASH_ALGOS = utils.HASH_ALGOS; -var PK_ALGOS = utils.PK_ALGOS; -var HttpSignatureError = utils.HttpSignatureError; -var InvalidAlgorithmError = utils.InvalidAlgorithmError; -var validateAlgorithm = utils.validateAlgorithm; +resolve.normalizeId = normalizeId; +resolve.fullPath = getFullPath; +resolve.url = resolveUrl; +resolve.ids = resolveIds; +resolve.inlineRef = inlineRef; +resolve.schema = resolveSchema; -var State = { - New: 0, - Params: 1 -}; - -var ParamsState = { - Name: 0, - Quote: 1, - Value: 2, - Comma: 3 -}; - - -///--- Specific Errors - - -function ExpiredRequestError(message) { - HttpSignatureError.call(this, message, ExpiredRequestError); -} -util.inherits(ExpiredRequestError, HttpSignatureError); - - -function InvalidHeaderError(message) { - HttpSignatureError.call(this, message, InvalidHeaderError); -} -util.inherits(InvalidHeaderError, HttpSignatureError); - - -function InvalidParamsError(message) { - HttpSignatureError.call(this, message, InvalidParamsError); -} -util.inherits(InvalidParamsError, HttpSignatureError); - - -function MissingHeaderError(message) { - HttpSignatureError.call(this, message, MissingHeaderError); -} -util.inherits(MissingHeaderError, HttpSignatureError); - -function StrictParsingError(message) { - HttpSignatureError.call(this, message, StrictParsingError); -} -util.inherits(StrictParsingError, HttpSignatureError); - -///--- Exported API - -module.exports = { - - /** - * Parses the 'Authorization' header out of an http.ServerRequest object. - * - * Note that this API will fully validate the Authorization header, and throw - * on any error. It will not however check the signature, or the keyId format - * as those are specific to your environment. You can use the options object - * to pass in extra constraints. - * - * As a response object you can expect this: - * - * { - * "scheme": "Signature", - * "params": { - * "keyId": "foo", - * "algorithm": "rsa-sha256", - * "headers": [ - * "date" or "x-date", - * "digest" - * ], - * "signature": "base64" - * }, - * "signingString": "ready to be passed to crypto.verify()" - * } - * - * @param {Object} request an http.ServerRequest. - * @param {Object} options an optional options object with: - * - clockSkew: allowed clock skew in seconds (default 300). - * - headers: required header names (def: date or x-date) - * - algorithms: algorithms to support (default: all). - * - strict: should enforce latest spec parsing - * (default: false). - * @return {Object} parsed out object (see above). - * @throws {TypeError} on invalid input. - * @throws {InvalidHeaderError} on an invalid Authorization header error. - * @throws {InvalidParamsError} if the params in the scheme are invalid. - * @throws {MissingHeaderError} if the params indicate a header not present, - * either in the request headers from the params, - * or not in the params from a required header - * in options. - * @throws {StrictParsingError} if old attributes are used in strict parsing - * mode. - * @throws {ExpiredRequestError} if the value of date or x-date exceeds skew. - */ - parseRequest: function parseRequest(request, options) { - assert.object(request, 'request'); - assert.object(request.headers, 'request.headers'); - if (options === undefined) { - options = {}; - } - if (options.headers === undefined) { - options.headers = [request.headers['x-date'] ? 'x-date' : 'date']; - } - assert.object(options, 'options'); - assert.arrayOfString(options.headers, 'options.headers'); - assert.optionalFinite(options.clockSkew, 'options.clockSkew'); - - var authzHeaderName = options.authorizationHeaderName || 'authorization'; - - if (!request.headers[authzHeaderName]) { - throw new MissingHeaderError('no ' + authzHeaderName + ' header ' + - 'present in the request'); - } - - options.clockSkew = options.clockSkew || 300; - - - var i = 0; - var state = State.New; - var substate = ParamsState.Name; - var tmpName = ''; - var tmpValue = ''; - - var parsed = { - scheme: '', - params: {}, - signingString: '' - }; - - var authz = request.headers[authzHeaderName]; - for (i = 0; i < authz.length; i++) { - var c = authz.charAt(i); - - switch (Number(state)) { - - case State.New: - if (c !== ' ') parsed.scheme += c; - else state = State.Params; - break; - - case State.Params: - switch (Number(substate)) { - - case ParamsState.Name: - var code = c.charCodeAt(0); - // restricted name of A-Z / a-z - if ((code >= 0x41 && code <= 0x5a) || // A-Z - (code >= 0x61 && code <= 0x7a)) { // a-z - tmpName += c; - } else if (c === '=') { - if (tmpName.length === 0) - throw new InvalidHeaderError('bad param format'); - substate = ParamsState.Quote; - } else { - throw new InvalidHeaderError('bad param format'); - } - break; - - case ParamsState.Quote: - if (c === '"') { - tmpValue = ''; - substate = ParamsState.Value; - } else { - throw new InvalidHeaderError('bad param format'); - } - break; - - case ParamsState.Value: - if (c === '"') { - parsed.params[tmpName] = tmpValue; - substate = ParamsState.Comma; - } else { - tmpValue += c; - } - break; - - case ParamsState.Comma: - if (c === ',') { - tmpName = ''; - substate = ParamsState.Name; - } else { - throw new InvalidHeaderError('bad param format'); - } - break; - - default: - throw new Error('Invalid substate'); - } - break; - - default: - throw new Error('Invalid substate'); - } - - } - - if (!parsed.params.headers || parsed.params.headers === '') { - if (request.headers['x-date']) { - parsed.params.headers = ['x-date']; - } else { - parsed.params.headers = ['date']; - } - } else { - parsed.params.headers = parsed.params.headers.split(' '); - } - - // Minimally validate the parsed object - if (!parsed.scheme || parsed.scheme !== 'Signature') - throw new InvalidHeaderError('scheme was not "Signature"'); - - if (!parsed.params.keyId) - throw new InvalidHeaderError('keyId was not specified'); - - if (!parsed.params.algorithm) - throw new InvalidHeaderError('algorithm was not specified'); - - if (!parsed.params.signature) - throw new InvalidHeaderError('signature was not specified'); - - // Check the algorithm against the official list - parsed.params.algorithm = parsed.params.algorithm.toLowerCase(); - try { - validateAlgorithm(parsed.params.algorithm); - } catch (e) { - if (e instanceof InvalidAlgorithmError) - throw (new InvalidParamsError(parsed.params.algorithm + ' is not ' + - 'supported')); - else - throw (e); - } - - // Build the signingString - for (i = 0; i < parsed.params.headers.length; i++) { - var h = parsed.params.headers[i].toLowerCase(); - parsed.params.headers[i] = h; - - if (h === 'request-line') { - if (!options.strict) { - /* - * We allow headers from the older spec drafts if strict parsing isn't - * specified in options. - */ - parsed.signingString += - request.method + ' ' + request.url + ' HTTP/' + request.httpVersion; - } else { - /* Strict parsing doesn't allow older draft headers. */ - throw (new StrictParsingError('request-line is not a valid header ' + - 'with strict parsing enabled.')); - } - } else if (h === '(request-target)') { - parsed.signingString += - '(request-target): ' + request.method.toLowerCase() + ' ' + - request.url; - } else { - var value = request.headers[h]; - if (value === undefined) - throw new MissingHeaderError(h + ' was not in the request'); - parsed.signingString += h + ': ' + value; - } - - if ((i + 1) < parsed.params.headers.length) - parsed.signingString += '\n'; - } - - // Check against the constraints - var date; - if (request.headers.date || request.headers['x-date']) { - if (request.headers['x-date']) { - date = new Date(request.headers['x-date']); - } else { - date = new Date(request.headers.date); - } - var now = new Date(); - var skew = Math.abs(now.getTime() - date.getTime()); - - if (skew > options.clockSkew * 1000) { - throw new ExpiredRequestError('clock skew of ' + - (skew / 1000) + - 's was greater than ' + - options.clockSkew + 's'); - } - } - - options.headers.forEach(function (hdr) { - // Remember that we already checked any headers in the params - // were in the request, so if this passes we're good. - if (parsed.params.headers.indexOf(hdr.toLowerCase()) < 0) - throw new MissingHeaderError(hdr + ' was not a signed header'); - }); - - if (options.algorithms) { - if (options.algorithms.indexOf(parsed.params.algorithm) === -1) - throw new InvalidParamsError(parsed.params.algorithm + - ' is not a supported algorithm'); - } - - parsed.algorithm = parsed.params.algorithm.toUpperCase(); - parsed.keyId = parsed.params.keyId; - return parsed; +/** + * [resolve and compile the references ($ref)] + * @this Ajv + * @param {Function} compile reference to schema compilation funciton (localCompile) + * @param {Object} root object with information about the root schema for the current schema + * @param {String} ref reference to resolve + * @return {Object|Function} schema object (if the schema can be inlined) or validation function + */ +function resolve(compile, root, ref) { + /* jshint validthis: true */ + var refVal = this._refs[ref]; + if (typeof refVal == 'string') { + if (this._refs[refVal]) refVal = this._refs[refVal]; + else return resolve.call(this, compile, root, refVal); } -}; + refVal = refVal || this._schemas[ref]; + if (refVal instanceof SchemaObject) { + return inlineRef(refVal.schema, this._opts.inlineRefs) + ? refVal.schema + : refVal.validate || this._compile(refVal); + } + + var res = resolveSchema.call(this, root, ref); + var schema, v, baseId; + if (res) { + schema = res.schema; + root = res.root; + baseId = res.baseId; + } + + if (schema instanceof SchemaObject) { + v = schema.validate || compile.call(this, schema.schema, root, undefined, baseId); + } else if (schema !== undefined) { + v = inlineRef(schema, this._opts.inlineRefs) + ? schema + : compile.call(this, schema, root, undefined, baseId); + } + + return v; +} + + +/** + * Resolve schema, its root and baseId + * @this Ajv + * @param {Object} root root object with properties schema, refVal, refs + * @param {String} ref reference to resolve + * @return {Object} object with properties schema, root, baseId + */ +function resolveSchema(root, ref) { + /* jshint validthis: true */ + var p = URI.parse(ref) + , refPath = _getFullPath(p) + , baseId = getFullPath(this._getId(root.schema)); + if (Object.keys(root.schema).length === 0 || refPath !== baseId) { + var id = normalizeId(refPath); + var refVal = this._refs[id]; + if (typeof refVal == 'string') { + return resolveRecursive.call(this, root, refVal, p); + } else if (refVal instanceof SchemaObject) { + if (!refVal.validate) this._compile(refVal); + root = refVal; + } else { + refVal = this._schemas[id]; + if (refVal instanceof SchemaObject) { + if (!refVal.validate) this._compile(refVal); + if (id == normalizeId(ref)) + return { schema: refVal, root: root, baseId: baseId }; + root = refVal; + } else { + return; + } + } + if (!root.schema) return; + baseId = getFullPath(this._getId(root.schema)); + } + return getJsonPointer.call(this, p, baseId, root.schema, root); +} + + +/* @this Ajv */ +function resolveRecursive(root, ref, parsedRef) { + /* jshint validthis: true */ + var res = resolveSchema.call(this, root, ref); + if (res) { + var schema = res.schema; + var baseId = res.baseId; + root = res.root; + var id = this._getId(schema); + if (id) baseId = resolveUrl(baseId, id); + return getJsonPointer.call(this, parsedRef, baseId, schema, root); + } +} + + +var PREVENT_SCOPE_CHANGE = util.toHash(['properties', 'patternProperties', 'enum', 'dependencies', 'definitions']); +/* @this Ajv */ +function getJsonPointer(parsedRef, baseId, schema, root) { + /* jshint validthis: true */ + parsedRef.fragment = parsedRef.fragment || ''; + if (parsedRef.fragment.slice(0,1) != '/') return; + var parts = parsedRef.fragment.split('/'); + + for (var i = 1; i < parts.length; i++) { + var part = parts[i]; + if (part) { + part = util.unescapeFragment(part); + schema = schema[part]; + if (schema === undefined) break; + var id; + if (!PREVENT_SCOPE_CHANGE[part]) { + id = this._getId(schema); + if (id) baseId = resolveUrl(baseId, id); + if (schema.$ref) { + var $ref = resolveUrl(baseId, schema.$ref); + var res = resolveSchema.call(this, root, $ref); + if (res) { + schema = res.schema; + root = res.root; + baseId = res.baseId; + } + } + } + } + } + if (schema !== undefined && schema !== root.schema) + return { schema: schema, root: root, baseId: baseId }; +} + + +var SIMPLE_INLINED = util.toHash([ + 'type', 'format', 'pattern', + 'maxLength', 'minLength', + 'maxProperties', 'minProperties', + 'maxItems', 'minItems', + 'maximum', 'minimum', + 'uniqueItems', 'multipleOf', + 'required', 'enum' +]); +function inlineRef(schema, limit) { + if (limit === false) return false; + if (limit === undefined || limit === true) return checkNoRef(schema); + else if (limit) return countKeys(schema) <= limit; +} + + +function checkNoRef(schema) { + var item; + if (Array.isArray(schema)) { + for (var i=0; i%\\^`{|}]|%[0-9a-f]{2})|\{[+#./;?&=,!@|]?(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?(?:,(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?)*\})*$/i; +// For the source: https://gist.github.com/dperini/729294 +// For test cases: https://mathiasbynens.be/demo/url-regex +// @todo Delete current URL in favour of the commented out URL rule when this issue is fixed https://github.com/eslint/eslint/issues/7983. +// var URL = /^(?:(?:https?|ftp):\/\/)(?:\S+(?::\S*)?@)?(?:(?!10(?:\.\d{1,3}){3})(?!127(?:\.\d{1,3}){3})(?!169\.254(?:\.\d{1,3}){2})(?!192\.168(?:\.\d{1,3}){2})(?!172\.(?:1[6-9]|2\d|3[0-1])(?:\.\d{1,3}){2})(?:[1-9]\d?|1\d\d|2[01]\d|22[0-3])(?:\.(?:1?\d{1,2}|2[0-4]\d|25[0-5])){2}(?:\.(?:[1-9]\d?|1\d\d|2[0-4]\d|25[0-4]))|(?:(?:[a-z\u{00a1}-\u{ffff}0-9]+-?)*[a-z\u{00a1}-\u{ffff}0-9]+)(?:\.(?:[a-z\u{00a1}-\u{ffff}0-9]+-?)*[a-z\u{00a1}-\u{ffff}0-9]+)*(?:\.(?:[a-z\u{00a1}-\u{ffff}]{2,})))(?::\d{2,5})?(?:\/[^\s]*)?$/iu; +var URL = /^(?:(?:http[s\u017F]?|ftp):\/\/)(?:(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+(?::(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?@)?(?:(?!10(?:\.[0-9]{1,3}){3})(?!127(?:\.[0-9]{1,3}){3})(?!169\.254(?:\.[0-9]{1,3}){2})(?!192\.168(?:\.[0-9]{1,3}){2})(?!172\.(?:1[6-9]|2[0-9]|3[01])(?:\.[0-9]{1,3}){2})(?:[1-9][0-9]?|1[0-9][0-9]|2[01][0-9]|22[0-3])(?:\.(?:1?[0-9]{1,2}|2[0-4][0-9]|25[0-5])){2}(?:\.(?:[1-9][0-9]?|1[0-9][0-9]|2[0-4][0-9]|25[0-4]))|(?:(?:(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-?)*(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)(?:\.(?:(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-?)*(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)*(?:\.(?:(?:[KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]){2,})))(?::[0-9]{2,5})?(?:\/(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?$/i; +var UUID = /^(?:urn:uuid:)?[0-9a-f]{8}-(?:[0-9a-f]{4}-){3}[0-9a-f]{12}$/i; +var JSON_POINTER = /^(?:\/(?:[^~/]|~0|~1)*)*$/; +var JSON_POINTER_URI_FRAGMENT = /^#(?:\/(?:[a-z0-9_\-.!$&'()*+,;:=@]|%[0-9a-f]{2}|~0|~1)*)*$/i; +var RELATIVE_JSON_POINTER = /^(?:0|[1-9][0-9]*)(?:#|(?:\/(?:[^~/]|~0|~1)*)*)$/; + + +module.exports = formats; + +function formats(mode) { + mode = mode == 'full' ? 'full' : 'fast'; + return util.copy(formats[mode]); +} + + +formats.fast = { + // date: http://tools.ietf.org/html/rfc3339#section-5.6 + date: /^\d\d\d\d-[0-1]\d-[0-3]\d$/, + // date-time: http://tools.ietf.org/html/rfc3339#section-5.6 + time: /^(?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d(?::?\d\d)?)?$/i, + 'date-time': /^\d\d\d\d-[0-1]\d-[0-3]\d[t\s](?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d(?::?\d\d)?)$/i, + // uri: https://github.com/mafintosh/is-my-json-valid/blob/master/formats.js + uri: /^(?:[a-z][a-z0-9+-.]*:)(?:\/?\/)?[^\s]*$/i, + 'uri-reference': /^(?:(?:[a-z][a-z0-9+-.]*:)?\/?\/)?(?:[^\\\s#][^\s#]*)?(?:#[^\\\s]*)?$/i, + 'uri-template': URITEMPLATE, + url: URL, + // email (sources from jsen validator): + // http://stackoverflow.com/questions/201323/using-a-regular-expression-to-validate-an-email-address#answer-8829363 + // http://www.w3.org/TR/html5/forms.html#valid-e-mail-address (search for 'willful violation') + email: /^[a-z0-9.!#$%&'*+/=?^_`{|}~-]+@[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?(?:\.[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?)*$/i, + hostname: HOSTNAME, + // optimized https://www.safaribooksonline.com/library/view/regular-expressions-cookbook/9780596802837/ch07s16.html + ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/, + // optimized http://stackoverflow.com/questions/53497/regular-expression-that-matches-valid-ipv6-addresses + ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i, + regex: regex, + // uuid: http://tools.ietf.org/html/rfc4122 + uuid: UUID, + // JSON-pointer: https://tools.ietf.org/html/rfc6901 + // uri fragment: https://tools.ietf.org/html/rfc3986#appendix-A + 'json-pointer': JSON_POINTER, + 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT, + // relative JSON-pointer: http://tools.ietf.org/html/draft-luff-relative-json-pointer-00 + 'relative-json-pointer': RELATIVE_JSON_POINTER +}; + + +formats.full = { + date: date, + time: time, + 'date-time': date_time, + uri: uri, + 'uri-reference': URIREF, + 'uri-template': URITEMPLATE, + url: URL, + email: /^[a-z0-9!#$%&'*+/=?^_`{|}~-]+(?:\.[a-z0-9!#$%&'*+/=?^_`{|}~-]+)*@(?:[a-z0-9](?:[a-z0-9-]*[a-z0-9])?\.)+[a-z0-9](?:[a-z0-9-]*[a-z0-9])?$/i, + hostname: HOSTNAME, + ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/, + ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i, + regex: regex, + uuid: UUID, + 'json-pointer': JSON_POINTER, + 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT, + 'relative-json-pointer': RELATIVE_JSON_POINTER +}; + + +function isLeapYear(year) { + // https://tools.ietf.org/html/rfc3339#appendix-C + return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); +} + + +function date(str) { + // full-date from http://tools.ietf.org/html/rfc3339#section-5.6 + var matches = str.match(DATE); + if (!matches) return false; + + var year = +matches[1]; + var month = +matches[2]; + var day = +matches[3]; + + return month >= 1 && month <= 12 && day >= 1 && + day <= (month == 2 && isLeapYear(year) ? 29 : DAYS[month]); +} + + +function time(str, full) { + var matches = str.match(TIME); + if (!matches) return false; + + var hour = matches[1]; + var minute = matches[2]; + var second = matches[3]; + var timeZone = matches[5]; + return ((hour <= 23 && minute <= 59 && second <= 59) || + (hour == 23 && minute == 59 && second == 60)) && + (!full || timeZone); +} + + +var DATE_TIME_SEPARATOR = /t|\s/i; +function date_time(str) { + // http://tools.ietf.org/html/rfc3339#section-5.6 + var dateTime = str.split(DATE_TIME_SEPARATOR); + return dateTime.length == 2 && date(dateTime[0]) && time(dateTime[1], true); +} + + +var NOT_URI_FRAGMENT = /\/|:/; +function uri(str) { + // http://jmrware.com/articles/2009/uri_regexp/URI_regex.html + optional protocol + required "." + return NOT_URI_FRAGMENT.test(str) && URI.test(str); +} + + +var Z_ANCHOR = /[^\\]\\Z/; +function regex(str) { + if (Z_ANCHOR.test(str)) return false; + try { + new RegExp(str); + return true; + } catch(e) { + return false; + } +} + + +/***/ }), + +/***/ 883: /***/ (function(module) { module.exports = {"$id":"header.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["name","value"],"properties":{"name":{"type":"string"},"value":{"type":"string"},"comment":{"type":"string"}}}; /***/ }), -/***/ 747: -/***/ (function(module) { - -module.exports = require("fs"); - -/***/ }), - -/***/ 753: -/***/ (function(module, __unusedexports, __webpack_require__) { - -var util = __webpack_require__(669); -var Stream = __webpack_require__(413).Stream; -var DelayedStream = __webpack_require__(756); - -module.exports = CombinedStream; -function CombinedStream() { - this.writable = false; - this.readable = true; - this.dataSize = 0; - this.maxDataSize = 2 * 1024 * 1024; - this.pauseStreams = true; - - this._released = false; - this._streams = []; - this._currentStream = null; - this._insideLoop = false; - this._pendingNext = false; -} -util.inherits(CombinedStream, Stream); - -CombinedStream.create = function(options) { - var combinedStream = new this(); - - options = options || {}; - for (var option in options) { - combinedStream[option] = options[option]; - } - - return combinedStream; -}; - -CombinedStream.isStreamLike = function(stream) { - return (typeof stream !== 'function') - && (typeof stream !== 'string') - && (typeof stream !== 'boolean') - && (typeof stream !== 'number') - && (!Buffer.isBuffer(stream)); -}; - -CombinedStream.prototype.append = function(stream) { - var isStreamLike = CombinedStream.isStreamLike(stream); - - if (isStreamLike) { - if (!(stream instanceof DelayedStream)) { - var newStream = DelayedStream.create(stream, { - maxDataSize: Infinity, - pauseStream: this.pauseStreams, - }); - stream.on('data', this._checkDataSize.bind(this)); - stream = newStream; - } - - this._handleErrors(stream); - - if (this.pauseStreams) { - stream.pause(); - } - } - - this._streams.push(stream); - return this; -}; - -CombinedStream.prototype.pipe = function(dest, options) { - Stream.prototype.pipe.call(this, dest, options); - this.resume(); - return dest; -}; - -CombinedStream.prototype._getNext = function() { - this._currentStream = null; - - if (this._insideLoop) { - this._pendingNext = true; - return; // defer call - } - - this._insideLoop = true; - try { - do { - this._pendingNext = false; - this._realGetNext(); - } while (this._pendingNext); - } finally { - this._insideLoop = false; - } -}; - -CombinedStream.prototype._realGetNext = function() { - var stream = this._streams.shift(); - - - if (typeof stream == 'undefined') { - this.end(); - return; - } - - if (typeof stream !== 'function') { - this._pipeNext(stream); - return; - } - - var getStream = stream; - getStream(function(stream) { - var isStreamLike = CombinedStream.isStreamLike(stream); - if (isStreamLike) { - stream.on('data', this._checkDataSize.bind(this)); - this._handleErrors(stream); - } - - this._pipeNext(stream); - }.bind(this)); -}; - -CombinedStream.prototype._pipeNext = function(stream) { - this._currentStream = stream; - - var isStreamLike = CombinedStream.isStreamLike(stream); - if (isStreamLike) { - stream.on('end', this._getNext.bind(this)); - stream.pipe(this, {end: false}); - return; - } - - var value = stream; - this.write(value); - this._getNext(); -}; - -CombinedStream.prototype._handleErrors = function(stream) { - var self = this; - stream.on('error', function(err) { - self._emitError(err); - }); -}; - -CombinedStream.prototype.write = function(data) { - this.emit('data', data); -}; - -CombinedStream.prototype.pause = function() { - if (!this.pauseStreams) { - return; - } - - if(this.pauseStreams && this._currentStream && typeof(this._currentStream.pause) == 'function') this._currentStream.pause(); - this.emit('pause'); -}; - -CombinedStream.prototype.resume = function() { - if (!this._released) { - this._released = true; - this.writable = true; - this._getNext(); - } - - if(this.pauseStreams && this._currentStream && typeof(this._currentStream.resume) == 'function') this._currentStream.resume(); - this.emit('resume'); -}; - -CombinedStream.prototype.end = function() { - this._reset(); - this.emit('end'); -}; - -CombinedStream.prototype.destroy = function() { - this._reset(); - this.emit('close'); -}; - -CombinedStream.prototype._reset = function() { - this.writable = false; - this._streams = []; - this._currentStream = null; -}; - -CombinedStream.prototype._checkDataSize = function() { - this._updateDataSize(); - if (this.dataSize <= this.maxDataSize) { - return; - } - - var message = - 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.'; - this._emitError(new Error(message)); -}; - -CombinedStream.prototype._updateDataSize = function() { - this.dataSize = 0; - - var self = this; - this._streams.forEach(function(stream) { - if (!stream.dataSize) { - return; - } - - self.dataSize += stream.dataSize; - }); - - if (this._currentStream && this._currentStream.dataSize) { - this.dataSize += this._currentStream.dataSize; - } -}; - -CombinedStream.prototype._emitError = function(err) { - this._reset(); - this.emit('error', err); -}; - - -/***/ }), - -/***/ 754: -/***/ (function(module) { - -module.exports = {"$id":"content.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["size","mimeType"],"properties":{"size":{"type":"integer"},"compression":{"type":"integer"},"mimeType":{"type":"string"},"text":{"type":"string"},"encoding":{"type":"string"},"comment":{"type":"string"}}}; - -/***/ }), - -/***/ 756: -/***/ (function(module, __unusedexports, __webpack_require__) { - -var Stream = __webpack_require__(413).Stream; -var util = __webpack_require__(669); - -module.exports = DelayedStream; -function DelayedStream() { - this.source = null; - this.dataSize = 0; - this.maxDataSize = 1024 * 1024; - this.pauseStream = true; - - this._maxDataSizeExceeded = false; - this._released = false; - this._bufferedEvents = []; -} -util.inherits(DelayedStream, Stream); - -DelayedStream.create = function(source, options) { - var delayedStream = new this(); - - options = options || {}; - for (var option in options) { - delayedStream[option] = options[option]; - } - - delayedStream.source = source; - - var realEmit = source.emit; - source.emit = function() { - delayedStream._handleEmit(arguments); - return realEmit.apply(source, arguments); - }; - - source.on('error', function() {}); - if (delayedStream.pauseStream) { - source.pause(); - } - - return delayedStream; -}; - -Object.defineProperty(DelayedStream.prototype, 'readable', { - configurable: true, - enumerable: true, - get: function() { - return this.source.readable; - } -}); - -DelayedStream.prototype.setEncoding = function() { - return this.source.setEncoding.apply(this.source, arguments); -}; - -DelayedStream.prototype.resume = function() { - if (!this._released) { - this.release(); - } - - this.source.resume(); -}; - -DelayedStream.prototype.pause = function() { - this.source.pause(); -}; - -DelayedStream.prototype.release = function() { - this._released = true; - - this._bufferedEvents.forEach(function(args) { - this.emit.apply(this, args); - }.bind(this)); - this._bufferedEvents = []; -}; - -DelayedStream.prototype.pipe = function() { - var r = Stream.prototype.pipe.apply(this, arguments); - this.resume(); - return r; -}; - -DelayedStream.prototype._handleEmit = function(args) { - if (this._released) { - this.emit.apply(this, args); - return; - } - - if (args[0] === 'data') { - this.dataSize += args[1].length; - this._checkIfMaxDataSizeExceeded(); - } - - this._bufferedEvents.push(args); -}; - -DelayedStream.prototype._checkIfMaxDataSizeExceeded = function() { - if (this._maxDataSizeExceeded) { - return; - } - - if (this.dataSize <= this.maxDataSize) { - return; - } - - this._maxDataSizeExceeded = true; - var message = - 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.' - this.emit('error', new Error(message)); -}; - - -/***/ }), - -/***/ 757: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = { - bufferSplit: bufferSplit, - addRSAMissing: addRSAMissing, - calculateDSAPublic: calculateDSAPublic, - calculateED25519Public: calculateED25519Public, - calculateX25519Public: calculateX25519Public, - mpNormalize: mpNormalize, - mpDenormalize: mpDenormalize, - ecNormalize: ecNormalize, - countZeros: countZeros, - assertCompatible: assertCompatible, - isCompatible: isCompatible, - opensslKeyDeriv: opensslKeyDeriv, - opensshCipherInfo: opensshCipherInfo, - publicFromPrivateECDSA: publicFromPrivateECDSA, - zeroPadToLength: zeroPadToLength, - writeBitString: writeBitString, - readBitString: readBitString, - pbkdf2: pbkdf2 -}; - -var assert = __webpack_require__(283); -var Buffer = __webpack_require__(375).Buffer; -var PrivateKey = __webpack_require__(463); -var Key = __webpack_require__(820); -var crypto = __webpack_require__(417); -var algs = __webpack_require__(936); -var asn1 = __webpack_require__(214); - -var ec = __webpack_require__(814); -var jsbn = __webpack_require__(71).BigInteger; -var nacl = __webpack_require__(199); - -var MAX_CLASS_DEPTH = 3; - -function isCompatible(obj, klass, needVer) { - if (obj === null || typeof (obj) !== 'object') - return (false); - if (needVer === undefined) - needVer = klass.prototype._sshpkApiVersion; - if (obj instanceof klass && - klass.prototype._sshpkApiVersion[0] == needVer[0]) - return (true); - var proto = Object.getPrototypeOf(obj); - var depth = 0; - while (proto.constructor.name !== klass.name) { - proto = Object.getPrototypeOf(proto); - if (!proto || ++depth > MAX_CLASS_DEPTH) - return (false); - } - if (proto.constructor.name !== klass.name) - return (false); - var ver = proto._sshpkApiVersion; - if (ver === undefined) - ver = klass._oldVersionDetect(obj); - if (ver[0] != needVer[0] || ver[1] < needVer[1]) - return (false); - return (true); -} - -function assertCompatible(obj, klass, needVer, name) { - if (name === undefined) - name = 'object'; - assert.ok(obj, name + ' must not be null'); - assert.object(obj, name + ' must be an object'); - if (needVer === undefined) - needVer = klass.prototype._sshpkApiVersion; - if (obj instanceof klass && - klass.prototype._sshpkApiVersion[0] == needVer[0]) - return; - var proto = Object.getPrototypeOf(obj); - var depth = 0; - while (proto.constructor.name !== klass.name) { - proto = Object.getPrototypeOf(proto); - assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, - name + ' must be a ' + klass.name + ' instance'); - } - assert.strictEqual(proto.constructor.name, klass.name, - name + ' must be a ' + klass.name + ' instance'); - var ver = proto._sshpkApiVersion; - if (ver === undefined) - ver = klass._oldVersionDetect(obj); - assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], - name + ' must be compatible with ' + klass.name + ' klass ' + - 'version ' + needVer[0] + '.' + needVer[1]); -} - -var CIPHER_LEN = { - 'des-ede3-cbc': { key: 24, iv: 8 }, - 'aes-128-cbc': { key: 16, iv: 16 }, - 'aes-256-cbc': { key: 32, iv: 16 } -}; -var PKCS5_SALT_LEN = 8; - -function opensslKeyDeriv(cipher, salt, passphrase, count) { - assert.buffer(salt, 'salt'); - assert.buffer(passphrase, 'passphrase'); - assert.number(count, 'iteration count'); - - var clen = CIPHER_LEN[cipher]; - assert.object(clen, 'supported cipher'); - - salt = salt.slice(0, PKCS5_SALT_LEN); - - var D, D_prev, bufs; - var material = Buffer.alloc(0); - while (material.length < clen.key + clen.iv) { - bufs = []; - if (D_prev) - bufs.push(D_prev); - bufs.push(passphrase); - bufs.push(salt); - D = Buffer.concat(bufs); - for (var j = 0; j < count; ++j) - D = crypto.createHash('md5').update(D).digest(); - material = Buffer.concat([material, D]); - D_prev = D; - } - - return ({ - key: material.slice(0, clen.key), - iv: material.slice(clen.key, clen.key + clen.iv) - }); -} - -/* See: RFC2898 */ -function pbkdf2(hashAlg, salt, iterations, size, passphrase) { - var hkey = Buffer.alloc(salt.length + 4); - salt.copy(hkey); - - var gen = 0, ts = []; - var i = 1; - while (gen < size) { - var t = T(i++); - gen += t.length; - ts.push(t); - } - return (Buffer.concat(ts).slice(0, size)); - - function T(I) { - hkey.writeUInt32BE(I, hkey.length - 4); - - var hmac = crypto.createHmac(hashAlg, passphrase); - hmac.update(hkey); - - var Ti = hmac.digest(); - var Uc = Ti; - var c = 1; - while (c++ < iterations) { - hmac = crypto.createHmac(hashAlg, passphrase); - hmac.update(Uc); - Uc = hmac.digest(); - for (var x = 0; x < Ti.length; ++x) - Ti[x] ^= Uc[x]; - } - return (Ti); - } -} - -/* Count leading zero bits on a buffer */ -function countZeros(buf) { - var o = 0, obit = 8; - while (o < buf.length) { - var mask = (1 << obit); - if ((buf[o] & mask) === mask) - break; - obit--; - if (obit < 0) { - o++; - obit = 8; - } - } - return (o*8 + (8 - obit) - 1); -} - -function bufferSplit(buf, chr) { - assert.buffer(buf); - assert.string(chr); - - var parts = []; - var lastPart = 0; - var matches = 0; - for (var i = 0; i < buf.length; ++i) { - if (buf[i] === chr.charCodeAt(matches)) - ++matches; - else if (buf[i] === chr.charCodeAt(0)) - matches = 1; - else - matches = 0; - - if (matches >= chr.length) { - var newPart = i + 1; - parts.push(buf.slice(lastPart, newPart - matches)); - lastPart = newPart; - matches = 0; - } - } - if (lastPart <= buf.length) - parts.push(buf.slice(lastPart, buf.length)); - - return (parts); -} - -function ecNormalize(buf, addZero) { - assert.buffer(buf); - if (buf[0] === 0x00 && buf[1] === 0x04) { - if (addZero) - return (buf); - return (buf.slice(1)); - } else if (buf[0] === 0x04) { - if (!addZero) - return (buf); - } else { - while (buf[0] === 0x00) - buf = buf.slice(1); - if (buf[0] === 0x02 || buf[0] === 0x03) - throw (new Error('Compressed elliptic curve points ' + - 'are not supported')); - if (buf[0] !== 0x04) - throw (new Error('Not a valid elliptic curve point')); - if (!addZero) - return (buf); - } - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x0; - buf.copy(b, 1); - return (b); -} - -function readBitString(der, tag) { - if (tag === undefined) - tag = asn1.Ber.BitString; - var buf = der.readString(tag, true); - assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' + - 'not supported (0x' + buf[0].toString(16) + ')'); - return (buf.slice(1)); -} - -function writeBitString(der, buf, tag) { - if (tag === undefined) - tag = asn1.Ber.BitString; - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - der.writeBuffer(b, tag); -} - -function mpNormalize(buf) { - assert.buffer(buf); - while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) - buf = buf.slice(1); - if ((buf[0] & 0x80) === 0x80) { - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - buf = b; - } - return (buf); -} - -function mpDenormalize(buf) { - assert.buffer(buf); - while (buf.length > 1 && buf[0] === 0x00) - buf = buf.slice(1); - return (buf); -} - -function zeroPadToLength(buf, len) { - assert.buffer(buf); - assert.number(len); - while (buf.length > len) { - assert.equal(buf[0], 0x00); - buf = buf.slice(1); - } - while (buf.length < len) { - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - buf = b; - } - return (buf); -} - -function bigintToMpBuf(bigint) { - var buf = Buffer.from(bigint.toByteArray()); - buf = mpNormalize(buf); - return (buf); -} - -function calculateDSAPublic(g, p, x) { - assert.buffer(g); - assert.buffer(p); - assert.buffer(x); - g = new jsbn(g); - p = new jsbn(p); - x = new jsbn(x); - var y = g.modPow(x, p); - var ybuf = bigintToMpBuf(y); - return (ybuf); -} - -function calculateED25519Public(k) { - assert.buffer(k); - - var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); - return (Buffer.from(kp.publicKey)); -} - -function calculateX25519Public(k) { - assert.buffer(k); - - var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); - return (Buffer.from(kp.publicKey)); -} - -function addRSAMissing(key) { - assert.object(key); - assertCompatible(key, PrivateKey, [1, 1]); - - var d = new jsbn(key.part.d.data); - var buf; - - if (!key.part.dmodp) { - var p = new jsbn(key.part.p.data); - var dmodp = d.mod(p.subtract(1)); - - buf = bigintToMpBuf(dmodp); - key.part.dmodp = {name: 'dmodp', data: buf}; - key.parts.push(key.part.dmodp); - } - if (!key.part.dmodq) { - var q = new jsbn(key.part.q.data); - var dmodq = d.mod(q.subtract(1)); - - buf = bigintToMpBuf(dmodq); - key.part.dmodq = {name: 'dmodq', data: buf}; - key.parts.push(key.part.dmodq); - } -} - -function publicFromPrivateECDSA(curveName, priv) { - assert.string(curveName, 'curveName'); - assert.buffer(priv); - var params = algs.curves[curveName]; - var p = new jsbn(params.p); - var a = new jsbn(params.a); - var b = new jsbn(params.b); - var curve = new ec.ECCurveFp(p, a, b); - var G = curve.decodePointHex(params.G.toString('hex')); - - var d = new jsbn(mpNormalize(priv)); - var pub = G.multiply(d); - pub = Buffer.from(curve.encodePointHex(pub), 'hex'); - - var parts = []; - parts.push({name: 'curve', data: Buffer.from(curveName)}); - parts.push({name: 'Q', data: pub}); - - var key = new Key({type: 'ecdsa', curve: curve, parts: parts}); - return (key); -} - -function opensshCipherInfo(cipher) { - var inf = {}; - switch (cipher) { - case '3des-cbc': - inf.keySize = 24; - inf.blockSize = 8; - inf.opensslName = 'des-ede3-cbc'; - break; - case 'blowfish-cbc': - inf.keySize = 16; - inf.blockSize = 8; - inf.opensslName = 'bf-cbc'; - break; - case 'aes128-cbc': - case 'aes128-ctr': - case 'aes128-gcm@openssh.com': - inf.keySize = 16; - inf.blockSize = 16; - inf.opensslName = 'aes-128-' + cipher.slice(7, 10); - break; - case 'aes192-cbc': - case 'aes192-ctr': - case 'aes192-gcm@openssh.com': - inf.keySize = 24; - inf.blockSize = 16; - inf.opensslName = 'aes-192-' + cipher.slice(7, 10); - break; - case 'aes256-cbc': - case 'aes256-ctr': - case 'aes256-gcm@openssh.com': - inf.keySize = 32; - inf.blockSize = 16; - inf.opensslName = 'aes-256-' + cipher.slice(7, 10); - break; - default: - throw (new Error( - 'Unsupported openssl cipher "' + cipher + '"')); - } - return (inf); -} - - -/***/ }), - -/***/ 761: -/***/ (function(module) { - -module.exports = require("zlib"); - -/***/ }), - -/***/ 765: -/***/ (function(__unusedmodule, exports) { - -"use strict"; -/*! - * Copyright (c) 2015, Salesforce.com, Inc. - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * - * 1. Redistributions of source code must retain the above copyright notice, - * this list of conditions and the following disclaimer. - * - * 2. Redistributions in binary form must reproduce the above copyright notice, - * this list of conditions and the following disclaimer in the documentation - * and/or other materials provided with the distribution. - * - * 3. Neither the name of Salesforce.com nor the names of its contributors may - * be used to endorse or promote products derived from this software without - * specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE - * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR - * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF - * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS - * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN - * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) - * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE - * POSSIBILITY OF SUCH DAMAGE. - */ - -/*jshint unused:false */ - -function Store() { -} -exports.Store = Store; - -// Stores may be synchronous, but are still required to use a -// Continuation-Passing Style API. The CookieJar itself will expose a "*Sync" -// API that converts from synchronous-callbacks to imperative style. -Store.prototype.synchronous = false; - -Store.prototype.findCookie = function(domain, path, key, cb) { - throw new Error('findCookie is not implemented'); -}; - -Store.prototype.findCookies = function(domain, path, cb) { - throw new Error('findCookies is not implemented'); -}; - -Store.prototype.putCookie = function(cookie, cb) { - throw new Error('putCookie is not implemented'); -}; - -Store.prototype.updateCookie = function(oldCookie, newCookie, cb) { - // recommended default implementation: - // return this.putCookie(newCookie, cb); - throw new Error('updateCookie is not implemented'); -}; - -Store.prototype.removeCookie = function(domain, path, key, cb) { - throw new Error('removeCookie is not implemented'); -}; - -Store.prototype.removeCookies = function(domain, path, cb) { - throw new Error('removeCookies is not implemented'); -}; - -Store.prototype.getAllCookies = function(cb) { - throw new Error('getAllCookies is not implemented (therefore jar cannot be serialized)'); -}; - - -/***/ }), - -/***/ 766: -/***/ (function(module, __unusedexports, __webpack_require__) { - -module.exports = -{ - parallel : __webpack_require__(729), - serial : __webpack_require__(778), - serialOrdered : __webpack_require__(235) -}; - - -/***/ }), - -/***/ 775: +/***/ 886: /***/ (function(__unusedmodule, exports, __webpack_require__) { -"use strict"; -/*! - * Copyright (c) 2015, Salesforce.com, Inc. - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * - * 1. Redistributions of source code must retain the above copyright notice, - * this list of conditions and the following disclaimer. - * - * 2. Redistributions in binary form must reproduce the above copyright notice, - * this list of conditions and the following disclaimer in the documentation - * and/or other materials provided with the distribution. - * - * 3. Neither the name of Salesforce.com nor the names of its contributors may - * be used to endorse or promote products derived from this software without - * specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE - * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR - * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF - * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS - * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN - * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) - * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE - * POSSIBILITY OF SUCH DAMAGE. - */ - -var net = __webpack_require__(631); -var urlParse = __webpack_require__(835).parse; -var util = __webpack_require__(669); -var pubsuffix = __webpack_require__(137); -var Store = __webpack_require__(765).Store; -var MemoryCookieStore = __webpack_require__(334).MemoryCookieStore; -var pathMatch = __webpack_require__(47).pathMatch; -var VERSION = __webpack_require__(876).version; - -var punycode; -try { - punycode = __webpack_require__(213); -} catch(e) { - console.warn("tough-cookie: can't load punycode; won't use punycode for domain normalization"); -} - -// From RFC6265 S4.1.1 -// note that it excludes \x3B ";" -var COOKIE_OCTETS = /^[\x21\x23-\x2B\x2D-\x3A\x3C-\x5B\x5D-\x7E]+$/; - -var CONTROL_CHARS = /[\x00-\x1F]/; - -// From Chromium // '\r', '\n' and '\0' should be treated as a terminator in -// the "relaxed" mode, see: -// https://github.com/ChromiumWebApps/chromium/blob/b3d3b4da8bb94c1b2e061600df106d590fda3620/net/cookies/parsed_cookie.cc#L60 -var TERMINATORS = ['\n', '\r', '\0']; - -// RFC6265 S4.1.1 defines path value as 'any CHAR except CTLs or ";"' -// Note ';' is \x3B -var PATH_VALUE = /[\x20-\x3A\x3C-\x7E]+/; - -// date-time parsing constants (RFC6265 S5.1.1) - -var DATE_DELIM = /[\x09\x20-\x2F\x3B-\x40\x5B-\x60\x7B-\x7E]/; - -var MONTH_TO_NUM = { - jan:0, feb:1, mar:2, apr:3, may:4, jun:5, - jul:6, aug:7, sep:8, oct:9, nov:10, dec:11 -}; -var NUM_TO_MONTH = [ - 'Jan','Feb','Mar','Apr','May','Jun','Jul','Aug','Sep','Oct','Nov','Dec' -]; -var NUM_TO_DAY = [ - 'Sun','Mon','Tue','Wed','Thu','Fri','Sat' -]; - -var MAX_TIME = 2147483647000; // 31-bit max -var MIN_TIME = 0; // 31-bit min - -/* - * Parses a Natural number (i.e., non-negative integer) with either the - * *DIGIT ( non-digit *OCTET ) - * or - * *DIGIT - * grammar (RFC6265 S5.1.1). - * - * The "trailingOK" boolean controls if the grammar accepts a - * "( non-digit *OCTET )" trailer. - */ -function parseDigits(token, minDigits, maxDigits, trailingOK) { - var count = 0; - while (count < token.length) { - var c = token.charCodeAt(count); - // "non-digit = %x00-2F / %x3A-FF" - if (c <= 0x2F || c >= 0x3A) { - break; - } - count++; - } - - // constrain to a minimum and maximum number of digits. - if (count < minDigits || count > maxDigits) { - return null; - } - - if (!trailingOK && count != token.length) { - return null; - } - - return parseInt(token.substr(0,count), 10); -} - -function parseTime(token) { - var parts = token.split(':'); - var result = [0,0,0]; - - /* RF6256 S5.1.1: - * time = hms-time ( non-digit *OCTET ) - * hms-time = time-field ":" time-field ":" time-field - * time-field = 1*2DIGIT - */ - - if (parts.length !== 3) { - return null; - } - - for (var i = 0; i < 3; i++) { - // "time-field" must be strictly "1*2DIGIT", HOWEVER, "hms-time" can be - // followed by "( non-digit *OCTET )" so therefore the last time-field can - // have a trailer - var trailingOK = (i == 2); - var num = parseDigits(parts[i], 1, 2, trailingOK); - if (num === null) { - return null; - } - result[i] = num; - } - - return result; -} - -function parseMonth(token) { - token = String(token).substr(0,3).toLowerCase(); - var num = MONTH_TO_NUM[token]; - return num >= 0 ? num : null; -} - -/* - * RFC6265 S5.1.1 date parser (see RFC for full grammar) - */ -function parseDate(str) { - if (!str) { - return; - } - - /* RFC6265 S5.1.1: - * 2. Process each date-token sequentially in the order the date-tokens - * appear in the cookie-date - */ - var tokens = str.split(DATE_DELIM); - if (!tokens) { - return; - } - - var hour = null; - var minute = null; - var second = null; - var dayOfMonth = null; - var month = null; - var year = null; - - for (var i=0; i= 70 && year <= 99) { - year += 1900; - } else if (year >= 0 && year <= 69) { - year += 2000; - } - } - } - } - - /* RFC 6265 S5.1.1 - * "5. Abort these steps and fail to parse the cookie-date if: - * * at least one of the found-day-of-month, found-month, found- - * year, or found-time flags is not set, - * * the day-of-month-value is less than 1 or greater than 31, - * * the year-value is less than 1601, - * * the hour-value is greater than 23, - * * the minute-value is greater than 59, or - * * the second-value is greater than 59. - * (Note that leap seconds cannot be represented in this syntax.)" - * - * So, in order as above: - */ - if ( - dayOfMonth === null || month === null || year === null || second === null || - dayOfMonth < 1 || dayOfMonth > 31 || - year < 1601 || - hour > 23 || - minute > 59 || - second > 59 - ) { - return; - } - - return new Date(Date.UTC(year, month, dayOfMonth, hour, minute, second)); -} - -function formatDate(date) { - var d = date.getUTCDate(); d = d >= 10 ? d : '0'+d; - var h = date.getUTCHours(); h = h >= 10 ? h : '0'+h; - var m = date.getUTCMinutes(); m = m >= 10 ? m : '0'+m; - var s = date.getUTCSeconds(); s = s >= 10 ? s : '0'+s; - return NUM_TO_DAY[date.getUTCDay()] + ', ' + - d+' '+ NUM_TO_MONTH[date.getUTCMonth()] +' '+ date.getUTCFullYear() +' '+ - h+':'+m+':'+s+' GMT'; -} - -// S5.1.2 Canonicalized Host Names -function canonicalDomain(str) { - if (str == null) { - return null; - } - str = str.trim().replace(/^\./,''); // S4.1.2.3 & S5.2.3: ignore leading . - - // convert to IDN if any non-ASCII characters - if (punycode && /[^\u0001-\u007f]/.test(str)) { - str = punycode.toASCII(str); - } - - return str.toLowerCase(); -} - -// S5.1.3 Domain Matching -function domainMatch(str, domStr, canonicalize) { - if (str == null || domStr == null) { - return null; - } - if (canonicalize !== false) { - str = canonicalDomain(str); - domStr = canonicalDomain(domStr); - } - - /* - * "The domain string and the string are identical. (Note that both the - * domain string and the string will have been canonicalized to lower case at - * this point)" - */ - if (str == domStr) { - return true; - } - - /* "All of the following [three] conditions hold:" (order adjusted from the RFC) */ - - /* "* The string is a host name (i.e., not an IP address)." */ - if (net.isIP(str)) { - return false; - } - - /* "* The domain string is a suffix of the string" */ - var idx = str.indexOf(domStr); - if (idx <= 0) { - return false; // it's a non-match (-1) or prefix (0) - } - - // e.g "a.b.c".indexOf("b.c") === 2 - // 5 === 3+2 - if (str.length !== domStr.length + idx) { // it's not a suffix - return false; - } - - /* "* The last character of the string that is not included in the domain - * string is a %x2E (".") character." */ - if (str.substr(idx-1,1) !== '.') { - return false; - } - - return true; -} - - -// RFC6265 S5.1.4 Paths and Path-Match - -/* - * "The user agent MUST use an algorithm equivalent to the following algorithm - * to compute the default-path of a cookie:" - * - * Assumption: the path (and not query part or absolute uri) is passed in. - */ -function defaultPath(path) { - // "2. If the uri-path is empty or if the first character of the uri-path is not - // a %x2F ("/") character, output %x2F ("/") and skip the remaining steps. - if (!path || path.substr(0,1) !== "/") { - return "/"; - } - - // "3. If the uri-path contains no more than one %x2F ("/") character, output - // %x2F ("/") and skip the remaining step." - if (path === "/") { - return path; - } - - var rightSlash = path.lastIndexOf("/"); - if (rightSlash === 0) { - return "/"; - } - - // "4. Output the characters of the uri-path from the first character up to, - // but not including, the right-most %x2F ("/")." - return path.slice(0, rightSlash); -} - -function trimTerminator(str) { - for (var t = 0; t < TERMINATORS.length; t++) { - var terminatorIdx = str.indexOf(TERMINATORS[t]); - if (terminatorIdx !== -1) { - str = str.substr(0,terminatorIdx); - } - } - - return str; -} - -function parseCookiePair(cookiePair, looseMode) { - cookiePair = trimTerminator(cookiePair); - - var firstEq = cookiePair.indexOf('='); - if (looseMode) { - if (firstEq === 0) { // '=' is immediately at start - cookiePair = cookiePair.substr(1); - firstEq = cookiePair.indexOf('='); // might still need to split on '=' - } - } else { // non-loose mode - if (firstEq <= 0) { // no '=' or is at start - return; // needs to have non-empty "cookie-name" - } - } - - var cookieName, cookieValue; - if (firstEq <= 0) { - cookieName = ""; - cookieValue = cookiePair.trim(); - } else { - cookieName = cookiePair.substr(0, firstEq).trim(); - cookieValue = cookiePair.substr(firstEq+1).trim(); - } - - if (CONTROL_CHARS.test(cookieName) || CONTROL_CHARS.test(cookieValue)) { - return; - } - - var c = new Cookie(); - c.key = cookieName; - c.value = cookieValue; - return c; -} - -function parse(str, options) { - if (!options || typeof options !== 'object') { - options = {}; - } - str = str.trim(); - - // We use a regex to parse the "name-value-pair" part of S5.2 - var firstSemi = str.indexOf(';'); // S5.2 step 1 - var cookiePair = (firstSemi === -1) ? str : str.substr(0, firstSemi); - var c = parseCookiePair(cookiePair, !!options.loose); - if (!c) { - return; - } - - if (firstSemi === -1) { - return c; - } - - // S5.2.3 "unparsed-attributes consist of the remainder of the set-cookie-string - // (including the %x3B (";") in question)." plus later on in the same section - // "discard the first ";" and trim". - var unparsed = str.slice(firstSemi + 1).trim(); - - // "If the unparsed-attributes string is empty, skip the rest of these - // steps." - if (unparsed.length === 0) { - return c; - } - - /* - * S5.2 says that when looping over the items "[p]rocess the attribute-name - * and attribute-value according to the requirements in the following - * subsections" for every item. Plus, for many of the individual attributes - * in S5.3 it says to use the "attribute-value of the last attribute in the - * cookie-attribute-list". Therefore, in this implementation, we overwrite - * the previous value. - */ - var cookie_avs = unparsed.split(';'); - while (cookie_avs.length) { - var av = cookie_avs.shift().trim(); - if (av.length === 0) { // happens if ";;" appears - continue; - } - var av_sep = av.indexOf('='); - var av_key, av_value; - - if (av_sep === -1) { - av_key = av; - av_value = null; - } else { - av_key = av.substr(0,av_sep); - av_value = av.substr(av_sep+1); - } - - av_key = av_key.trim().toLowerCase(); - - if (av_value) { - av_value = av_value.trim(); - } - - switch(av_key) { - case 'expires': // S5.2.1 - if (av_value) { - var exp = parseDate(av_value); - // "If the attribute-value failed to parse as a cookie date, ignore the - // cookie-av." - if (exp) { - // over and underflow not realistically a concern: V8's getTime() seems to - // store something larger than a 32-bit time_t (even with 32-bit node) - c.expires = exp; - } - } - break; - - case 'max-age': // S5.2.2 - if (av_value) { - // "If the first character of the attribute-value is not a DIGIT or a "-" - // character ...[or]... If the remainder of attribute-value contains a - // non-DIGIT character, ignore the cookie-av." - if (/^-?[0-9]+$/.test(av_value)) { - var delta = parseInt(av_value, 10); - // "If delta-seconds is less than or equal to zero (0), let expiry-time - // be the earliest representable date and time." - c.setMaxAge(delta); - } - } - break; - - case 'domain': // S5.2.3 - // "If the attribute-value is empty, the behavior is undefined. However, - // the user agent SHOULD ignore the cookie-av entirely." - if (av_value) { - // S5.2.3 "Let cookie-domain be the attribute-value without the leading %x2E - // (".") character." - var domain = av_value.trim().replace(/^\./, ''); - if (domain) { - // "Convert the cookie-domain to lower case." - c.domain = domain.toLowerCase(); - } - } - break; - - case 'path': // S5.2.4 - /* - * "If the attribute-value is empty or if the first character of the - * attribute-value is not %x2F ("/"): - * Let cookie-path be the default-path. - * Otherwise: - * Let cookie-path be the attribute-value." - * - * We'll represent the default-path as null since it depends on the - * context of the parsing. - */ - c.path = av_value && av_value[0] === "/" ? av_value : null; - break; - - case 'secure': // S5.2.5 - /* - * "If the attribute-name case-insensitively matches the string "Secure", - * the user agent MUST append an attribute to the cookie-attribute-list - * with an attribute-name of Secure and an empty attribute-value." - */ - c.secure = true; - break; - - case 'httponly': // S5.2.6 -- effectively the same as 'secure' - c.httpOnly = true; - break; - - default: - c.extensions = c.extensions || []; - c.extensions.push(av); - break; - } - } - - return c; -} - -// avoid the V8 deoptimization monster! -function jsonParse(str) { - var obj; - try { - obj = JSON.parse(str); - } catch (e) { - return e; - } - return obj; -} - -function fromJSON(str) { - if (!str) { - return null; - } - - var obj; - if (typeof str === 'string') { - obj = jsonParse(str); - if (obj instanceof Error) { - return null; - } - } else { - // assume it's an Object - obj = str; - } - - var c = new Cookie(); - for (var i=0; i 1) { - var lindex = path.lastIndexOf('/'); - if (lindex === 0) { - break; - } - path = path.substr(0,lindex); - permutations.push(path); - } - permutations.push('/'); - return permutations; -} - -function getCookieContext(url) { - if (url instanceof Object) { - return url; - } - // NOTE: decodeURI will throw on malformed URIs (see GH-32). - // Therefore, we will just skip decoding for such URIs. - try { - url = decodeURI(url); - } - catch(err) { - // Silently swallow error - } - - return urlParse(url); -} - -function Cookie(options) { - options = options || {}; - - Object.keys(options).forEach(function(prop) { - if (Cookie.prototype.hasOwnProperty(prop) && - Cookie.prototype[prop] !== options[prop] && - prop.substr(0,1) !== '_') - { - this[prop] = options[prop]; - } - }, this); - - this.creation = this.creation || new Date(); - - // used to break creation ties in cookieCompare(): - Object.defineProperty(this, 'creationIndex', { - configurable: false, - enumerable: false, // important for assert.deepEqual checks - writable: true, - value: ++Cookie.cookiesCreated - }); -} - -Cookie.cookiesCreated = 0; // incremented each time a cookie is created - -Cookie.parse = parse; -Cookie.fromJSON = fromJSON; - -Cookie.prototype.key = ""; -Cookie.prototype.value = ""; - -// the order in which the RFC has them: -Cookie.prototype.expires = "Infinity"; // coerces to literal Infinity -Cookie.prototype.maxAge = null; // takes precedence over expires for TTL -Cookie.prototype.domain = null; -Cookie.prototype.path = null; -Cookie.prototype.secure = false; -Cookie.prototype.httpOnly = false; -Cookie.prototype.extensions = null; - -// set by the CookieJar: -Cookie.prototype.hostOnly = null; // boolean when set -Cookie.prototype.pathIsDefault = null; // boolean when set -Cookie.prototype.creation = null; // Date when set; defaulted by Cookie.parse -Cookie.prototype.lastAccessed = null; // Date when set -Object.defineProperty(Cookie.prototype, 'creationIndex', { - configurable: true, - enumerable: false, - writable: true, - value: 0 -}); - -Cookie.serializableProperties = Object.keys(Cookie.prototype) - .filter(function(prop) { - return !( - Cookie.prototype[prop] instanceof Function || - prop === 'creationIndex' || - prop.substr(0,1) === '_' - ); - }); - -Cookie.prototype.inspect = function inspect() { - var now = Date.now(); - return 'Cookie="'+this.toString() + - '; hostOnly='+(this.hostOnly != null ? this.hostOnly : '?') + - '; aAge='+(this.lastAccessed ? (now-this.lastAccessed.getTime())+'ms' : '?') + - '; cAge='+(this.creation ? (now-this.creation.getTime())+'ms' : '?') + - '"'; -}; - -// Use the new custom inspection symbol to add the custom inspect function if -// available. -if (util.inspect.custom) { - Cookie.prototype[util.inspect.custom] = Cookie.prototype.inspect; -} - -Cookie.prototype.toJSON = function() { - var obj = {}; - - var props = Cookie.serializableProperties; - for (var i=0; i lines.length) { - throw (new Error('Invalid public-lines count')); - } - - var publicBuf = Buffer.from( - lines.slice(si, si + publicLines).join(''), 'base64'); - var keyType = rfc4253.algToKeyType(alg); - var key = rfc4253.read(publicBuf); - if (key.type !== keyType) { - throw (new Error('Outer key algorithm mismatch')); - } - key.comment = comment; - return (key); -} - -function splitHeader(line) { - var idx = line.indexOf(':'); - if (idx === -1) - return (null); - var header = line.slice(0, idx); - ++idx; - while (line[idx] === ' ') - ++idx; - var rest = line.slice(idx); - return ([header, rest]); -} - -function write(key, options) { - assert.object(key); - if (!Key.isKey(key)) - throw (new Error('Must be a public key')); - - var alg = rfc4253.keyTypeToAlg(key); - var buf = rfc4253.write(key); - var comment = key.comment || ''; - - var b64 = buf.toString('base64'); - var lines = wrap(b64, 64); - - lines.unshift('Public-Lines: ' + lines.length); - lines.unshift('Comment: ' + comment); - lines.unshift('Encryption: none'); - lines.unshift('PuTTY-User-Key-File-2: ' + alg); - - return (Buffer.from(lines.join('\n') + '\n')); -} - -function wrap(txt, len) { - var lines = []; - var pos = 0; - while (pos < txt.length) { - lines.push(txt.slice(pos, pos + 64)); - pos += 64; - } - return (lines); -} - - -/***/ }), - -/***/ 778: -/***/ (function(module, __unusedexports, __webpack_require__) { - -var serialOrdered = __webpack_require__(235); - -// Public API -module.exports = serial; - -/** - * Runs iterator over provided array elements in series - * - * @param {array|object} list - array or object (named list) to iterate over - * @param {function} iterator - iterator to run - * @param {function} callback - invoked when all elements processed - * @returns {function} - jobs terminator - */ -function serial(list, iterator, callback) +var crypto = __webpack_require__(417); +var BigInteger = __webpack_require__(242).BigInteger; +var ECPointFp = __webpack_require__(729).ECPointFp; +var Buffer = __webpack_require__(215).Buffer; +exports.ECCurves = __webpack_require__(959); + +// zero prepad +function unstupid(hex,len) { - return serialOrdered(list, iterator, null, callback); + return (hex.length >= len) ? hex : unstupid("0"+hex,len); } +exports.ECKey = function(curve, key, isPublic) +{ + var priv; + var c = curve(); + var n = c.getN(); + var bytes = Math.floor(n.bitLength()/8); + + if(key) + { + if(isPublic) + { + var curve = c.getCurve(); +// var x = key.slice(1,bytes+1); // skip the 04 for uncompressed format +// var y = key.slice(bytes+1); +// this.P = new ECPointFp(curve, +// curve.fromBigInteger(new BigInteger(x.toString("hex"), 16)), +// curve.fromBigInteger(new BigInteger(y.toString("hex"), 16))); + this.P = curve.decodePointHex(key.toString("hex")); + }else{ + if(key.length != bytes) return false; + priv = new BigInteger(key.toString("hex"), 16); + } + }else{ + var n1 = n.subtract(BigInteger.ONE); + var r = new BigInteger(crypto.randomBytes(n.bitLength())); + priv = r.mod(n1).add(BigInteger.ONE); + this.P = c.getG().multiply(priv); + } + if(this.P) + { +// var pubhex = unstupid(this.P.getX().toBigInteger().toString(16),bytes*2)+unstupid(this.P.getY().toBigInteger().toString(16),bytes*2); +// this.PublicKey = Buffer.from("04"+pubhex,"hex"); + this.PublicKey = Buffer.from(c.getCurve().encodeCompressedPointHex(this.P),"hex"); + } + if(priv) + { + this.PrivateKey = Buffer.from(unstupid(priv.toString(16),bytes*2),"hex"); + this.deriveSharedSecret = function(key) + { + if(!key || !key.P) return false; + var S = key.P.multiply(priv); + return Buffer.from(unstupid(S.getX().toBigInteger().toString(16),bytes*2),"hex"); + } + } +} + + /***/ }), -/***/ 784: +/***/ 887: /***/ (function(__unusedmodule, exports, __webpack_require__) { /* @@ -27620,7 +30204,7 @@ exports.fprintf = jsFprintf; * Everything else is currently unsupported, most notably precision, unsigned * numbers, non-decimal numbers, and characters. */ -function jsSprintf(fmt) +function jsSprintf(ofmt) { var regex = [ '([^%]*)', /* normal text */ @@ -27633,18 +30217,43 @@ function jsSprintf(fmt) ].join(''); var re = new RegExp(regex); + + /* variadic arguments used to fill in conversion specifiers */ var args = Array.prototype.slice.call(arguments, 1); + /* remaining format string */ + var fmt = ofmt; + + /* components of the current conversion specifier */ var flags, width, precision, conversion; var left, pad, sign, arg, match; - var ret = ''; - var argn = 1; - mod_assert.equal('string', typeof (fmt)); + /* return value */ + var ret = ''; + + /* current variadic argument (1-based) */ + var argn = 1; + /* 0-based position in the format string that we've read */ + var posn = 0; + /* 1-based position in the format string of the current conversion */ + var convposn; + /* current conversion specifier */ + var curconv; + + mod_assert.equal('string', typeof (fmt), + 'first argument must be a format string'); while ((match = re.exec(fmt)) !== null) { ret += match[1]; fmt = fmt.substring(match[0].length); + /* + * Update flags related to the current conversion specifier's + * position so that we can report clear error messages. + */ + curconv = match[0].substring(match[1].length); + convposn = posn + match[1].length + 1; + posn += match[0].length; + flags = match[2] || ''; width = match[3] || 0; precision = match[4] || ''; @@ -27658,19 +30267,24 @@ function jsSprintf(fmt) continue; } - if (args.length === 0) - throw (new Error('too few args to sprintf')); + if (args.length === 0) { + throw (jsError(ofmt, convposn, curconv, + 'has no matching argument ' + + '(too few arguments passed)')); + } arg = args.shift(); argn++; - if (flags.match(/[\' #]/)) - throw (new Error( - 'unsupported flags: ' + flags)); + if (flags.match(/[\' #]/)) { + throw (jsError(ofmt, convposn, curconv, + 'uses unsupported flags')); + } - if (precision.length > 0) - throw (new Error( - 'non-zero precision not supported')); + if (precision.length > 0) { + throw (jsError(ofmt, convposn, curconv, + 'uses non-zero precision (not supported)')); + } if (flags.match(/-/)) left = true; @@ -27683,10 +30297,12 @@ function jsSprintf(fmt) switch (conversion) { case 's': - if (arg === undefined || arg === null) - throw (new Error('argument ' + argn + - ': attempted to print undefined or null ' + - 'as a string')); + if (arg === undefined || arg === null) { + throw (jsError(ofmt, convposn, curconv, + 'attempted to print undefined or null ' + + 'as a string (argument ' + argn + ' to ' + + 'sprintf)')); + } ret += doPad(pad, width, left, arg.toString()); break; @@ -27714,8 +30330,8 @@ function jsSprintf(fmt) break; default: - throw (new Error('unsupported conversion: ' + - conversion)); + throw (jsError(ofmt, convposn, curconv, + 'is not supported')); } } @@ -27723,6 +30339,16 @@ function jsSprintf(fmt) return (ret); } +function jsError(fmtstr, convposn, curconv, reason) { + mod_assert.equal(typeof (fmtstr), 'string'); + mod_assert.equal(typeof (curconv), 'string'); + mod_assert.equal(typeof (convposn), 'number'); + mod_assert.equal(typeof (reason), 'string'); + return (new Error('format string "' + fmtstr + + '": conversion specifier "' + curconv + '" at character ' + + convposn + ' ' + reason)); +} + function jsPrintf() { var args = Array.prototype.slice.call(arguments); args.unshift(process.stdout); @@ -27775,1357 +30401,904 @@ function dumpException(ex) /***/ }), -/***/ 786: -/***/ (function(__unusedmodule, exports, __webpack_require__) { +/***/ 890: +/***/ (function(module, __unusedexports, __webpack_require__) { "use strict"; -/*eslint no-var:0, prefer-arrow-callback: 0, object-shorthand: 0 */ +var MissingRefError = __webpack_require__(844).MissingRef; -var Punycode = __webpack_require__(213); +module.exports = compileAsync; -var internals = {}; - - -// -// Read rules from file. -// -internals.rules = __webpack_require__(171).map(function (rule) { - - return { - rule: rule, - suffix: rule.replace(/^(\*\.|\!)/, ''), - punySuffix: -1, - wildcard: rule.charAt(0) === '*', - exception: rule.charAt(0) === '!' - }; -}); - - -// -// Check is given string ends with `suffix`. -// -internals.endsWith = function (str, suffix) { - - return str.indexOf(suffix, str.length - suffix.length) !== -1; -}; - - -// -// Find rule for a given domain. -// -internals.findRule = function (domain) { - - var punyDomain = Punycode.toASCII(domain); - return internals.rules.reduce(function (memo, rule) { - - if (rule.punySuffix === -1){ - rule.punySuffix = Punycode.toASCII(rule.suffix); - } - if (!internals.endsWith(punyDomain, '.' + rule.punySuffix) && punyDomain !== rule.punySuffix) { - return memo; - } - // This has been commented out as it never seems to run. This is because - // sub tlds always appear after their parents and we never find a shorter - // match. - //if (memo) { - // var memoSuffix = Punycode.toASCII(memo.suffix); - // if (memoSuffix.length >= punySuffix.length) { - // return memo; - // } - //} - return rule; - }, null); -}; - - -// -// Error codes and messages. -// -exports.errorCodes = { - DOMAIN_TOO_SHORT: 'Domain name too short.', - DOMAIN_TOO_LONG: 'Domain name too long. It should be no more than 255 chars.', - LABEL_STARTS_WITH_DASH: 'Domain name label can not start with a dash.', - LABEL_ENDS_WITH_DASH: 'Domain name label can not end with a dash.', - LABEL_TOO_LONG: 'Domain name label should be at most 63 chars long.', - LABEL_TOO_SHORT: 'Domain name label should be at least 1 character long.', - LABEL_INVALID_CHARS: 'Domain name label can only contain alphanumeric characters or dashes.' -}; - - -// -// Validate domain name and throw if not valid. -// -// From wikipedia: -// -// Hostnames are composed of series of labels concatenated with dots, as are all -// domain names. Each label must be between 1 and 63 characters long, and the -// entire hostname (including the delimiting dots) has a maximum of 255 chars. -// -// Allowed chars: -// -// * `a-z` -// * `0-9` -// * `-` but not as a starting or ending character -// * `.` as a separator for the textual portions of a domain name -// -// * http://en.wikipedia.org/wiki/Domain_name -// * http://en.wikipedia.org/wiki/Hostname -// -internals.validate = function (input) { - - // Before we can validate we need to take care of IDNs with unicode chars. - var ascii = Punycode.toASCII(input); - - if (ascii.length < 1) { - return 'DOMAIN_TOO_SHORT'; - } - if (ascii.length > 255) { - return 'DOMAIN_TOO_LONG'; - } - - // Check each part's length and allowed chars. - var labels = ascii.split('.'); - var label; - - for (var i = 0; i < labels.length; ++i) { - label = labels[i]; - if (!label.length) { - return 'LABEL_TOO_SHORT'; - } - if (label.length > 63) { - return 'LABEL_TOO_LONG'; - } - if (label.charAt(0) === '-') { - return 'LABEL_STARTS_WITH_DASH'; - } - if (label.charAt(label.length - 1) === '-') { - return 'LABEL_ENDS_WITH_DASH'; - } - if (!/^[a-z0-9\-]+$/.test(label)) { - return 'LABEL_INVALID_CHARS'; - } - } -}; - - -// -// Public API -// - - -// -// Parse domain. -// -exports.parse = function (input) { - - if (typeof input !== 'string') { - throw new TypeError('Domain name must be a string.'); - } - - // Force domain to lowercase. - var domain = input.slice(0).toLowerCase(); - - // Handle FQDN. - // TODO: Simply remove trailing dot? - if (domain.charAt(domain.length - 1) === '.') { - domain = domain.slice(0, domain.length - 1); - } - - // Validate and sanitise input. - var error = internals.validate(domain); - if (error) { - return { - input: input, - error: { - message: exports.errorCodes[error], - code: error - } - }; - } - - var parsed = { - input: input, - tld: null, - sld: null, - domain: null, - subdomain: null, - listed: false - }; - - var domainParts = domain.split('.'); - - // Non-Internet TLD - if (domainParts[domainParts.length - 1] === 'local') { - return parsed; - } - - var handlePunycode = function () { - - if (!/xn--/.test(domain)) { - return parsed; - } - if (parsed.domain) { - parsed.domain = Punycode.toASCII(parsed.domain); - } - if (parsed.subdomain) { - parsed.subdomain = Punycode.toASCII(parsed.subdomain); - } - return parsed; - }; - - var rule = internals.findRule(domain); - - // Unlisted tld. - if (!rule) { - if (domainParts.length < 2) { - return parsed; - } - parsed.tld = domainParts.pop(); - parsed.sld = domainParts.pop(); - parsed.domain = [parsed.sld, parsed.tld].join('.'); - if (domainParts.length) { - parsed.subdomain = domainParts.pop(); - } - return handlePunycode(); - } - - // At this point we know the public suffix is listed. - parsed.listed = true; - - var tldParts = rule.suffix.split('.'); - var privateParts = domainParts.slice(0, domainParts.length - tldParts.length); - - if (rule.exception) { - privateParts.push(tldParts.shift()); - } - - parsed.tld = tldParts.join('.'); - - if (!privateParts.length) { - return handlePunycode(); - } - - if (rule.wildcard) { - tldParts.unshift(privateParts.pop()); - parsed.tld = tldParts.join('.'); - } - - if (!privateParts.length) { - return handlePunycode(); - } - - parsed.sld = privateParts.pop(); - parsed.domain = [parsed.sld, parsed.tld].join('.'); - - if (privateParts.length) { - parsed.subdomain = privateParts.join('.'); - } - - return handlePunycode(); -}; - - -// -// Get domain. -// -exports.get = function (domain) { - - if (!domain) { - return null; - } - return exports.parse(domain).domain || null; -}; - - -// -// Check whether domain belongs to a known public suffix. -// -exports.isValid = function (domain) { - - var parsed = exports.parse(domain); - return Boolean(parsed.domain && parsed.listed); -}; - - -/***/ }), - -/***/ 794: -/***/ (function(module) { - -module.exports = {"$id":"cache.json#","$schema":"http://json-schema.org/draft-06/schema#","properties":{"beforeRequest":{"oneOf":[{"type":"null"},{"$ref":"beforeRequest.json#"}]},"afterRequest":{"oneOf":[{"type":"null"},{"$ref":"afterRequest.json#"}]},"comment":{"type":"string"}}}; - -/***/ }), - -/***/ 802: -/***/ (function(__unusedmodule, exports, __webpack_require__) { - -"use strict"; -/*! - * Copyright (c) 2015, Salesforce.com, Inc. - * All rights reserved. - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * - * 1. Redistributions of source code must retain the above copyright notice, - * this list of conditions and the following disclaimer. - * - * 2. Redistributions in binary form must reproduce the above copyright notice, - * this list of conditions and the following disclaimer in the documentation - * and/or other materials provided with the distribution. - * - * 3. Neither the name of Salesforce.com nor the names of its contributors may - * be used to endorse or promote products derived from this software without - * specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE - * LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR - * CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF - * SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS - * INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN - * CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) - * ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE - * POSSIBILITY OF SUCH DAMAGE. +/** + * Creates validating function for passed schema with asynchronous loading of missing schemas. + * `loadSchema` option should be a function that accepts schema uri and returns promise that resolves with the schema. + * @this Ajv + * @param {Object} schema schema object + * @param {Boolean} meta optional true to compile meta-schema; this parameter can be skipped + * @param {Function} callback an optional node-style callback, it is called with 2 parameters: error (or null) and validating function. + * @return {Promise} promise that resolves with a validating function. */ +function compileAsync(schema, meta, callback) { + /* eslint no-shadow: 0 */ + /* global Promise */ + /* jshint validthis: true */ + var self = this; + if (typeof this._opts.loadSchema != 'function') + throw new Error('options.loadSchema should be a function'); -var pubsuffix = __webpack_require__(137); - -// Gives the permutation of all possible domainMatch()es of a given domain. The -// array is in shortest-to-longest order. Handy for indexing. -function permuteDomain (domain) { - var pubSuf = pubsuffix.getPublicSuffix(domain); - if (!pubSuf) { - return null; - } - if (pubSuf == domain) { - return [domain]; + if (typeof meta == 'function') { + callback = meta; + meta = undefined; } - var prefix = domain.slice(0, -(pubSuf.length + 1)); // ".example.com" - var parts = prefix.split('.').reverse(); - var cur = pubSuf; - var permutations = [cur]; - while (parts.length) { - cur = parts.shift() + '.' + cur; - permutations.push(cur); + var p = loadMetaSchemaOf(schema).then(function () { + var schemaObj = self._addSchema(schema, undefined, meta); + return schemaObj.validate || _compileAsync(schemaObj); + }); + + if (callback) { + p.then( + function(v) { callback(null, v); }, + callback + ); } - return permutations; -} -exports.permuteDomain = permuteDomain; + return p; -/***/ }), - -/***/ 804: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -var Key = __webpack_require__(820); -var Fingerprint = __webpack_require__(658); -var Signature = __webpack_require__(719); -var PrivateKey = __webpack_require__(463); -var Certificate = __webpack_require__(219); -var Identity = __webpack_require__(905); -var errs = __webpack_require__(266); - -module.exports = { - /* top-level classes */ - Key: Key, - parseKey: Key.parse, - Fingerprint: Fingerprint, - parseFingerprint: Fingerprint.parse, - Signature: Signature, - parseSignature: Signature.parse, - PrivateKey: PrivateKey, - parsePrivateKey: PrivateKey.parse, - generatePrivateKey: PrivateKey.generate, - Certificate: Certificate, - parseCertificate: Certificate.parse, - createSelfSignedCertificate: Certificate.createSelfSigned, - createCertificate: Certificate.create, - Identity: Identity, - identityFromDN: Identity.parseDN, - identityForHost: Identity.forHost, - identityForUser: Identity.forUser, - identityForEmail: Identity.forEmail, - identityFromArray: Identity.fromArray, - - /* errors */ - FingerprintFormatError: errs.FingerprintFormatError, - InvalidAlgorithmError: errs.InvalidAlgorithmError, - KeyParseError: errs.KeyParseError, - SignatureParseError: errs.SignatureParseError, - KeyEncryptedError: errs.KeyEncryptedError, - CertificateParseError: errs.CertificateParseError -}; - - -/***/ }), - -/***/ 806: -/***/ (function(module) { - -module.exports = {"$schema":"http://json-schema.org/draft-07/schema#","$id":"http://json-schema.org/draft-07/schema#","title":"Core schema meta-schema","definitions":{"schemaArray":{"type":"array","minItems":1,"items":{"$ref":"#"}},"nonNegativeInteger":{"type":"integer","minimum":0},"nonNegativeIntegerDefault0":{"allOf":[{"$ref":"#/definitions/nonNegativeInteger"},{"default":0}]},"simpleTypes":{"enum":["array","boolean","integer","null","number","object","string"]},"stringArray":{"type":"array","items":{"type":"string"},"uniqueItems":true,"default":[]}},"type":["object","boolean"],"properties":{"$id":{"type":"string","format":"uri-reference"},"$schema":{"type":"string","format":"uri"},"$ref":{"type":"string","format":"uri-reference"},"$comment":{"type":"string"},"title":{"type":"string"},"description":{"type":"string"},"default":true,"readOnly":{"type":"boolean","default":false},"examples":{"type":"array","items":true},"multipleOf":{"type":"number","exclusiveMinimum":0},"maximum":{"type":"number"},"exclusiveMaximum":{"type":"number"},"minimum":{"type":"number"},"exclusiveMinimum":{"type":"number"},"maxLength":{"$ref":"#/definitions/nonNegativeInteger"},"minLength":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"pattern":{"type":"string","format":"regex"},"additionalItems":{"$ref":"#"},"items":{"anyOf":[{"$ref":"#"},{"$ref":"#/definitions/schemaArray"}],"default":true},"maxItems":{"$ref":"#/definitions/nonNegativeInteger"},"minItems":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"uniqueItems":{"type":"boolean","default":false},"contains":{"$ref":"#"},"maxProperties":{"$ref":"#/definitions/nonNegativeInteger"},"minProperties":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"required":{"$ref":"#/definitions/stringArray"},"additionalProperties":{"$ref":"#"},"definitions":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"properties":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"patternProperties":{"type":"object","additionalProperties":{"$ref":"#"},"propertyNames":{"format":"regex"},"default":{}},"dependencies":{"type":"object","additionalProperties":{"anyOf":[{"$ref":"#"},{"$ref":"#/definitions/stringArray"}]}},"propertyNames":{"$ref":"#"},"const":true,"enum":{"type":"array","items":true,"minItems":1,"uniqueItems":true},"type":{"anyOf":[{"$ref":"#/definitions/simpleTypes"},{"type":"array","items":{"$ref":"#/definitions/simpleTypes"},"minItems":1,"uniqueItems":true}]},"format":{"type":"string"},"contentMediaType":{"type":"string"},"contentEncoding":{"type":"string"},"if":{"$ref":"#"},"then":{"$ref":"#"},"else":{"$ref":"#"},"allOf":{"$ref":"#/definitions/schemaArray"},"anyOf":{"$ref":"#/definitions/schemaArray"},"oneOf":{"$ref":"#/definitions/schemaArray"},"not":{"$ref":"#"}},"default":true}; - -/***/ }), - -/***/ 812: -/***/ (function(module) { - -function Caseless (dict) { - this.dict = dict || {} -} -Caseless.prototype.set = function (name, value, clobber) { - if (typeof name === 'object') { - for (var i in name) { - this.set(i, name[i], value) - } - } else { - if (typeof clobber === 'undefined') clobber = true - var has = this.has(name) - - if (!clobber && has) this.dict[has] = this.dict[has] + ',' + value - else this.dict[has || name] = value - return has + function loadMetaSchemaOf(sch) { + var $schema = sch.$schema; + return $schema && !self.getSchema($schema) + ? compileAsync.call(self, { $ref: $schema }, true) + : Promise.resolve(); } -} -Caseless.prototype.has = function (name) { - var keys = Object.keys(this.dict) - , name = name.toLowerCase() - ; - for (var i=0;i= 0) error - this.q = q; -} - -function feFpEquals(other) { - if(other == this) return true; - return (this.q.equals(other.q) && this.x.equals(other.x)); -} - -function feFpToBigInteger() { - return this.x; -} - -function feFpNegate() { - return new ECFieldElementFp(this.q, this.x.negate().mod(this.q)); -} - -function feFpAdd(b) { - return new ECFieldElementFp(this.q, this.x.add(b.toBigInteger()).mod(this.q)); -} - -function feFpSubtract(b) { - return new ECFieldElementFp(this.q, this.x.subtract(b.toBigInteger()).mod(this.q)); -} - -function feFpMultiply(b) { - return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger()).mod(this.q)); -} - -function feFpSquare() { - return new ECFieldElementFp(this.q, this.x.square().mod(this.q)); -} - -function feFpDivide(b) { - return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger().modInverse(this.q)).mod(this.q)); -} - -ECFieldElementFp.prototype.equals = feFpEquals; -ECFieldElementFp.prototype.toBigInteger = feFpToBigInteger; -ECFieldElementFp.prototype.negate = feFpNegate; -ECFieldElementFp.prototype.add = feFpAdd; -ECFieldElementFp.prototype.subtract = feFpSubtract; -ECFieldElementFp.prototype.multiply = feFpMultiply; -ECFieldElementFp.prototype.square = feFpSquare; -ECFieldElementFp.prototype.divide = feFpDivide; - -// ---------------- -// ECPointFp - -// constructor -function ECPointFp(curve,x,y,z) { - this.curve = curve; - this.x = x; - this.y = y; - // Projective coordinates: either zinv == null or z * zinv == 1 - // z and zinv are just BigIntegers, not fieldElements - if(z == null) { - this.z = BigInteger.ONE; - } - else { - this.z = z; - } - this.zinv = null; - //TODO: compression flag -} - -function pointFpGetX() { - if(this.zinv == null) { - this.zinv = this.z.modInverse(this.curve.q); - } - var r = this.x.toBigInteger().multiply(this.zinv); - this.curve.reduce(r); - return this.curve.fromBigInteger(r); -} - -function pointFpGetY() { - if(this.zinv == null) { - this.zinv = this.z.modInverse(this.curve.q); - } - var r = this.y.toBigInteger().multiply(this.zinv); - this.curve.reduce(r); - return this.curve.fromBigInteger(r); -} - -function pointFpEquals(other) { - if(other == this) return true; - if(this.isInfinity()) return other.isInfinity(); - if(other.isInfinity()) return this.isInfinity(); - var u, v; - // u = Y2 * Z1 - Y1 * Z2 - u = other.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(other.z)).mod(this.curve.q); - if(!u.equals(BigInteger.ZERO)) return false; - // v = X2 * Z1 - X1 * Z2 - v = other.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(other.z)).mod(this.curve.q); - return v.equals(BigInteger.ZERO); -} - -function pointFpIsInfinity() { - if((this.x == null) && (this.y == null)) return true; - return this.z.equals(BigInteger.ZERO) && !this.y.toBigInteger().equals(BigInteger.ZERO); -} - -function pointFpNegate() { - return new ECPointFp(this.curve, this.x, this.y.negate(), this.z); -} - -function pointFpAdd(b) { - if(this.isInfinity()) return b; - if(b.isInfinity()) return this; - - // u = Y2 * Z1 - Y1 * Z2 - var u = b.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(b.z)).mod(this.curve.q); - // v = X2 * Z1 - X1 * Z2 - var v = b.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(b.z)).mod(this.curve.q); - - if(BigInteger.ZERO.equals(v)) { - if(BigInteger.ZERO.equals(u)) { - return this.twice(); // this == b, so double - } - return this.curve.getInfinity(); // this = -b, so infinity + function _compileAsync(schemaObj) { + try { return self._compile(schemaObj); } + catch(e) { + if (e instanceof MissingRefError) return loadMissingSchema(e); + throw e; } - var THREE = new BigInteger("3"); - var x1 = this.x.toBigInteger(); - var y1 = this.y.toBigInteger(); - var x2 = b.x.toBigInteger(); - var y2 = b.y.toBigInteger(); - var v2 = v.square(); - var v3 = v2.multiply(v); - var x1v2 = x1.multiply(v2); - var zu2 = u.square().multiply(this.z); + function loadMissingSchema(e) { + var ref = e.missingSchema; + if (added(ref)) throw new Error('Schema ' + ref + ' is loaded but ' + e.missingRef + ' cannot be resolved'); - // x3 = v * (z2 * (z1 * u^2 - 2 * x1 * v^2) - v^3) - var x3 = zu2.subtract(x1v2.shiftLeft(1)).multiply(b.z).subtract(v3).multiply(v).mod(this.curve.q); - // y3 = z2 * (3 * x1 * u * v^2 - y1 * v^3 - z1 * u^3) + u * v^3 - var y3 = x1v2.multiply(THREE).multiply(u).subtract(y1.multiply(v3)).subtract(zu2.multiply(u)).multiply(b.z).add(u.multiply(v3)).mod(this.curve.q); - // z3 = v^3 * z1 * z2 - var z3 = v3.multiply(this.z).multiply(b.z).mod(this.curve.q); - - return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); -} - -function pointFpTwice() { - if(this.isInfinity()) return this; - if(this.y.toBigInteger().signum() == 0) return this.curve.getInfinity(); - - // TODO: optimized handling of constants - var THREE = new BigInteger("3"); - var x1 = this.x.toBigInteger(); - var y1 = this.y.toBigInteger(); - - var y1z1 = y1.multiply(this.z); - var y1sqz1 = y1z1.multiply(y1).mod(this.curve.q); - var a = this.curve.a.toBigInteger(); - - // w = 3 * x1^2 + a * z1^2 - var w = x1.square().multiply(THREE); - if(!BigInteger.ZERO.equals(a)) { - w = w.add(this.z.square().multiply(a)); - } - w = w.mod(this.curve.q); - //this.curve.reduce(w); - // x3 = 2 * y1 * z1 * (w^2 - 8 * x1 * y1^2 * z1) - var x3 = w.square().subtract(x1.shiftLeft(3).multiply(y1sqz1)).shiftLeft(1).multiply(y1z1).mod(this.curve.q); - // y3 = 4 * y1^2 * z1 * (3 * w * x1 - 2 * y1^2 * z1) - w^3 - var y3 = w.multiply(THREE).multiply(x1).subtract(y1sqz1.shiftLeft(1)).shiftLeft(2).multiply(y1sqz1).subtract(w.square().multiply(w)).mod(this.curve.q); - // z3 = 8 * (y1 * z1)^3 - var z3 = y1z1.square().multiply(y1z1).shiftLeft(3).mod(this.curve.q); - - return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3); -} - -// Simple NAF (Non-Adjacent Form) multiplication algorithm -// TODO: modularize the multiplication algorithm -function pointFpMultiply(k) { - if(this.isInfinity()) return this; - if(k.signum() == 0) return this.curve.getInfinity(); - - var e = k; - var h = e.multiply(new BigInteger("3")); - - var neg = this.negate(); - var R = this; - - var i; - for(i = h.bitLength() - 2; i > 0; --i) { - R = R.twice(); - - var hBit = h.testBit(i); - var eBit = e.testBit(i); - - if (hBit != eBit) { - R = R.add(hBit ? this : neg); - } - } - - return R; -} - -// Compute this*j + x*k (simultaneous multiplication) -function pointFpMultiplyTwo(j,x,k) { - var i; - if(j.bitLength() > k.bitLength()) - i = j.bitLength() - 1; - else - i = k.bitLength() - 1; - - var R = this.curve.getInfinity(); - var both = this.add(x); - while(i >= 0) { - R = R.twice(); - if(j.testBit(i)) { - if(k.testBit(i)) { - R = R.add(both); + var schemaPromise = self._loadingSchemas[ref]; + if (!schemaPromise) { + schemaPromise = self._loadingSchemas[ref] = self._opts.loadSchema(ref); + schemaPromise.then(removePromise, removePromise); } - else { - R = R.add(this); + + return schemaPromise.then(function (sch) { + if (!added(ref)) { + return loadMetaSchemaOf(sch).then(function () { + if (!added(ref)) self.addSchema(sch, ref, undefined, meta); + }); + } + }).then(function() { + return _compileAsync(schemaObj); + }); + + function removePromise() { + delete self._loadingSchemas[ref]; + } + + function added(ref) { + return self._refs[ref] || self._schemas[ref]; } } - else { - if(k.testBit(i)) { - R = R.add(x); - } - } - --i; } - - return R; } -ECPointFp.prototype.getX = pointFpGetX; -ECPointFp.prototype.getY = pointFpGetY; -ECPointFp.prototype.equals = pointFpEquals; -ECPointFp.prototype.isInfinity = pointFpIsInfinity; -ECPointFp.prototype.negate = pointFpNegate; -ECPointFp.prototype.add = pointFpAdd; -ECPointFp.prototype.twice = pointFpTwice; -ECPointFp.prototype.multiply = pointFpMultiply; -ECPointFp.prototype.multiplyTwo = pointFpMultiplyTwo; - -// ---------------- -// ECCurveFp - -// constructor -function ECCurveFp(q,a,b) { - this.q = q; - this.a = this.fromBigInteger(a); - this.b = this.fromBigInteger(b); - this.infinity = new ECPointFp(this, null, null); - this.reducer = new Barrett(this.q); -} - -function curveFpGetQ() { - return this.q; -} - -function curveFpGetA() { - return this.a; -} - -function curveFpGetB() { - return this.b; -} - -function curveFpEquals(other) { - if(other == this) return true; - return(this.q.equals(other.q) && this.a.equals(other.a) && this.b.equals(other.b)); -} - -function curveFpGetInfinity() { - return this.infinity; -} - -function curveFpFromBigInteger(x) { - return new ECFieldElementFp(this.q, x); -} - -function curveReduce(x) { - this.reducer.reduce(x); -} - -// for now, work with hex strings because they're easier in JS -function curveFpDecodePointHex(s) { - switch(parseInt(s.substr(0,2), 16)) { // first byte - case 0: - return this.infinity; - case 2: - case 3: - // point compression not supported yet - return null; - case 4: - case 6: - case 7: - var len = (s.length - 2) / 2; - var xHex = s.substr(2, len); - var yHex = s.substr(len+2, len); - - return new ECPointFp(this, - this.fromBigInteger(new BigInteger(xHex, 16)), - this.fromBigInteger(new BigInteger(yHex, 16))); - - default: // unsupported - return null; - } -} - -function curveFpEncodePointHex(p) { - if (p.isInfinity()) return "00"; - var xHex = p.getX().toBigInteger().toString(16); - var yHex = p.getY().toBigInteger().toString(16); - var oLen = this.getQ().toString(16).length; - if ((oLen % 2) != 0) oLen++; - while (xHex.length < oLen) { - xHex = "0" + xHex; - } - while (yHex.length < oLen) { - yHex = "0" + yHex; - } - return "04" + xHex + yHex; -} - -ECCurveFp.prototype.getQ = curveFpGetQ; -ECCurveFp.prototype.getA = curveFpGetA; -ECCurveFp.prototype.getB = curveFpGetB; -ECCurveFp.prototype.equals = curveFpEquals; -ECCurveFp.prototype.getInfinity = curveFpGetInfinity; -ECCurveFp.prototype.fromBigInteger = curveFpFromBigInteger; -ECCurveFp.prototype.reduce = curveReduce; -//ECCurveFp.prototype.decodePointHex = curveFpDecodePointHex; -ECCurveFp.prototype.encodePointHex = curveFpEncodePointHex; - -// from: https://github.com/kaielvin/jsbn-ec-point-compression -ECCurveFp.prototype.decodePointHex = function(s) -{ - var yIsEven; - switch(parseInt(s.substr(0,2), 16)) { // first byte - case 0: - return this.infinity; - case 2: - yIsEven = false; - case 3: - if(yIsEven == undefined) yIsEven = true; - var len = s.length - 2; - var xHex = s.substr(2, len); - var x = this.fromBigInteger(new BigInteger(xHex,16)); - var alpha = x.multiply(x.square().add(this.getA())).add(this.getB()); - var beta = alpha.sqrt(); - - if (beta == null) throw "Invalid point compression"; - - var betaValue = beta.toBigInteger(); - if (betaValue.testBit(0) != yIsEven) - { - // Use the other root - beta = this.fromBigInteger(this.getQ().subtract(betaValue)); - } - return new ECPointFp(this,x,beta); - case 4: - case 6: - case 7: - var len = (s.length - 2) / 2; - var xHex = s.substr(2, len); - var yHex = s.substr(len+2, len); - - return new ECPointFp(this, - this.fromBigInteger(new BigInteger(xHex, 16)), - this.fromBigInteger(new BigInteger(yHex, 16))); - - default: // unsupported - return null; - } -} -ECCurveFp.prototype.encodeCompressedPointHex = function(p) -{ - if (p.isInfinity()) return "00"; - var xHex = p.getX().toBigInteger().toString(16); - var oLen = this.getQ().toString(16).length; - if ((oLen % 2) != 0) oLen++; - while (xHex.length < oLen) - xHex = "0" + xHex; - var yPrefix; - if(p.getY().toBigInteger().isEven()) yPrefix = "02"; - else yPrefix = "03"; - - return yPrefix + xHex; -} - - -ECFieldElementFp.prototype.getR = function() -{ - if(this.r != undefined) return this.r; - - this.r = null; - var bitLength = this.q.bitLength(); - if (bitLength > 128) - { - var firstWord = this.q.shiftRight(bitLength - 64); - if (firstWord.intValue() == -1) - { - this.r = BigInteger.ONE.shiftLeft(bitLength).subtract(this.q); - } - } - return this.r; -} -ECFieldElementFp.prototype.modMult = function(x1,x2) -{ - return this.modReduce(x1.multiply(x2)); -} -ECFieldElementFp.prototype.modReduce = function(x) -{ - if (this.getR() != null) - { - var qLen = q.bitLength(); - while (x.bitLength() > (qLen + 1)) - { - var u = x.shiftRight(qLen); - var v = x.subtract(u.shiftLeft(qLen)); - if (!this.getR().equals(BigInteger.ONE)) - { - u = u.multiply(this.getR()); - } - x = u.add(v); - } - while (x.compareTo(q) >= 0) - { - x = x.subtract(q); - } - } - else - { - x = x.mod(q); - } - return x; -} -ECFieldElementFp.prototype.sqrt = function() -{ - if (!this.q.testBit(0)) throw "unsupported"; - - // p mod 4 == 3 - if (this.q.testBit(1)) - { - var z = new ECFieldElementFp(this.q,this.x.modPow(this.q.shiftRight(2).add(BigInteger.ONE),this.q)); - return z.square().equals(this) ? z : null; - } - - // p mod 4 == 1 - var qMinusOne = this.q.subtract(BigInteger.ONE); - - var legendreExponent = qMinusOne.shiftRight(1); - if (!(this.x.modPow(legendreExponent, this.q).equals(BigInteger.ONE))) - { - return null; - } - - var u = qMinusOne.shiftRight(2); - var k = u.shiftLeft(1).add(BigInteger.ONE); - - var Q = this.x; - var fourQ = modDouble(modDouble(Q)); - - var U, V; - do - { - var P; - do - { - P = new BigInteger(this.q.bitLength(), new SecureRandom()); - } - while (P.compareTo(this.q) >= 0 - || !(P.multiply(P).subtract(fourQ).modPow(legendreExponent, this.q).equals(qMinusOne))); - - var result = this.lucasSequence(P, Q, k); - U = result[0]; - V = result[1]; - - if (this.modMult(V, V).equals(fourQ)) - { - // Integer division by 2, mod q - if (V.testBit(0)) - { - V = V.add(q); - } - - V = V.shiftRight(1); - - return new ECFieldElementFp(q,V); - } - } - while (U.equals(BigInteger.ONE) || U.equals(qMinusOne)); - - return null; -} -ECFieldElementFp.prototype.lucasSequence = function(P,Q,k) -{ - var n = k.bitLength(); - var s = k.getLowestSetBit(); - - var Uh = BigInteger.ONE; - var Vl = BigInteger.TWO; - var Vh = P; - var Ql = BigInteger.ONE; - var Qh = BigInteger.ONE; - - for (var j = n - 1; j >= s + 1; --j) - { - Ql = this.modMult(Ql, Qh); - - if (k.testBit(j)) - { - Qh = this.modMult(Ql, Q); - Uh = this.modMult(Uh, Vh); - Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); - Vh = this.modReduce(Vh.multiply(Vh).subtract(Qh.shiftLeft(1))); - } - else - { - Qh = Ql; - Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); - Vh = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); - Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); - } - } - - Ql = this.modMult(Ql, Qh); - Qh = this.modMult(Ql, Q); - Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql)); - Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql))); - Ql = this.modMult(Ql, Qh); - - for (var j = 1; j <= s; ++j) - { - Uh = this.modMult(Uh, Vl); - Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1))); - Ql = this.modMult(Ql, Ql); - } - - return [ Uh, Vl ]; -} - -var exports = { - ECCurveFp: ECCurveFp, - ECPointFp: ECPointFp, - ECFieldElementFp: ECFieldElementFp -} - -module.exports = exports - /***/ }), -/***/ 820: +/***/ 892: /***/ (function(module, __unusedexports, __webpack_require__) { -// Copyright 2018 Joyent, Inc. +var iterate = __webpack_require__(157) + , initState = __webpack_require__(147) + , terminator = __webpack_require__(939) + ; -module.exports = Key; +// Public API +module.exports = serialOrdered; +// sorting helpers +module.exports.ascending = ascending; +module.exports.descending = descending; -var assert = __webpack_require__(283); -var algs = __webpack_require__(936); -var crypto = __webpack_require__(417); -var Fingerprint = __webpack_require__(658); -var Signature = __webpack_require__(719); -var DiffieHellman = __webpack_require__(472).DiffieHellman; -var errs = __webpack_require__(266); -var utils = __webpack_require__(757); -var PrivateKey = __webpack_require__(463); -var edCompat; +/** + * Runs iterator over provided sorted array elements in series + * + * @param {array|object} list - array or object (named list) to iterate over + * @param {function} iterator - iterator to run + * @param {function} sortMethod - custom sort function + * @param {function} callback - invoked when all elements processed + * @returns {function} - jobs terminator + */ +function serialOrdered(list, iterator, sortMethod, callback) +{ + var state = initState(list, sortMethod); -try { - edCompat = __webpack_require__(73); -} catch (e) { - /* Just continue through, and bail out if we try to use it. */ + iterate(list, iterator, state, function iteratorHandler(error, result) + { + if (error) + { + callback(error, result); + return; + } + + state.index++; + + // are we there yet? + if (state.index < (state['keyedList'] || list).length) + { + iterate(list, iterator, state, iteratorHandler); + return; + } + + // done here + callback(null, state.results); + }); + + return terminator.bind(state, callback); } -var InvalidAlgorithmError = errs.InvalidAlgorithmError; -var KeyParseError = errs.KeyParseError; - -var formats = {}; -formats['auto'] = __webpack_require__(737); -formats['pem'] = __webpack_require__(502); -formats['pkcs1'] = __webpack_require__(39); -formats['pkcs8'] = __webpack_require__(274); -formats['rfc4253'] = __webpack_require__(533); -formats['ssh'] = __webpack_require__(33); -formats['ssh-private'] = __webpack_require__(269); -formats['openssh'] = formats['ssh-private']; -formats['dnssec'] = __webpack_require__(554); -formats['putty'] = __webpack_require__(777); -formats['ppk'] = formats['putty']; - -function Key(opts) { - assert.object(opts, 'options'); - assert.arrayOfObject(opts.parts, 'options.parts'); - assert.string(opts.type, 'options.type'); - assert.optionalString(opts.comment, 'options.comment'); - - var algInfo = algs.info[opts.type]; - if (typeof (algInfo) !== 'object') - throw (new InvalidAlgorithmError(opts.type)); - - var partLookup = {}; - for (var i = 0; i < opts.parts.length; ++i) { - var part = opts.parts[i]; - partLookup[part.name] = part; - } - - this.type = opts.type; - this.parts = opts.parts; - this.part = partLookup; - this.comment = undefined; - this.source = opts.source; - - /* for speeding up hashing/fingerprint operations */ - this._rfc4253Cache = opts._rfc4253Cache; - this._hashCache = {}; - - var sz; - this.curve = undefined; - if (this.type === 'ecdsa') { - var curve = this.part.curve.data.toString(); - this.curve = curve; - sz = algs.curves[curve].size; - } else if (this.type === 'ed25519' || this.type === 'curve25519') { - sz = 256; - this.curve = 'curve25519'; - } else { - var szPart = this.part[algInfo.sizePart]; - sz = szPart.data.length; - sz = sz * 8 - utils.countZeros(szPart.data); - } - this.size = sz; -} - -Key.formats = formats; - -Key.prototype.toBuffer = function (format, options) { - if (format === undefined) - format = 'ssh'; - assert.string(format, 'format'); - assert.object(formats[format], 'formats[format]'); - assert.optionalObject(options, 'options'); - - if (format === 'rfc4253') { - if (this._rfc4253Cache === undefined) - this._rfc4253Cache = formats['rfc4253'].write(this); - return (this._rfc4253Cache); - } - - return (formats[format].write(this, options)); -}; - -Key.prototype.toString = function (format, options) { - return (this.toBuffer(format, options).toString()); -}; - -Key.prototype.hash = function (algo, type) { - assert.string(algo, 'algorithm'); - assert.optionalString(type, 'type'); - if (type === undefined) - type = 'ssh'; - algo = algo.toLowerCase(); - if (algs.hashAlgs[algo] === undefined) - throw (new InvalidAlgorithmError(algo)); - - var cacheKey = algo + '||' + type; - if (this._hashCache[cacheKey]) - return (this._hashCache[cacheKey]); - - var buf; - if (type === 'ssh') { - buf = this.toBuffer('rfc4253'); - } else if (type === 'spki') { - buf = formats.pkcs8.pkcs8ToBuffer(this); - } else { - throw (new Error('Hash type ' + type + ' not supported')); - } - var hash = crypto.createHash(algo).update(buf).digest(); - this._hashCache[cacheKey] = hash; - return (hash); -}; - -Key.prototype.fingerprint = function (algo, type) { - if (algo === undefined) - algo = 'sha256'; - if (type === undefined) - type = 'ssh'; - assert.string(algo, 'algorithm'); - assert.string(type, 'type'); - var opts = { - type: 'key', - hash: this.hash(algo, type), - algorithm: algo, - hashType: type - }; - return (new Fingerprint(opts)); -}; - -Key.prototype.defaultHashAlgorithm = function () { - var hashAlgo = 'sha1'; - if (this.type === 'rsa') - hashAlgo = 'sha256'; - if (this.type === 'dsa' && this.size > 1024) - hashAlgo = 'sha256'; - if (this.type === 'ed25519') - hashAlgo = 'sha512'; - if (this.type === 'ecdsa') { - if (this.size <= 256) - hashAlgo = 'sha256'; - else if (this.size <= 384) - hashAlgo = 'sha384'; - else - hashAlgo = 'sha512'; - } - return (hashAlgo); -}; - -Key.prototype.createVerify = function (hashAlgo) { - if (hashAlgo === undefined) - hashAlgo = this.defaultHashAlgorithm(); - assert.string(hashAlgo, 'hash algorithm'); - - /* ED25519 is not supported by OpenSSL, use a javascript impl. */ - if (this.type === 'ed25519' && edCompat !== undefined) - return (new edCompat.Verifier(this, hashAlgo)); - if (this.type === 'curve25519') - throw (new Error('Curve25519 keys are not suitable for ' + - 'signing or verification')); - - var v, nm, err; - try { - nm = hashAlgo.toUpperCase(); - v = crypto.createVerify(nm); - } catch (e) { - err = e; - } - if (v === undefined || (err instanceof Error && - err.message.match(/Unknown message digest/))) { - nm = 'RSA-'; - nm += hashAlgo.toUpperCase(); - v = crypto.createVerify(nm); - } - assert.ok(v, 'failed to create verifier'); - var oldVerify = v.verify.bind(v); - var key = this.toBuffer('pkcs8'); - var curve = this.curve; - var self = this; - v.verify = function (signature, fmt) { - if (Signature.isSignature(signature, [2, 0])) { - if (signature.type !== self.type) - return (false); - if (signature.hashAlgorithm && - signature.hashAlgorithm !== hashAlgo) - return (false); - if (signature.curve && self.type === 'ecdsa' && - signature.curve !== curve) - return (false); - return (oldVerify(key, signature.toBuffer('asn1'))); - - } else if (typeof (signature) === 'string' || - Buffer.isBuffer(signature)) { - return (oldVerify(key, signature, fmt)); - - /* - * Avoid doing this on valid arguments, walking the prototype - * chain can be quite slow. - */ - } else if (Signature.isSignature(signature, [1, 0])) { - throw (new Error('signature was created by too old ' + - 'a version of sshpk and cannot be verified')); - - } else { - throw (new TypeError('signature must be a string, ' + - 'Buffer, or Signature object')); - } - }; - return (v); -}; - -Key.prototype.createDiffieHellman = function () { - if (this.type === 'rsa') - throw (new Error('RSA keys do not support Diffie-Hellman')); - - return (new DiffieHellman(this)); -}; -Key.prototype.createDH = Key.prototype.createDiffieHellman; - -Key.parse = function (data, format, options) { - if (typeof (data) !== 'string') - assert.buffer(data, 'data'); - if (format === undefined) - format = 'auto'; - assert.string(format, 'format'); - if (typeof (options) === 'string') - options = { filename: options }; - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalString(options.filename, 'options.filename'); - if (options.filename === undefined) - options.filename = '(unnamed)'; - - assert.object(formats[format], 'formats[format]'); - - try { - var k = formats[format].read(data, options); - if (k instanceof PrivateKey) - k = k.toPublic(); - if (!k.comment) - k.comment = options.filename; - return (k); - } catch (e) { - if (e.name === 'KeyEncryptedError') - throw (e); - throw (new KeyParseError(options.filename, format, e)); - } -}; - -Key.isKey = function (obj, ver) { - return (utils.isCompatible(obj, Key, ver)); -}; - /* - * API versions for Key: - * [1,0] -- initial ver, may take Signature for createVerify or may not - * [1,1] -- added pkcs1, pkcs8 formats - * [1,2] -- added auto, ssh-private, openssh formats - * [1,3] -- added defaultHashAlgorithm - * [1,4] -- added ed support, createDH - * [1,5] -- first explicitly tagged version - * [1,6] -- changed ed25519 part names - * [1,7] -- spki hash types + * -- Sort methods */ -Key.prototype._sshpkApiVersion = [1, 7]; -Key._oldVersionDetect = function (obj) { - assert.func(obj.toBuffer); - assert.func(obj.fingerprint); - if (obj.createDH) - return ([1, 4]); - if (obj.defaultHashAlgorithm) - return ([1, 3]); - if (obj.formats['auto']) - return ([1, 2]); - if (obj.formats['pkcs1']) - return ([1, 1]); - return ([1, 0]); +/** + * sort helper to sort array elements in ascending order + * + * @param {mixed} a - an item to compare + * @param {mixed} b - an item to compare + * @returns {number} - comparison result + */ +function ascending(a, b) +{ + return a < b ? -1 : a > b ? 1 : 0; +} + +/** + * sort helper to sort array elements in descending order + * + * @param {mixed} a - an item to compare + * @param {mixed} b - an item to compare + * @returns {number} - comparison result + */ +function descending(a, b) +{ + return -1 * ascending(a, b); +} + + +/***/ }), + +/***/ 893: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2017 Joyent, Inc. + +module.exports = { + read: read, + verify: verify, + sign: sign, + signAsync: signAsync, + write: write, + + /* Internal private API */ + fromBuffer: fromBuffer, + toBuffer: toBuffer +}; + +var assert = __webpack_require__(477); +var SSHBuffer = __webpack_require__(940); +var crypto = __webpack_require__(417); +var Buffer = __webpack_require__(215).Buffer; +var algs = __webpack_require__(98); +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var Identity = __webpack_require__(378); +var rfc4253 = __webpack_require__(538); +var Signature = __webpack_require__(575); +var utils = __webpack_require__(270); +var Certificate = __webpack_require__(752); + +function verify(cert, key) { + /* + * We always give an issuerKey, so if our verify() is being called then + * there was no signature. Return false. + */ + return (false); +} + +var TYPES = { + 'user': 1, + 'host': 2 +}; +Object.keys(TYPES).forEach(function (k) { TYPES[TYPES[k]] = k; }); + +var ECDSA_ALGO = /^ecdsa-sha2-([^@-]+)-cert-v01@openssh.com$/; + +function read(buf, options) { + if (Buffer.isBuffer(buf)) + buf = buf.toString('ascii'); + var parts = buf.trim().split(/[ \t\n]+/g); + if (parts.length < 2 || parts.length > 3) + throw (new Error('Not a valid SSH certificate line')); + + var algo = parts[0]; + var data = parts[1]; + + data = Buffer.from(data, 'base64'); + return (fromBuffer(data, algo)); +} + +function fromBuffer(data, algo, partial) { + var sshbuf = new SSHBuffer({ buffer: data }); + var innerAlgo = sshbuf.readString(); + if (algo !== undefined && innerAlgo !== algo) + throw (new Error('SSH certificate algorithm mismatch')); + if (algo === undefined) + algo = innerAlgo; + + var cert = {}; + cert.signatures = {}; + cert.signatures.openssh = {}; + + cert.signatures.openssh.nonce = sshbuf.readBuffer(); + + var key = {}; + var parts = (key.parts = []); + key.type = getAlg(algo); + + var partCount = algs.info[key.type].parts.length; + while (parts.length < partCount) + parts.push(sshbuf.readPart()); + assert.ok(parts.length >= 1, 'key must have at least one part'); + + var algInfo = algs.info[key.type]; + if (key.type === 'ecdsa') { + var res = ECDSA_ALGO.exec(algo); + assert.ok(res !== null); + assert.strictEqual(res[1], parts[0].data.toString()); + } + + for (var i = 0; i < algInfo.parts.length; ++i) { + parts[i].name = algInfo.parts[i]; + if (parts[i].name !== 'curve' && + algInfo.normalize !== false) { + var p = parts[i]; + p.data = utils.mpNormalize(p.data); + } + } + + cert.subjectKey = new Key(key); + + cert.serial = sshbuf.readInt64(); + + var type = TYPES[sshbuf.readInt()]; + assert.string(type, 'valid cert type'); + + cert.signatures.openssh.keyId = sshbuf.readString(); + + var principals = []; + var pbuf = sshbuf.readBuffer(); + var psshbuf = new SSHBuffer({ buffer: pbuf }); + while (!psshbuf.atEnd()) + principals.push(psshbuf.readString()); + if (principals.length === 0) + principals = ['*']; + + cert.subjects = principals.map(function (pr) { + if (type === 'user') + return (Identity.forUser(pr)); + else if (type === 'host') + return (Identity.forHost(pr)); + throw (new Error('Unknown identity type ' + type)); + }); + + cert.validFrom = int64ToDate(sshbuf.readInt64()); + cert.validUntil = int64ToDate(sshbuf.readInt64()); + + var exts = []; + var extbuf = new SSHBuffer({ buffer: sshbuf.readBuffer() }); + var ext; + while (!extbuf.atEnd()) { + ext = { critical: true }; + ext.name = extbuf.readString(); + ext.data = extbuf.readBuffer(); + exts.push(ext); + } + extbuf = new SSHBuffer({ buffer: sshbuf.readBuffer() }); + while (!extbuf.atEnd()) { + ext = { critical: false }; + ext.name = extbuf.readString(); + ext.data = extbuf.readBuffer(); + exts.push(ext); + } + cert.signatures.openssh.exts = exts; + + /* reserved */ + sshbuf.readBuffer(); + + var signingKeyBuf = sshbuf.readBuffer(); + cert.issuerKey = rfc4253.read(signingKeyBuf); + + /* + * OpenSSH certs don't give the identity of the issuer, just their + * public key. So, we use an Identity that matches anything. The + * isSignedBy() function will later tell you if the key matches. + */ + cert.issuer = Identity.forHost('**'); + + var sigBuf = sshbuf.readBuffer(); + cert.signatures.openssh.signature = + Signature.parse(sigBuf, cert.issuerKey.type, 'ssh'); + + if (partial !== undefined) { + partial.remainder = sshbuf.remainder(); + partial.consumed = sshbuf._offset; + } + + return (new Certificate(cert)); +} + +function int64ToDate(buf) { + var i = buf.readUInt32BE(0) * 4294967296; + i += buf.readUInt32BE(4); + var d = new Date(); + d.setTime(i * 1000); + d.sourceInt64 = buf; + return (d); +} + +function dateToInt64(date) { + if (date.sourceInt64 !== undefined) + return (date.sourceInt64); + var i = Math.round(date.getTime() / 1000); + var upper = Math.floor(i / 4294967296); + var lower = Math.floor(i % 4294967296); + var buf = Buffer.alloc(8); + buf.writeUInt32BE(upper, 0); + buf.writeUInt32BE(lower, 4); + return (buf); +} + +function sign(cert, key) { + if (cert.signatures.openssh === undefined) + cert.signatures.openssh = {}; + try { + var blob = toBuffer(cert, true); + } catch (e) { + delete (cert.signatures.openssh); + return (false); + } + var sig = cert.signatures.openssh; + var hashAlgo = undefined; + if (key.type === 'rsa' || key.type === 'dsa') + hashAlgo = 'sha1'; + var signer = key.createSign(hashAlgo); + signer.write(blob); + sig.signature = signer.sign(); + return (true); +} + +function signAsync(cert, signer, done) { + if (cert.signatures.openssh === undefined) + cert.signatures.openssh = {}; + try { + var blob = toBuffer(cert, true); + } catch (e) { + delete (cert.signatures.openssh); + done(e); + return; + } + var sig = cert.signatures.openssh; + + signer(blob, function (err, signature) { + if (err) { + done(err); + return; + } + try { + /* + * This will throw if the signature isn't of a + * type/algo that can be used for SSH. + */ + signature.toBuffer('ssh'); + } catch (e) { + done(e); + return; + } + sig.signature = signature; + done(); + }); +} + +function write(cert, options) { + if (options === undefined) + options = {}; + + var blob = toBuffer(cert); + var out = getCertType(cert.subjectKey) + ' ' + blob.toString('base64'); + if (options.comment) + out = out + ' ' + options.comment; + return (out); +} + + +function toBuffer(cert, noSig) { + assert.object(cert.signatures.openssh, 'signature for openssh format'); + var sig = cert.signatures.openssh; + + if (sig.nonce === undefined) + sig.nonce = crypto.randomBytes(16); + var buf = new SSHBuffer({}); + buf.writeString(getCertType(cert.subjectKey)); + buf.writeBuffer(sig.nonce); + + var key = cert.subjectKey; + var algInfo = algs.info[key.type]; + algInfo.parts.forEach(function (part) { + buf.writePart(key.part[part]); + }); + + buf.writeInt64(cert.serial); + + var type = cert.subjects[0].type; + assert.notStrictEqual(type, 'unknown'); + cert.subjects.forEach(function (id) { + assert.strictEqual(id.type, type); + }); + type = TYPES[type]; + buf.writeInt(type); + + if (sig.keyId === undefined) { + sig.keyId = cert.subjects[0].type + '_' + + (cert.subjects[0].uid || cert.subjects[0].hostname); + } + buf.writeString(sig.keyId); + + var sub = new SSHBuffer({}); + cert.subjects.forEach(function (id) { + if (type === TYPES.host) + sub.writeString(id.hostname); + else if (type === TYPES.user) + sub.writeString(id.uid); + }); + buf.writeBuffer(sub.toBuffer()); + + buf.writeInt64(dateToInt64(cert.validFrom)); + buf.writeInt64(dateToInt64(cert.validUntil)); + + var exts = sig.exts; + if (exts === undefined) + exts = []; + + var extbuf = new SSHBuffer({}); + exts.forEach(function (ext) { + if (ext.critical !== true) + return; + extbuf.writeString(ext.name); + extbuf.writeBuffer(ext.data); + }); + buf.writeBuffer(extbuf.toBuffer()); + + extbuf = new SSHBuffer({}); + exts.forEach(function (ext) { + if (ext.critical === true) + return; + extbuf.writeString(ext.name); + extbuf.writeBuffer(ext.data); + }); + buf.writeBuffer(extbuf.toBuffer()); + + /* reserved */ + buf.writeBuffer(Buffer.alloc(0)); + + sub = rfc4253.write(cert.issuerKey); + buf.writeBuffer(sub); + + if (!noSig) + buf.writeBuffer(sig.signature.toBuffer('ssh')); + + return (buf.toBuffer()); +} + +function getAlg(certType) { + if (certType === 'ssh-rsa-cert-v01@openssh.com') + return ('rsa'); + if (certType === 'ssh-dss-cert-v01@openssh.com') + return ('dsa'); + if (certType.match(ECDSA_ALGO)) + return ('ecdsa'); + if (certType === 'ssh-ed25519-cert-v01@openssh.com') + return ('ed25519'); + throw (new Error('Unsupported cert type ' + certType)); +} + +function getCertType(key) { + if (key.type === 'rsa') + return ('ssh-rsa-cert-v01@openssh.com'); + if (key.type === 'dsa') + return ('ssh-dss-cert-v01@openssh.com'); + if (key.type === 'ecdsa') + return ('ecdsa-sha2-' + key.curve + '-cert-v01@openssh.com'); + if (key.type === 'ed25519') + return ('ssh-ed25519-cert-v01@openssh.com'); + throw (new Error('Unsupported key type ' + key.type)); +} + + +/***/ }), + +/***/ 894: +/***/ (function(module, __unusedexports, __webpack_require__) { + +"use strict"; + + +//all requires must be explicit because browserify won't work with dynamic requires +module.exports = { + '$ref': __webpack_require__(266), + allOf: __webpack_require__(107), + anyOf: __webpack_require__(902), + '$comment': __webpack_require__(28), + const: __webpack_require__(662), + contains: __webpack_require__(154), + dependencies: __webpack_require__(233), + 'enum': __webpack_require__(281), + format: __webpack_require__(687), + 'if': __webpack_require__(479), + items: __webpack_require__(643), + maximum: __webpack_require__(341), + minimum: __webpack_require__(341), + maxItems: __webpack_require__(85), + minItems: __webpack_require__(85), + maxLength: __webpack_require__(772), + minLength: __webpack_require__(772), + maxProperties: __webpack_require__(560), + minProperties: __webpack_require__(560), + multipleOf: __webpack_require__(397), + not: __webpack_require__(673), + oneOf: __webpack_require__(653), + pattern: __webpack_require__(542), + properties: __webpack_require__(343), + propertyNames: __webpack_require__(35), + required: __webpack_require__(858), + uniqueItems: __webpack_require__(899), + validate: __webpack_require__(967) }; /***/ }), -/***/ 825: +/***/ 897: +/***/ (function(module, __unusedexports, __webpack_require__) { + +"use strict"; + + +var utils = __webpack_require__(581); +var formats = __webpack_require__(13); + +var arrayPrefixGenerators = { + brackets: function brackets(prefix) { // eslint-disable-line func-name-matching + return prefix + '[]'; + }, + indices: function indices(prefix, key) { // eslint-disable-line func-name-matching + return prefix + '[' + key + ']'; + }, + repeat: function repeat(prefix) { // eslint-disable-line func-name-matching + return prefix; + } +}; + +var toISO = Date.prototype.toISOString; + +var defaults = { + delimiter: '&', + encode: true, + encoder: utils.encode, + encodeValuesOnly: false, + serializeDate: function serializeDate(date) { // eslint-disable-line func-name-matching + return toISO.call(date); + }, + skipNulls: false, + strictNullHandling: false +}; + +var stringify = function stringify( // eslint-disable-line func-name-matching + object, + prefix, + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly +) { + var obj = object; + if (typeof filter === 'function') { + obj = filter(prefix, obj); + } else if (obj instanceof Date) { + obj = serializeDate(obj); + } else if (obj === null) { + if (strictNullHandling) { + return encoder && !encodeValuesOnly ? encoder(prefix, defaults.encoder) : prefix; + } + + obj = ''; + } + + if (typeof obj === 'string' || typeof obj === 'number' || typeof obj === 'boolean' || utils.isBuffer(obj)) { + if (encoder) { + var keyValue = encodeValuesOnly ? prefix : encoder(prefix, defaults.encoder); + return [formatter(keyValue) + '=' + formatter(encoder(obj, defaults.encoder))]; + } + return [formatter(prefix) + '=' + formatter(String(obj))]; + } + + var values = []; + + if (typeof obj === 'undefined') { + return values; + } + + var objKeys; + if (Array.isArray(filter)) { + objKeys = filter; + } else { + var keys = Object.keys(obj); + objKeys = sort ? keys.sort(sort) : keys; + } + + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + + if (skipNulls && obj[key] === null) { + continue; + } + + if (Array.isArray(obj)) { + values = values.concat(stringify( + obj[key], + generateArrayPrefix(prefix, key), + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly + )); + } else { + values = values.concat(stringify( + obj[key], + prefix + (allowDots ? '.' + key : '[' + key + ']'), + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly + )); + } + } + + return values; +}; + +module.exports = function (object, opts) { + var obj = object; + var options = opts ? utils.assign({}, opts) : {}; + + if (options.encoder !== null && options.encoder !== undefined && typeof options.encoder !== 'function') { + throw new TypeError('Encoder has to be a function.'); + } + + var delimiter = typeof options.delimiter === 'undefined' ? defaults.delimiter : options.delimiter; + var strictNullHandling = typeof options.strictNullHandling === 'boolean' ? options.strictNullHandling : defaults.strictNullHandling; + var skipNulls = typeof options.skipNulls === 'boolean' ? options.skipNulls : defaults.skipNulls; + var encode = typeof options.encode === 'boolean' ? options.encode : defaults.encode; + var encoder = typeof options.encoder === 'function' ? options.encoder : defaults.encoder; + var sort = typeof options.sort === 'function' ? options.sort : null; + var allowDots = typeof options.allowDots === 'undefined' ? false : options.allowDots; + var serializeDate = typeof options.serializeDate === 'function' ? options.serializeDate : defaults.serializeDate; + var encodeValuesOnly = typeof options.encodeValuesOnly === 'boolean' ? options.encodeValuesOnly : defaults.encodeValuesOnly; + if (typeof options.format === 'undefined') { + options.format = formats['default']; + } else if (!Object.prototype.hasOwnProperty.call(formats.formatters, options.format)) { + throw new TypeError('Unknown format option provided.'); + } + var formatter = formats.formatters[options.format]; + var objKeys; + var filter; + + if (typeof options.filter === 'function') { + filter = options.filter; + obj = filter('', obj); + } else if (Array.isArray(options.filter)) { + filter = options.filter; + objKeys = filter; + } + + var keys = []; + + if (typeof obj !== 'object' || obj === null) { + return ''; + } + + var arrayFormat; + if (options.arrayFormat in arrayPrefixGenerators) { + arrayFormat = options.arrayFormat; + } else if ('indices' in options) { + arrayFormat = options.indices ? 'indices' : 'repeat'; + } else { + arrayFormat = 'indices'; + } + + var generateArrayPrefix = arrayPrefixGenerators[arrayFormat]; + + if (!objKeys) { + objKeys = Object.keys(obj); + } + + if (sort) { + objKeys.sort(sort); + } + + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + + if (skipNulls && obj[key] === null) { + continue; + } + + keys = keys.concat(stringify( + obj[key], + key, + generateArrayPrefix, + strictNullHandling, + skipNulls, + encode ? encoder : null, + filter, + sort, + allowDots, + serializeDate, + formatter, + encodeValuesOnly + )); + } + + var joined = keys.join(delimiter); + var prefix = options.addQueryPrefix === true ? '?' : ''; + + return joined.length > 0 ? prefix + joined : ''; +}; + + +/***/ }), + +/***/ 899: /***/ (function(module) { "use strict"; -module.exports = function generate_if(it, $keyword, $ruleType) { +module.exports = function generate_uniqueItems(it, $keyword, $ruleType) { + var out = ' '; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + var $isData = it.opts.$data && $schema && $schema.$data, + $schemaValue; + if ($isData) { + out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; + $schemaValue = 'schema' + $lvl; + } else { + $schemaValue = $schema; + } + if (($schema || $isData) && it.opts.uniqueItems !== false) { + if ($isData) { + out += ' var ' + ($valid) + '; if (' + ($schemaValue) + ' === false || ' + ($schemaValue) + ' === undefined) ' + ($valid) + ' = true; else if (typeof ' + ($schemaValue) + ' != \'boolean\') ' + ($valid) + ' = false; else { '; + } + out += ' var i = ' + ($data) + '.length , ' + ($valid) + ' = true , j; if (i > 1) { '; + var $itemType = it.schema.items && it.schema.items.type, + $typeIsArray = Array.isArray($itemType); + if (!$itemType || $itemType == 'object' || $itemType == 'array' || ($typeIsArray && ($itemType.indexOf('object') >= 0 || $itemType.indexOf('array') >= 0))) { + out += ' outer: for (;i--;) { for (j = i; j--;) { if (equal(' + ($data) + '[i], ' + ($data) + '[j])) { ' + ($valid) + ' = false; break outer; } } } '; + } else { + out += ' var itemIndices = {}, item; for (;i--;) { var item = ' + ($data) + '[i]; '; + var $method = 'checkDataType' + ($typeIsArray ? 's' : ''); + out += ' if (' + (it.util[$method]($itemType, 'item', true)) + ') continue; '; + if ($typeIsArray) { + out += ' if (typeof item == \'string\') item = \'"\' + item; '; + } + out += ' if (typeof itemIndices[item] == \'number\') { ' + ($valid) + ' = false; j = itemIndices[item]; break; } itemIndices[item] = i; } '; + } + out += ' } '; + if ($isData) { + out += ' } '; + } + out += ' if (!' + ($valid) + ') { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ('uniqueItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { i: i, j: j } '; + if (it.opts.messages !== false) { + out += ' , message: \'should NOT have duplicate items (items ## \' + j + \' and \' + i + \' are identical)\' '; + } + if (it.opts.verbose) { + out += ' , schema: '; + if ($isData) { + out += 'validate.schema' + ($schemaPath); + } else { + out += '' + ($schema); + } + out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } '; + if ($breakOnError) { + out += ' else { '; + } + } else { + if ($breakOnError) { + out += ' if (true) { '; + } + } + return out; +} + + +/***/ }), + +/***/ 902: +/***/ (function(module) { + +"use strict"; + +module.exports = function generate_anyOf(it, $keyword, $ruleType) { var out = ' '; var $lvl = it.level; var $dataLvl = it.dataLevel; @@ -29137,68 +31310,38 @@ module.exports = function generate_if(it, $keyword, $ruleType) { var $valid = 'valid' + $lvl; var $errs = 'errs__' + $lvl; var $it = it.util.copy(it); + var $closingBraces = ''; $it.level++; var $nextValid = 'valid' + $it.level; - var $thenSch = it.schema['then'], - $elseSch = it.schema['else'], - $thenPresent = $thenSch !== undefined && (it.opts.strictKeywords ? typeof $thenSch == 'object' && Object.keys($thenSch).length > 0 : it.util.schemaHasRules($thenSch, it.RULES.all)), - $elsePresent = $elseSch !== undefined && (it.opts.strictKeywords ? typeof $elseSch == 'object' && Object.keys($elseSch).length > 0 : it.util.schemaHasRules($elseSch, it.RULES.all)), - $currentBaseId = $it.baseId; - if ($thenPresent || $elsePresent) { - var $ifClause; - $it.createErrors = false; - $it.schema = $schema; - $it.schemaPath = $schemaPath; - $it.errSchemaPath = $errSchemaPath; - out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = true; '; + var $noEmptySchema = $schema.every(function($sch) { + return (it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all)); + }); + if ($noEmptySchema) { + var $currentBaseId = $it.baseId; + out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = false; '; var $wasComposite = it.compositeRule; it.compositeRule = $it.compositeRule = true; - out += ' ' + (it.validate($it)) + ' '; - $it.baseId = $currentBaseId; - $it.createErrors = true; - out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; + var arr1 = $schema; + if (arr1) { + var $sch, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $sch = arr1[$i += 1]; + $it.schema = $sch; + $it.schemaPath = $schemaPath + '[' + $i + ']'; + $it.errSchemaPath = $errSchemaPath + '/' + $i; + out += ' ' + (it.validate($it)) + ' '; + $it.baseId = $currentBaseId; + out += ' ' + ($valid) + ' = ' + ($valid) + ' || ' + ($nextValid) + '; if (!' + ($valid) + ') { '; + $closingBraces += '}'; + } + } it.compositeRule = $it.compositeRule = $wasComposite; - if ($thenPresent) { - out += ' if (' + ($nextValid) + ') { '; - $it.schema = it.schema['then']; - $it.schemaPath = it.schemaPath + '.then'; - $it.errSchemaPath = it.errSchemaPath + '/then'; - out += ' ' + (it.validate($it)) + ' '; - $it.baseId = $currentBaseId; - out += ' ' + ($valid) + ' = ' + ($nextValid) + '; '; - if ($thenPresent && $elsePresent) { - $ifClause = 'ifClause' + $lvl; - out += ' var ' + ($ifClause) + ' = \'then\'; '; - } else { - $ifClause = '\'then\''; - } - out += ' } '; - if ($elsePresent) { - out += ' else { '; - } - } else { - out += ' if (!' + ($nextValid) + ') { '; - } - if ($elsePresent) { - $it.schema = it.schema['else']; - $it.schemaPath = it.schemaPath + '.else'; - $it.errSchemaPath = it.errSchemaPath + '/else'; - out += ' ' + (it.validate($it)) + ' '; - $it.baseId = $currentBaseId; - out += ' ' + ($valid) + ' = ' + ($nextValid) + '; '; - if ($thenPresent && $elsePresent) { - $ifClause = 'ifClause' + $lvl; - out += ' var ' + ($ifClause) + ' = \'else\'; '; - } else { - $ifClause = '\'else\''; - } - out += ' } '; - } - out += ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ + out += ' ' + ($closingBraces) + ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ if (it.createErrors !== false) { - out += ' { keyword: \'' + ('if') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { failingKeyword: ' + ($ifClause) + ' } '; + out += ' { keyword: \'' + ('anyOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; if (it.opts.messages !== false) { - out += ' , message: \'should match "\' + ' + ($ifClause) + ' + \'" schema\' '; + out += ' , message: \'should match some schema in anyOf\' '; } if (it.opts.verbose) { out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; @@ -29216,9 +31359,9 @@ module.exports = function generate_if(it, $keyword, $ruleType) { out += ' validate.errors = vErrors; return false; '; } } - out += ' } '; - if ($breakOnError) { - out += ' else { '; + out += ' } else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; + if (it.opts.allErrors) { + out += ' } '; } out = it.util.cleanUpCode(out); } else { @@ -29232,220 +31375,1163 @@ module.exports = function generate_if(it, $keyword, $ruleType) { /***/ }), -/***/ 827: -/***/ (function(__unusedmodule, exports, __webpack_require__) { +/***/ 909: +/***/ (function(module, __unusedexports, __webpack_require__) { -"use strict"; +// Copyright 2012 Joyent, Inc. All rights reserved. -var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { - function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } - return new (P || (P = Promise))(function (resolve, reject) { - function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } - function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } - function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } - step((generator = generator.apply(thisArg, _arguments || [])).next()); - }); +var assert = __webpack_require__(477); +var sshpk = __webpack_require__(650); +var util = __webpack_require__(669); + +var HASH_ALGOS = { + 'sha1': true, + 'sha256': true, + 'sha512': true }; -Object.defineProperty(exports, "__esModule", { value: true }); -const command_1 = __webpack_require__(215); -const os = __webpack_require__(87); -const path = __webpack_require__(277); -/** - * The code to exit an action - */ -var ExitCode; -(function (ExitCode) { - /** - * A code indicating that the action was successful - */ - ExitCode[ExitCode["Success"] = 0] = "Success"; - /** - * A code indicating that the action was a failure - */ - ExitCode[ExitCode["Failure"] = 1] = "Failure"; -})(ExitCode = exports.ExitCode || (exports.ExitCode = {})); -//----------------------------------------------------------------------- -// Variables -//----------------------------------------------------------------------- -/** - * Sets env variable for this action and future actions in the job - * @param name the name of the variable to set - * @param val the value of the variable - */ -function exportVariable(name, val) { - process.env[name] = val; - command_1.issueCommand('set-env', { name }, val); + +var PK_ALGOS = { + 'rsa': true, + 'dsa': true, + 'ecdsa': true +}; + +function HttpSignatureError(message, caller) { + if (Error.captureStackTrace) + Error.captureStackTrace(this, caller || HttpSignatureError); + + this.message = message; + this.name = caller.name; } -exports.exportVariable = exportVariable; -/** - * Registers a secret which will get masked from logs - * @param secret value of the secret - */ -function setSecret(secret) { - command_1.issueCommand('add-mask', {}, secret); +util.inherits(HttpSignatureError, Error); + +function InvalidAlgorithmError(message) { + HttpSignatureError.call(this, message, InvalidAlgorithmError); } -exports.setSecret = setSecret; -/** - * Prepends inputPath to the PATH (for this action and future actions) - * @param inputPath - */ -function addPath(inputPath) { - command_1.issueCommand('add-path', {}, inputPath); - process.env['PATH'] = `${inputPath}${path.delimiter}${process.env['PATH']}`; +util.inherits(InvalidAlgorithmError, HttpSignatureError); + +function validateAlgorithm(algorithm) { + var alg = algorithm.toLowerCase().split('-'); + + if (alg.length !== 2) { + throw (new InvalidAlgorithmError(alg[0].toUpperCase() + ' is not a ' + + 'valid algorithm')); + } + + if (alg[0] !== 'hmac' && !PK_ALGOS[alg[0]]) { + throw (new InvalidAlgorithmError(alg[0].toUpperCase() + ' type keys ' + + 'are not supported')); + } + + if (!HASH_ALGOS[alg[1]]) { + throw (new InvalidAlgorithmError(alg[1].toUpperCase() + ' is not a ' + + 'supported hash algorithm')); + } + + return (alg); } -exports.addPath = addPath; -/** - * Gets the value of an input. The value is also trimmed. - * - * @param name name of the input to get - * @param options optional. See InputOptions. - * @returns string - */ -function getInput(name, options) { - const val = process.env[`INPUT_${name.replace(/ /g, '_').toUpperCase()}`] || ''; - if (options && options.required && !val) { - throw new Error(`Input required and not supplied: ${name}`); - } - return val.trim(); -} -exports.getInput = getInput; -/** - * Sets the value of an output. - * - * @param name name of the output to set - * @param value value to store - */ -function setOutput(name, value) { - command_1.issueCommand('set-output', { name }, value); -} -exports.setOutput = setOutput; -//----------------------------------------------------------------------- -// Results -//----------------------------------------------------------------------- -/** - * Sets the action status to failed. - * When the action exits it will be with an exit code of 1 - * @param message add error issue message - */ -function setFailed(message) { - process.exitCode = ExitCode.Failure; - error(message); -} -exports.setFailed = setFailed; -//----------------------------------------------------------------------- -// Logging Commands -//----------------------------------------------------------------------- -/** - * Writes debug message to user log - * @param message debug message - */ -function debug(message) { - command_1.issueCommand('debug', {}, message); -} -exports.debug = debug; -/** - * Adds an error issue - * @param message error issue message - */ -function error(message) { - command_1.issue('error', message); -} -exports.error = error; -/** - * Adds an warning issue - * @param message warning issue message - */ -function warning(message) { - command_1.issue('warning', message); -} -exports.warning = warning; -/** - * Writes info to log with console.log. - * @param message info message - */ -function info(message) { - process.stdout.write(message + os.EOL); -} -exports.info = info; -/** - * Begin an output group. - * - * Output until the next `groupEnd` will be foldable in this group - * - * @param name The name of the output group - */ -function startGroup(name) { - command_1.issue('group', name); -} -exports.startGroup = startGroup; -/** - * End an output group. - */ -function endGroup() { - command_1.issue('endgroup'); -} -exports.endGroup = endGroup; -/** - * Wrap an asynchronous function call in a group. - * - * Returns the same type as the function itself. - * - * @param name The name of the group - * @param fn The function to wrap in the group - */ -function group(name, fn) { - return __awaiter(this, void 0, void 0, function* () { - startGroup(name); - let result; - try { - result = yield fn(); - } - finally { - endGroup(); - } - return result; - }); -} -exports.group = group; -//----------------------------------------------------------------------- -// Wrapper action state -//----------------------------------------------------------------------- -/** - * Saves state for current action, the state can only be retrieved by this action's post job execution. - * - * @param name name of the state to store - * @param value value to store - */ -function saveState(name, value) { - command_1.issueCommand('save-state', { name }, value); -} -exports.saveState = saveState; -/** - * Gets the value of an state set by this action's main execution. - * - * @param name name of the state to get - * @returns string - */ -function getState(name) { - return process.env[`STATE_${name}`] || ''; -} -exports.getState = getState; -//# sourceMappingURL=core.js.map + +///--- API + +module.exports = { + + HASH_ALGOS: HASH_ALGOS, + PK_ALGOS: PK_ALGOS, + + HttpSignatureError: HttpSignatureError, + InvalidAlgorithmError: InvalidAlgorithmError, + + validateAlgorithm: validateAlgorithm, + + /** + * Converts an OpenSSH public key (rsa only) to a PKCS#8 PEM file. + * + * The intent of this module is to interoperate with OpenSSL only, + * specifically the node crypto module's `verify` method. + * + * @param {String} key an OpenSSH public key. + * @return {String} PEM encoded form of the RSA public key. + * @throws {TypeError} on bad input. + * @throws {Error} on invalid ssh key formatted data. + */ + sshKeyToPEM: function sshKeyToPEM(key) { + assert.string(key, 'ssh_key'); + + var k = sshpk.parseKey(key, 'ssh'); + return (k.toString('pem')); + }, + + + /** + * Generates an OpenSSH fingerprint from an ssh public key. + * + * @param {String} key an OpenSSH public key. + * @return {String} key fingerprint. + * @throws {TypeError} on bad input. + * @throws {Error} if what you passed doesn't look like an ssh public key. + */ + fingerprint: function fingerprint(key) { + assert.string(key, 'ssh_key'); + + var k = sshpk.parseKey(key, 'ssh'); + return (k.fingerprint('md5').toString('hex')); + }, + + /** + * Converts a PKGCS#8 PEM file to an OpenSSH public key (rsa) + * + * The reverse of the above function. + */ + pemToRsaSSHKey: function pemToRsaSSHKey(pem, comment) { + assert.equal('string', typeof (pem), 'typeof pem'); + + var k = sshpk.parseKey(pem, 'pem'); + k.comment = comment; + return (k.toString('ssh')); + } +}; + /***/ }), -/***/ 829: +/***/ 919: +/***/ (function(module) { + +module.exports = {"$id":"entry.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["startedDateTime","time","request","response","cache","timings"],"properties":{"pageref":{"type":"string"},"startedDateTime":{"type":"string","format":"date-time","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))"},"time":{"type":"number","min":0},"request":{"$ref":"request.json#"},"response":{"$ref":"response.json#"},"cache":{"$ref":"cache.json#"},"timings":{"$ref":"timings.json#"},"serverIPAddress":{"type":"string","oneOf":[{"format":"ipv4"},{"format":"ipv6"}]},"connection":{"type":"string"},"comment":{"type":"string"}}}; + +/***/ }), + +/***/ 921: +/***/ (function(module) { + +"use strict"; + + + +var Cache = module.exports = function Cache() { + this._cache = {}; +}; + + +Cache.prototype.put = function Cache_put(key, value) { + this._cache[key] = value; +}; + + +Cache.prototype.get = function Cache_get(key) { + return this._cache[key]; +}; + + +Cache.prototype.del = function Cache_del(key) { + delete this._cache[key]; +}; + + +Cache.prototype.clear = function Cache_clear() { + this._cache = {}; +}; + + +/***/ }), + +/***/ 928: +/***/ (function(module, __unusedexports, __webpack_require__) { + +var CombinedStream = __webpack_require__(547); +var util = __webpack_require__(669); +var path = __webpack_require__(622); +var http = __webpack_require__(605); +var https = __webpack_require__(211); +var parseUrl = __webpack_require__(835).parse; +var fs = __webpack_require__(747); +var mime = __webpack_require__(779); +var asynckit = __webpack_require__(334); +var populate = __webpack_require__(69); + +// Public API +module.exports = FormData; + +// make it a Stream +util.inherits(FormData, CombinedStream); + +/** + * Create readable "multipart/form-data" streams. + * Can be used to submit forms + * and file uploads to other web applications. + * + * @constructor + * @param {Object} options - Properties to be added/overriden for FormData and CombinedStream + */ +function FormData(options) { + if (!(this instanceof FormData)) { + return new FormData(); + } + + this._overheadLength = 0; + this._valueLength = 0; + this._valuesToMeasure = []; + + CombinedStream.call(this); + + options = options || {}; + for (var option in options) { + this[option] = options[option]; + } +} + +FormData.LINE_BREAK = '\r\n'; +FormData.DEFAULT_CONTENT_TYPE = 'application/octet-stream'; + +FormData.prototype.append = function(field, value, options) { + + options = options || {}; + + // allow filename as single option + if (typeof options == 'string') { + options = {filename: options}; + } + + var append = CombinedStream.prototype.append.bind(this); + + // all that streamy business can't handle numbers + if (typeof value == 'number') { + value = '' + value; + } + + // https://github.com/felixge/node-form-data/issues/38 + if (util.isArray(value)) { + // Please convert your array into string + // the way web server expects it + this._error(new Error('Arrays are not supported.')); + return; + } + + var header = this._multiPartHeader(field, value, options); + var footer = this._multiPartFooter(); + + append(header); + append(value); + append(footer); + + // pass along options.knownLength + this._trackLength(header, value, options); +}; + +FormData.prototype._trackLength = function(header, value, options) { + var valueLength = 0; + + // used w/ getLengthSync(), when length is known. + // e.g. for streaming directly from a remote server, + // w/ a known file a size, and not wanting to wait for + // incoming file to finish to get its size. + if (options.knownLength != null) { + valueLength += +options.knownLength; + } else if (Buffer.isBuffer(value)) { + valueLength = value.length; + } else if (typeof value === 'string') { + valueLength = Buffer.byteLength(value); + } + + this._valueLength += valueLength; + + // @check why add CRLF? does this account for custom/multiple CRLFs? + this._overheadLength += + Buffer.byteLength(header) + + FormData.LINE_BREAK.length; + + // empty or either doesn't have path or not an http response + if (!value || ( !value.path && !(value.readable && value.hasOwnProperty('httpVersion')) )) { + return; + } + + // no need to bother with the length + if (!options.knownLength) { + this._valuesToMeasure.push(value); + } +}; + +FormData.prototype._lengthRetriever = function(value, callback) { + + if (value.hasOwnProperty('fd')) { + + // take read range into a account + // `end` = Infinity –> read file till the end + // + // TODO: Looks like there is bug in Node fs.createReadStream + // it doesn't respect `end` options without `start` options + // Fix it when node fixes it. + // https://github.com/joyent/node/issues/7819 + if (value.end != undefined && value.end != Infinity && value.start != undefined) { + + // when end specified + // no need to calculate range + // inclusive, starts with 0 + callback(null, value.end + 1 - (value.start ? value.start : 0)); + + // not that fast snoopy + } else { + // still need to fetch file size from fs + fs.stat(value.path, function(err, stat) { + + var fileSize; + + if (err) { + callback(err); + return; + } + + // update final size based on the range options + fileSize = stat.size - (value.start ? value.start : 0); + callback(null, fileSize); + }); + } + + // or http response + } else if (value.hasOwnProperty('httpVersion')) { + callback(null, +value.headers['content-length']); + + // or request stream http://github.com/mikeal/request + } else if (value.hasOwnProperty('httpModule')) { + // wait till response come back + value.on('response', function(response) { + value.pause(); + callback(null, +response.headers['content-length']); + }); + value.resume(); + + // something else + } else { + callback('Unknown stream'); + } +}; + +FormData.prototype._multiPartHeader = function(field, value, options) { + // custom header specified (as string)? + // it becomes responsible for boundary + // (e.g. to handle extra CRLFs on .NET servers) + if (typeof options.header == 'string') { + return options.header; + } + + var contentDisposition = this._getContentDisposition(value, options); + var contentType = this._getContentType(value, options); + + var contents = ''; + var headers = { + // add custom disposition as third element or keep it two elements if not + 'Content-Disposition': ['form-data', 'name="' + field + '"'].concat(contentDisposition || []), + // if no content type. allow it to be empty array + 'Content-Type': [].concat(contentType || []) + }; + + // allow custom headers. + if (typeof options.header == 'object') { + populate(headers, options.header); + } + + var header; + for (var prop in headers) { + if (!headers.hasOwnProperty(prop)) continue; + header = headers[prop]; + + // skip nullish headers. + if (header == null) { + continue; + } + + // convert all headers to arrays. + if (!Array.isArray(header)) { + header = [header]; + } + + // add non-empty headers. + if (header.length) { + contents += prop + ': ' + header.join('; ') + FormData.LINE_BREAK; + } + } + + return '--' + this.getBoundary() + FormData.LINE_BREAK + contents + FormData.LINE_BREAK; +}; + +FormData.prototype._getContentDisposition = function(value, options) { + + var filename + , contentDisposition + ; + + if (typeof options.filepath === 'string') { + // custom filepath for relative paths + filename = path.normalize(options.filepath).replace(/\\/g, '/'); + } else if (options.filename || value.name || value.path) { + // custom filename take precedence + // formidable and the browser add a name property + // fs- and request- streams have path property + filename = path.basename(options.filename || value.name || value.path); + } else if (value.readable && value.hasOwnProperty('httpVersion')) { + // or try http response + filename = path.basename(value.client._httpMessage.path); + } + + if (filename) { + contentDisposition = 'filename="' + filename + '"'; + } + + return contentDisposition; +}; + +FormData.prototype._getContentType = function(value, options) { + + // use custom content-type above all + var contentType = options.contentType; + + // or try `name` from formidable, browser + if (!contentType && value.name) { + contentType = mime.lookup(value.name); + } + + // or try `path` from fs-, request- streams + if (!contentType && value.path) { + contentType = mime.lookup(value.path); + } + + // or if it's http-reponse + if (!contentType && value.readable && value.hasOwnProperty('httpVersion')) { + contentType = value.headers['content-type']; + } + + // or guess it from the filepath or filename + if (!contentType && (options.filepath || options.filename)) { + contentType = mime.lookup(options.filepath || options.filename); + } + + // fallback to the default content type if `value` is not simple value + if (!contentType && typeof value == 'object') { + contentType = FormData.DEFAULT_CONTENT_TYPE; + } + + return contentType; +}; + +FormData.prototype._multiPartFooter = function() { + return function(next) { + var footer = FormData.LINE_BREAK; + + var lastPart = (this._streams.length === 0); + if (lastPart) { + footer += this._lastBoundary(); + } + + next(footer); + }.bind(this); +}; + +FormData.prototype._lastBoundary = function() { + return '--' + this.getBoundary() + '--' + FormData.LINE_BREAK; +}; + +FormData.prototype.getHeaders = function(userHeaders) { + var header; + var formHeaders = { + 'content-type': 'multipart/form-data; boundary=' + this.getBoundary() + }; + + for (header in userHeaders) { + if (userHeaders.hasOwnProperty(header)) { + formHeaders[header.toLowerCase()] = userHeaders[header]; + } + } + + return formHeaders; +}; + +FormData.prototype.getBoundary = function() { + if (!this._boundary) { + this._generateBoundary(); + } + + return this._boundary; +}; + +FormData.prototype._generateBoundary = function() { + // This generates a 50 character boundary similar to those used by Firefox. + // They are optimized for boyer-moore parsing. + var boundary = '--------------------------'; + for (var i = 0; i < 24; i++) { + boundary += Math.floor(Math.random() * 10).toString(16); + } + + this._boundary = boundary; +}; + +// Note: getLengthSync DOESN'T calculate streams length +// As workaround one can calculate file size manually +// and add it as knownLength option +FormData.prototype.getLengthSync = function() { + var knownLength = this._overheadLength + this._valueLength; + + // Don't get confused, there are 3 "internal" streams for each keyval pair + // so it basically checks if there is any value added to the form + if (this._streams.length) { + knownLength += this._lastBoundary().length; + } + + // https://github.com/form-data/form-data/issues/40 + if (!this.hasKnownLength()) { + // Some async length retrievers are present + // therefore synchronous length calculation is false. + // Please use getLength(callback) to get proper length + this._error(new Error('Cannot calculate proper length in synchronous way.')); + } + + return knownLength; +}; + +// Public API to check if length of added values is known +// https://github.com/form-data/form-data/issues/196 +// https://github.com/form-data/form-data/issues/262 +FormData.prototype.hasKnownLength = function() { + var hasKnownLength = true; + + if (this._valuesToMeasure.length) { + hasKnownLength = false; + } + + return hasKnownLength; +}; + +FormData.prototype.getLength = function(cb) { + var knownLength = this._overheadLength + this._valueLength; + + if (this._streams.length) { + knownLength += this._lastBoundary().length; + } + + if (!this._valuesToMeasure.length) { + process.nextTick(cb.bind(this, null, knownLength)); + return; + } + + asynckit.parallel(this._valuesToMeasure, this._lengthRetriever, function(err, values) { + if (err) { + cb(err); + return; + } + + values.forEach(function(length) { + knownLength += length; + }); + + cb(null, knownLength); + }); +}; + +FormData.prototype.submit = function(params, cb) { + var request + , options + , defaults = {method: 'post'} + ; + + // parse provided url if it's string + // or treat it as options object + if (typeof params == 'string') { + + params = parseUrl(params); + options = populate({ + port: params.port, + path: params.pathname, + host: params.hostname, + protocol: params.protocol + }, defaults); + + // use custom params + } else { + + options = populate(params, defaults); + // if no port provided use default one + if (!options.port) { + options.port = options.protocol == 'https:' ? 443 : 80; + } + } + + // put that good code in getHeaders to some use + options.headers = this.getHeaders(params.headers); + + // https if specified, fallback to http in any other case + if (options.protocol == 'https:') { + request = https.request(options); + } else { + request = http.request(options); + } + + // get content length and fire away + this.getLength(function(err, length) { + if (err) { + this._error(err); + return; + } + + // add content length + request.setHeader('Content-Length', length); + + this.pipe(request); + if (cb) { + request.on('error', cb); + request.on('response', cb.bind(this, null)); + } + }.bind(this)); + + return request; +}; + +FormData.prototype._error = function(err) { + if (!this.error) { + this.error = err; + this.pause(); + this.emit('error', err); + } +}; + +FormData.prototype.toString = function () { + return '[object FormData]'; +}; + + +/***/ }), + +/***/ 939: +/***/ (function(module, __unusedexports, __webpack_require__) { + +var abort = __webpack_require__(566) + , async = __webpack_require__(751) + ; + +// API +module.exports = terminator; + +/** + * Terminates jobs in the attached state context + * + * @this AsyncKitState# + * @param {function} callback - final callback to invoke after termination + */ +function terminator(callback) +{ + if (!Object.keys(this.jobs).length) + { + return; + } + + // fast forward iteration index + this.index = this.size; + + // abort jobs + abort(this); + + // send back results we have so far + async(callback)(null, this.results); +} + + +/***/ }), + +/***/ 940: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2015 Joyent, Inc. + +module.exports = SSHBuffer; + +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; + +function SSHBuffer(opts) { + assert.object(opts, 'options'); + if (opts.buffer !== undefined) + assert.buffer(opts.buffer, 'options.buffer'); + + this._size = opts.buffer ? opts.buffer.length : 1024; + this._buffer = opts.buffer || Buffer.alloc(this._size); + this._offset = 0; +} + +SSHBuffer.prototype.toBuffer = function () { + return (this._buffer.slice(0, this._offset)); +}; + +SSHBuffer.prototype.atEnd = function () { + return (this._offset >= this._buffer.length); +}; + +SSHBuffer.prototype.remainder = function () { + return (this._buffer.slice(this._offset)); +}; + +SSHBuffer.prototype.skip = function (n) { + this._offset += n; +}; + +SSHBuffer.prototype.expand = function () { + this._size *= 2; + var buf = Buffer.alloc(this._size); + this._buffer.copy(buf, 0); + this._buffer = buf; +}; + +SSHBuffer.prototype.readPart = function () { + return ({data: this.readBuffer()}); +}; + +SSHBuffer.prototype.readBuffer = function () { + var len = this._buffer.readUInt32BE(this._offset); + this._offset += 4; + assert.ok(this._offset + len <= this._buffer.length, + 'length out of bounds at +0x' + this._offset.toString(16) + + ' (data truncated?)'); + var buf = this._buffer.slice(this._offset, this._offset + len); + this._offset += len; + return (buf); +}; + +SSHBuffer.prototype.readString = function () { + return (this.readBuffer().toString()); +}; + +SSHBuffer.prototype.readCString = function () { + var offset = this._offset; + while (offset < this._buffer.length && + this._buffer[offset] !== 0x00) + offset++; + assert.ok(offset < this._buffer.length, 'c string does not terminate'); + var str = this._buffer.slice(this._offset, offset).toString(); + this._offset = offset + 1; + return (str); +}; + +SSHBuffer.prototype.readInt = function () { + var v = this._buffer.readUInt32BE(this._offset); + this._offset += 4; + return (v); +}; + +SSHBuffer.prototype.readInt64 = function () { + assert.ok(this._offset + 8 < this._buffer.length, + 'buffer not long enough to read Int64'); + var v = this._buffer.slice(this._offset, this._offset + 8); + this._offset += 8; + return (v); +}; + +SSHBuffer.prototype.readChar = function () { + var v = this._buffer[this._offset++]; + return (v); +}; + +SSHBuffer.prototype.writeBuffer = function (buf) { + while (this._offset + 4 + buf.length > this._size) + this.expand(); + this._buffer.writeUInt32BE(buf.length, this._offset); + this._offset += 4; + buf.copy(this._buffer, this._offset); + this._offset += buf.length; +}; + +SSHBuffer.prototype.writeString = function (str) { + this.writeBuffer(Buffer.from(str, 'utf8')); +}; + +SSHBuffer.prototype.writeCString = function (str) { + while (this._offset + 1 + str.length > this._size) + this.expand(); + this._buffer.write(str, this._offset); + this._offset += str.length; + this._buffer[this._offset++] = 0; +}; + +SSHBuffer.prototype.writeInt = function (v) { + while (this._offset + 4 > this._size) + this.expand(); + this._buffer.writeUInt32BE(v, this._offset); + this._offset += 4; +}; + +SSHBuffer.prototype.writeInt64 = function (v) { + assert.buffer(v, 'value'); + if (v.length > 8) { + var lead = v.slice(0, v.length - 8); + for (var i = 0; i < lead.length; ++i) { + assert.strictEqual(lead[i], 0, + 'must fit in 64 bits of precision'); + } + v = v.slice(v.length - 8, v.length); + } + while (this._offset + 8 > this._size) + this.expand(); + v.copy(this._buffer, this._offset); + this._offset += 8; +}; + +SSHBuffer.prototype.writeChar = function (v) { + while (this._offset + 1 > this._size) + this.expand(); + this._buffer[this._offset++] = v; +}; + +SSHBuffer.prototype.writePart = function (p) { + this.writeBuffer(p.data); +}; + +SSHBuffer.prototype.write = function (buf) { + while (this._offset + buf.length > this._size) + this.expand(); + buf.copy(this._buffer, this._offset); + this._offset += buf.length; +}; + + +/***/ }), + +/***/ 942: +/***/ (function(module, __unusedexports, __webpack_require__) { + + +/*! + * Copyright 2010 LearnBoost + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +/** + * Module dependencies. + */ + +var crypto = __webpack_require__(417) + , parse = __webpack_require__(835).parse + ; + +/** + * Valid keys. + */ + +var keys = + [ 'acl' + , 'location' + , 'logging' + , 'notification' + , 'partNumber' + , 'policy' + , 'requestPayment' + , 'torrent' + , 'uploadId' + , 'uploads' + , 'versionId' + , 'versioning' + , 'versions' + , 'website' + ] + +/** + * Return an "Authorization" header value with the given `options` + * in the form of "AWS :" + * + * @param {Object} options + * @return {String} + * @api private + */ + +function authorization (options) { + return 'AWS ' + options.key + ':' + sign(options) +} + +module.exports = authorization +module.exports.authorization = authorization + +/** + * Simple HMAC-SHA1 Wrapper + * + * @param {Object} options + * @return {String} + * @api private + */ + +function hmacSha1 (options) { + return crypto.createHmac('sha1', options.secret).update(options.message).digest('base64') +} + +module.exports.hmacSha1 = hmacSha1 + +/** + * Create a base64 sha1 HMAC for `options`. + * + * @param {Object} options + * @return {String} + * @api private + */ + +function sign (options) { + options.message = stringToSign(options) + return hmacSha1(options) +} +module.exports.sign = sign + +/** + * Create a base64 sha1 HMAC for `options`. + * + * Specifically to be used with S3 presigned URLs + * + * @param {Object} options + * @return {String} + * @api private + */ + +function signQuery (options) { + options.message = queryStringToSign(options) + return hmacSha1(options) +} +module.exports.signQuery= signQuery + +/** + * Return a string for sign() with the given `options`. + * + * Spec: + * + * \n + * \n + * \n + * \n + * [headers\n] + * + * + * @param {Object} options + * @return {String} + * @api private + */ + +function stringToSign (options) { + var headers = options.amazonHeaders || '' + if (headers) headers += '\n' + var r = + [ options.verb + , options.md5 + , options.contentType + , options.date ? options.date.toUTCString() : '' + , headers + options.resource + ] + return r.join('\n') +} +module.exports.stringToSign = stringToSign + +/** + * Return a string for sign() with the given `options`, but is meant exclusively + * for S3 presigned URLs + * + * Spec: + * + * \n + * + * + * @param {Object} options + * @return {String} + * @api private + */ + +function queryStringToSign (options){ + return 'GET\n\n\n' + options.date + '\n' + options.resource +} +module.exports.queryStringToSign = queryStringToSign + +/** + * Perform the following: + * + * - ignore non-amazon headers + * - lowercase fields + * - sort lexicographically + * - trim whitespace between ":" + * - join with newline + * + * @param {Object} headers + * @return {String} + * @api private + */ + +function canonicalizeHeaders (headers) { + var buf = [] + , fields = Object.keys(headers) + ; + for (var i = 0, len = fields.length; i < len; ++i) { + var field = fields[i] + , val = headers[field] + , field = field.toLowerCase() + ; + if (0 !== field.indexOf('x-amz')) continue + buf.push(field + ':' + val) + } + return buf.sort().join('\n') +} +module.exports.canonicalizeHeaders = canonicalizeHeaders + +/** + * Perform the following: + * + * - ignore non sub-resources + * - sort lexicographically + * + * @param {String} resource + * @return {String} + * @api private + */ + +function canonicalizeResource (resource) { + var url = parse(resource, true) + , path = url.pathname + , buf = [] + ; + + Object.keys(url.query).forEach(function(key){ + if (!~keys.indexOf(key)) return + var val = '' == url.query[key] ? '' : '=' + encodeURIComponent(url.query[key]) + buf.push(key + val) + }) + + return path + (buf.length ? '?' + buf.sort().join('&') : '') +} +module.exports.canonicalizeResource = canonicalizeResource + + +/***/ }), + +/***/ 944: +/***/ (function(module) { + +module.exports = isTypedArray +isTypedArray.strict = isStrictTypedArray +isTypedArray.loose = isLooseTypedArray + +var toString = Object.prototype.toString +var names = { + '[object Int8Array]': true + , '[object Int16Array]': true + , '[object Int32Array]': true + , '[object Uint8Array]': true + , '[object Uint8ClampedArray]': true + , '[object Uint16Array]': true + , '[object Uint32Array]': true + , '[object Float32Array]': true + , '[object Float64Array]': true +} + +function isTypedArray(arr) { + return ( + isStrictTypedArray(arr) + || isLooseTypedArray(arr) + ) +} + +function isStrictTypedArray(arr) { + return ( + arr instanceof Int8Array + || arr instanceof Int16Array + || arr instanceof Int32Array + || arr instanceof Uint8Array + || arr instanceof Uint8ClampedArray + || arr instanceof Uint16Array + || arr instanceof Uint32Array + || arr instanceof Float32Array + || arr instanceof Float64Array + ) +} + +function isLooseTypedArray(arr) { + return names[toString.call(arr)] +} + + +/***/ }), + +/***/ 952: +/***/ (function(module, __unusedexports, __webpack_require__) { + +"use strict"; + + +var metaSchema = __webpack_require__(522); + +module.exports = { + $id: 'https://github.com/epoberezkin/ajv/blob/master/lib/definition_schema.js', + definitions: { + simpleTypes: metaSchema.definitions.simpleTypes + }, + type: 'object', + dependencies: { + schema: ['validate'], + $data: ['validate'], + statements: ['inline'], + valid: {not: {required: ['macro']}} + }, + properties: { + type: metaSchema.properties.type, + schema: {type: 'boolean'}, + statements: {type: 'boolean'}, + dependencies: { + type: 'array', + items: {type: 'string'} + }, + metaSchema: {type: 'object'}, + modifying: {type: 'boolean'}, + valid: {type: 'boolean'}, + $data: {type: 'boolean'}, + async: {type: 'boolean'}, + errors: { + anyOf: [ + {type: 'boolean'}, + {const: 'full'} + ] + } + } +}; + + +/***/ }), + +/***/ 955: +/***/ (function(module, __unusedexports, __webpack_require__) { + +"use strict"; + + +var util = __webpack_require__(855); + +module.exports = SchemaObject; + +function SchemaObject(obj) { + util.copy(obj, this); +} + + +/***/ }), + +/***/ 956: /***/ (function(module, __unusedexports, __webpack_require__) { /* * verror.js: richer JavaScript errors */ -var mod_assertplus = __webpack_require__(283); +var mod_assertplus = __webpack_require__(477); var mod_util = __webpack_require__(669); -var mod_extsprintf = __webpack_require__(784); -var mod_isError = __webpack_require__(160).isError; +var mod_extsprintf = __webpack_require__(887); +var mod_isError = __webpack_require__(286).isError; var sprintf = mod_extsprintf.sprintf; /* @@ -29892,1064 +32978,702 @@ WError.prototype.cause = function we_cause(c) /***/ }), -/***/ 835: -/***/ (function(module) { - -module.exports = require("url"); - -/***/ }), - -/***/ 843: -/***/ (function(module) { - -module.exports = {"$id":"afterRequest.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["lastAccess","eTag","hitCount"],"properties":{"expires":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"lastAccess":{"type":"string","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))?"},"eTag":{"type":"string"},"hitCount":{"type":"integer"},"comment":{"type":"string"}}}; - -/***/ }), - -/***/ 849: -/***/ (function(module) { - -"use strict"; - - -// https://mathiasbynens.be/notes/javascript-encoding -// https://github.com/bestiejs/punycode.js - punycode.ucs2.decode -module.exports = function ucs2length(str) { - var length = 0 - , len = str.length - , pos = 0 - , value; - while (pos < len) { - length++; - value = str.charCodeAt(pos++); - if (value >= 0xD800 && value <= 0xDBFF && pos < len) { - // high surrogate, and there is a next character - value = str.charCodeAt(pos); - if ((value & 0xFC00) == 0xDC00) pos++; // low surrogate - } - } - return length; -}; - - -/***/ }), - -/***/ 853: +/***/ 959: /***/ (function(module, __unusedexports, __webpack_require__) { -/*! - * mime-db - * Copyright(c) 2014 Jonathan Ong - * MIT Licensed - */ +// Named EC curves -/** - * Module exports. - */ - -module.exports = __webpack_require__(917) +// Requires ec.js, jsbn.js, and jsbn2.js +var BigInteger = __webpack_require__(242).BigInteger +var ECCurveFp = __webpack_require__(729).ECCurveFp -/***/ }), +// ---------------- +// X9ECParameters -/***/ 854: -/***/ (function(module, __unusedexports, __webpack_require__) { - -var stream = __webpack_require__(413) - - -function isStream (obj) { - return obj instanceof stream.Stream +// constructor +function X9ECParameters(curve,g,n,h) { + this.curve = curve; + this.g = g; + this.n = n; + this.h = h; } - -function isReadable (obj) { - return isStream(obj) && typeof obj._read == 'function' && typeof obj._readableState == 'object' +function x9getCurve() { + return this.curve; } - -function isWritable (obj) { - return isStream(obj) && typeof obj._write == 'function' && typeof obj._writableState == 'object' +function x9getG() { + return this.g; } - -function isDuplex (obj) { - return isReadable(obj) && isWritable(obj) +function x9getN() { + return this.n; } +function x9getH() { + return this.h; +} -module.exports = isStream -module.exports.isReadable = isReadable -module.exports.isWritable = isWritable -module.exports.isDuplex = isDuplex +X9ECParameters.prototype.getCurve = x9getCurve; +X9ECParameters.prototype.getG = x9getG; +X9ECParameters.prototype.getN = x9getN; +X9ECParameters.prototype.getH = x9getH; +// ---------------- +// SECNamedCurves -/***/ }), +function fromHex(s) { return new BigInteger(s, 16); } -/***/ 856: -/***/ (function(module) { +function secp128r1() { + // p = 2^128 - 2^97 - 1 + var p = fromHex("FFFFFFFDFFFFFFFFFFFFFFFFFFFFFFFF"); + var a = fromHex("FFFFFFFDFFFFFFFFFFFFFFFFFFFFFFFC"); + var b = fromHex("E87579C11079F43DD824993C2CEE5ED3"); + //byte[] S = Hex.decode("000E0D4D696E6768756151750CC03A4473D03679"); + var n = fromHex("FFFFFFFE0000000075A30D1B9038A115"); + var h = BigInteger.ONE; + var curve = new ECCurveFp(p, a, b); + var G = curve.decodePointHex("04" + + "161FF7528B899B2D0C28607CA52C5B86" + + "CF5AC8395BAFEB13C02DA292DDED7A83"); + return new X9ECParameters(curve, G, n, h); +} -"use strict"; +function secp160k1() { + // p = 2^160 - 2^32 - 2^14 - 2^12 - 2^9 - 2^8 - 2^7 - 2^3 - 2^2 - 1 + var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFAC73"); + var a = BigInteger.ZERO; + var b = fromHex("7"); + //byte[] S = null; + var n = fromHex("0100000000000000000001B8FA16DFAB9ACA16B6B3"); + var h = BigInteger.ONE; + var curve = new ECCurveFp(p, a, b); + var G = curve.decodePointHex("04" + + "3B4C382CE37AA192A4019E763036F4F5DD4D7EBB" + + "938CF935318FDCED6BC28286531733C3F03C4FEE"); + return new X9ECParameters(curve, G, n, h); +} -module.exports = function generate_not(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - $it.level++; - var $nextValid = 'valid' + $it.level; - if ((it.opts.strictKeywords ? typeof $schema == 'object' && Object.keys($schema).length > 0 : it.util.schemaHasRules($schema, it.RULES.all))) { - $it.schema = $schema; - $it.schemaPath = $schemaPath; - $it.errSchemaPath = $errSchemaPath; - out += ' var ' + ($errs) + ' = errors; '; - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - $it.createErrors = false; - var $allErrorsOption; - if ($it.opts.allErrors) { - $allErrorsOption = $it.opts.allErrors; - $it.opts.allErrors = false; - } - out += ' ' + (it.validate($it)) + ' '; - $it.createErrors = true; - if ($allErrorsOption) $it.opts.allErrors = $allErrorsOption; - it.compositeRule = $it.compositeRule = $wasComposite; - out += ' if (' + ($nextValid) + ') { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('not') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; - if (it.opts.messages !== false) { - out += ' , message: \'should NOT be valid\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += ' } else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } '; - if (it.opts.allErrors) { - out += ' } '; - } - } else { - out += ' var err = '; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('not') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; - if (it.opts.messages !== false) { - out += ' , message: \'should NOT be valid\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - if ($breakOnError) { - out += ' if (false) { '; - } - } - return out; +function secp160r1() { + // p = 2^160 - 2^31 - 1 + var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFF"); + var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFC"); + var b = fromHex("1C97BEFC54BD7A8B65ACF89F81D4D4ADC565FA45"); + //byte[] S = Hex.decode("1053CDE42C14D696E67687561517533BF3F83345"); + var n = fromHex("0100000000000000000001F4C8F927AED3CA752257"); + var h = BigInteger.ONE; + var curve = new ECCurveFp(p, a, b); + var G = curve.decodePointHex("04" + + "4A96B5688EF573284664698968C38BB913CBFC82" + + "23A628553168947D59DCC912042351377AC5FB32"); + return new X9ECParameters(curve, G, n, h); +} + +function secp192k1() { + // p = 2^192 - 2^32 - 2^12 - 2^8 - 2^7 - 2^6 - 2^3 - 1 + var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFEE37"); + var a = BigInteger.ZERO; + var b = fromHex("3"); + //byte[] S = null; + var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFE26F2FC170F69466A74DEFD8D"); + var h = BigInteger.ONE; + var curve = new ECCurveFp(p, a, b); + var G = curve.decodePointHex("04" + + "DB4FF10EC057E9AE26B07D0280B7F4341DA5D1B1EAE06C7D" + + "9B2F2F6D9C5628A7844163D015BE86344082AA88D95E2F9D"); + return new X9ECParameters(curve, G, n, h); +} + +function secp192r1() { + // p = 2^192 - 2^64 - 1 + var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFF"); + var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFC"); + var b = fromHex("64210519E59C80E70FA7E9AB72243049FEB8DEECC146B9B1"); + //byte[] S = Hex.decode("3045AE6FC8422F64ED579528D38120EAE12196D5"); + var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFF99DEF836146BC9B1B4D22831"); + var h = BigInteger.ONE; + var curve = new ECCurveFp(p, a, b); + var G = curve.decodePointHex("04" + + "188DA80EB03090F67CBF20EB43A18800F4FF0AFD82FF1012" + + "07192B95FFC8DA78631011ED6B24CDD573F977A11E794811"); + return new X9ECParameters(curve, G, n, h); +} + +function secp224r1() { + // p = 2^224 - 2^96 + 1 + var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF000000000000000000000001"); + var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFE"); + var b = fromHex("B4050A850C04B3ABF54132565044B0B7D7BFD8BA270B39432355FFB4"); + //byte[] S = Hex.decode("BD71344799D5C7FCDC45B59FA3B9AB8F6A948BC5"); + var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFF16A2E0B8F03E13DD29455C5C2A3D"); + var h = BigInteger.ONE; + var curve = new ECCurveFp(p, a, b); + var G = curve.decodePointHex("04" + + "B70E0CBD6BB4BF7F321390B94A03C1D356C21122343280D6115C1D21" + + "BD376388B5F723FB4C22DFE6CD4375A05A07476444D5819985007E34"); + return new X9ECParameters(curve, G, n, h); +} + +function secp256r1() { + // p = 2^224 (2^32 - 1) + 2^192 + 2^96 - 1 + var p = fromHex("FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFF"); + var a = fromHex("FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFC"); + var b = fromHex("5AC635D8AA3A93E7B3EBBD55769886BC651D06B0CC53B0F63BCE3C3E27D2604B"); + //byte[] S = Hex.decode("C49D360886E704936A6678E1139D26B7819F7E90"); + var n = fromHex("FFFFFFFF00000000FFFFFFFFFFFFFFFFBCE6FAADA7179E84F3B9CAC2FC632551"); + var h = BigInteger.ONE; + var curve = new ECCurveFp(p, a, b); + var G = curve.decodePointHex("04" + + "6B17D1F2E12C4247F8BCE6E563A440F277037D812DEB33A0F4A13945D898C296" + + "4FE342E2FE1A7F9B8EE7EB4A7C0F9E162BCE33576B315ECECBB6406837BF51F5"); + return new X9ECParameters(curve, G, n, h); +} + +// TODO: make this into a proper hashtable +function getSECCurveByName(name) { + if(name == "secp128r1") return secp128r1(); + if(name == "secp160k1") return secp160k1(); + if(name == "secp160r1") return secp160r1(); + if(name == "secp192k1") return secp192k1(); + if(name == "secp192r1") return secp192r1(); + if(name == "secp224r1") return secp224r1(); + if(name == "secp256r1") return secp256r1(); + return null; +} + +module.exports = { + "secp128r1":secp128r1, + "secp160k1":secp160k1, + "secp160r1":secp160r1, + "secp192k1":secp192k1, + "secp192r1":secp192r1, + "secp224r1":secp224r1, + "secp256r1":secp256r1 } /***/ }), -/***/ 860: +/***/ 964: /***/ (function(__unusedmodule, exports, __webpack_require__) { "use strict"; -var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { - function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } - return new (P || (P = Promise))(function (resolve, reject) { - function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } - function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } - function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } - step((generator = generator.apply(thisArg, _arguments || [])).next()); - }); -}; -Object.defineProperty(exports, "__esModule", { value: true }); -const os = __webpack_require__(87); -const events = __webpack_require__(614); -const child = __webpack_require__(129); -/* eslint-disable @typescript-eslint/unbound-method */ -const IS_WINDOWS = process.platform === 'win32'; -/* - * Class for running command line tools. Handles quoting and arg parsing in a platform agnostic way. - */ -class ToolRunner extends events.EventEmitter { - constructor(toolPath, args, options) { - super(); - if (!toolPath) { - throw new Error("Parameter 'toolPath' cannot be null or empty."); - } - this.toolPath = toolPath; - this.args = args || []; - this.options = options || {}; - } - _debug(message) { - if (this.options.listeners && this.options.listeners.debug) { - this.options.listeners.debug(message); - } - } - _getCommandString(options, noPrefix) { - const toolPath = this._getSpawnFileName(); - const args = this._getSpawnArgs(options); - let cmd = noPrefix ? '' : '[command]'; // omit prefix when piped to a second tool - if (IS_WINDOWS) { - // Windows + cmd file - if (this._isCmdFile()) { - cmd += toolPath; - for (const a of args) { - cmd += ` ${a}`; - } - } - // Windows + verbatim - else if (options.windowsVerbatimArguments) { - cmd += `"${toolPath}"`; - for (const a of args) { - cmd += ` ${a}`; - } - } - // Windows (regular) - else { - cmd += this._windowsQuoteCmdArg(toolPath); - for (const a of args) { - cmd += ` ${this._windowsQuoteCmdArg(a)}`; - } - } - } - else { - // OSX/Linux - this can likely be improved with some form of quoting. - // creating processes on Unix is fundamentally different than Windows. - // on Unix, execvp() takes an arg array. - cmd += toolPath; - for (const a of args) { - cmd += ` ${a}`; - } - } - return cmd; - } - _processLineBuffer(data, strBuffer, onLine) { - try { - let s = strBuffer + data.toString(); - let n = s.indexOf(os.EOL); - while (n > -1) { - const line = s.substring(0, n); - onLine(line); - // the rest of the string ... - s = s.substring(n + os.EOL.length); - n = s.indexOf(os.EOL); - } - strBuffer = s; - } - catch (err) { - // streaming lines to console is best effort. Don't fail a build. - this._debug(`error processing line. Failed with error ${err}`); - } - } - _getSpawnFileName() { - if (IS_WINDOWS) { - if (this._isCmdFile()) { - return process.env['COMSPEC'] || 'cmd.exe'; - } - } - return this.toolPath; - } - _getSpawnArgs(options) { - if (IS_WINDOWS) { - if (this._isCmdFile()) { - let argline = `/D /S /C "${this._windowsQuoteCmdArg(this.toolPath)}`; - for (const a of this.args) { - argline += ' '; - argline += options.windowsVerbatimArguments - ? a - : this._windowsQuoteCmdArg(a); - } - argline += '"'; - return [argline]; - } - } - return this.args; - } - _endsWith(str, end) { - return str.endsWith(end); - } - _isCmdFile() { - const upperToolPath = this.toolPath.toUpperCase(); - return (this._endsWith(upperToolPath, '.CMD') || - this._endsWith(upperToolPath, '.BAT')); - } - _windowsQuoteCmdArg(arg) { - // for .exe, apply the normal quoting rules that libuv applies - if (!this._isCmdFile()) { - return this._uvQuoteCmdArg(arg); - } - // otherwise apply quoting rules specific to the cmd.exe command line parser. - // the libuv rules are generic and are not designed specifically for cmd.exe - // command line parser. - // - // for a detailed description of the cmd.exe command line parser, refer to - // http://stackoverflow.com/questions/4094699/how-does-the-windows-command-interpreter-cmd-exe-parse-scripts/7970912#7970912 - // need quotes for empty arg - if (!arg) { - return '""'; - } - // determine whether the arg needs to be quoted - const cmdSpecialChars = [ - ' ', - '\t', - '&', - '(', - ')', - '[', - ']', - '{', - '}', - '^', - '=', - ';', - '!', - "'", - '+', - ',', - '`', - '~', - '|', - '<', - '>', - '"' - ]; - let needsQuotes = false; - for (const char of arg) { - if (cmdSpecialChars.some(x => x === char)) { - needsQuotes = true; - break; - } - } - // short-circuit if quotes not needed - if (!needsQuotes) { - return arg; - } - // the following quoting rules are very similar to the rules that by libuv applies. - // - // 1) wrap the string in quotes - // - // 2) double-up quotes - i.e. " => "" - // - // this is different from the libuv quoting rules. libuv replaces " with \", which unfortunately - // doesn't work well with a cmd.exe command line. - // - // note, replacing " with "" also works well if the arg is passed to a downstream .NET console app. - // for example, the command line: - // foo.exe "myarg:""my val""" - // is parsed by a .NET console app into an arg array: - // [ "myarg:\"my val\"" ] - // which is the same end result when applying libuv quoting rules. although the actual - // command line from libuv quoting rules would look like: - // foo.exe "myarg:\"my val\"" - // - // 3) double-up slashes that precede a quote, - // e.g. hello \world => "hello \world" - // hello\"world => "hello\\""world" - // hello\\"world => "hello\\\\""world" - // hello world\ => "hello world\\" - // - // technically this is not required for a cmd.exe command line, or the batch argument parser. - // the reasons for including this as a .cmd quoting rule are: - // - // a) this is optimized for the scenario where the argument is passed from the .cmd file to an - // external program. many programs (e.g. .NET console apps) rely on the slash-doubling rule. - // - // b) it's what we've been doing previously (by deferring to node default behavior) and we - // haven't heard any complaints about that aspect. - // - // note, a weakness of the quoting rules chosen here, is that % is not escaped. in fact, % cannot be - // escaped when used on the command line directly - even though within a .cmd file % can be escaped - // by using %%. - // - // the saving grace is, on the command line, %var% is left as-is if var is not defined. this contrasts - // the line parsing rules within a .cmd file, where if var is not defined it is replaced with nothing. - // - // one option that was explored was replacing % with ^% - i.e. %var% => ^%var^%. this hack would - // often work, since it is unlikely that var^ would exist, and the ^ character is removed when the - // variable is used. the problem, however, is that ^ is not removed when %* is used to pass the args - // to an external program. - // - // an unexplored potential solution for the % escaping problem, is to create a wrapper .cmd file. - // % can be escaped within a .cmd file. - let reverse = '"'; - let quoteHit = true; - for (let i = arg.length; i > 0; i--) { - // walk the string in reverse - reverse += arg[i - 1]; - if (quoteHit && arg[i - 1] === '\\') { - reverse += '\\'; // double the slash - } - else if (arg[i - 1] === '"') { - quoteHit = true; - reverse += '"'; // double the quote - } - else { - quoteHit = false; - } - } - reverse += '"'; - return reverse - .split('') - .reverse() - .join(''); - } - _uvQuoteCmdArg(arg) { - // Tool runner wraps child_process.spawn() and needs to apply the same quoting as - // Node in certain cases where the undocumented spawn option windowsVerbatimArguments - // is used. - // - // Since this function is a port of quote_cmd_arg from Node 4.x (technically, lib UV, - // see https://github.com/nodejs/node/blob/v4.x/deps/uv/src/win/process.c for details), - // pasting copyright notice from Node within this function: - // - // Copyright Joyent, Inc. and other Node contributors. All rights reserved. - // - // Permission is hereby granted, free of charge, to any person obtaining a copy - // of this software and associated documentation files (the "Software"), to - // deal in the Software without restriction, including without limitation the - // rights to use, copy, modify, merge, publish, distribute, sublicense, and/or - // sell copies of the Software, and to permit persons to whom the Software is - // furnished to do so, subject to the following conditions: - // - // The above copyright notice and this permission notice shall be included in - // all copies or substantial portions of the Software. - // - // THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR - // IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, - // FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE - // AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER - // LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING - // FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS - // IN THE SOFTWARE. - if (!arg) { - // Need double quotation for empty argument - return '""'; - } - if (!arg.includes(' ') && !arg.includes('\t') && !arg.includes('"')) { - // No quotation needed - return arg; - } - if (!arg.includes('"') && !arg.includes('\\')) { - // No embedded double quotes or backslashes, so I can just wrap - // quote marks around the whole thing. - return `"${arg}"`; - } - // Expected input/output: - // input : hello"world - // output: "hello\"world" - // input : hello""world - // output: "hello\"\"world" - // input : hello\world - // output: hello\world - // input : hello\\world - // output: hello\\world - // input : hello\"world - // output: "hello\\\"world" - // input : hello\\"world - // output: "hello\\\\\"world" - // input : hello world\ - // output: "hello world\\" - note the comment in libuv actually reads "hello world\" - // but it appears the comment is wrong, it should be "hello world\\" - let reverse = '"'; - let quoteHit = true; - for (let i = arg.length; i > 0; i--) { - // walk the string in reverse - reverse += arg[i - 1]; - if (quoteHit && arg[i - 1] === '\\') { - reverse += '\\'; - } - else if (arg[i - 1] === '"') { - quoteHit = true; - reverse += '\\'; - } - else { - quoteHit = false; - } - } - reverse += '"'; - return reverse - .split('') - .reverse() - .join(''); - } - _cloneExecOptions(options) { - options = options || {}; - const result = { - cwd: options.cwd || process.cwd(), - env: options.env || process.env, - silent: options.silent || false, - windowsVerbatimArguments: options.windowsVerbatimArguments || false, - failOnStdErr: options.failOnStdErr || false, - ignoreReturnCode: options.ignoreReturnCode || false, - delay: options.delay || 10000 - }; - result.outStream = options.outStream || process.stdout; - result.errStream = options.errStream || process.stderr; - return result; - } - _getSpawnOptions(options, toolPath) { - options = options || {}; - const result = {}; - result.cwd = options.cwd; - result.env = options.env; - result['windowsVerbatimArguments'] = - options.windowsVerbatimArguments || this._isCmdFile(); - if (options.windowsVerbatimArguments) { - result.argv0 = `"${toolPath}"`; - } - return result; - } - /** - * Exec a tool. - * Output will be streamed to the live console. - * Returns promise with return code - * - * @param tool path to tool to exec - * @param options optional exec options. See ExecOptions - * @returns number - */ - exec() { - return __awaiter(this, void 0, void 0, function* () { - return new Promise((resolve, reject) => { - this._debug(`exec tool: ${this.toolPath}`); - this._debug('arguments:'); - for (const arg of this.args) { - this._debug(` ${arg}`); - } - const optionsNonNull = this._cloneExecOptions(this.options); - if (!optionsNonNull.silent && optionsNonNull.outStream) { - optionsNonNull.outStream.write(this._getCommandString(optionsNonNull) + os.EOL); - } - const state = new ExecState(optionsNonNull, this.toolPath); - state.on('debug', (message) => { - this._debug(message); - }); - const fileName = this._getSpawnFileName(); - const cp = child.spawn(fileName, this._getSpawnArgs(optionsNonNull), this._getSpawnOptions(this.options, fileName)); - const stdbuffer = ''; - if (cp.stdout) { - cp.stdout.on('data', (data) => { - if (this.options.listeners && this.options.listeners.stdout) { - this.options.listeners.stdout(data); - } - if (!optionsNonNull.silent && optionsNonNull.outStream) { - optionsNonNull.outStream.write(data); - } - this._processLineBuffer(data, stdbuffer, (line) => { - if (this.options.listeners && this.options.listeners.stdline) { - this.options.listeners.stdline(line); - } - }); - }); - } - const errbuffer = ''; - if (cp.stderr) { - cp.stderr.on('data', (data) => { - state.processStderr = true; - if (this.options.listeners && this.options.listeners.stderr) { - this.options.listeners.stderr(data); - } - if (!optionsNonNull.silent && - optionsNonNull.errStream && - optionsNonNull.outStream) { - const s = optionsNonNull.failOnStdErr - ? optionsNonNull.errStream - : optionsNonNull.outStream; - s.write(data); - } - this._processLineBuffer(data, errbuffer, (line) => { - if (this.options.listeners && this.options.listeners.errline) { - this.options.listeners.errline(line); - } - }); - }); - } - cp.on('error', (err) => { - state.processError = err.message; - state.processExited = true; - state.processClosed = true; - state.CheckComplete(); - }); - cp.on('exit', (code) => { - state.processExitCode = code; - state.processExited = true; - this._debug(`Exit code ${code} received from tool '${this.toolPath}'`); - state.CheckComplete(); - }); - cp.on('close', (code) => { - state.processExitCode = code; - state.processExited = true; - state.processClosed = true; - this._debug(`STDIO streams have closed for tool '${this.toolPath}'`); - state.CheckComplete(); - }); - state.on('done', (error, exitCode) => { - if (stdbuffer.length > 0) { - this.emit('stdline', stdbuffer); - } - if (errbuffer.length > 0) { - this.emit('errline', errbuffer); - } - cp.removeAllListeners(); - if (error) { - reject(error); - } - else { - resolve(exitCode); - } - }); - }); - }); - } + +var crypto = __webpack_require__(417) + +function randomString (size) { + var bits = (size + 1) * 6 + var buffer = crypto.randomBytes(Math.ceil(bits / 8)) + var string = buffer.toString('base64').replace(/\+/g, '-').replace(/\//g, '_').replace(/=/g, '') + return string.slice(0, size) } -exports.ToolRunner = ToolRunner; -/** - * Convert an arg string to an array of args. Handles escaping - * - * @param argString string of arguments - * @returns string[] array of arguments - */ -function argStringToArray(argString) { - const args = []; - let inQuotes = false; - let escaped = false; - let arg = ''; - function append(c) { - // we only escape double quotes. - if (escaped && c !== '"') { - arg += '\\'; - } - arg += c; - escaped = false; - } - for (let i = 0; i < argString.length; i++) { - const c = argString.charAt(i); - if (c === '"') { - if (!escaped) { - inQuotes = !inQuotes; - } - else { - append(c); - } - continue; - } - if (c === '\\' && escaped) { - append(c); - continue; - } - if (c === '\\' && inQuotes) { - escaped = true; - continue; - } - if (c === ' ' && !inQuotes) { - if (arg.length > 0) { - args.push(arg); - arg = ''; - } - continue; - } - append(c); - } - if (arg.length > 0) { - args.push(arg.trim()); - } - return args; + +function calculatePayloadHash (payload, algorithm, contentType) { + var hash = crypto.createHash(algorithm) + hash.update('hawk.1.payload\n') + hash.update((contentType ? contentType.split(';')[0].trim().toLowerCase() : '') + '\n') + hash.update(payload || '') + hash.update('\n') + return hash.digest('base64') } -exports.argStringToArray = argStringToArray; -class ExecState extends events.EventEmitter { - constructor(options, toolPath) { - super(); - this.processClosed = false; // tracks whether the process has exited and stdio is closed - this.processError = ''; - this.processExitCode = 0; - this.processExited = false; // tracks whether the process has exited - this.processStderr = false; // tracks whether stderr was written to - this.delay = 10000; // 10 seconds - this.done = false; - this.timeout = null; - if (!toolPath) { - throw new Error('toolPath must not be empty'); - } - this.options = options; - this.toolPath = toolPath; - if (options.delay) { - this.delay = options.delay; - } - } - CheckComplete() { - if (this.done) { - return; - } - if (this.processClosed) { - this._setResult(); - } - else if (this.processExited) { - this.timeout = setTimeout(ExecState.HandleTimeout, this.delay, this); - } - } - _debug(message) { - this.emit('debug', message); - } - _setResult() { - // determine whether there is an error - let error; - if (this.processExited) { - if (this.processError) { - error = new Error(`There was an error when attempting to execute the process '${this.toolPath}'. This may indicate the process failed to start. Error: ${this.processError}`); - } - else if (this.processExitCode !== 0 && !this.options.ignoreReturnCode) { - error = new Error(`The process '${this.toolPath}' failed with exit code ${this.processExitCode}`); - } - else if (this.processStderr && this.options.failOnStdErr) { - error = new Error(`The process '${this.toolPath}' failed because one or more lines were written to the STDERR stream`); - } - } - // clear the timeout - if (this.timeout) { - clearTimeout(this.timeout); - this.timeout = null; - } - this.done = true; - this.emit('done', error, this.processExitCode); - } - static HandleTimeout(state) { - if (state.done) { - return; - } - if (!state.processClosed && state.processExited) { - const message = `The STDIO streams did not close within ${state.delay / - 1000} seconds of the exit event from process '${state.toolPath}'. This may indicate a child process inherited the STDIO streams and has not yet exited.`; - state._debug(message); - } - state._setResult(); - } -} -//# sourceMappingURL=toolrunner.js.map -/***/ }), +exports.calculateMac = function (credentials, opts) { + var normalized = 'hawk.1.header\n' + + opts.ts + '\n' + + opts.nonce + '\n' + + (opts.method || '').toUpperCase() + '\n' + + opts.resource + '\n' + + opts.host.toLowerCase() + '\n' + + opts.port + '\n' + + (opts.hash || '') + '\n' -/***/ 869: -/***/ (function(module) { - -"use strict"; - - -var KEYWORDS = [ - 'multipleOf', - 'maximum', - 'exclusiveMaximum', - 'minimum', - 'exclusiveMinimum', - 'maxLength', - 'minLength', - 'pattern', - 'additionalItems', - 'maxItems', - 'minItems', - 'uniqueItems', - 'maxProperties', - 'minProperties', - 'required', - 'additionalProperties', - 'enum', - 'format', - 'const' -]; - -module.exports = function (metaSchema, keywordsJsonPointers) { - for (var i=0; i 8) { - out += ' || validate.schema' + ($schemaPath) + '.hasOwnProperty(' + ($key) + ') '; + out += 'function(data, dataPath, parentData, parentDataProperty, rootData) { \'use strict\'; '; + if ($id && (it.opts.sourceCode || it.opts.processCode)) { + out += ' ' + ('/\*# sourceURL=' + $id + ' */') + ' '; + } + } + if (typeof it.schema == 'boolean' || !($refKeywords || it.schema.$ref)) { + var $keyword = 'false schema'; + var $lvl = it.level; + var $dataLvl = it.dataLevel; + var $schema = it.schema[$keyword]; + var $schemaPath = it.schemaPath + it.util.getProperty($keyword); + var $errSchemaPath = it.errSchemaPath + '/' + $keyword; + var $breakOnError = !it.opts.allErrors; + var $errorKeyword; + var $data = 'data' + ($dataLvl || ''); + var $valid = 'valid' + $lvl; + if (it.schema === false) { + if (it.isTop) { + $breakOnError = true; + } else { + out += ' var ' + ($valid) + ' = false; '; + } + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'false schema') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} '; + if (it.opts.messages !== false) { + out += ' , message: \'boolean schema is false\' '; + } + if (it.opts.verbose) { + out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; } else { - var arr1 = $schemaKeys; - if (arr1) { - var $propertyKey, i1 = -1, - l1 = arr1.length - 1; - while (i1 < l1) { - $propertyKey = arr1[i1 += 1]; - out += ' || ' + ($key) + ' == ' + (it.util.toQuotedString($propertyKey)) + ' '; + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + } else { + if (it.isTop) { + if ($async) { + out += ' return data; '; + } else { + out += ' validate.errors = null; return true; '; + } + } else { + out += ' var ' + ($valid) + ' = true; '; + } + } + if (it.isTop) { + out += ' }; return validate; '; + } + return out; + } + if (it.isTop) { + var $top = it.isTop, + $lvl = it.level = 0, + $dataLvl = it.dataLevel = 0, + $data = 'data'; + it.rootId = it.resolve.fullPath(it.self._getId(it.root.schema)); + it.baseId = it.baseId || it.rootId; + delete it.isTop; + it.dataPathArr = [undefined]; + if (it.schema.default !== undefined && it.opts.useDefaults && it.opts.strictDefaults) { + var $defaultMsg = 'default is ignored in the schema root'; + if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); + else throw new Error($defaultMsg); + } + out += ' var vErrors = null; '; + out += ' var errors = 0; '; + out += ' if (rootData === undefined) rootData = data; '; + } else { + var $lvl = it.level, + $dataLvl = it.dataLevel, + $data = 'data' + ($dataLvl || ''); + if ($id) it.baseId = it.resolve.url(it.baseId, $id); + if ($async && !it.async) throw new Error('async schema in sync schema'); + out += ' var errs_' + ($lvl) + ' = errors;'; + } + var $valid = 'valid' + $lvl, + $breakOnError = !it.opts.allErrors, + $closingBraces1 = '', + $closingBraces2 = ''; + var $errorKeyword; + var $typeSchema = it.schema.type, + $typeIsArray = Array.isArray($typeSchema); + if ($typeSchema && it.opts.nullable && it.schema.nullable === true) { + if ($typeIsArray) { + if ($typeSchema.indexOf('null') == -1) $typeSchema = $typeSchema.concat('null'); + } else if ($typeSchema != 'null') { + $typeSchema = [$typeSchema, 'null']; + $typeIsArray = true; + } + } + if ($typeIsArray && $typeSchema.length == 1) { + $typeSchema = $typeSchema[0]; + $typeIsArray = false; + } + if (it.schema.$ref && $refKeywords) { + if (it.opts.extendRefs == 'fail') { + throw new Error('$ref: validation keywords used in schema at path "' + it.errSchemaPath + '" (see option extendRefs)'); + } else if (it.opts.extendRefs !== true) { + $refKeywords = false; + it.logger.warn('$ref: keywords ignored in schema at path "' + it.errSchemaPath + '"'); + } + } + if (it.schema.$comment && it.opts.$comment) { + out += ' ' + (it.RULES.all.$comment.code(it, '$comment')); + } + if ($typeSchema) { + if (it.opts.coerceTypes) { + var $coerceToTypes = it.util.coerceToTypes(it.opts.coerceTypes, $typeSchema); + } + var $rulesGroup = it.RULES.types[$typeSchema]; + if ($coerceToTypes || $typeIsArray || $rulesGroup === true || ($rulesGroup && !$shouldUseGroup($rulesGroup))) { + var $schemaPath = it.schemaPath + '.type', + $errSchemaPath = it.errSchemaPath + '/type'; + var $schemaPath = it.schemaPath + '.type', + $errSchemaPath = it.errSchemaPath + '/type', + $method = $typeIsArray ? 'checkDataTypes' : 'checkDataType'; + out += ' if (' + (it.util[$method]($typeSchema, $data, true)) + ') { '; + if ($coerceToTypes) { + var $dataType = 'dataType' + $lvl, + $coerced = 'coerced' + $lvl; + out += ' var ' + ($dataType) + ' = typeof ' + ($data) + '; '; + if (it.opts.coerceTypes == 'array') { + out += ' if (' + ($dataType) + ' == \'object\' && Array.isArray(' + ($data) + ')) ' + ($dataType) + ' = \'array\'; '; + } + out += ' var ' + ($coerced) + ' = undefined; '; + var $bracesCoercion = ''; + var arr1 = $coerceToTypes; + if (arr1) { + var $type, $i = -1, + l1 = arr1.length - 1; + while ($i < l1) { + $type = arr1[$i += 1]; + if ($i) { + out += ' if (' + ($coerced) + ' === undefined) { '; + $bracesCoercion += '}'; } - } - } - } - if ($pPropertyKeys.length) { - var arr2 = $pPropertyKeys; - if (arr2) { - var $pProperty, $i = -1, - l2 = arr2.length - 1; - while ($i < l2) { - $pProperty = arr2[$i += 1]; - out += ' || ' + (it.usePattern($pProperty)) + '.test(' + ($key) + ') '; - } - } - } - out += ' ); if (isAdditional' + ($lvl) + ') { '; - } - if ($removeAdditional == 'all') { - out += ' delete ' + ($data) + '[' + ($key) + ']; '; - } else { - var $currentErrorPath = it.errorPath; - var $additionalProperty = '\' + ' + $key + ' + \''; - if (it.opts._errorDataPathProperty) { - it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); - } - if ($noAdditional) { - if ($removeAdditional) { - out += ' delete ' + ($data) + '[' + ($key) + ']; '; - } else { - out += ' ' + ($nextValid) + ' = false; '; - var $currErrSchemaPath = $errSchemaPath; - $errSchemaPath = it.errSchemaPath + '/additionalProperties'; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('additionalProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { additionalProperty: \'' + ($additionalProperty) + '\' } '; - if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is an invalid additional property'; - } else { - out += 'should NOT have additional properties'; + if (it.opts.coerceTypes == 'array' && $type != 'array') { + out += ' if (' + ($dataType) + ' == \'array\' && ' + ($data) + '.length == 1) { ' + ($coerced) + ' = ' + ($data) + ' = ' + ($data) + '[0]; ' + ($dataType) + ' = typeof ' + ($data) + '; } '; + } + if ($type == 'string') { + out += ' if (' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\') ' + ($coerced) + ' = \'\' + ' + ($data) + '; else if (' + ($data) + ' === null) ' + ($coerced) + ' = \'\'; '; + } else if ($type == 'number' || $type == 'integer') { + out += ' if (' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' === null || (' + ($dataType) + ' == \'string\' && ' + ($data) + ' && ' + ($data) + ' == +' + ($data) + ' '; + if ($type == 'integer') { + out += ' && !(' + ($data) + ' % 1)'; } - out += '\' '; + out += ')) ' + ($coerced) + ' = +' + ($data) + '; '; + } else if ($type == 'boolean') { + out += ' if (' + ($data) + ' === \'false\' || ' + ($data) + ' === 0 || ' + ($data) + ' === null) ' + ($coerced) + ' = false; else if (' + ($data) + ' === \'true\' || ' + ($data) + ' === 1) ' + ($coerced) + ' = true; '; + } else if ($type == 'null') { + out += ' if (' + ($data) + ' === \'\' || ' + ($data) + ' === 0 || ' + ($data) + ' === false) ' + ($coerced) + ' = null; '; + } else if (it.opts.coerceTypes == 'array' && $type == 'array') { + out += ' if (' + ($dataType) + ' == \'string\' || ' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' == null) ' + ($coerced) + ' = [' + ($data) + ']; '; } - if (it.opts.verbose) { - out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - $errSchemaPath = $currErrSchemaPath; - if ($breakOnError) { - out += ' break; '; } } - } else if ($additionalIsSchema) { - if ($removeAdditional == 'failing') { - out += ' var ' + ($errs) + ' = errors; '; - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - $it.schema = $aProperties; - $it.schemaPath = it.schemaPath + '.additionalProperties'; - $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; - $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); - var $passData = $data + '[' + $key + ']'; - $it.dataPathArr[$dataNxt] = $key; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + out += ' ' + ($bracesCoercion) + ' if (' + ($coerced) + ' === undefined) { '; + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + out += '' + ($typeSchema); } - out += ' if (!' + ($nextValid) + ') { errors = ' + ($errs) + '; if (validate.errors !== null) { if (errors) validate.errors.length = errors; else validate.errors = null; } delete ' + ($data) + '[' + ($key) + ']; } '; - it.compositeRule = $it.compositeRule = $wasComposite; + out += '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be '; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; } else { - $it.schema = $aProperties; - $it.schemaPath = it.schemaPath + '.additionalProperties'; - $it.errSchemaPath = it.errSchemaPath + '/additionalProperties'; - $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); - var $passData = $data + '[' + $key + ']'; - $it.dataPathArr[$dataNxt] = $key; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; + out += ' validate.errors = [' + (__err) + ']; return false; '; } - if ($breakOnError) { - out += ' if (!' + ($nextValid) + ') break; '; + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; + } + out += ' } else { '; + var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData', + $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty'; + out += ' ' + ($data) + ' = ' + ($coerced) + '; '; + if (!$dataLvl) { + out += 'if (' + ($parentData) + ' !== undefined)'; + } + out += ' ' + ($parentData) + '[' + ($parentDataProperty) + '] = ' + ($coerced) + '; } '; + } else { + var $$outStack = $$outStack || []; + $$outStack.push(out); + out = ''; /* istanbul ignore else */ + if (it.createErrors !== false) { + out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); } + out += '\' } '; + if (it.opts.messages !== false) { + out += ' , message: \'should be '; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' '; + } + if (it.opts.verbose) { + out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; + } + out += ' } '; + } else { + out += ' {} '; + } + var __err = out; + out = $$outStack.pop(); + if (!it.compositeRule && $breakOnError) { + /* istanbul ignore if */ + if (it.async) { + out += ' throw new ValidationError([' + (__err) + ']); '; + } else { + out += ' validate.errors = [' + (__err) + ']; return false; '; + } + } else { + out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } } - it.errorPath = $currentErrorPath; - } - if ($someProperties) { out += ' } '; } - out += ' } '; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; - } } - var $useDefaults = it.opts.useDefaults && !it.compositeRule; - if ($schemaKeys.length) { - var arr3 = $schemaKeys; - if (arr3) { - var $propertyKey, i3 = -1, - l3 = arr3.length - 1; - while (i3 < l3) { - $propertyKey = arr3[i3 += 1]; - var $sch = $schema[$propertyKey]; - if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { - var $prop = it.util.getProperty($propertyKey), - $passData = $data + $prop, - $hasDefault = $useDefaults && $sch.default !== undefined; - $it.schema = $sch; - $it.schemaPath = $schemaPath + $prop; - $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($propertyKey); - $it.errorPath = it.util.getPath(it.errorPath, $propertyKey, it.opts.jsonPointers); - $it.dataPathArr[$dataNxt] = it.util.toQuotedString($propertyKey); - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - $code = it.util.varReplace($code, $nextData, $passData); - var $useData = $passData; - } else { - var $useData = $nextData; - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; '; + if (it.schema.$ref && !$refKeywords) { + out += ' ' + (it.RULES.all.$ref.code(it, '$ref')) + ' '; + if ($breakOnError) { + out += ' } if (errors === '; + if ($top) { + out += '0'; + } else { + out += 'errs_' + ($lvl); + } + out += ') { '; + $closingBraces2 += '}'; + } + } else { + var arr2 = it.RULES; + if (arr2) { + var $rulesGroup, i2 = -1, + l2 = arr2.length - 1; + while (i2 < l2) { + $rulesGroup = arr2[i2 += 1]; + if ($shouldUseGroup($rulesGroup)) { + if ($rulesGroup.type) { + out += ' if (' + (it.util.checkDataType($rulesGroup.type, $data)) + ') { '; } - if ($hasDefault) { - out += ' ' + ($code) + ' '; - } else { - if ($requiredHash && $requiredHash[$propertyKey]) { - out += ' if ( ' + ($useData) + ' === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; + if (it.opts.useDefaults) { + if ($rulesGroup.type == 'object' && it.schema.properties) { + var $schema = it.schema.properties, + $schemaKeys = Object.keys($schema); + var arr3 = $schemaKeys; + if (arr3) { + var $propertyKey, i3 = -1, + l3 = arr3.length - 1; + while (i3 < l3) { + $propertyKey = arr3[i3 += 1]; + var $sch = $schema[$propertyKey]; + if ($sch.default !== undefined) { + var $passData = $data + it.util.getProperty($propertyKey); + if (it.compositeRule) { + if (it.opts.strictDefaults) { + var $defaultMsg = 'default is ignored for: ' + $passData; + if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); + else throw new Error($defaultMsg); + } + } else { + out += ' if (' + ($passData) + ' === undefined '; + if (it.opts.useDefaults == 'empty') { + out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' '; + } + out += ' ) ' + ($passData) + ' = '; + if (it.opts.useDefaults == 'shared') { + out += ' ' + (it.useDefault($sch.default)) + ' '; + } else { + out += ' ' + (JSON.stringify($sch.default)) + ' '; + } + out += '; '; + } + } + } } - out += ') { ' + ($nextValid) + ' = false; '; - var $currentErrorPath = it.errorPath, - $currErrSchemaPath = $errSchemaPath, - $missingProperty = it.util.escapeQuotes($propertyKey); - if (it.opts._errorDataPathProperty) { - it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers); + } else if ($rulesGroup.type == 'array' && Array.isArray(it.schema.items)) { + var arr4 = it.schema.items; + if (arr4) { + var $sch, $i = -1, + l4 = arr4.length - 1; + while ($i < l4) { + $sch = arr4[$i += 1]; + if ($sch.default !== undefined) { + var $passData = $data + '[' + $i + ']'; + if (it.compositeRule) { + if (it.opts.strictDefaults) { + var $defaultMsg = 'default is ignored for: ' + $passData; + if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg); + else throw new Error($defaultMsg); + } + } else { + out += ' if (' + ($passData) + ' === undefined '; + if (it.opts.useDefaults == 'empty') { + out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' '; + } + out += ' ) ' + ($passData) + ' = '; + if (it.opts.useDefaults == 'shared') { + out += ' ' + (it.useDefault($sch.default)) + ' '; + } else { + out += ' ' + (JSON.stringify($sch.default)) + ' '; + } + out += '; '; + } + } + } } - $errSchemaPath = it.errSchemaPath + '/required'; + } + } + var arr5 = $rulesGroup.rules; + if (arr5) { + var $rule, i5 = -1, + l5 = arr5.length - 1; + while (i5 < l5) { + $rule = arr5[i5 += 1]; + if ($shouldUseRule($rule)) { + var $code = $rule.code(it, $rule.keyword, $rulesGroup.type); + if ($code) { + out += ' ' + ($code) + ' '; + if ($breakOnError) { + $closingBraces1 += '}'; + } + } + } + } + } + if ($breakOnError) { + out += ' ' + ($closingBraces1) + ' '; + $closingBraces1 = ''; + } + if ($rulesGroup.type) { + out += ' } '; + if ($typeSchema && $typeSchema === $rulesGroup.type && !$coerceToTypes) { + out += ' else { '; + var $schemaPath = it.schemaPath + '.type', + $errSchemaPath = it.errSchemaPath + '/type'; var $$outStack = $$outStack || []; $$outStack.push(out); out = ''; /* istanbul ignore else */ if (it.createErrors !== false) { - out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } '; + out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \''; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); + } else { + out += '' + ($typeSchema); + } + out += '\' } '; if (it.opts.messages !== false) { - out += ' , message: \''; - if (it.opts._errorDataPathProperty) { - out += 'is a required property'; + out += ' , message: \'should be '; + if ($typeIsArray) { + out += '' + ($typeSchema.join(",")); } else { - out += 'should have required property \\\'' + ($missingProperty) + '\\\''; + out += '' + ($typeSchema); } out += '\' '; } @@ -30972,2716 +33696,850 @@ module.exports = function generate_properties(it, $keyword, $ruleType) { } else { out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; } - $errSchemaPath = $currErrSchemaPath; - it.errorPath = $currentErrorPath; - out += ' } else { '; - } else { - if ($breakOnError) { - out += ' if ( ' + ($useData) + ' === undefined '; - if ($ownProperties) { - out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ') { ' + ($nextValid) + ' = true; } else { '; - } else { - out += ' if (' + ($useData) + ' !== undefined '; - if ($ownProperties) { - out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') '; - } - out += ' ) { '; - } + out += ' } '; } - out += ' ' + ($code) + ' } '; - } - } - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; - } - } - } - } - if ($pPropertyKeys.length) { - var arr4 = $pPropertyKeys; - if (arr4) { - var $pProperty, i4 = -1, - l4 = arr4.length - 1; - while (i4 < l4) { - $pProperty = arr4[i4 += 1]; - var $sch = $pProperties[$pProperty]; - if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { - $it.schema = $sch; - $it.schemaPath = it.schemaPath + '.patternProperties' + it.util.getProperty($pProperty); - $it.errSchemaPath = it.errSchemaPath + '/patternProperties/' + it.util.escapeFragment($pProperty); - if ($ownProperties) { - out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; '; - } else { - out += ' for (var ' + ($key) + ' in ' + ($data) + ') { '; - } - out += ' if (' + (it.usePattern($pProperty)) + '.test(' + ($key) + ')) { '; - $it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers); - var $passData = $data + '[' + $key + ']'; - $it.dataPathArr[$dataNxt] = $key; - var $code = it.validate($it); - $it.baseId = $currentBaseId; - if (it.util.varOccurences($code, $nextData) < 2) { - out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' '; - } else { - out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' '; } if ($breakOnError) { - out += ' if (!' + ($nextValid) + ') break; '; - } - out += ' } '; - if ($breakOnError) { - out += ' else ' + ($nextValid) + ' = true; '; - } - out += ' } '; - if ($breakOnError) { - out += ' if (' + ($nextValid) + ') { '; - $closingBraces += '}'; + out += ' if (errors === '; + if ($top) { + out += '0'; + } else { + out += 'errs_' + ($lvl); + } + out += ') { '; + $closingBraces2 += '}'; } } } } } if ($breakOnError) { - out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {'; + out += ' ' + ($closingBraces2) + ' '; + } + if ($top) { + if ($async) { + out += ' if (errors === 0) return data; '; + out += ' else throw new ValidationError(vErrors); '; + } else { + out += ' validate.errors = vErrors; '; + out += ' return errors === 0; '; + } + out += ' }; return validate;'; + } else { + out += ' var ' + ($valid) + ' = errors === errs_' + ($lvl) + ';'; } out = it.util.cleanUpCode(out); + if ($top) { + out = it.util.finalCleanUpCode(out, $async); + } + + function $shouldUseGroup($rulesGroup) { + var rules = $rulesGroup.rules; + for (var i = 0; i < rules.length; i++) + if ($shouldUseRule(rules[i])) return true; + } + + function $shouldUseRule($rule) { + return it.schema[$rule.keyword] !== undefined || ($rule.implements && $ruleImplementsSomeKeyword($rule)); + } + + function $ruleImplementsSomeKeyword($rule) { + var impl = $rule.implements; + for (var i = 0; i < impl.length; i++) + if (it.schema[impl[i]] !== undefined) return true; + } return out; } /***/ }), -/***/ 872: +/***/ 972: +/***/ (function(module, __unusedexports, __webpack_require__) { + +/*! + * mime-db + * Copyright(c) 2014 Jonathan Ong + * MIT Licensed + */ + +/** + * Module exports. + */ + +module.exports = __webpack_require__(512) + + +/***/ }), + +/***/ 982: +/***/ (function(module, __unusedexports, __webpack_require__) { + +// Copyright 2017 Joyent, Inc. + +module.exports = { + read: read, + write: write +}; + +var assert = __webpack_require__(477); +var Buffer = __webpack_require__(215).Buffer; +var Key = __webpack_require__(852); +var PrivateKey = __webpack_require__(502); +var utils = __webpack_require__(270); +var SSHBuffer = __webpack_require__(940); +var Dhe = __webpack_require__(290); + +var supportedAlgos = { + 'rsa-sha1' : 5, + 'rsa-sha256' : 8, + 'rsa-sha512' : 10, + 'ecdsa-p256-sha256' : 13, + 'ecdsa-p384-sha384' : 14 + /* + * ed25519 is hypothetically supported with id 15 + * but the common tools available don't appear to be + * capable of generating/using ed25519 keys + */ +}; + +var supportedAlgosById = {}; +Object.keys(supportedAlgos).forEach(function (k) { + supportedAlgosById[supportedAlgos[k]] = k.toUpperCase(); +}); + +function read(buf, options) { + if (typeof (buf) !== 'string') { + assert.buffer(buf, 'buf'); + buf = buf.toString('ascii'); + } + var lines = buf.split('\n'); + if (lines[0].match(/^Private-key-format\: v1/)) { + var algElems = lines[1].split(' '); + var algoNum = parseInt(algElems[1], 10); + var algoName = algElems[2]; + if (!supportedAlgosById[algoNum]) + throw (new Error('Unsupported algorithm: ' + algoName)); + return (readDNSSECPrivateKey(algoNum, lines.slice(2))); + } + + // skip any comment-lines + var line = 0; + /* JSSTYLED */ + while (lines[line].match(/^\;/)) + line++; + // we should now have *one single* line left with our KEY on it. + if ((lines[line].match(/\. IN KEY /) || + lines[line].match(/\. IN DNSKEY /)) && lines[line+1].length === 0) { + return (readRFC3110(lines[line])); + } + throw (new Error('Cannot parse dnssec key')); +} + +function readRFC3110(keyString) { + var elems = keyString.split(' '); + //unused var flags = parseInt(elems[3], 10); + //unused var protocol = parseInt(elems[4], 10); + var algorithm = parseInt(elems[5], 10); + if (!supportedAlgosById[algorithm]) + throw (new Error('Unsupported algorithm: ' + algorithm)); + var base64key = elems.slice(6, elems.length).join(); + var keyBuffer = Buffer.from(base64key, 'base64'); + if (supportedAlgosById[algorithm].match(/^RSA-/)) { + // join the rest of the body into a single base64-blob + var publicExponentLen = keyBuffer.readUInt8(0); + if (publicExponentLen != 3 && publicExponentLen != 1) + throw (new Error('Cannot parse dnssec key: ' + + 'unsupported exponent length')); + + var publicExponent = keyBuffer.slice(1, publicExponentLen+1); + publicExponent = utils.mpNormalize(publicExponent); + var modulus = keyBuffer.slice(1+publicExponentLen); + modulus = utils.mpNormalize(modulus); + // now, make the key + var rsaKey = { + type: 'rsa', + parts: [] + }; + rsaKey.parts.push({ name: 'e', data: publicExponent}); + rsaKey.parts.push({ name: 'n', data: modulus}); + return (new Key(rsaKey)); + } + if (supportedAlgosById[algorithm] === 'ECDSA-P384-SHA384' || + supportedAlgosById[algorithm] === 'ECDSA-P256-SHA256') { + var curve = 'nistp384'; + var size = 384; + if (supportedAlgosById[algorithm].match(/^ECDSA-P256-SHA256/)) { + curve = 'nistp256'; + size = 256; + } + + var ecdsaKey = { + type: 'ecdsa', + curve: curve, + size: size, + parts: [ + {name: 'curve', data: Buffer.from(curve) }, + {name: 'Q', data: utils.ecNormalize(keyBuffer) } + ] + }; + return (new Key(ecdsaKey)); + } + throw (new Error('Unsupported algorithm: ' + + supportedAlgosById[algorithm])); +} + +function elementToBuf(e) { + return (Buffer.from(e.split(' ')[1], 'base64')); +} + +function readDNSSECRSAPrivateKey(elements) { + var rsaParams = {}; + elements.forEach(function (element) { + if (element.split(' ')[0] === 'Modulus:') + rsaParams['n'] = elementToBuf(element); + else if (element.split(' ')[0] === 'PublicExponent:') + rsaParams['e'] = elementToBuf(element); + else if (element.split(' ')[0] === 'PrivateExponent:') + rsaParams['d'] = elementToBuf(element); + else if (element.split(' ')[0] === 'Prime1:') + rsaParams['p'] = elementToBuf(element); + else if (element.split(' ')[0] === 'Prime2:') + rsaParams['q'] = elementToBuf(element); + else if (element.split(' ')[0] === 'Exponent1:') + rsaParams['dmodp'] = elementToBuf(element); + else if (element.split(' ')[0] === 'Exponent2:') + rsaParams['dmodq'] = elementToBuf(element); + else if (element.split(' ')[0] === 'Coefficient:') + rsaParams['iqmp'] = elementToBuf(element); + }); + // now, make the key + var key = { + type: 'rsa', + parts: [ + { name: 'e', data: utils.mpNormalize(rsaParams['e'])}, + { name: 'n', data: utils.mpNormalize(rsaParams['n'])}, + { name: 'd', data: utils.mpNormalize(rsaParams['d'])}, + { name: 'p', data: utils.mpNormalize(rsaParams['p'])}, + { name: 'q', data: utils.mpNormalize(rsaParams['q'])}, + { name: 'dmodp', + data: utils.mpNormalize(rsaParams['dmodp'])}, + { name: 'dmodq', + data: utils.mpNormalize(rsaParams['dmodq'])}, + { name: 'iqmp', + data: utils.mpNormalize(rsaParams['iqmp'])} + ] + }; + return (new PrivateKey(key)); +} + +function readDNSSECPrivateKey(alg, elements) { + if (supportedAlgosById[alg].match(/^RSA-/)) { + return (readDNSSECRSAPrivateKey(elements)); + } + if (supportedAlgosById[alg] === 'ECDSA-P384-SHA384' || + supportedAlgosById[alg] === 'ECDSA-P256-SHA256') { + var d = Buffer.from(elements[0].split(' ')[1], 'base64'); + var curve = 'nistp384'; + var size = 384; + if (supportedAlgosById[alg] === 'ECDSA-P256-SHA256') { + curve = 'nistp256'; + size = 256; + } + // DNSSEC generates the public-key on the fly (go calculate it) + var publicKey = utils.publicFromPrivateECDSA(curve, d); + var Q = publicKey.part['Q'].data; + var ecdsaKey = { + type: 'ecdsa', + curve: curve, + size: size, + parts: [ + {name: 'curve', data: Buffer.from(curve) }, + {name: 'd', data: d }, + {name: 'Q', data: Q } + ] + }; + return (new PrivateKey(ecdsaKey)); + } + throw (new Error('Unsupported algorithm: ' + supportedAlgosById[alg])); +} + +function dnssecTimestamp(date) { + var year = date.getFullYear() + ''; //stringify + var month = (date.getMonth() + 1); + var timestampStr = year + month + date.getUTCDate(); + timestampStr += '' + date.getUTCHours() + date.getUTCMinutes(); + timestampStr += date.getUTCSeconds(); + return (timestampStr); +} + +function rsaAlgFromOptions(opts) { + if (!opts || !opts.hashAlgo || opts.hashAlgo === 'sha1') + return ('5 (RSASHA1)'); + else if (opts.hashAlgo === 'sha256') + return ('8 (RSASHA256)'); + else if (opts.hashAlgo === 'sha512') + return ('10 (RSASHA512)'); + else + throw (new Error('Unknown or unsupported hash: ' + + opts.hashAlgo)); +} + +function writeRSA(key, options) { + // if we're missing parts, add them. + if (!key.part.dmodp || !key.part.dmodq) { + utils.addRSAMissing(key); + } + + var out = ''; + out += 'Private-key-format: v1.3\n'; + out += 'Algorithm: ' + rsaAlgFromOptions(options) + '\n'; + var n = utils.mpDenormalize(key.part['n'].data); + out += 'Modulus: ' + n.toString('base64') + '\n'; + var e = utils.mpDenormalize(key.part['e'].data); + out += 'PublicExponent: ' + e.toString('base64') + '\n'; + var d = utils.mpDenormalize(key.part['d'].data); + out += 'PrivateExponent: ' + d.toString('base64') + '\n'; + var p = utils.mpDenormalize(key.part['p'].data); + out += 'Prime1: ' + p.toString('base64') + '\n'; + var q = utils.mpDenormalize(key.part['q'].data); + out += 'Prime2: ' + q.toString('base64') + '\n'; + var dmodp = utils.mpDenormalize(key.part['dmodp'].data); + out += 'Exponent1: ' + dmodp.toString('base64') + '\n'; + var dmodq = utils.mpDenormalize(key.part['dmodq'].data); + out += 'Exponent2: ' + dmodq.toString('base64') + '\n'; + var iqmp = utils.mpDenormalize(key.part['iqmp'].data); + out += 'Coefficient: ' + iqmp.toString('base64') + '\n'; + // Assume that we're valid as-of now + var timestamp = new Date(); + out += 'Created: ' + dnssecTimestamp(timestamp) + '\n'; + out += 'Publish: ' + dnssecTimestamp(timestamp) + '\n'; + out += 'Activate: ' + dnssecTimestamp(timestamp) + '\n'; + return (Buffer.from(out, 'ascii')); +} + +function writeECDSA(key, options) { + var out = ''; + out += 'Private-key-format: v1.3\n'; + + if (key.curve === 'nistp256') { + out += 'Algorithm: 13 (ECDSAP256SHA256)\n'; + } else if (key.curve === 'nistp384') { + out += 'Algorithm: 14 (ECDSAP384SHA384)\n'; + } else { + throw (new Error('Unsupported curve')); + } + var base64Key = key.part['d'].data.toString('base64'); + out += 'PrivateKey: ' + base64Key + '\n'; + + // Assume that we're valid as-of now + var timestamp = new Date(); + out += 'Created: ' + dnssecTimestamp(timestamp) + '\n'; + out += 'Publish: ' + dnssecTimestamp(timestamp) + '\n'; + out += 'Activate: ' + dnssecTimestamp(timestamp) + '\n'; + + return (Buffer.from(out, 'ascii')); +} + +function write(key, options) { + if (PrivateKey.isPrivateKey(key)) { + if (key.type === 'rsa') { + return (writeRSA(key, options)); + } else if (key.type === 'ecdsa') { + return (writeECDSA(key, options)); + } else { + throw (new Error('Unsupported algorithm: ' + key.type)); + } + } else if (Key.isKey(key)) { + /* + * RFC3110 requires a keyname, and a keytype, which we + * don't really have a mechanism for specifying such + * additional metadata. + */ + throw (new Error('Format "dnssec" only supports ' + + 'writing private keys')); + } else { + throw (new Error('key is not a Key or PrivateKey')); + } +} + + +/***/ }), + +/***/ 985: +/***/ (function(module) { + +module.exports = function(size) { + return new LruCache(size) +} + +function LruCache(size) { + this.capacity = size | 0 + this.map = Object.create(null) + this.list = new DoublyLinkedList() +} + +LruCache.prototype.get = function(key) { + var node = this.map[key] + if (node == null) return undefined + this.used(node) + return node.val +} + +LruCache.prototype.set = function(key, val) { + var node = this.map[key] + if (node != null) { + node.val = val + } else { + if (!this.capacity) this.prune() + if (!this.capacity) return false + node = new DoublyLinkedNode(key, val) + this.map[key] = node + this.capacity-- + } + this.used(node) + return true +} + +LruCache.prototype.used = function(node) { + this.list.moveToFront(node) +} + +LruCache.prototype.prune = function() { + var node = this.list.pop() + if (node != null) { + delete this.map[node.key] + this.capacity++ + } +} + + +function DoublyLinkedList() { + this.firstNode = null + this.lastNode = null +} + +DoublyLinkedList.prototype.moveToFront = function(node) { + if (this.firstNode == node) return + + this.remove(node) + + if (this.firstNode == null) { + this.firstNode = node + this.lastNode = node + node.prev = null + node.next = null + } else { + node.prev = null + node.next = this.firstNode + node.next.prev = node + this.firstNode = node + } +} + +DoublyLinkedList.prototype.pop = function() { + var lastNode = this.lastNode + if (lastNode != null) { + this.remove(lastNode) + } + return lastNode +} + +DoublyLinkedList.prototype.remove = function(node) { + if (this.firstNode == node) { + this.firstNode = node.next + } else if (node.prev != null) { + node.prev.next = node.next + } + if (this.lastNode == node) { + this.lastNode = node.prev + } else if (node.next != null) { + node.next.prev = node.prev + } +} + + +function DoublyLinkedNode(key, val) { + this.key = key + this.val = val + this.prev = null + this.next = null +} + + +/***/ }), + +/***/ 986: +/***/ (function(__unusedmodule, exports, __webpack_require__) { + +"use strict"; + +var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); +}; +Object.defineProperty(exports, "__esModule", { value: true }); +const tr = __webpack_require__(9); +/** + * Exec a command. + * Output will be streamed to the live console. + * Returns promise with return code + * + * @param commandLine command to execute (can include additional args). Must be correctly escaped. + * @param args optional arguments for tool. Escaping is handled by the lib. + * @param options optional exec options. See ExecOptions + * @returns Promise exit code + */ +function exec(commandLine, args, options) { + return __awaiter(this, void 0, void 0, function* () { + const commandArgs = tr.argStringToArray(commandLine); + if (commandArgs.length === 0) { + throw new Error(`Parameter 'commandLine' cannot be null or empty.`); + } + // Path to tool to execute should be first arg + const toolPath = commandArgs[0]; + args = commandArgs.slice(1).concat(args || []); + const runner = new tr.ToolRunner(toolPath, args, options); + return runner.exec(); + }); +} +exports.exec = exec; +//# sourceMappingURL=exec.js.map + +/***/ }), + +/***/ 993: +/***/ (function(module) { + +module.exports = {"$id":"cache.json#","$schema":"http://json-schema.org/draft-06/schema#","properties":{"beforeRequest":{"oneOf":[{"type":"null"},{"$ref":"beforeRequest.json#"}]},"afterRequest":{"oneOf":[{"type":"null"},{"$ref":"afterRequest.json#"}]},"comment":{"type":"string"}}}; + +/***/ }), + +/***/ 998: /***/ (function(module, __unusedexports, __webpack_require__) { // Copyright 2011 Mark Cavage All rights reserved. var assert = __webpack_require__(357); -var Buffer = __webpack_require__(375).Buffer; - -var ASN1 = __webpack_require__(616); -var errors = __webpack_require__(690); +var Buffer = __webpack_require__(215).Buffer; +var ASN1 = __webpack_require__(362); +var errors = __webpack_require__(584); // --- Globals var newInvalidAsn1Error = errors.newInvalidAsn1Error; +var DEFAULT_OPTS = { + size: 1024, + growthFactor: 8 +}; + + +// --- Helpers + +function merge(from, to) { + assert.ok(from); + assert.equal(typeof (from), 'object'); + assert.ok(to); + assert.equal(typeof (to), 'object'); + + var keys = Object.getOwnPropertyNames(from); + keys.forEach(function (key) { + if (to[key]) + return; + + var value = Object.getOwnPropertyDescriptor(from, key); + Object.defineProperty(to, key, value); + }); + + return to; +} + // --- API -function Reader(data) { - if (!data || !Buffer.isBuffer(data)) - throw new TypeError('data must be a node Buffer'); +function Writer(options) { + options = merge(DEFAULT_OPTS, options || {}); - this._buf = data; - this._size = data.length; - - // These hold the "current" state - this._len = 0; + this._buf = Buffer.alloc(options.size || 1024); + this._size = this._buf.length; this._offset = 0; + this._options = options; + + // A list of offsets in the buffer where we need to insert + // sequence tag/len pairs. + this._seq = []; } -Object.defineProperty(Reader.prototype, 'length', { - enumerable: true, - get: function () { return (this._len); } +Object.defineProperty(Writer.prototype, 'buffer', { + get: function () { + if (this._seq.length) + throw newInvalidAsn1Error(this._seq.length + ' unended sequence(s)'); + + return (this._buf.slice(0, this._offset)); + } }); -Object.defineProperty(Reader.prototype, 'offset', { - enumerable: true, - get: function () { return (this._offset); } -}); +Writer.prototype.writeByte = function (b) { + if (typeof (b) !== 'number') + throw new TypeError('argument must be a Number'); -Object.defineProperty(Reader.prototype, 'remain', { - get: function () { return (this._size - this._offset); } -}); - -Object.defineProperty(Reader.prototype, 'buffer', { - get: function () { return (this._buf.slice(this._offset)); } -}); - - -/** - * Reads a single byte and advances offset; you can pass in `true` to make this - * a "peek" operation (i.e., get the byte, but don't advance the offset). - * - * @param {Boolean} peek true means don't move offset. - * @return {Number} the next byte, null if not enough data. - */ -Reader.prototype.readByte = function (peek) { - if (this._size - this._offset < 1) - return null; - - var b = this._buf[this._offset] & 0xff; - - if (!peek) - this._offset += 1; - - return b; + this._ensure(1); + this._buf[this._offset++] = b; }; -Reader.prototype.peek = function () { - return this.readByte(true); -}; +Writer.prototype.writeInt = function (i, tag) { + if (typeof (i) !== 'number') + throw new TypeError('argument must be a Number'); + if (typeof (tag) !== 'number') + tag = ASN1.Integer; + var sz = 4; -/** - * Reads a (potentially) variable length off the BER buffer. This call is - * not really meant to be called directly, as callers have to manipulate - * the internal buffer afterwards. - * - * As a result of this call, you can call `Reader.length`, until the - * next thing called that does a readLength. - * - * @return {Number} the amount of offset to advance the buffer. - * @throws {InvalidAsn1Error} on bad ASN.1 - */ -Reader.prototype.readLength = function (offset) { - if (offset === undefined) - offset = this._offset; - - if (offset >= this._size) - return null; - - var lenB = this._buf[offset++] & 0xff; - if (lenB === null) - return null; - - if ((lenB & 0x80) === 0x80) { - lenB &= 0x7f; - - if (lenB === 0) - throw newInvalidAsn1Error('Indefinite length not supported'); - - if (lenB > 4) - throw newInvalidAsn1Error('encoding too long'); - - if (this._size - offset < lenB) - return null; - - this._len = 0; - for (var i = 0; i < lenB; i++) - this._len = (this._len << 8) + (this._buf[offset++] & 0xff); - - } else { - // Wasn't a variable length - this._len = lenB; + while ((((i & 0xff800000) === 0) || ((i & 0xff800000) === 0xff800000 >> 0)) && + (sz > 1)) { + sz--; + i <<= 8; + } + + if (sz > 4) + throw newInvalidAsn1Error('BER ints cannot be > 0xffffffff'); + + this._ensure(2 + sz); + this._buf[this._offset++] = tag; + this._buf[this._offset++] = sz; + + while (sz-- > 0) { + this._buf[this._offset++] = ((i & 0xff000000) >>> 24); + i <<= 8; } - return offset; }; -/** - * Parses the next sequence in this BER buffer. - * - * To get the length of the sequence, call `Reader.length`. - * - * @return {Number} the sequence's tag. - */ -Reader.prototype.readSequence = function (tag) { - var seq = this.peek(); - if (seq === null) - return null; - if (tag !== undefined && tag !== seq) - throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) + - ': got 0x' + seq.toString(16)); - - var o = this.readLength(this._offset + 1); // stored in `length` - if (o === null) - return null; - - this._offset = o; - return seq; +Writer.prototype.writeNull = function () { + this.writeByte(ASN1.Null); + this.writeByte(0x00); }; -Reader.prototype.readInt = function () { - return this._readTag(ASN1.Integer); +Writer.prototype.writeEnumeration = function (i, tag) { + if (typeof (i) !== 'number') + throw new TypeError('argument must be a Number'); + if (typeof (tag) !== 'number') + tag = ASN1.Enumeration; + + return this.writeInt(i, tag); }; -Reader.prototype.readBoolean = function () { - return (this._readTag(ASN1.Boolean) === 0 ? false : true); +Writer.prototype.writeBoolean = function (b, tag) { + if (typeof (b) !== 'boolean') + throw new TypeError('argument must be a Boolean'); + if (typeof (tag) !== 'number') + tag = ASN1.Boolean; + + this._ensure(3); + this._buf[this._offset++] = tag; + this._buf[this._offset++] = 0x01; + this._buf[this._offset++] = b ? 0xff : 0x00; }; -Reader.prototype.readEnumeration = function () { - return this._readTag(ASN1.Enumeration); -}; - - -Reader.prototype.readString = function (tag, retbuf) { - if (!tag) +Writer.prototype.writeString = function (s, tag) { + if (typeof (s) !== 'string') + throw new TypeError('argument must be a string (was: ' + typeof (s) + ')'); + if (typeof (tag) !== 'number') tag = ASN1.OctetString; - var b = this.peek(); - if (b === null) - return null; - - if (b !== tag) - throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) + - ': got 0x' + b.toString(16)); - - var o = this.readLength(this._offset + 1); // stored in `length` - - if (o === null) - return null; - - if (this.length > this._size - o) - return null; - - this._offset = o; - - if (this.length === 0) - return retbuf ? Buffer.alloc(0) : ''; - - var str = this._buf.slice(this._offset, this._offset + this.length); - this._offset += this.length; - - return retbuf ? str : str.toString('utf8'); + var len = Buffer.byteLength(s); + this.writeByte(tag); + this.writeLength(len); + if (len) { + this._ensure(len); + this._buf.write(s, this._offset); + this._offset += len; + } }; -Reader.prototype.readOID = function (tag) { - if (!tag) + +Writer.prototype.writeBuffer = function (buf, tag) { + if (typeof (tag) !== 'number') + throw new TypeError('tag must be a number'); + if (!Buffer.isBuffer(buf)) + throw new TypeError('argument must be a buffer'); + + this.writeByte(tag); + this.writeLength(buf.length); + this._ensure(buf.length); + buf.copy(this._buf, this._offset, 0, buf.length); + this._offset += buf.length; +}; + + +Writer.prototype.writeStringArray = function (strings) { + if ((!strings instanceof Array)) + throw new TypeError('argument must be an Array[String]'); + + var self = this; + strings.forEach(function (s) { + self.writeString(s); + }); +}; + +// This is really to solve DER cases, but whatever for now +Writer.prototype.writeOID = function (s, tag) { + if (typeof (s) !== 'string') + throw new TypeError('argument must be a string'); + if (typeof (tag) !== 'number') tag = ASN1.OID; - var b = this.readString(tag, true); - if (b === null) - return null; + if (!/^([0-9]+\.){3,}[0-9]+$/.test(s)) + throw new Error('argument is not a valid OID string'); - var values = []; - var value = 0; - - for (var i = 0; i < b.length; i++) { - var byte = b[i] & 0xff; - - value <<= 7; - value += byte & 0x7f; - if ((byte & 0x80) === 0) { - values.push(value); - value = 0; + function encodeOctet(bytes, octet) { + if (octet < 128) { + bytes.push(octet); + } else if (octet < 16384) { + bytes.push((octet >>> 7) | 0x80); + bytes.push(octet & 0x7F); + } else if (octet < 2097152) { + bytes.push((octet >>> 14) | 0x80); + bytes.push(((octet >>> 7) | 0x80) & 0xFF); + bytes.push(octet & 0x7F); + } else if (octet < 268435456) { + bytes.push((octet >>> 21) | 0x80); + bytes.push(((octet >>> 14) | 0x80) & 0xFF); + bytes.push(((octet >>> 7) | 0x80) & 0xFF); + bytes.push(octet & 0x7F); + } else { + bytes.push(((octet >>> 28) | 0x80) & 0xFF); + bytes.push(((octet >>> 21) | 0x80) & 0xFF); + bytes.push(((octet >>> 14) | 0x80) & 0xFF); + bytes.push(((octet >>> 7) | 0x80) & 0xFF); + bytes.push(octet & 0x7F); } } - value = values.shift(); - values.unshift(value % 40); - values.unshift((value / 40) >> 0); + var tmp = s.split('.'); + var bytes = []; + bytes.push(parseInt(tmp[0], 10) * 40 + parseInt(tmp[1], 10)); + tmp.slice(2).forEach(function (b) { + encodeOctet(bytes, parseInt(b, 10)); + }); - return values.join('.'); + var self = this; + this._ensure(2 + bytes.length); + this.writeByte(tag); + this.writeLength(bytes.length); + bytes.forEach(function (b) { + self.writeByte(b); + }); }; -Reader.prototype._readTag = function (tag) { - assert.ok(tag !== undefined); +Writer.prototype.writeLength = function (len) { + if (typeof (len) !== 'number') + throw new TypeError('argument must be a Number'); - var b = this.peek(); + this._ensure(4); - if (b === null) - return null; - - if (b !== tag) - throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) + - ': got 0x' + b.toString(16)); - - var o = this.readLength(this._offset + 1); // stored in `length` - if (o === null) - return null; - - if (this.length > 4) - throw newInvalidAsn1Error('Integer too long: ' + this.length); - - if (this.length > this._size - o) - return null; - this._offset = o; - - var fb = this._buf[this._offset]; - var value = 0; - - for (var i = 0; i < this.length; i++) { - value <<= 8; - value |= (this._buf[this._offset++] & 0xff); + if (len <= 0x7f) { + this._buf[this._offset++] = len; + } else if (len <= 0xff) { + this._buf[this._offset++] = 0x81; + this._buf[this._offset++] = len; + } else if (len <= 0xffff) { + this._buf[this._offset++] = 0x82; + this._buf[this._offset++] = len >> 8; + this._buf[this._offset++] = len; + } else if (len <= 0xffffff) { + this._buf[this._offset++] = 0x83; + this._buf[this._offset++] = len >> 16; + this._buf[this._offset++] = len >> 8; + this._buf[this._offset++] = len; + } else { + throw newInvalidAsn1Error('Length too long (> 4 bytes)'); } +}; - if ((fb & 0x80) === 0x80 && i !== 4) - value -= (1 << (i * 8)); +Writer.prototype.startSequence = function (tag) { + if (typeof (tag) !== 'number') + tag = ASN1.Sequence | ASN1.Constructor; - return value >> 0; + this.writeByte(tag); + this._seq.push(this._offset); + this._ensure(3); + this._offset += 3; +}; + + +Writer.prototype.endSequence = function () { + var seq = this._seq.pop(); + var start = seq + 3; + var len = this._offset - start; + + if (len <= 0x7f) { + this._shift(start, len, -2); + this._buf[seq] = len; + } else if (len <= 0xff) { + this._shift(start, len, -1); + this._buf[seq] = 0x81; + this._buf[seq + 1] = len; + } else if (len <= 0xffff) { + this._buf[seq] = 0x82; + this._buf[seq + 1] = len >> 8; + this._buf[seq + 2] = len; + } else if (len <= 0xffffff) { + this._shift(start, len, 1); + this._buf[seq] = 0x83; + this._buf[seq + 1] = len >> 16; + this._buf[seq + 2] = len >> 8; + this._buf[seq + 3] = len; + } else { + throw newInvalidAsn1Error('Sequence too long'); + } +}; + + +Writer.prototype._shift = function (start, len, shift) { + assert.ok(start !== undefined); + assert.ok(len !== undefined); + assert.ok(shift); + + this._buf.copy(this._buf, start + shift, start, start + len); + this._offset += shift; +}; + +Writer.prototype._ensure = function (len) { + assert.ok(len); + + if (this._size - this._offset < len) { + var sz = this._size * this._options.growthFactor; + if (sz - this._offset < len) + sz += len; + + var buf = Buffer.alloc(sz); + + this._buf.copy(buf, 0, 0, this._offset); + this._buf = buf; + this._size = sz; + } }; // --- Exported API -module.exports = Reader; - - -/***/ }), - -/***/ 876: -/***/ (function(module) { - -module.exports = {"_args":[["tough-cookie@2.4.3","/Users/Ibrahim/Desktop/codecov/codecov-action"]],"_from":"tough-cookie@2.4.3","_id":"tough-cookie@2.4.3","_inBundle":false,"_integrity":"sha512-Q5srk/4vDM54WJsJio3XNn6K2sCG+CQ8G5Wz6bZhRZoAe/+TxjWB/GlFAnYEbkYVlON9FMk/fE3h2RLpPXo4lQ==","_location":"/tough-cookie","_phantomChildren":{},"_requested":{"type":"version","registry":true,"raw":"tough-cookie@2.4.3","name":"tough-cookie","escapedName":"tough-cookie","rawSpec":"2.4.3","saveSpec":null,"fetchSpec":"2.4.3"},"_requiredBy":["/request"],"_resolved":"https://registry.npmjs.org/tough-cookie/-/tough-cookie-2.4.3.tgz","_spec":"2.4.3","_where":"/Users/Ibrahim/Desktop/codecov/codecov-action","author":{"name":"Jeremy Stashewsky","email":"jstash@gmail.com"},"bugs":{"url":"https://github.com/salesforce/tough-cookie/issues"},"contributors":[{"name":"Alexander Savin"},{"name":"Ian Livingstone"},{"name":"Ivan Nikulin"},{"name":"Lalit Kapoor"},{"name":"Sam Thompson"},{"name":"Sebastian Mayr"}],"dependencies":{"psl":"^1.1.24","punycode":"^1.4.1"},"description":"RFC6265 Cookies and Cookie Jar for node.js","devDependencies":{"async":"^1.4.2","nyc":"^11.6.0","string.prototype.repeat":"^0.2.0","vows":"^0.8.1"},"engines":{"node":">=0.8"},"files":["lib"],"homepage":"https://github.com/salesforce/tough-cookie","keywords":["HTTP","cookie","cookies","set-cookie","cookiejar","jar","RFC6265","RFC2965"],"license":"BSD-3-Clause","main":"./lib/cookie","name":"tough-cookie","repository":{"type":"git","url":"git://github.com/salesforce/tough-cookie.git"},"scripts":{"cover":"nyc --reporter=lcov --reporter=html vows test/*_test.js","test":"vows test/*_test.js"},"version":"2.4.3"}; - -/***/ }), - -/***/ 877: -/***/ (function(module) { - -module.exports = {"$id":"page.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","optional":true,"required":["startedDateTime","id","title","pageTimings"],"properties":{"startedDateTime":{"type":"string","format":"date-time","pattern":"^(\\d{4})(-)?(\\d\\d)(-)?(\\d\\d)(T)?(\\d\\d)(:)?(\\d\\d)(:)?(\\d\\d)(\\.\\d+)?(Z|([+-])(\\d\\d)(:)?(\\d\\d))"},"id":{"type":"string","unique":true},"title":{"type":"string"},"pageTimings":{"$ref":"pageTimings.json#"},"comment":{"type":"string"}}}; - -/***/ }), - -/***/ 886: -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -var util = __webpack_require__(435); - -var DATE = /^(\d\d\d\d)-(\d\d)-(\d\d)$/; -var DAYS = [0,31,28,31,30,31,30,31,31,30,31,30,31]; -var TIME = /^(\d\d):(\d\d):(\d\d)(\.\d+)?(z|[+-]\d\d:\d\d)?$/i; -var HOSTNAME = /^[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?(?:\.[a-z0-9](?:[-0-9a-z]{0,61}[0-9a-z])?)*$/i; -var URI = /^(?:[a-z][a-z0-9+\-.]*:)(?:\/?\/(?:(?:[a-z0-9\-._~!$&'()*+,;=:]|%[0-9a-f]{2})*@)?(?:\[(?:(?:(?:(?:[0-9a-f]{1,4}:){6}|::(?:[0-9a-f]{1,4}:){5}|(?:[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){4}|(?:(?:[0-9a-f]{1,4}:){0,1}[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){3}|(?:(?:[0-9a-f]{1,4}:){0,2}[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){2}|(?:(?:[0-9a-f]{1,4}:){0,3}[0-9a-f]{1,4})?::[0-9a-f]{1,4}:|(?:(?:[0-9a-f]{1,4}:){0,4}[0-9a-f]{1,4})?::)(?:[0-9a-f]{1,4}:[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?))|(?:(?:[0-9a-f]{1,4}:){0,5}[0-9a-f]{1,4})?::[0-9a-f]{1,4}|(?:(?:[0-9a-f]{1,4}:){0,6}[0-9a-f]{1,4})?::)|[Vv][0-9a-f]+\.[a-z0-9\-._~!$&'()*+,;=:]+)\]|(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)|(?:[a-z0-9\-._~!$&'()*+,;=]|%[0-9a-f]{2})*)(?::\d*)?(?:\/(?:[a-z0-9\-._~!$&'()*+,;=:@]|%[0-9a-f]{2})*)*|\/(?:(?:[a-z0-9\-._~!$&'()*+,;=:@]|%[0-9a-f]{2})+(?:\/(?:[a-z0-9\-._~!$&'()*+,;=:@]|%[0-9a-f]{2})*)*)?|(?:[a-z0-9\-._~!$&'()*+,;=:@]|%[0-9a-f]{2})+(?:\/(?:[a-z0-9\-._~!$&'()*+,;=:@]|%[0-9a-f]{2})*)*)(?:\?(?:[a-z0-9\-._~!$&'()*+,;=:@/?]|%[0-9a-f]{2})*)?(?:#(?:[a-z0-9\-._~!$&'()*+,;=:@/?]|%[0-9a-f]{2})*)?$/i; -var URIREF = /^(?:[a-z][a-z0-9+\-.]*:)?(?:\/?\/(?:(?:[a-z0-9\-._~!$&'()*+,;=:]|%[0-9a-f]{2})*@)?(?:\[(?:(?:(?:(?:[0-9a-f]{1,4}:){6}|::(?:[0-9a-f]{1,4}:){5}|(?:[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){4}|(?:(?:[0-9a-f]{1,4}:){0,1}[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){3}|(?:(?:[0-9a-f]{1,4}:){0,2}[0-9a-f]{1,4})?::(?:[0-9a-f]{1,4}:){2}|(?:(?:[0-9a-f]{1,4}:){0,3}[0-9a-f]{1,4})?::[0-9a-f]{1,4}:|(?:(?:[0-9a-f]{1,4}:){0,4}[0-9a-f]{1,4})?::)(?:[0-9a-f]{1,4}:[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?))|(?:(?:[0-9a-f]{1,4}:){0,5}[0-9a-f]{1,4})?::[0-9a-f]{1,4}|(?:(?:[0-9a-f]{1,4}:){0,6}[0-9a-f]{1,4})?::)|[Vv][0-9a-f]+\.[a-z0-9\-._~!$&'()*+,;=:]+)\]|(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)|(?:[a-z0-9\-._~!$&'"()*+,;=]|%[0-9a-f]{2})*)(?::\d*)?(?:\/(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})*)*|\/(?:(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})+(?:\/(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})*)*)?|(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})+(?:\/(?:[a-z0-9\-._~!$&'"()*+,;=:@]|%[0-9a-f]{2})*)*)?(?:\?(?:[a-z0-9\-._~!$&'"()*+,;=:@/?]|%[0-9a-f]{2})*)?(?:#(?:[a-z0-9\-._~!$&'"()*+,;=:@/?]|%[0-9a-f]{2})*)?$/i; -// uri-template: https://tools.ietf.org/html/rfc6570 -var URITEMPLATE = /^(?:(?:[^\x00-\x20"'<>%\\^`{|}]|%[0-9a-f]{2})|\{[+#./;?&=,!@|]?(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?(?:,(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?)*\})*$/i; -// For the source: https://gist.github.com/dperini/729294 -// For test cases: https://mathiasbynens.be/demo/url-regex -// @todo Delete current URL in favour of the commented out URL rule when this issue is fixed https://github.com/eslint/eslint/issues/7983. -// var URL = /^(?:(?:https?|ftp):\/\/)(?:\S+(?::\S*)?@)?(?:(?!10(?:\.\d{1,3}){3})(?!127(?:\.\d{1,3}){3})(?!169\.254(?:\.\d{1,3}){2})(?!192\.168(?:\.\d{1,3}){2})(?!172\.(?:1[6-9]|2\d|3[0-1])(?:\.\d{1,3}){2})(?:[1-9]\d?|1\d\d|2[01]\d|22[0-3])(?:\.(?:1?\d{1,2}|2[0-4]\d|25[0-5])){2}(?:\.(?:[1-9]\d?|1\d\d|2[0-4]\d|25[0-4]))|(?:(?:[a-z\u{00a1}-\u{ffff}0-9]+-?)*[a-z\u{00a1}-\u{ffff}0-9]+)(?:\.(?:[a-z\u{00a1}-\u{ffff}0-9]+-?)*[a-z\u{00a1}-\u{ffff}0-9]+)*(?:\.(?:[a-z\u{00a1}-\u{ffff}]{2,})))(?::\d{2,5})?(?:\/[^\s]*)?$/iu; -var URL = /^(?:(?:http[s\u017F]?|ftp):\/\/)(?:(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+(?::(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?@)?(?:(?!10(?:\.[0-9]{1,3}){3})(?!127(?:\.[0-9]{1,3}){3})(?!169\.254(?:\.[0-9]{1,3}){2})(?!192\.168(?:\.[0-9]{1,3}){2})(?!172\.(?:1[6-9]|2[0-9]|3[01])(?:\.[0-9]{1,3}){2})(?:[1-9][0-9]?|1[0-9][0-9]|2[01][0-9]|22[0-3])(?:\.(?:1?[0-9]{1,2}|2[0-4][0-9]|25[0-5])){2}(?:\.(?:[1-9][0-9]?|1[0-9][0-9]|2[0-4][0-9]|25[0-4]))|(?:(?:(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-?)*(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)(?:\.(?:(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-?)*(?:[0-9KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)*(?:\.(?:(?:[KSa-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]){2,})))(?::[0-9]{2,5})?(?:\/(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?$/i; -var UUID = /^(?:urn:uuid:)?[0-9a-f]{8}-(?:[0-9a-f]{4}-){3}[0-9a-f]{12}$/i; -var JSON_POINTER = /^(?:\/(?:[^~/]|~0|~1)*)*$/; -var JSON_POINTER_URI_FRAGMENT = /^#(?:\/(?:[a-z0-9_\-.!$&'()*+,;:=@]|%[0-9a-f]{2}|~0|~1)*)*$/i; -var RELATIVE_JSON_POINTER = /^(?:0|[1-9][0-9]*)(?:#|(?:\/(?:[^~/]|~0|~1)*)*)$/; - - -module.exports = formats; - -function formats(mode) { - mode = mode == 'full' ? 'full' : 'fast'; - return util.copy(formats[mode]); -} - - -formats.fast = { - // date: http://tools.ietf.org/html/rfc3339#section-5.6 - date: /^\d\d\d\d-[0-1]\d-[0-3]\d$/, - // date-time: http://tools.ietf.org/html/rfc3339#section-5.6 - time: /^(?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d:\d\d)?$/i, - 'date-time': /^\d\d\d\d-[0-1]\d-[0-3]\d[t\s](?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d:\d\d)$/i, - // uri: https://github.com/mafintosh/is-my-json-valid/blob/master/formats.js - uri: /^(?:[a-z][a-z0-9+-.]*:)(?:\/?\/)?[^\s]*$/i, - 'uri-reference': /^(?:(?:[a-z][a-z0-9+-.]*:)?\/?\/)?(?:[^\\\s#][^\s#]*)?(?:#[^\\\s]*)?$/i, - 'uri-template': URITEMPLATE, - url: URL, - // email (sources from jsen validator): - // http://stackoverflow.com/questions/201323/using-a-regular-expression-to-validate-an-email-address#answer-8829363 - // http://www.w3.org/TR/html5/forms.html#valid-e-mail-address (search for 'willful violation') - email: /^[a-z0-9.!#$%&'*+/=?^_`{|}~-]+@[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?(?:\.[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?)*$/i, - hostname: HOSTNAME, - // optimized https://www.safaribooksonline.com/library/view/regular-expressions-cookbook/9780596802837/ch07s16.html - ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/, - // optimized http://stackoverflow.com/questions/53497/regular-expression-that-matches-valid-ipv6-addresses - ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i, - regex: regex, - // uuid: http://tools.ietf.org/html/rfc4122 - uuid: UUID, - // JSON-pointer: https://tools.ietf.org/html/rfc6901 - // uri fragment: https://tools.ietf.org/html/rfc3986#appendix-A - 'json-pointer': JSON_POINTER, - 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT, - // relative JSON-pointer: http://tools.ietf.org/html/draft-luff-relative-json-pointer-00 - 'relative-json-pointer': RELATIVE_JSON_POINTER -}; - - -formats.full = { - date: date, - time: time, - 'date-time': date_time, - uri: uri, - 'uri-reference': URIREF, - 'uri-template': URITEMPLATE, - url: URL, - email: /^[a-z0-9!#$%&'*+/=?^_`{|}~-]+(?:\.[a-z0-9!#$%&'*+/=?^_`{|}~-]+)*@(?:[a-z0-9](?:[a-z0-9-]*[a-z0-9])?\.)+[a-z0-9](?:[a-z0-9-]*[a-z0-9])?$/i, - hostname: hostname, - ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/, - ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i, - regex: regex, - uuid: UUID, - 'json-pointer': JSON_POINTER, - 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT, - 'relative-json-pointer': RELATIVE_JSON_POINTER -}; - - -function isLeapYear(year) { - // https://tools.ietf.org/html/rfc3339#appendix-C - return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); -} - - -function date(str) { - // full-date from http://tools.ietf.org/html/rfc3339#section-5.6 - var matches = str.match(DATE); - if (!matches) return false; - - var year = +matches[1]; - var month = +matches[2]; - var day = +matches[3]; - - return month >= 1 && month <= 12 && day >= 1 && - day <= (month == 2 && isLeapYear(year) ? 29 : DAYS[month]); -} - - -function time(str, full) { - var matches = str.match(TIME); - if (!matches) return false; - - var hour = matches[1]; - var minute = matches[2]; - var second = matches[3]; - var timeZone = matches[5]; - return ((hour <= 23 && minute <= 59 && second <= 59) || - (hour == 23 && minute == 59 && second == 60)) && - (!full || timeZone); -} - - -var DATE_TIME_SEPARATOR = /t|\s/i; -function date_time(str) { - // http://tools.ietf.org/html/rfc3339#section-5.6 - var dateTime = str.split(DATE_TIME_SEPARATOR); - return dateTime.length == 2 && date(dateTime[0]) && time(dateTime[1], true); -} - - -function hostname(str) { - // https://tools.ietf.org/html/rfc1034#section-3.5 - // https://tools.ietf.org/html/rfc1123#section-2 - return str.length <= 255 && HOSTNAME.test(str); -} - - -var NOT_URI_FRAGMENT = /\/|:/; -function uri(str) { - // http://jmrware.com/articles/2009/uri_regexp/URI_regex.html + optional protocol + required "." - return NOT_URI_FRAGMENT.test(str) && URI.test(str); -} - - -var Z_ANCHOR = /[^\\]\\Z/; -function regex(str) { - if (Z_ANCHOR.test(str)) return false; - try { - new RegExp(str); - return true; - } catch(e) { - return false; - } -} - - -/***/ }), - -/***/ 905: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. - -module.exports = Identity; - -var assert = __webpack_require__(283); -var algs = __webpack_require__(936); -var crypto = __webpack_require__(417); -var Fingerprint = __webpack_require__(658); -var Signature = __webpack_require__(719); -var errs = __webpack_require__(266); -var util = __webpack_require__(669); -var utils = __webpack_require__(757); -var asn1 = __webpack_require__(214); -var Buffer = __webpack_require__(375).Buffer; - -/*JSSTYLED*/ -var DNS_NAME_RE = /^([*]|[a-z0-9][a-z0-9\-]{0,62})(?:\.([*]|[a-z0-9][a-z0-9\-]{0,62}))*$/i; - -var oids = {}; -oids.cn = '2.5.4.3'; -oids.o = '2.5.4.10'; -oids.ou = '2.5.4.11'; -oids.l = '2.5.4.7'; -oids.s = '2.5.4.8'; -oids.c = '2.5.4.6'; -oids.sn = '2.5.4.4'; -oids.postalCode = '2.5.4.17'; -oids.serialNumber = '2.5.4.5'; -oids.street = '2.5.4.9'; -oids.x500UniqueIdentifier = '2.5.4.45'; -oids.role = '2.5.4.72'; -oids.telephoneNumber = '2.5.4.20'; -oids.description = '2.5.4.13'; -oids.dc = '0.9.2342.19200300.100.1.25'; -oids.uid = '0.9.2342.19200300.100.1.1'; -oids.mail = '0.9.2342.19200300.100.1.3'; -oids.title = '2.5.4.12'; -oids.gn = '2.5.4.42'; -oids.initials = '2.5.4.43'; -oids.pseudonym = '2.5.4.65'; -oids.emailAddress = '1.2.840.113549.1.9.1'; - -var unoids = {}; -Object.keys(oids).forEach(function (k) { - unoids[oids[k]] = k; -}); - -function Identity(opts) { - var self = this; - assert.object(opts, 'options'); - assert.arrayOfObject(opts.components, 'options.components'); - this.components = opts.components; - this.componentLookup = {}; - this.components.forEach(function (c) { - if (c.name && !c.oid) - c.oid = oids[c.name]; - if (c.oid && !c.name) - c.name = unoids[c.oid]; - if (self.componentLookup[c.name] === undefined) - self.componentLookup[c.name] = []; - self.componentLookup[c.name].push(c); - }); - if (this.componentLookup.cn && this.componentLookup.cn.length > 0) { - this.cn = this.componentLookup.cn[0].value; - } - assert.optionalString(opts.type, 'options.type'); - if (opts.type === undefined) { - if (this.components.length === 1 && - this.componentLookup.cn && - this.componentLookup.cn.length === 1 && - this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { - this.type = 'host'; - this.hostname = this.componentLookup.cn[0].value; - - } else if (this.componentLookup.dc && - this.components.length === this.componentLookup.dc.length) { - this.type = 'host'; - this.hostname = this.componentLookup.dc.map( - function (c) { - return (c.value); - }).join('.'); - - } else if (this.componentLookup.uid && - this.components.length === - this.componentLookup.uid.length) { - this.type = 'user'; - this.uid = this.componentLookup.uid[0].value; - - } else if (this.componentLookup.cn && - this.componentLookup.cn.length === 1 && - this.componentLookup.cn[0].value.match(DNS_NAME_RE)) { - this.type = 'host'; - this.hostname = this.componentLookup.cn[0].value; - - } else if (this.componentLookup.uid && - this.componentLookup.uid.length === 1) { - this.type = 'user'; - this.uid = this.componentLookup.uid[0].value; - - } else if (this.componentLookup.mail && - this.componentLookup.mail.length === 1) { - this.type = 'email'; - this.email = this.componentLookup.mail[0].value; - - } else if (this.componentLookup.cn && - this.componentLookup.cn.length === 1) { - this.type = 'user'; - this.uid = this.componentLookup.cn[0].value; - - } else { - this.type = 'unknown'; - } - } else { - this.type = opts.type; - if (this.type === 'host') - this.hostname = opts.hostname; - else if (this.type === 'user') - this.uid = opts.uid; - else if (this.type === 'email') - this.email = opts.email; - else - throw (new Error('Unknown type ' + this.type)); - } -} - -Identity.prototype.toString = function () { - return (this.components.map(function (c) { - var n = c.name.toUpperCase(); - /*JSSTYLED*/ - n = n.replace(/=/g, '\\='); - var v = c.value; - /*JSSTYLED*/ - v = v.replace(/,/g, '\\,'); - return (n + '=' + v); - }).join(', ')); -}; - -Identity.prototype.get = function (name, asArray) { - assert.string(name, 'name'); - var arr = this.componentLookup[name]; - if (arr === undefined || arr.length === 0) - return (undefined); - if (!asArray && arr.length > 1) - throw (new Error('Multiple values for attribute ' + name)); - if (!asArray) - return (arr[0].value); - return (arr.map(function (c) { - return (c.value); - })); -}; - -Identity.prototype.toArray = function (idx) { - return (this.components.map(function (c) { - return ({ - name: c.name, - value: c.value - }); - })); -}; - -/* - * These are from X.680 -- PrintableString allowed chars are in section 37.4 - * table 8. Spec for IA5Strings is "1,6 + SPACE + DEL" where 1 refers to - * ISO IR #001 (standard ASCII control characters) and 6 refers to ISO IR #006 - * (the basic ASCII character set). - */ -/* JSSTYLED */ -var NOT_PRINTABLE = /[^a-zA-Z0-9 '(),+.\/:=?-]/; -/* JSSTYLED */ -var NOT_IA5 = /[^\x00-\x7f]/; - -Identity.prototype.toAsn1 = function (der, tag) { - der.startSequence(tag); - this.components.forEach(function (c) { - der.startSequence(asn1.Ber.Constructor | asn1.Ber.Set); - der.startSequence(); - der.writeOID(c.oid); - /* - * If we fit in a PrintableString, use that. Otherwise use an - * IA5String or UTF8String. - * - * If this identity was parsed from a DN, use the ASN.1 types - * from the original representation (otherwise this might not - * be a full match for the original in some validators). - */ - if (c.asn1type === asn1.Ber.Utf8String || - c.value.match(NOT_IA5)) { - var v = Buffer.from(c.value, 'utf8'); - der.writeBuffer(v, asn1.Ber.Utf8String); - - } else if (c.asn1type === asn1.Ber.IA5String || - c.value.match(NOT_PRINTABLE)) { - der.writeString(c.value, asn1.Ber.IA5String); - - } else { - var type = asn1.Ber.PrintableString; - if (c.asn1type !== undefined) - type = c.asn1type; - der.writeString(c.value, type); - } - der.endSequence(); - der.endSequence(); - }); - der.endSequence(); -}; - -function globMatch(a, b) { - if (a === '**' || b === '**') - return (true); - var aParts = a.split('.'); - var bParts = b.split('.'); - if (aParts.length !== bParts.length) - return (false); - for (var i = 0; i < aParts.length; ++i) { - if (aParts[i] === '*' || bParts[i] === '*') - continue; - if (aParts[i] !== bParts[i]) - return (false); - } - return (true); -} - -Identity.prototype.equals = function (other) { - if (!Identity.isIdentity(other, [1, 0])) - return (false); - if (other.components.length !== this.components.length) - return (false); - for (var i = 0; i < this.components.length; ++i) { - if (this.components[i].oid !== other.components[i].oid) - return (false); - if (!globMatch(this.components[i].value, - other.components[i].value)) { - return (false); - } - } - return (true); -}; - -Identity.forHost = function (hostname) { - assert.string(hostname, 'hostname'); - return (new Identity({ - type: 'host', - hostname: hostname, - components: [ { name: 'cn', value: hostname } ] - })); -}; - -Identity.forUser = function (uid) { - assert.string(uid, 'uid'); - return (new Identity({ - type: 'user', - uid: uid, - components: [ { name: 'uid', value: uid } ] - })); -}; - -Identity.forEmail = function (email) { - assert.string(email, 'email'); - return (new Identity({ - type: 'email', - email: email, - components: [ { name: 'mail', value: email } ] - })); -}; - -Identity.parseDN = function (dn) { - assert.string(dn, 'dn'); - var parts = ['']; - var idx = 0; - var rem = dn; - while (rem.length > 0) { - var m; - /*JSSTYLED*/ - if ((m = /^,/.exec(rem)) !== null) { - parts[++idx] = ''; - rem = rem.slice(m[0].length); - /*JSSTYLED*/ - } else if ((m = /^\\,/.exec(rem)) !== null) { - parts[idx] += ','; - rem = rem.slice(m[0].length); - /*JSSTYLED*/ - } else if ((m = /^\\./.exec(rem)) !== null) { - parts[idx] += m[0]; - rem = rem.slice(m[0].length); - /*JSSTYLED*/ - } else if ((m = /^[^\\,]+/.exec(rem)) !== null) { - parts[idx] += m[0]; - rem = rem.slice(m[0].length); - } else { - throw (new Error('Failed to parse DN')); - } - } - var cmps = parts.map(function (c) { - c = c.trim(); - var eqPos = c.indexOf('='); - while (eqPos > 0 && c.charAt(eqPos - 1) === '\\') - eqPos = c.indexOf('=', eqPos + 1); - if (eqPos === -1) { - throw (new Error('Failed to parse DN')); - } - /*JSSTYLED*/ - var name = c.slice(0, eqPos).toLowerCase().replace(/\\=/g, '='); - var value = c.slice(eqPos + 1); - return ({ name: name, value: value }); - }); - return (new Identity({ components: cmps })); -}; - -Identity.fromArray = function (components) { - assert.arrayOfObject(components, 'components'); - components.forEach(function (cmp) { - assert.object(cmp, 'component'); - assert.string(cmp.name, 'component.name'); - if (!Buffer.isBuffer(cmp.value) && - !(typeof (cmp.value) === 'string')) { - throw (new Error('Invalid component value')); - } - }); - return (new Identity({ components: components })); -}; - -Identity.parseAsn1 = function (der, top) { - var components = []; - der.readSequence(top); - var end = der.offset + der.length; - while (der.offset < end) { - der.readSequence(asn1.Ber.Constructor | asn1.Ber.Set); - var after = der.offset + der.length; - der.readSequence(); - var oid = der.readOID(); - var type = der.peek(); - var value; - switch (type) { - case asn1.Ber.PrintableString: - case asn1.Ber.IA5String: - case asn1.Ber.OctetString: - case asn1.Ber.T61String: - value = der.readString(type); - break; - case asn1.Ber.Utf8String: - value = der.readString(type, true); - value = value.toString('utf8'); - break; - case asn1.Ber.CharacterString: - case asn1.Ber.BMPString: - value = der.readString(type, true); - value = value.toString('utf16le'); - break; - default: - throw (new Error('Unknown asn1 type ' + type)); - } - components.push({ oid: oid, asn1type: type, value: value }); - der._offset = after; - } - der._offset = end; - return (new Identity({ - components: components - })); -}; - -Identity.isIdentity = function (obj, ver) { - return (utils.isCompatible(obj, Identity, ver)); -}; - -/* - * API versions for Identity: - * [1,0] -- initial ver - */ -Identity.prototype._sshpkApiVersion = [1, 0]; - -Identity._oldVersionDetect = function (obj) { - return ([1, 0]); -}; - - -/***/ }), - -/***/ 907: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = SSHBuffer; - -var assert = __webpack_require__(283); -var Buffer = __webpack_require__(375).Buffer; - -function SSHBuffer(opts) { - assert.object(opts, 'options'); - if (opts.buffer !== undefined) - assert.buffer(opts.buffer, 'options.buffer'); - - this._size = opts.buffer ? opts.buffer.length : 1024; - this._buffer = opts.buffer || Buffer.alloc(this._size); - this._offset = 0; -} - -SSHBuffer.prototype.toBuffer = function () { - return (this._buffer.slice(0, this._offset)); -}; - -SSHBuffer.prototype.atEnd = function () { - return (this._offset >= this._buffer.length); -}; - -SSHBuffer.prototype.remainder = function () { - return (this._buffer.slice(this._offset)); -}; - -SSHBuffer.prototype.skip = function (n) { - this._offset += n; -}; - -SSHBuffer.prototype.expand = function () { - this._size *= 2; - var buf = Buffer.alloc(this._size); - this._buffer.copy(buf, 0); - this._buffer = buf; -}; - -SSHBuffer.prototype.readPart = function () { - return ({data: this.readBuffer()}); -}; - -SSHBuffer.prototype.readBuffer = function () { - var len = this._buffer.readUInt32BE(this._offset); - this._offset += 4; - assert.ok(this._offset + len <= this._buffer.length, - 'length out of bounds at +0x' + this._offset.toString(16) + - ' (data truncated?)'); - var buf = this._buffer.slice(this._offset, this._offset + len); - this._offset += len; - return (buf); -}; - -SSHBuffer.prototype.readString = function () { - return (this.readBuffer().toString()); -}; - -SSHBuffer.prototype.readCString = function () { - var offset = this._offset; - while (offset < this._buffer.length && - this._buffer[offset] !== 0x00) - offset++; - assert.ok(offset < this._buffer.length, 'c string does not terminate'); - var str = this._buffer.slice(this._offset, offset).toString(); - this._offset = offset + 1; - return (str); -}; - -SSHBuffer.prototype.readInt = function () { - var v = this._buffer.readUInt32BE(this._offset); - this._offset += 4; - return (v); -}; - -SSHBuffer.prototype.readInt64 = function () { - assert.ok(this._offset + 8 < this._buffer.length, - 'buffer not long enough to read Int64'); - var v = this._buffer.slice(this._offset, this._offset + 8); - this._offset += 8; - return (v); -}; - -SSHBuffer.prototype.readChar = function () { - var v = this._buffer[this._offset++]; - return (v); -}; - -SSHBuffer.prototype.writeBuffer = function (buf) { - while (this._offset + 4 + buf.length > this._size) - this.expand(); - this._buffer.writeUInt32BE(buf.length, this._offset); - this._offset += 4; - buf.copy(this._buffer, this._offset); - this._offset += buf.length; -}; - -SSHBuffer.prototype.writeString = function (str) { - this.writeBuffer(Buffer.from(str, 'utf8')); -}; - -SSHBuffer.prototype.writeCString = function (str) { - while (this._offset + 1 + str.length > this._size) - this.expand(); - this._buffer.write(str, this._offset); - this._offset += str.length; - this._buffer[this._offset++] = 0; -}; - -SSHBuffer.prototype.writeInt = function (v) { - while (this._offset + 4 > this._size) - this.expand(); - this._buffer.writeUInt32BE(v, this._offset); - this._offset += 4; -}; - -SSHBuffer.prototype.writeInt64 = function (v) { - assert.buffer(v, 'value'); - if (v.length > 8) { - var lead = v.slice(0, v.length - 8); - for (var i = 0; i < lead.length; ++i) { - assert.strictEqual(lead[i], 0, - 'must fit in 64 bits of precision'); - } - v = v.slice(v.length - 8, v.length); - } - while (this._offset + 8 > this._size) - this.expand(); - v.copy(this._buffer, this._offset); - this._offset += 8; -}; - -SSHBuffer.prototype.writeChar = function (v) { - while (this._offset + 1 > this._size) - this.expand(); - this._buffer[this._offset++] = v; -}; - -SSHBuffer.prototype.writePart = function (p) { - this.writeBuffer(p.data); -}; - -SSHBuffer.prototype.write = function (buf) { - while (this._offset + buf.length > this._size) - this.expand(); - buf.copy(this._buffer, this._offset); - this._offset += buf.length; -}; - - -/***/ }), - -/***/ 917: -/***/ (function(module) { - -module.exports = {"application/1d-interleaved-parityfec":{"source":"iana"},"application/3gpdash-qoe-report+xml":{"source":"iana","compressible":true},"application/3gpp-ims+xml":{"source":"iana","compressible":true},"application/a2l":{"source":"iana"},"application/activemessage":{"source":"iana"},"application/activity+json":{"source":"iana","compressible":true},"application/alto-costmap+json":{"source":"iana","compressible":true},"application/alto-costmapfilter+json":{"source":"iana","compressible":true},"application/alto-directory+json":{"source":"iana","compressible":true},"application/alto-endpointcost+json":{"source":"iana","compressible":true},"application/alto-endpointcostparams+json":{"source":"iana","compressible":true},"application/alto-endpointprop+json":{"source":"iana","compressible":true},"application/alto-endpointpropparams+json":{"source":"iana","compressible":true},"application/alto-error+json":{"source":"iana","compressible":true},"application/alto-networkmap+json":{"source":"iana","compressible":true},"application/alto-networkmapfilter+json":{"source":"iana","compressible":true},"application/aml":{"source":"iana"},"application/andrew-inset":{"source":"iana","extensions":["ez"]},"application/applefile":{"source":"iana"},"application/applixware":{"source":"apache","extensions":["aw"]},"application/atf":{"source":"iana"},"application/atfx":{"source":"iana"},"application/atom+xml":{"source":"iana","compressible":true,"extensions":["atom"]},"application/atomcat+xml":{"source":"iana","compressible":true,"extensions":["atomcat"]},"application/atomdeleted+xml":{"source":"iana","compressible":true},"application/atomicmail":{"source":"iana"},"application/atomsvc+xml":{"source":"iana","compressible":true,"extensions":["atomsvc"]},"application/atsc-dwd+xml":{"source":"iana","compressible":true},"application/atsc-held+xml":{"source":"iana","compressible":true},"application/atsc-rsat+xml":{"source":"iana","compressible":true},"application/atxml":{"source":"iana"},"application/auth-policy+xml":{"source":"iana","compressible":true},"application/bacnet-xdd+zip":{"source":"iana","compressible":false},"application/batch-smtp":{"source":"iana"},"application/bdoc":{"compressible":false,"extensions":["bdoc"]},"application/beep+xml":{"source":"iana","compressible":true},"application/calendar+json":{"source":"iana","compressible":true},"application/calendar+xml":{"source":"iana","compressible":true},"application/call-completion":{"source":"iana"},"application/cals-1840":{"source":"iana"},"application/cbor":{"source":"iana"},"application/cccex":{"source":"iana"},"application/ccmp+xml":{"source":"iana","compressible":true},"application/ccxml+xml":{"source":"iana","compressible":true,"extensions":["ccxml"]},"application/cdfx+xml":{"source":"iana","compressible":true},"application/cdmi-capability":{"source":"iana","extensions":["cdmia"]},"application/cdmi-container":{"source":"iana","extensions":["cdmic"]},"application/cdmi-domain":{"source":"iana","extensions":["cdmid"]},"application/cdmi-object":{"source":"iana","extensions":["cdmio"]},"application/cdmi-queue":{"source":"iana","extensions":["cdmiq"]},"application/cdni":{"source":"iana"},"application/cea":{"source":"iana"},"application/cea-2018+xml":{"source":"iana","compressible":true},"application/cellml+xml":{"source":"iana","compressible":true},"application/cfw":{"source":"iana"},"application/clue_info+xml":{"source":"iana","compressible":true},"application/cms":{"source":"iana"},"application/cnrp+xml":{"source":"iana","compressible":true},"application/coap-group+json":{"source":"iana","compressible":true},"application/coap-payload":{"source":"iana"},"application/commonground":{"source":"iana"},"application/conference-info+xml":{"source":"iana","compressible":true},"application/cose":{"source":"iana"},"application/cose-key":{"source":"iana"},"application/cose-key-set":{"source":"iana"},"application/cpl+xml":{"source":"iana","compressible":true},"application/csrattrs":{"source":"iana"},"application/csta+xml":{"source":"iana","compressible":true},"application/cstadata+xml":{"source":"iana","compressible":true},"application/csvm+json":{"source":"iana","compressible":true},"application/cu-seeme":{"source":"apache","extensions":["cu"]},"application/cwt":{"source":"iana"},"application/cybercash":{"source":"iana"},"application/dart":{"compressible":true},"application/dash+xml":{"source":"iana","compressible":true,"extensions":["mpd"]},"application/dashdelta":{"source":"iana"},"application/davmount+xml":{"source":"iana","compressible":true,"extensions":["davmount"]},"application/dca-rft":{"source":"iana"},"application/dcd":{"source":"iana"},"application/dec-dx":{"source":"iana"},"application/dialog-info+xml":{"source":"iana","compressible":true},"application/dicom":{"source":"iana"},"application/dicom+json":{"source":"iana","compressible":true},"application/dicom+xml":{"source":"iana","compressible":true},"application/dii":{"source":"iana"},"application/dit":{"source":"iana"},"application/dns":{"source":"iana"},"application/dns+json":{"source":"iana","compressible":true},"application/dns-message":{"source":"iana"},"application/docbook+xml":{"source":"apache","compressible":true,"extensions":["dbk"]},"application/dskpp+xml":{"source":"iana","compressible":true},"application/dssc+der":{"source":"iana","extensions":["dssc"]},"application/dssc+xml":{"source":"iana","compressible":true,"extensions":["xdssc"]},"application/dvcs":{"source":"iana"},"application/ecmascript":{"source":"iana","compressible":true,"extensions":["ecma","es"]},"application/edi-consent":{"source":"iana"},"application/edi-x12":{"source":"iana","compressible":false},"application/edifact":{"source":"iana","compressible":false},"application/efi":{"source":"iana"},"application/emergencycalldata.comment+xml":{"source":"iana","compressible":true},"application/emergencycalldata.control+xml":{"source":"iana","compressible":true},"application/emergencycalldata.deviceinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.ecall.msd":{"source":"iana"},"application/emergencycalldata.providerinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.serviceinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.subscriberinfo+xml":{"source":"iana","compressible":true},"application/emergencycalldata.veds+xml":{"source":"iana","compressible":true},"application/emma+xml":{"source":"iana","compressible":true,"extensions":["emma"]},"application/emotionml+xml":{"source":"iana","compressible":true},"application/encaprtp":{"source":"iana"},"application/epp+xml":{"source":"iana","compressible":true},"application/epub+zip":{"source":"iana","compressible":false,"extensions":["epub"]},"application/eshop":{"source":"iana"},"application/exi":{"source":"iana","extensions":["exi"]},"application/expect-ct-report+json":{"source":"iana","compressible":true},"application/fastinfoset":{"source":"iana"},"application/fastsoap":{"source":"iana"},"application/fdt+xml":{"source":"iana","compressible":true},"application/fhir+json":{"source":"iana","compressible":true},"application/fhir+xml":{"source":"iana","compressible":true},"application/fido.trusted-apps+json":{"compressible":true},"application/fits":{"source":"iana"},"application/flexfec":{"source":"iana"},"application/font-sfnt":{"source":"iana"},"application/font-tdpfr":{"source":"iana","extensions":["pfr"]},"application/font-woff":{"source":"iana","compressible":false},"application/framework-attributes+xml":{"source":"iana","compressible":true},"application/geo+json":{"source":"iana","compressible":true,"extensions":["geojson"]},"application/geo+json-seq":{"source":"iana"},"application/geopackage+sqlite3":{"source":"iana"},"application/geoxacml+xml":{"source":"iana","compressible":true},"application/gltf-buffer":{"source":"iana"},"application/gml+xml":{"source":"iana","compressible":true,"extensions":["gml"]},"application/gpx+xml":{"source":"apache","compressible":true,"extensions":["gpx"]},"application/gxf":{"source":"apache","extensions":["gxf"]},"application/gzip":{"source":"iana","compressible":false,"extensions":["gz"]},"application/h224":{"source":"iana"},"application/held+xml":{"source":"iana","compressible":true},"application/hjson":{"extensions":["hjson"]},"application/http":{"source":"iana"},"application/hyperstudio":{"source":"iana","extensions":["stk"]},"application/ibe-key-request+xml":{"source":"iana","compressible":true},"application/ibe-pkg-reply+xml":{"source":"iana","compressible":true},"application/ibe-pp-data":{"source":"iana"},"application/iges":{"source":"iana"},"application/im-iscomposing+xml":{"source":"iana","compressible":true},"application/index":{"source":"iana"},"application/index.cmd":{"source":"iana"},"application/index.obj":{"source":"iana"},"application/index.response":{"source":"iana"},"application/index.vnd":{"source":"iana"},"application/inkml+xml":{"source":"iana","compressible":true,"extensions":["ink","inkml"]},"application/iotp":{"source":"iana"},"application/ipfix":{"source":"iana","extensions":["ipfix"]},"application/ipp":{"source":"iana"},"application/isup":{"source":"iana"},"application/its+xml":{"source":"iana","compressible":true},"application/java-archive":{"source":"apache","compressible":false,"extensions":["jar","war","ear"]},"application/java-serialized-object":{"source":"apache","compressible":false,"extensions":["ser"]},"application/java-vm":{"source":"apache","compressible":false,"extensions":["class"]},"application/javascript":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["js","mjs"]},"application/jf2feed+json":{"source":"iana","compressible":true},"application/jose":{"source":"iana"},"application/jose+json":{"source":"iana","compressible":true},"application/jrd+json":{"source":"iana","compressible":true},"application/json":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["json","map"]},"application/json-patch+json":{"source":"iana","compressible":true},"application/json-seq":{"source":"iana"},"application/json5":{"extensions":["json5"]},"application/jsonml+json":{"source":"apache","compressible":true,"extensions":["jsonml"]},"application/jwk+json":{"source":"iana","compressible":true},"application/jwk-set+json":{"source":"iana","compressible":true},"application/jwt":{"source":"iana"},"application/kpml-request+xml":{"source":"iana","compressible":true},"application/kpml-response+xml":{"source":"iana","compressible":true},"application/ld+json":{"source":"iana","compressible":true,"extensions":["jsonld"]},"application/lgr+xml":{"source":"iana","compressible":true},"application/link-format":{"source":"iana"},"application/load-control+xml":{"source":"iana","compressible":true},"application/lost+xml":{"source":"iana","compressible":true,"extensions":["lostxml"]},"application/lostsync+xml":{"source":"iana","compressible":true},"application/lxf":{"source":"iana"},"application/mac-binhex40":{"source":"iana","extensions":["hqx"]},"application/mac-compactpro":{"source":"apache","extensions":["cpt"]},"application/macwriteii":{"source":"iana"},"application/mads+xml":{"source":"iana","compressible":true,"extensions":["mads"]},"application/manifest+json":{"charset":"UTF-8","compressible":true,"extensions":["webmanifest"]},"application/marc":{"source":"iana","extensions":["mrc"]},"application/marcxml+xml":{"source":"iana","compressible":true,"extensions":["mrcx"]},"application/mathematica":{"source":"iana","extensions":["ma","nb","mb"]},"application/mathml+xml":{"source":"iana","compressible":true,"extensions":["mathml"]},"application/mathml-content+xml":{"source":"iana","compressible":true},"application/mathml-presentation+xml":{"source":"iana","compressible":true},"application/mbms-associated-procedure-description+xml":{"source":"iana","compressible":true},"application/mbms-deregister+xml":{"source":"iana","compressible":true},"application/mbms-envelope+xml":{"source":"iana","compressible":true},"application/mbms-msk+xml":{"source":"iana","compressible":true},"application/mbms-msk-response+xml":{"source":"iana","compressible":true},"application/mbms-protection-description+xml":{"source":"iana","compressible":true},"application/mbms-reception-report+xml":{"source":"iana","compressible":true},"application/mbms-register+xml":{"source":"iana","compressible":true},"application/mbms-register-response+xml":{"source":"iana","compressible":true},"application/mbms-schedule+xml":{"source":"iana","compressible":true},"application/mbms-user-service-description+xml":{"source":"iana","compressible":true},"application/mbox":{"source":"iana","extensions":["mbox"]},"application/media-policy-dataset+xml":{"source":"iana","compressible":true},"application/media_control+xml":{"source":"iana","compressible":true},"application/mediaservercontrol+xml":{"source":"iana","compressible":true,"extensions":["mscml"]},"application/merge-patch+json":{"source":"iana","compressible":true},"application/metalink+xml":{"source":"apache","compressible":true,"extensions":["metalink"]},"application/metalink4+xml":{"source":"iana","compressible":true,"extensions":["meta4"]},"application/mets+xml":{"source":"iana","compressible":true,"extensions":["mets"]},"application/mf4":{"source":"iana"},"application/mikey":{"source":"iana"},"application/mipc":{"source":"iana"},"application/mmt-aei+xml":{"source":"iana","compressible":true},"application/mmt-usd+xml":{"source":"iana","compressible":true},"application/mods+xml":{"source":"iana","compressible":true,"extensions":["mods"]},"application/moss-keys":{"source":"iana"},"application/moss-signature":{"source":"iana"},"application/mosskey-data":{"source":"iana"},"application/mosskey-request":{"source":"iana"},"application/mp21":{"source":"iana","extensions":["m21","mp21"]},"application/mp4":{"source":"iana","extensions":["mp4s","m4p"]},"application/mpeg4-generic":{"source":"iana"},"application/mpeg4-iod":{"source":"iana"},"application/mpeg4-iod-xmt":{"source":"iana"},"application/mrb-consumer+xml":{"source":"iana","compressible":true},"application/mrb-publish+xml":{"source":"iana","compressible":true},"application/msc-ivr+xml":{"source":"iana","compressible":true},"application/msc-mixer+xml":{"source":"iana","compressible":true},"application/msword":{"source":"iana","compressible":false,"extensions":["doc","dot"]},"application/mud+json":{"source":"iana","compressible":true},"application/mxf":{"source":"iana","extensions":["mxf"]},"application/n-quads":{"source":"iana","extensions":["nq"]},"application/n-triples":{"source":"iana","extensions":["nt"]},"application/nasdata":{"source":"iana"},"application/news-checkgroups":{"source":"iana"},"application/news-groupinfo":{"source":"iana"},"application/news-transmission":{"source":"iana"},"application/nlsml+xml":{"source":"iana","compressible":true},"application/node":{"source":"iana"},"application/nss":{"source":"iana"},"application/ocsp-request":{"source":"iana"},"application/ocsp-response":{"source":"iana"},"application/octet-stream":{"source":"iana","compressible":false,"extensions":["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","exe","dll","deb","dmg","iso","img","msi","msp","msm","buffer"]},"application/oda":{"source":"iana","extensions":["oda"]},"application/odm+xml":{"source":"iana","compressible":true},"application/odx":{"source":"iana"},"application/oebps-package+xml":{"source":"iana","compressible":true,"extensions":["opf"]},"application/ogg":{"source":"iana","compressible":false,"extensions":["ogx"]},"application/omdoc+xml":{"source":"apache","compressible":true,"extensions":["omdoc"]},"application/onenote":{"source":"apache","extensions":["onetoc","onetoc2","onetmp","onepkg"]},"application/oscore":{"source":"iana"},"application/oxps":{"source":"iana","extensions":["oxps"]},"application/p2p-overlay+xml":{"source":"iana","compressible":true},"application/parityfec":{"source":"iana"},"application/passport":{"source":"iana"},"application/patch-ops-error+xml":{"source":"iana","compressible":true,"extensions":["xer"]},"application/pdf":{"source":"iana","compressible":false,"extensions":["pdf"]},"application/pdx":{"source":"iana"},"application/pem-certificate-chain":{"source":"iana"},"application/pgp-encrypted":{"source":"iana","compressible":false,"extensions":["pgp"]},"application/pgp-keys":{"source":"iana"},"application/pgp-signature":{"source":"iana","extensions":["asc","sig"]},"application/pics-rules":{"source":"apache","extensions":["prf"]},"application/pidf+xml":{"source":"iana","compressible":true},"application/pidf-diff+xml":{"source":"iana","compressible":true},"application/pkcs10":{"source":"iana","extensions":["p10"]},"application/pkcs12":{"source":"iana"},"application/pkcs7-mime":{"source":"iana","extensions":["p7m","p7c"]},"application/pkcs7-signature":{"source":"iana","extensions":["p7s"]},"application/pkcs8":{"source":"iana","extensions":["p8"]},"application/pkcs8-encrypted":{"source":"iana"},"application/pkix-attr-cert":{"source":"iana","extensions":["ac"]},"application/pkix-cert":{"source":"iana","extensions":["cer"]},"application/pkix-crl":{"source":"iana","extensions":["crl"]},"application/pkix-pkipath":{"source":"iana","extensions":["pkipath"]},"application/pkixcmp":{"source":"iana","extensions":["pki"]},"application/pls+xml":{"source":"iana","compressible":true,"extensions":["pls"]},"application/poc-settings+xml":{"source":"iana","compressible":true},"application/postscript":{"source":"iana","compressible":true,"extensions":["ai","eps","ps"]},"application/ppsp-tracker+json":{"source":"iana","compressible":true},"application/problem+json":{"source":"iana","compressible":true},"application/problem+xml":{"source":"iana","compressible":true},"application/provenance+xml":{"source":"iana","compressible":true},"application/prs.alvestrand.titrax-sheet":{"source":"iana"},"application/prs.cww":{"source":"iana","extensions":["cww"]},"application/prs.hpub+zip":{"source":"iana","compressible":false},"application/prs.nprend":{"source":"iana"},"application/prs.plucker":{"source":"iana"},"application/prs.rdf-xml-crypt":{"source":"iana"},"application/prs.xsf+xml":{"source":"iana","compressible":true},"application/pskc+xml":{"source":"iana","compressible":true,"extensions":["pskcxml"]},"application/qsig":{"source":"iana"},"application/raml+yaml":{"compressible":true,"extensions":["raml"]},"application/raptorfec":{"source":"iana"},"application/rdap+json":{"source":"iana","compressible":true},"application/rdf+xml":{"source":"iana","compressible":true,"extensions":["rdf","owl"]},"application/reginfo+xml":{"source":"iana","compressible":true,"extensions":["rif"]},"application/relax-ng-compact-syntax":{"source":"iana","extensions":["rnc"]},"application/remote-printing":{"source":"iana"},"application/reputon+json":{"source":"iana","compressible":true},"application/resource-lists+xml":{"source":"iana","compressible":true,"extensions":["rl"]},"application/resource-lists-diff+xml":{"source":"iana","compressible":true,"extensions":["rld"]},"application/rfc+xml":{"source":"iana","compressible":true},"application/riscos":{"source":"iana"},"application/rlmi+xml":{"source":"iana","compressible":true},"application/rls-services+xml":{"source":"iana","compressible":true,"extensions":["rs"]},"application/route-apd+xml":{"source":"iana","compressible":true},"application/route-s-tsid+xml":{"source":"iana","compressible":true},"application/route-usd+xml":{"source":"iana","compressible":true},"application/rpki-ghostbusters":{"source":"iana","extensions":["gbr"]},"application/rpki-manifest":{"source":"iana","extensions":["mft"]},"application/rpki-publication":{"source":"iana"},"application/rpki-roa":{"source":"iana","extensions":["roa"]},"application/rpki-updown":{"source":"iana"},"application/rsd+xml":{"source":"apache","compressible":true,"extensions":["rsd"]},"application/rss+xml":{"source":"apache","compressible":true,"extensions":["rss"]},"application/rtf":{"source":"iana","compressible":true,"extensions":["rtf"]},"application/rtploopback":{"source":"iana"},"application/rtx":{"source":"iana"},"application/samlassertion+xml":{"source":"iana","compressible":true},"application/samlmetadata+xml":{"source":"iana","compressible":true},"application/sbml+xml":{"source":"iana","compressible":true,"extensions":["sbml"]},"application/scaip+xml":{"source":"iana","compressible":true},"application/scim+json":{"source":"iana","compressible":true},"application/scvp-cv-request":{"source":"iana","extensions":["scq"]},"application/scvp-cv-response":{"source":"iana","extensions":["scs"]},"application/scvp-vp-request":{"source":"iana","extensions":["spq"]},"application/scvp-vp-response":{"source":"iana","extensions":["spp"]},"application/sdp":{"source":"iana","extensions":["sdp"]},"application/secevent+jwt":{"source":"iana"},"application/senml+cbor":{"source":"iana"},"application/senml+json":{"source":"iana","compressible":true},"application/senml+xml":{"source":"iana","compressible":true},"application/senml-exi":{"source":"iana"},"application/sensml+cbor":{"source":"iana"},"application/sensml+json":{"source":"iana","compressible":true},"application/sensml+xml":{"source":"iana","compressible":true},"application/sensml-exi":{"source":"iana"},"application/sep+xml":{"source":"iana","compressible":true},"application/sep-exi":{"source":"iana"},"application/session-info":{"source":"iana"},"application/set-payment":{"source":"iana"},"application/set-payment-initiation":{"source":"iana","extensions":["setpay"]},"application/set-registration":{"source":"iana"},"application/set-registration-initiation":{"source":"iana","extensions":["setreg"]},"application/sgml":{"source":"iana"},"application/sgml-open-catalog":{"source":"iana"},"application/shf+xml":{"source":"iana","compressible":true,"extensions":["shf"]},"application/sieve":{"source":"iana","extensions":["siv","sieve"]},"application/simple-filter+xml":{"source":"iana","compressible":true},"application/simple-message-summary":{"source":"iana"},"application/simplesymbolcontainer":{"source":"iana"},"application/sipc":{"source":"iana"},"application/slate":{"source":"iana"},"application/smil":{"source":"iana"},"application/smil+xml":{"source":"iana","compressible":true,"extensions":["smi","smil"]},"application/smpte336m":{"source":"iana"},"application/soap+fastinfoset":{"source":"iana"},"application/soap+xml":{"source":"iana","compressible":true},"application/sparql-query":{"source":"iana","extensions":["rq"]},"application/sparql-results+xml":{"source":"iana","compressible":true,"extensions":["srx"]},"application/spirits-event+xml":{"source":"iana","compressible":true},"application/sql":{"source":"iana"},"application/srgs":{"source":"iana","extensions":["gram"]},"application/srgs+xml":{"source":"iana","compressible":true,"extensions":["grxml"]},"application/sru+xml":{"source":"iana","compressible":true,"extensions":["sru"]},"application/ssdl+xml":{"source":"apache","compressible":true,"extensions":["ssdl"]},"application/ssml+xml":{"source":"iana","compressible":true,"extensions":["ssml"]},"application/stix+json":{"source":"iana","compressible":true},"application/swid+xml":{"source":"iana","compressible":true},"application/tamp-apex-update":{"source":"iana"},"application/tamp-apex-update-confirm":{"source":"iana"},"application/tamp-community-update":{"source":"iana"},"application/tamp-community-update-confirm":{"source":"iana"},"application/tamp-error":{"source":"iana"},"application/tamp-sequence-adjust":{"source":"iana"},"application/tamp-sequence-adjust-confirm":{"source":"iana"},"application/tamp-status-query":{"source":"iana"},"application/tamp-status-response":{"source":"iana"},"application/tamp-update":{"source":"iana"},"application/tamp-update-confirm":{"source":"iana"},"application/tar":{"compressible":true},"application/taxii+json":{"source":"iana","compressible":true},"application/tei+xml":{"source":"iana","compressible":true,"extensions":["tei","teicorpus"]},"application/tetra_isi":{"source":"iana"},"application/thraud+xml":{"source":"iana","compressible":true,"extensions":["tfi"]},"application/timestamp-query":{"source":"iana"},"application/timestamp-reply":{"source":"iana"},"application/timestamped-data":{"source":"iana","extensions":["tsd"]},"application/tlsrpt+gzip":{"source":"iana"},"application/tlsrpt+json":{"source":"iana","compressible":true},"application/tnauthlist":{"source":"iana"},"application/toml":{"compressible":true,"extensions":["toml"]},"application/trickle-ice-sdpfrag":{"source":"iana"},"application/trig":{"source":"iana"},"application/ttml+xml":{"source":"iana","compressible":true},"application/tve-trigger":{"source":"iana"},"application/tzif":{"source":"iana"},"application/tzif-leap":{"source":"iana"},"application/ulpfec":{"source":"iana"},"application/urc-grpsheet+xml":{"source":"iana","compressible":true},"application/urc-ressheet+xml":{"source":"iana","compressible":true},"application/urc-targetdesc+xml":{"source":"iana","compressible":true},"application/urc-uisocketdesc+xml":{"source":"iana","compressible":true},"application/vcard+json":{"source":"iana","compressible":true},"application/vcard+xml":{"source":"iana","compressible":true},"application/vemmi":{"source":"iana"},"application/vividence.scriptfile":{"source":"apache"},"application/vnd.1000minds.decision-model+xml":{"source":"iana","compressible":true},"application/vnd.3gpp-prose+xml":{"source":"iana","compressible":true},"application/vnd.3gpp-prose-pc3ch+xml":{"source":"iana","compressible":true},"application/vnd.3gpp-v2x-local-service-information":{"source":"iana"},"application/vnd.3gpp.access-transfer-events+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.bsf+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.gmop+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mc-signalling-ear":{"source":"iana"},"application/vnd.3gpp.mcdata-affiliation-command+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-payload":{"source":"iana"},"application/vnd.3gpp.mcdata-service-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-signalling":{"source":"iana"},"application/vnd.3gpp.mcdata-ue-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcdata-user-profile+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-affiliation-command+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-floor-request+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-location-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-mbms-usage-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-service-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-signed+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-ue-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-ue-init-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcptt-user-profile+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-affiliation-command+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-affiliation-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-location-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-mbms-usage-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-service-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-transmission-request+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-ue-config+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mcvideo-user-profile+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.mid-call+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.pic-bw-large":{"source":"iana","extensions":["plb"]},"application/vnd.3gpp.pic-bw-small":{"source":"iana","extensions":["psb"]},"application/vnd.3gpp.pic-bw-var":{"source":"iana","extensions":["pvb"]},"application/vnd.3gpp.sms":{"source":"iana"},"application/vnd.3gpp.sms+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.srvcc-ext+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.srvcc-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.state-and-event-info+xml":{"source":"iana","compressible":true},"application/vnd.3gpp.ussd+xml":{"source":"iana","compressible":true},"application/vnd.3gpp2.bcmcsinfo+xml":{"source":"iana","compressible":true},"application/vnd.3gpp2.sms":{"source":"iana"},"application/vnd.3gpp2.tcap":{"source":"iana","extensions":["tcap"]},"application/vnd.3lightssoftware.imagescal":{"source":"iana"},"application/vnd.3m.post-it-notes":{"source":"iana","extensions":["pwn"]},"application/vnd.accpac.simply.aso":{"source":"iana","extensions":["aso"]},"application/vnd.accpac.simply.imp":{"source":"iana","extensions":["imp"]},"application/vnd.acucobol":{"source":"iana","extensions":["acu"]},"application/vnd.acucorp":{"source":"iana","extensions":["atc","acutc"]},"application/vnd.adobe.air-application-installer-package+zip":{"source":"apache","compressible":false,"extensions":["air"]},"application/vnd.adobe.flash.movie":{"source":"iana"},"application/vnd.adobe.formscentral.fcdt":{"source":"iana","extensions":["fcdt"]},"application/vnd.adobe.fxp":{"source":"iana","extensions":["fxp","fxpl"]},"application/vnd.adobe.partial-upload":{"source":"iana"},"application/vnd.adobe.xdp+xml":{"source":"iana","compressible":true,"extensions":["xdp"]},"application/vnd.adobe.xfdf":{"source":"iana","extensions":["xfdf"]},"application/vnd.aether.imp":{"source":"iana"},"application/vnd.afpc.afplinedata":{"source":"iana"},"application/vnd.afpc.modca":{"source":"iana"},"application/vnd.ah-barcode":{"source":"iana"},"application/vnd.ahead.space":{"source":"iana","extensions":["ahead"]},"application/vnd.airzip.filesecure.azf":{"source":"iana","extensions":["azf"]},"application/vnd.airzip.filesecure.azs":{"source":"iana","extensions":["azs"]},"application/vnd.amadeus+json":{"source":"iana","compressible":true},"application/vnd.amazon.ebook":{"source":"apache","extensions":["azw"]},"application/vnd.amazon.mobi8-ebook":{"source":"iana"},"application/vnd.americandynamics.acc":{"source":"iana","extensions":["acc"]},"application/vnd.amiga.ami":{"source":"iana","extensions":["ami"]},"application/vnd.amundsen.maze+xml":{"source":"iana","compressible":true},"application/vnd.android.ota":{"source":"iana"},"application/vnd.android.package-archive":{"source":"apache","compressible":false,"extensions":["apk"]},"application/vnd.anki":{"source":"iana"},"application/vnd.anser-web-certificate-issue-initiation":{"source":"iana","extensions":["cii"]},"application/vnd.anser-web-funds-transfer-initiation":{"source":"apache","extensions":["fti"]},"application/vnd.antix.game-component":{"source":"iana","extensions":["atx"]},"application/vnd.apache.thrift.binary":{"source":"iana"},"application/vnd.apache.thrift.compact":{"source":"iana"},"application/vnd.apache.thrift.json":{"source":"iana"},"application/vnd.api+json":{"source":"iana","compressible":true},"application/vnd.apothekende.reservation+json":{"source":"iana","compressible":true},"application/vnd.apple.installer+xml":{"source":"iana","compressible":true,"extensions":["mpkg"]},"application/vnd.apple.keynote":{"source":"iana","extensions":["keynote"]},"application/vnd.apple.mpegurl":{"source":"iana","extensions":["m3u8"]},"application/vnd.apple.numbers":{"source":"iana","extensions":["numbers"]},"application/vnd.apple.pages":{"source":"iana","extensions":["pages"]},"application/vnd.apple.pkpass":{"compressible":false,"extensions":["pkpass"]},"application/vnd.arastra.swi":{"source":"iana"},"application/vnd.aristanetworks.swi":{"source":"iana","extensions":["swi"]},"application/vnd.artisan+json":{"source":"iana","compressible":true},"application/vnd.artsquare":{"source":"iana"},"application/vnd.astraea-software.iota":{"source":"iana","extensions":["iota"]},"application/vnd.audiograph":{"source":"iana","extensions":["aep"]},"application/vnd.autopackage":{"source":"iana"},"application/vnd.avalon+json":{"source":"iana","compressible":true},"application/vnd.avistar+xml":{"source":"iana","compressible":true},"application/vnd.balsamiq.bmml+xml":{"source":"iana","compressible":true},"application/vnd.balsamiq.bmpr":{"source":"iana"},"application/vnd.banana-accounting":{"source":"iana"},"application/vnd.bbf.usp.error":{"source":"iana"},"application/vnd.bbf.usp.msg":{"source":"iana"},"application/vnd.bbf.usp.msg+json":{"source":"iana","compressible":true},"application/vnd.bekitzur-stech+json":{"source":"iana","compressible":true},"application/vnd.bint.med-content":{"source":"iana"},"application/vnd.biopax.rdf+xml":{"source":"iana","compressible":true},"application/vnd.blink-idb-value-wrapper":{"source":"iana"},"application/vnd.blueice.multipass":{"source":"iana","extensions":["mpm"]},"application/vnd.bluetooth.ep.oob":{"source":"iana"},"application/vnd.bluetooth.le.oob":{"source":"iana"},"application/vnd.bmi":{"source":"iana","extensions":["bmi"]},"application/vnd.bpf":{"source":"iana"},"application/vnd.bpf3":{"source":"iana"},"application/vnd.businessobjects":{"source":"iana","extensions":["rep"]},"application/vnd.byu.uapi+json":{"source":"iana","compressible":true},"application/vnd.cab-jscript":{"source":"iana"},"application/vnd.canon-cpdl":{"source":"iana"},"application/vnd.canon-lips":{"source":"iana"},"application/vnd.capasystems-pg+json":{"source":"iana","compressible":true},"application/vnd.cendio.thinlinc.clientconf":{"source":"iana"},"application/vnd.century-systems.tcp_stream":{"source":"iana"},"application/vnd.chemdraw+xml":{"source":"iana","compressible":true,"extensions":["cdxml"]},"application/vnd.chess-pgn":{"source":"iana"},"application/vnd.chipnuts.karaoke-mmd":{"source":"iana","extensions":["mmd"]},"application/vnd.ciedi":{"source":"iana"},"application/vnd.cinderella":{"source":"iana","extensions":["cdy"]},"application/vnd.cirpack.isdn-ext":{"source":"iana"},"application/vnd.citationstyles.style+xml":{"source":"iana","compressible":true,"extensions":["csl"]},"application/vnd.claymore":{"source":"iana","extensions":["cla"]},"application/vnd.cloanto.rp9":{"source":"iana","extensions":["rp9"]},"application/vnd.clonk.c4group":{"source":"iana","extensions":["c4g","c4d","c4f","c4p","c4u"]},"application/vnd.cluetrust.cartomobile-config":{"source":"iana","extensions":["c11amc"]},"application/vnd.cluetrust.cartomobile-config-pkg":{"source":"iana","extensions":["c11amz"]},"application/vnd.coffeescript":{"source":"iana"},"application/vnd.collabio.xodocuments.document":{"source":"iana"},"application/vnd.collabio.xodocuments.document-template":{"source":"iana"},"application/vnd.collabio.xodocuments.presentation":{"source":"iana"},"application/vnd.collabio.xodocuments.presentation-template":{"source":"iana"},"application/vnd.collabio.xodocuments.spreadsheet":{"source":"iana"},"application/vnd.collabio.xodocuments.spreadsheet-template":{"source":"iana"},"application/vnd.collection+json":{"source":"iana","compressible":true},"application/vnd.collection.doc+json":{"source":"iana","compressible":true},"application/vnd.collection.next+json":{"source":"iana","compressible":true},"application/vnd.comicbook+zip":{"source":"iana","compressible":false},"application/vnd.comicbook-rar":{"source":"iana"},"application/vnd.commerce-battelle":{"source":"iana"},"application/vnd.commonspace":{"source":"iana","extensions":["csp"]},"application/vnd.contact.cmsg":{"source":"iana","extensions":["cdbcmsg"]},"application/vnd.coreos.ignition+json":{"source":"iana","compressible":true},"application/vnd.cosmocaller":{"source":"iana","extensions":["cmc"]},"application/vnd.crick.clicker":{"source":"iana","extensions":["clkx"]},"application/vnd.crick.clicker.keyboard":{"source":"iana","extensions":["clkk"]},"application/vnd.crick.clicker.palette":{"source":"iana","extensions":["clkp"]},"application/vnd.crick.clicker.template":{"source":"iana","extensions":["clkt"]},"application/vnd.crick.clicker.wordbank":{"source":"iana","extensions":["clkw"]},"application/vnd.criticaltools.wbs+xml":{"source":"iana","compressible":true,"extensions":["wbs"]},"application/vnd.cryptii.pipe+json":{"source":"iana","compressible":true},"application/vnd.crypto-shade-file":{"source":"iana"},"application/vnd.ctc-posml":{"source":"iana","extensions":["pml"]},"application/vnd.ctct.ws+xml":{"source":"iana","compressible":true},"application/vnd.cups-pdf":{"source":"iana"},"application/vnd.cups-postscript":{"source":"iana"},"application/vnd.cups-ppd":{"source":"iana","extensions":["ppd"]},"application/vnd.cups-raster":{"source":"iana"},"application/vnd.cups-raw":{"source":"iana"},"application/vnd.curl":{"source":"iana"},"application/vnd.curl.car":{"source":"apache","extensions":["car"]},"application/vnd.curl.pcurl":{"source":"apache","extensions":["pcurl"]},"application/vnd.cyan.dean.root+xml":{"source":"iana","compressible":true},"application/vnd.cybank":{"source":"iana"},"application/vnd.d2l.coursepackage1p0+zip":{"source":"iana","compressible":false},"application/vnd.dart":{"source":"iana","compressible":true,"extensions":["dart"]},"application/vnd.data-vision.rdz":{"source":"iana","extensions":["rdz"]},"application/vnd.datapackage+json":{"source":"iana","compressible":true},"application/vnd.dataresource+json":{"source":"iana","compressible":true},"application/vnd.debian.binary-package":{"source":"iana"},"application/vnd.dece.data":{"source":"iana","extensions":["uvf","uvvf","uvd","uvvd"]},"application/vnd.dece.ttml+xml":{"source":"iana","compressible":true,"extensions":["uvt","uvvt"]},"application/vnd.dece.unspecified":{"source":"iana","extensions":["uvx","uvvx"]},"application/vnd.dece.zip":{"source":"iana","extensions":["uvz","uvvz"]},"application/vnd.denovo.fcselayout-link":{"source":"iana","extensions":["fe_launch"]},"application/vnd.desmume.movie":{"source":"iana"},"application/vnd.dir-bi.plate-dl-nosuffix":{"source":"iana"},"application/vnd.dm.delegation+xml":{"source":"iana","compressible":true},"application/vnd.dna":{"source":"iana","extensions":["dna"]},"application/vnd.document+json":{"source":"iana","compressible":true},"application/vnd.dolby.mlp":{"source":"apache","extensions":["mlp"]},"application/vnd.dolby.mobile.1":{"source":"iana"},"application/vnd.dolby.mobile.2":{"source":"iana"},"application/vnd.doremir.scorecloud-binary-document":{"source":"iana"},"application/vnd.dpgraph":{"source":"iana","extensions":["dpg"]},"application/vnd.dreamfactory":{"source":"iana","extensions":["dfac"]},"application/vnd.drive+json":{"source":"iana","compressible":true},"application/vnd.ds-keypoint":{"source":"apache","extensions":["kpxx"]},"application/vnd.dtg.local":{"source":"iana"},"application/vnd.dtg.local.flash":{"source":"iana"},"application/vnd.dtg.local.html":{"source":"iana"},"application/vnd.dvb.ait":{"source":"iana","extensions":["ait"]},"application/vnd.dvb.dvbj":{"source":"iana"},"application/vnd.dvb.esgcontainer":{"source":"iana"},"application/vnd.dvb.ipdcdftnotifaccess":{"source":"iana"},"application/vnd.dvb.ipdcesgaccess":{"source":"iana"},"application/vnd.dvb.ipdcesgaccess2":{"source":"iana"},"application/vnd.dvb.ipdcesgpdd":{"source":"iana"},"application/vnd.dvb.ipdcroaming":{"source":"iana"},"application/vnd.dvb.iptv.alfec-base":{"source":"iana"},"application/vnd.dvb.iptv.alfec-enhancement":{"source":"iana"},"application/vnd.dvb.notif-aggregate-root+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-container+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-generic+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-ia-msglist+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-ia-registration-request+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-ia-registration-response+xml":{"source":"iana","compressible":true},"application/vnd.dvb.notif-init+xml":{"source":"iana","compressible":true},"application/vnd.dvb.pfr":{"source":"iana"},"application/vnd.dvb.service":{"source":"iana","extensions":["svc"]},"application/vnd.dxr":{"source":"iana"},"application/vnd.dynageo":{"source":"iana","extensions":["geo"]},"application/vnd.dzr":{"source":"iana"},"application/vnd.easykaraoke.cdgdownload":{"source":"iana"},"application/vnd.ecdis-update":{"source":"iana"},"application/vnd.ecip.rlp":{"source":"iana"},"application/vnd.ecowin.chart":{"source":"iana","extensions":["mag"]},"application/vnd.ecowin.filerequest":{"source":"iana"},"application/vnd.ecowin.fileupdate":{"source":"iana"},"application/vnd.ecowin.series":{"source":"iana"},"application/vnd.ecowin.seriesrequest":{"source":"iana"},"application/vnd.ecowin.seriesupdate":{"source":"iana"},"application/vnd.efi.img":{"source":"iana"},"application/vnd.efi.iso":{"source":"iana"},"application/vnd.emclient.accessrequest+xml":{"source":"iana","compressible":true},"application/vnd.enliven":{"source":"iana","extensions":["nml"]},"application/vnd.enphase.envoy":{"source":"iana"},"application/vnd.eprints.data+xml":{"source":"iana","compressible":true},"application/vnd.epson.esf":{"source":"iana","extensions":["esf"]},"application/vnd.epson.msf":{"source":"iana","extensions":["msf"]},"application/vnd.epson.quickanime":{"source":"iana","extensions":["qam"]},"application/vnd.epson.salt":{"source":"iana","extensions":["slt"]},"application/vnd.epson.ssf":{"source":"iana","extensions":["ssf"]},"application/vnd.ericsson.quickcall":{"source":"iana"},"application/vnd.espass-espass+zip":{"source":"iana","compressible":false},"application/vnd.eszigno3+xml":{"source":"iana","compressible":true,"extensions":["es3","et3"]},"application/vnd.etsi.aoc+xml":{"source":"iana","compressible":true},"application/vnd.etsi.asic-e+zip":{"source":"iana","compressible":false},"application/vnd.etsi.asic-s+zip":{"source":"iana","compressible":false},"application/vnd.etsi.cug+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvcommand+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvdiscovery+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvprofile+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsad-bc+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsad-cod+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsad-npvr+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvservice+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvsync+xml":{"source":"iana","compressible":true},"application/vnd.etsi.iptvueprofile+xml":{"source":"iana","compressible":true},"application/vnd.etsi.mcid+xml":{"source":"iana","compressible":true},"application/vnd.etsi.mheg5":{"source":"iana"},"application/vnd.etsi.overload-control-policy-dataset+xml":{"source":"iana","compressible":true},"application/vnd.etsi.pstn+xml":{"source":"iana","compressible":true},"application/vnd.etsi.sci+xml":{"source":"iana","compressible":true},"application/vnd.etsi.simservs+xml":{"source":"iana","compressible":true},"application/vnd.etsi.timestamp-token":{"source":"iana"},"application/vnd.etsi.tsl+xml":{"source":"iana","compressible":true},"application/vnd.etsi.tsl.der":{"source":"iana"},"application/vnd.eudora.data":{"source":"iana"},"application/vnd.evolv.ecig.profile":{"source":"iana"},"application/vnd.evolv.ecig.settings":{"source":"iana"},"application/vnd.evolv.ecig.theme":{"source":"iana"},"application/vnd.exstream-empower+zip":{"source":"iana","compressible":false},"application/vnd.exstream-package":{"source":"iana"},"application/vnd.ezpix-album":{"source":"iana","extensions":["ez2"]},"application/vnd.ezpix-package":{"source":"iana","extensions":["ez3"]},"application/vnd.f-secure.mobile":{"source":"iana"},"application/vnd.fastcopy-disk-image":{"source":"iana"},"application/vnd.fdf":{"source":"iana","extensions":["fdf"]},"application/vnd.fdsn.mseed":{"source":"iana","extensions":["mseed"]},"application/vnd.fdsn.seed":{"source":"iana","extensions":["seed","dataless"]},"application/vnd.ffsns":{"source":"iana"},"application/vnd.ficlab.flb+zip":{"source":"iana","compressible":false},"application/vnd.filmit.zfc":{"source":"iana"},"application/vnd.fints":{"source":"iana"},"application/vnd.firemonkeys.cloudcell":{"source":"iana"},"application/vnd.flographit":{"source":"iana","extensions":["gph"]},"application/vnd.fluxtime.clip":{"source":"iana","extensions":["ftc"]},"application/vnd.font-fontforge-sfd":{"source":"iana"},"application/vnd.framemaker":{"source":"iana","extensions":["fm","frame","maker","book"]},"application/vnd.frogans.fnc":{"source":"iana","extensions":["fnc"]},"application/vnd.frogans.ltf":{"source":"iana","extensions":["ltf"]},"application/vnd.fsc.weblaunch":{"source":"iana","extensions":["fsc"]},"application/vnd.fujitsu.oasys":{"source":"iana","extensions":["oas"]},"application/vnd.fujitsu.oasys2":{"source":"iana","extensions":["oa2"]},"application/vnd.fujitsu.oasys3":{"source":"iana","extensions":["oa3"]},"application/vnd.fujitsu.oasysgp":{"source":"iana","extensions":["fg5"]},"application/vnd.fujitsu.oasysprs":{"source":"iana","extensions":["bh2"]},"application/vnd.fujixerox.art-ex":{"source":"iana"},"application/vnd.fujixerox.art4":{"source":"iana"},"application/vnd.fujixerox.ddd":{"source":"iana","extensions":["ddd"]},"application/vnd.fujixerox.docuworks":{"source":"iana","extensions":["xdw"]},"application/vnd.fujixerox.docuworks.binder":{"source":"iana","extensions":["xbd"]},"application/vnd.fujixerox.docuworks.container":{"source":"iana"},"application/vnd.fujixerox.hbpl":{"source":"iana"},"application/vnd.fut-misnet":{"source":"iana"},"application/vnd.futoin+cbor":{"source":"iana"},"application/vnd.futoin+json":{"source":"iana","compressible":true},"application/vnd.fuzzysheet":{"source":"iana","extensions":["fzs"]},"application/vnd.genomatix.tuxedo":{"source":"iana","extensions":["txd"]},"application/vnd.geo+json":{"source":"iana","compressible":true},"application/vnd.geocube+xml":{"source":"iana","compressible":true},"application/vnd.geogebra.file":{"source":"iana","extensions":["ggb"]},"application/vnd.geogebra.tool":{"source":"iana","extensions":["ggt"]},"application/vnd.geometry-explorer":{"source":"iana","extensions":["gex","gre"]},"application/vnd.geonext":{"source":"iana","extensions":["gxt"]},"application/vnd.geoplan":{"source":"iana","extensions":["g2w"]},"application/vnd.geospace":{"source":"iana","extensions":["g3w"]},"application/vnd.gerber":{"source":"iana"},"application/vnd.globalplatform.card-content-mgt":{"source":"iana"},"application/vnd.globalplatform.card-content-mgt-response":{"source":"iana"},"application/vnd.gmx":{"source":"iana","extensions":["gmx"]},"application/vnd.google-apps.document":{"compressible":false,"extensions":["gdoc"]},"application/vnd.google-apps.presentation":{"compressible":false,"extensions":["gslides"]},"application/vnd.google-apps.spreadsheet":{"compressible":false,"extensions":["gsheet"]},"application/vnd.google-earth.kml+xml":{"source":"iana","compressible":true,"extensions":["kml"]},"application/vnd.google-earth.kmz":{"source":"iana","compressible":false,"extensions":["kmz"]},"application/vnd.gov.sk.e-form+xml":{"source":"iana","compressible":true},"application/vnd.gov.sk.e-form+zip":{"source":"iana","compressible":false},"application/vnd.gov.sk.xmldatacontainer+xml":{"source":"iana","compressible":true},"application/vnd.grafeq":{"source":"iana","extensions":["gqf","gqs"]},"application/vnd.gridmp":{"source":"iana"},"application/vnd.groove-account":{"source":"iana","extensions":["gac"]},"application/vnd.groove-help":{"source":"iana","extensions":["ghf"]},"application/vnd.groove-identity-message":{"source":"iana","extensions":["gim"]},"application/vnd.groove-injector":{"source":"iana","extensions":["grv"]},"application/vnd.groove-tool-message":{"source":"iana","extensions":["gtm"]},"application/vnd.groove-tool-template":{"source":"iana","extensions":["tpl"]},"application/vnd.groove-vcard":{"source":"iana","extensions":["vcg"]},"application/vnd.hal+json":{"source":"iana","compressible":true},"application/vnd.hal+xml":{"source":"iana","compressible":true,"extensions":["hal"]},"application/vnd.handheld-entertainment+xml":{"source":"iana","compressible":true,"extensions":["zmm"]},"application/vnd.hbci":{"source":"iana","extensions":["hbci"]},"application/vnd.hc+json":{"source":"iana","compressible":true},"application/vnd.hcl-bireports":{"source":"iana"},"application/vnd.hdt":{"source":"iana"},"application/vnd.heroku+json":{"source":"iana","compressible":true},"application/vnd.hhe.lesson-player":{"source":"iana","extensions":["les"]},"application/vnd.hp-hpgl":{"source":"iana","extensions":["hpgl"]},"application/vnd.hp-hpid":{"source":"iana","extensions":["hpid"]},"application/vnd.hp-hps":{"source":"iana","extensions":["hps"]},"application/vnd.hp-jlyt":{"source":"iana","extensions":["jlt"]},"application/vnd.hp-pcl":{"source":"iana","extensions":["pcl"]},"application/vnd.hp-pclxl":{"source":"iana","extensions":["pclxl"]},"application/vnd.httphone":{"source":"iana"},"application/vnd.hydrostatix.sof-data":{"source":"iana","extensions":["sfd-hdstx"]},"application/vnd.hyper+json":{"source":"iana","compressible":true},"application/vnd.hyper-item+json":{"source":"iana","compressible":true},"application/vnd.hyperdrive+json":{"source":"iana","compressible":true},"application/vnd.hzn-3d-crossword":{"source":"iana"},"application/vnd.ibm.afplinedata":{"source":"iana"},"application/vnd.ibm.electronic-media":{"source":"iana"},"application/vnd.ibm.minipay":{"source":"iana","extensions":["mpy"]},"application/vnd.ibm.modcap":{"source":"iana","extensions":["afp","listafp","list3820"]},"application/vnd.ibm.rights-management":{"source":"iana","extensions":["irm"]},"application/vnd.ibm.secure-container":{"source":"iana","extensions":["sc"]},"application/vnd.iccprofile":{"source":"iana","extensions":["icc","icm"]},"application/vnd.ieee.1905":{"source":"iana"},"application/vnd.igloader":{"source":"iana","extensions":["igl"]},"application/vnd.imagemeter.folder+zip":{"source":"iana","compressible":false},"application/vnd.imagemeter.image+zip":{"source":"iana","compressible":false},"application/vnd.immervision-ivp":{"source":"iana","extensions":["ivp"]},"application/vnd.immervision-ivu":{"source":"iana","extensions":["ivu"]},"application/vnd.ims.imsccv1p1":{"source":"iana"},"application/vnd.ims.imsccv1p2":{"source":"iana"},"application/vnd.ims.imsccv1p3":{"source":"iana"},"application/vnd.ims.lis.v2.result+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolconsumerprofile+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolproxy+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolproxy.id+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolsettings+json":{"source":"iana","compressible":true},"application/vnd.ims.lti.v2.toolsettings.simple+json":{"source":"iana","compressible":true},"application/vnd.informedcontrol.rms+xml":{"source":"iana","compressible":true},"application/vnd.informix-visionary":{"source":"iana"},"application/vnd.infotech.project":{"source":"iana"},"application/vnd.infotech.project+xml":{"source":"iana","compressible":true},"application/vnd.innopath.wamp.notification":{"source":"iana"},"application/vnd.insors.igm":{"source":"iana","extensions":["igm"]},"application/vnd.intercon.formnet":{"source":"iana","extensions":["xpw","xpx"]},"application/vnd.intergeo":{"source":"iana","extensions":["i2g"]},"application/vnd.intertrust.digibox":{"source":"iana"},"application/vnd.intertrust.nncp":{"source":"iana"},"application/vnd.intu.qbo":{"source":"iana","extensions":["qbo"]},"application/vnd.intu.qfx":{"source":"iana","extensions":["qfx"]},"application/vnd.iptc.g2.catalogitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.conceptitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.knowledgeitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.newsitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.newsmessage+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.packageitem+xml":{"source":"iana","compressible":true},"application/vnd.iptc.g2.planningitem+xml":{"source":"iana","compressible":true},"application/vnd.ipunplugged.rcprofile":{"source":"iana","extensions":["rcprofile"]},"application/vnd.irepository.package+xml":{"source":"iana","compressible":true,"extensions":["irp"]},"application/vnd.is-xpr":{"source":"iana","extensions":["xpr"]},"application/vnd.isac.fcs":{"source":"iana","extensions":["fcs"]},"application/vnd.iso11783-10+zip":{"source":"iana","compressible":false},"application/vnd.jam":{"source":"iana","extensions":["jam"]},"application/vnd.japannet-directory-service":{"source":"iana"},"application/vnd.japannet-jpnstore-wakeup":{"source":"iana"},"application/vnd.japannet-payment-wakeup":{"source":"iana"},"application/vnd.japannet-registration":{"source":"iana"},"application/vnd.japannet-registration-wakeup":{"source":"iana"},"application/vnd.japannet-setstore-wakeup":{"source":"iana"},"application/vnd.japannet-verification":{"source":"iana"},"application/vnd.japannet-verification-wakeup":{"source":"iana"},"application/vnd.jcp.javame.midlet-rms":{"source":"iana","extensions":["rms"]},"application/vnd.jisp":{"source":"iana","extensions":["jisp"]},"application/vnd.joost.joda-archive":{"source":"iana","extensions":["joda"]},"application/vnd.jsk.isdn-ngn":{"source":"iana"},"application/vnd.kahootz":{"source":"iana","extensions":["ktz","ktr"]},"application/vnd.kde.karbon":{"source":"iana","extensions":["karbon"]},"application/vnd.kde.kchart":{"source":"iana","extensions":["chrt"]},"application/vnd.kde.kformula":{"source":"iana","extensions":["kfo"]},"application/vnd.kde.kivio":{"source":"iana","extensions":["flw"]},"application/vnd.kde.kontour":{"source":"iana","extensions":["kon"]},"application/vnd.kde.kpresenter":{"source":"iana","extensions":["kpr","kpt"]},"application/vnd.kde.kspread":{"source":"iana","extensions":["ksp"]},"application/vnd.kde.kword":{"source":"iana","extensions":["kwd","kwt"]},"application/vnd.kenameaapp":{"source":"iana","extensions":["htke"]},"application/vnd.kidspiration":{"source":"iana","extensions":["kia"]},"application/vnd.kinar":{"source":"iana","extensions":["kne","knp"]},"application/vnd.koan":{"source":"iana","extensions":["skp","skd","skt","skm"]},"application/vnd.kodak-descriptor":{"source":"iana","extensions":["sse"]},"application/vnd.las":{"source":"iana"},"application/vnd.las.las+json":{"source":"iana","compressible":true},"application/vnd.las.las+xml":{"source":"iana","compressible":true,"extensions":["lasxml"]},"application/vnd.laszip":{"source":"iana"},"application/vnd.leap+json":{"source":"iana","compressible":true},"application/vnd.liberty-request+xml":{"source":"iana","compressible":true},"application/vnd.llamagraphics.life-balance.desktop":{"source":"iana","extensions":["lbd"]},"application/vnd.llamagraphics.life-balance.exchange+xml":{"source":"iana","compressible":true,"extensions":["lbe"]},"application/vnd.logipipe.circuit+zip":{"source":"iana","compressible":false},"application/vnd.loom":{"source":"iana"},"application/vnd.lotus-1-2-3":{"source":"iana","extensions":["123"]},"application/vnd.lotus-approach":{"source":"iana","extensions":["apr"]},"application/vnd.lotus-freelance":{"source":"iana","extensions":["pre"]},"application/vnd.lotus-notes":{"source":"iana","extensions":["nsf"]},"application/vnd.lotus-organizer":{"source":"iana","extensions":["org"]},"application/vnd.lotus-screencam":{"source":"iana","extensions":["scm"]},"application/vnd.lotus-wordpro":{"source":"iana","extensions":["lwp"]},"application/vnd.macports.portpkg":{"source":"iana","extensions":["portpkg"]},"application/vnd.mapbox-vector-tile":{"source":"iana"},"application/vnd.marlin.drm.actiontoken+xml":{"source":"iana","compressible":true},"application/vnd.marlin.drm.conftoken+xml":{"source":"iana","compressible":true},"application/vnd.marlin.drm.license+xml":{"source":"iana","compressible":true},"application/vnd.marlin.drm.mdcf":{"source":"iana"},"application/vnd.mason+json":{"source":"iana","compressible":true},"application/vnd.maxmind.maxmind-db":{"source":"iana"},"application/vnd.mcd":{"source":"iana","extensions":["mcd"]},"application/vnd.medcalcdata":{"source":"iana","extensions":["mc1"]},"application/vnd.mediastation.cdkey":{"source":"iana","extensions":["cdkey"]},"application/vnd.meridian-slingshot":{"source":"iana"},"application/vnd.mfer":{"source":"iana","extensions":["mwf"]},"application/vnd.mfmp":{"source":"iana","extensions":["mfm"]},"application/vnd.micro+json":{"source":"iana","compressible":true},"application/vnd.micrografx.flo":{"source":"iana","extensions":["flo"]},"application/vnd.micrografx.igx":{"source":"iana","extensions":["igx"]},"application/vnd.microsoft.portable-executable":{"source":"iana"},"application/vnd.microsoft.windows.thumbnail-cache":{"source":"iana"},"application/vnd.miele+json":{"source":"iana","compressible":true},"application/vnd.mif":{"source":"iana","extensions":["mif"]},"application/vnd.minisoft-hp3000-save":{"source":"iana"},"application/vnd.mitsubishi.misty-guard.trustweb":{"source":"iana"},"application/vnd.mobius.daf":{"source":"iana","extensions":["daf"]},"application/vnd.mobius.dis":{"source":"iana","extensions":["dis"]},"application/vnd.mobius.mbk":{"source":"iana","extensions":["mbk"]},"application/vnd.mobius.mqy":{"source":"iana","extensions":["mqy"]},"application/vnd.mobius.msl":{"source":"iana","extensions":["msl"]},"application/vnd.mobius.plc":{"source":"iana","extensions":["plc"]},"application/vnd.mobius.txf":{"source":"iana","extensions":["txf"]},"application/vnd.mophun.application":{"source":"iana","extensions":["mpn"]},"application/vnd.mophun.certificate":{"source":"iana","extensions":["mpc"]},"application/vnd.motorola.flexsuite":{"source":"iana"},"application/vnd.motorola.flexsuite.adsi":{"source":"iana"},"application/vnd.motorola.flexsuite.fis":{"source":"iana"},"application/vnd.motorola.flexsuite.gotap":{"source":"iana"},"application/vnd.motorola.flexsuite.kmr":{"source":"iana"},"application/vnd.motorola.flexsuite.ttc":{"source":"iana"},"application/vnd.motorola.flexsuite.wem":{"source":"iana"},"application/vnd.motorola.iprm":{"source":"iana"},"application/vnd.mozilla.xul+xml":{"source":"iana","compressible":true,"extensions":["xul"]},"application/vnd.ms-3mfdocument":{"source":"iana"},"application/vnd.ms-artgalry":{"source":"iana","extensions":["cil"]},"application/vnd.ms-asf":{"source":"iana"},"application/vnd.ms-cab-compressed":{"source":"iana","extensions":["cab"]},"application/vnd.ms-color.iccprofile":{"source":"apache"},"application/vnd.ms-excel":{"source":"iana","compressible":false,"extensions":["xls","xlm","xla","xlc","xlt","xlw"]},"application/vnd.ms-excel.addin.macroenabled.12":{"source":"iana","extensions":["xlam"]},"application/vnd.ms-excel.sheet.binary.macroenabled.12":{"source":"iana","extensions":["xlsb"]},"application/vnd.ms-excel.sheet.macroenabled.12":{"source":"iana","extensions":["xlsm"]},"application/vnd.ms-excel.template.macroenabled.12":{"source":"iana","extensions":["xltm"]},"application/vnd.ms-fontobject":{"source":"iana","compressible":true,"extensions":["eot"]},"application/vnd.ms-htmlhelp":{"source":"iana","extensions":["chm"]},"application/vnd.ms-ims":{"source":"iana","extensions":["ims"]},"application/vnd.ms-lrm":{"source":"iana","extensions":["lrm"]},"application/vnd.ms-office.activex+xml":{"source":"iana","compressible":true},"application/vnd.ms-officetheme":{"source":"iana","extensions":["thmx"]},"application/vnd.ms-opentype":{"source":"apache","compressible":true},"application/vnd.ms-outlook":{"compressible":false,"extensions":["msg"]},"application/vnd.ms-package.obfuscated-opentype":{"source":"apache"},"application/vnd.ms-pki.seccat":{"source":"apache","extensions":["cat"]},"application/vnd.ms-pki.stl":{"source":"apache","extensions":["stl"]},"application/vnd.ms-playready.initiator+xml":{"source":"iana","compressible":true},"application/vnd.ms-powerpoint":{"source":"iana","compressible":false,"extensions":["ppt","pps","pot"]},"application/vnd.ms-powerpoint.addin.macroenabled.12":{"source":"iana","extensions":["ppam"]},"application/vnd.ms-powerpoint.presentation.macroenabled.12":{"source":"iana","extensions":["pptm"]},"application/vnd.ms-powerpoint.slide.macroenabled.12":{"source":"iana","extensions":["sldm"]},"application/vnd.ms-powerpoint.slideshow.macroenabled.12":{"source":"iana","extensions":["ppsm"]},"application/vnd.ms-powerpoint.template.macroenabled.12":{"source":"iana","extensions":["potm"]},"application/vnd.ms-printdevicecapabilities+xml":{"source":"iana","compressible":true},"application/vnd.ms-printing.printticket+xml":{"source":"apache","compressible":true},"application/vnd.ms-printschematicket+xml":{"source":"iana","compressible":true},"application/vnd.ms-project":{"source":"iana","extensions":["mpp","mpt"]},"application/vnd.ms-tnef":{"source":"iana"},"application/vnd.ms-windows.devicepairing":{"source":"iana"},"application/vnd.ms-windows.nwprinting.oob":{"source":"iana"},"application/vnd.ms-windows.printerpairing":{"source":"iana"},"application/vnd.ms-windows.wsd.oob":{"source":"iana"},"application/vnd.ms-wmdrm.lic-chlg-req":{"source":"iana"},"application/vnd.ms-wmdrm.lic-resp":{"source":"iana"},"application/vnd.ms-wmdrm.meter-chlg-req":{"source":"iana"},"application/vnd.ms-wmdrm.meter-resp":{"source":"iana"},"application/vnd.ms-word.document.macroenabled.12":{"source":"iana","extensions":["docm"]},"application/vnd.ms-word.template.macroenabled.12":{"source":"iana","extensions":["dotm"]},"application/vnd.ms-works":{"source":"iana","extensions":["wps","wks","wcm","wdb"]},"application/vnd.ms-wpl":{"source":"iana","extensions":["wpl"]},"application/vnd.ms-xpsdocument":{"source":"iana","compressible":false,"extensions":["xps"]},"application/vnd.msa-disk-image":{"source":"iana"},"application/vnd.mseq":{"source":"iana","extensions":["mseq"]},"application/vnd.msign":{"source":"iana"},"application/vnd.multiad.creator":{"source":"iana"},"application/vnd.multiad.creator.cif":{"source":"iana"},"application/vnd.music-niff":{"source":"iana"},"application/vnd.musician":{"source":"iana","extensions":["mus"]},"application/vnd.muvee.style":{"source":"iana","extensions":["msty"]},"application/vnd.mynfc":{"source":"iana","extensions":["taglet"]},"application/vnd.ncd.control":{"source":"iana"},"application/vnd.ncd.reference":{"source":"iana"},"application/vnd.nearst.inv+json":{"source":"iana","compressible":true},"application/vnd.nervana":{"source":"iana"},"application/vnd.netfpx":{"source":"iana"},"application/vnd.neurolanguage.nlu":{"source":"iana","extensions":["nlu"]},"application/vnd.nimn":{"source":"iana"},"application/vnd.nintendo.nitro.rom":{"source":"iana"},"application/vnd.nintendo.snes.rom":{"source":"iana"},"application/vnd.nitf":{"source":"iana","extensions":["ntf","nitf"]},"application/vnd.noblenet-directory":{"source":"iana","extensions":["nnd"]},"application/vnd.noblenet-sealer":{"source":"iana","extensions":["nns"]},"application/vnd.noblenet-web":{"source":"iana","extensions":["nnw"]},"application/vnd.nokia.catalogs":{"source":"iana"},"application/vnd.nokia.conml+wbxml":{"source":"iana"},"application/vnd.nokia.conml+xml":{"source":"iana","compressible":true},"application/vnd.nokia.iptv.config+xml":{"source":"iana","compressible":true},"application/vnd.nokia.isds-radio-presets":{"source":"iana"},"application/vnd.nokia.landmark+wbxml":{"source":"iana"},"application/vnd.nokia.landmark+xml":{"source":"iana","compressible":true},"application/vnd.nokia.landmarkcollection+xml":{"source":"iana","compressible":true},"application/vnd.nokia.n-gage.ac+xml":{"source":"iana","compressible":true},"application/vnd.nokia.n-gage.data":{"source":"iana","extensions":["ngdat"]},"application/vnd.nokia.n-gage.symbian.install":{"source":"iana","extensions":["n-gage"]},"application/vnd.nokia.ncd":{"source":"iana"},"application/vnd.nokia.pcd+wbxml":{"source":"iana"},"application/vnd.nokia.pcd+xml":{"source":"iana","compressible":true},"application/vnd.nokia.radio-preset":{"source":"iana","extensions":["rpst"]},"application/vnd.nokia.radio-presets":{"source":"iana","extensions":["rpss"]},"application/vnd.novadigm.edm":{"source":"iana","extensions":["edm"]},"application/vnd.novadigm.edx":{"source":"iana","extensions":["edx"]},"application/vnd.novadigm.ext":{"source":"iana","extensions":["ext"]},"application/vnd.ntt-local.content-share":{"source":"iana"},"application/vnd.ntt-local.file-transfer":{"source":"iana"},"application/vnd.ntt-local.ogw_remote-access":{"source":"iana"},"application/vnd.ntt-local.sip-ta_remote":{"source":"iana"},"application/vnd.ntt-local.sip-ta_tcp_stream":{"source":"iana"},"application/vnd.oasis.opendocument.chart":{"source":"iana","extensions":["odc"]},"application/vnd.oasis.opendocument.chart-template":{"source":"iana","extensions":["otc"]},"application/vnd.oasis.opendocument.database":{"source":"iana","extensions":["odb"]},"application/vnd.oasis.opendocument.formula":{"source":"iana","extensions":["odf"]},"application/vnd.oasis.opendocument.formula-template":{"source":"iana","extensions":["odft"]},"application/vnd.oasis.opendocument.graphics":{"source":"iana","compressible":false,"extensions":["odg"]},"application/vnd.oasis.opendocument.graphics-template":{"source":"iana","extensions":["otg"]},"application/vnd.oasis.opendocument.image":{"source":"iana","extensions":["odi"]},"application/vnd.oasis.opendocument.image-template":{"source":"iana","extensions":["oti"]},"application/vnd.oasis.opendocument.presentation":{"source":"iana","compressible":false,"extensions":["odp"]},"application/vnd.oasis.opendocument.presentation-template":{"source":"iana","extensions":["otp"]},"application/vnd.oasis.opendocument.spreadsheet":{"source":"iana","compressible":false,"extensions":["ods"]},"application/vnd.oasis.opendocument.spreadsheet-template":{"source":"iana","extensions":["ots"]},"application/vnd.oasis.opendocument.text":{"source":"iana","compressible":false,"extensions":["odt"]},"application/vnd.oasis.opendocument.text-master":{"source":"iana","extensions":["odm"]},"application/vnd.oasis.opendocument.text-template":{"source":"iana","extensions":["ott"]},"application/vnd.oasis.opendocument.text-web":{"source":"iana","extensions":["oth"]},"application/vnd.obn":{"source":"iana"},"application/vnd.ocf+cbor":{"source":"iana"},"application/vnd.oftn.l10n+json":{"source":"iana","compressible":true},"application/vnd.oipf.contentaccessdownload+xml":{"source":"iana","compressible":true},"application/vnd.oipf.contentaccessstreaming+xml":{"source":"iana","compressible":true},"application/vnd.oipf.cspg-hexbinary":{"source":"iana"},"application/vnd.oipf.dae.svg+xml":{"source":"iana","compressible":true},"application/vnd.oipf.dae.xhtml+xml":{"source":"iana","compressible":true},"application/vnd.oipf.mippvcontrolmessage+xml":{"source":"iana","compressible":true},"application/vnd.oipf.pae.gem":{"source":"iana"},"application/vnd.oipf.spdiscovery+xml":{"source":"iana","compressible":true},"application/vnd.oipf.spdlist+xml":{"source":"iana","compressible":true},"application/vnd.oipf.ueprofile+xml":{"source":"iana","compressible":true},"application/vnd.oipf.userprofile+xml":{"source":"iana","compressible":true},"application/vnd.olpc-sugar":{"source":"iana","extensions":["xo"]},"application/vnd.oma-scws-config":{"source":"iana"},"application/vnd.oma-scws-http-request":{"source":"iana"},"application/vnd.oma-scws-http-response":{"source":"iana"},"application/vnd.oma.bcast.associated-procedure-parameter+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.drm-trigger+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.imd+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.ltkm":{"source":"iana"},"application/vnd.oma.bcast.notification+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.provisioningtrigger":{"source":"iana"},"application/vnd.oma.bcast.sgboot":{"source":"iana"},"application/vnd.oma.bcast.sgdd+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.sgdu":{"source":"iana"},"application/vnd.oma.bcast.simple-symbol-container":{"source":"iana"},"application/vnd.oma.bcast.smartcard-trigger+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.sprov+xml":{"source":"iana","compressible":true},"application/vnd.oma.bcast.stkm":{"source":"iana"},"application/vnd.oma.cab-address-book+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-feature-handler+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-pcc+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-subs-invite+xml":{"source":"iana","compressible":true},"application/vnd.oma.cab-user-prefs+xml":{"source":"iana","compressible":true},"application/vnd.oma.dcd":{"source":"iana"},"application/vnd.oma.dcdc":{"source":"iana"},"application/vnd.oma.dd2+xml":{"source":"iana","compressible":true,"extensions":["dd2"]},"application/vnd.oma.drm.risd+xml":{"source":"iana","compressible":true},"application/vnd.oma.group-usage-list+xml":{"source":"iana","compressible":true},"application/vnd.oma.lwm2m+json":{"source":"iana","compressible":true},"application/vnd.oma.lwm2m+tlv":{"source":"iana"},"application/vnd.oma.pal+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.detailed-progress-report+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.final-report+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.groups+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.invocation-descriptor+xml":{"source":"iana","compressible":true},"application/vnd.oma.poc.optimized-progress-report+xml":{"source":"iana","compressible":true},"application/vnd.oma.push":{"source":"iana"},"application/vnd.oma.scidm.messages+xml":{"source":"iana","compressible":true},"application/vnd.oma.xcap-directory+xml":{"source":"iana","compressible":true},"application/vnd.omads-email+xml":{"source":"iana","compressible":true},"application/vnd.omads-file+xml":{"source":"iana","compressible":true},"application/vnd.omads-folder+xml":{"source":"iana","compressible":true},"application/vnd.omaloc-supl-init":{"source":"iana"},"application/vnd.onepager":{"source":"iana"},"application/vnd.onepagertamp":{"source":"iana"},"application/vnd.onepagertamx":{"source":"iana"},"application/vnd.onepagertat":{"source":"iana"},"application/vnd.onepagertatp":{"source":"iana"},"application/vnd.onepagertatx":{"source":"iana"},"application/vnd.openblox.game+xml":{"source":"iana","compressible":true},"application/vnd.openblox.game-binary":{"source":"iana"},"application/vnd.openeye.oeb":{"source":"iana"},"application/vnd.openofficeorg.extension":{"source":"apache","extensions":["oxt"]},"application/vnd.openstreetmap.data+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.custom-properties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.customxmlproperties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawing+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.chart+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.chartshapes+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramcolors+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramdata+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramlayout+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.drawingml.diagramstyle+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.extended-properties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.commentauthors+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.comments+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.handoutmaster+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.notesmaster+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.notesslide+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.presentation":{"source":"iana","compressible":false,"extensions":["pptx"]},"application/vnd.openxmlformats-officedocument.presentationml.presentation.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.presprops+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slide":{"source":"iana","extensions":["sldx"]},"application/vnd.openxmlformats-officedocument.presentationml.slide+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slidelayout+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slidemaster+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slideshow":{"source":"iana","extensions":["ppsx"]},"application/vnd.openxmlformats-officedocument.presentationml.slideshow.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.slideupdateinfo+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.tablestyles+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.tags+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.template":{"source":"iana","extensions":["potx"]},"application/vnd.openxmlformats-officedocument.presentationml.template.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.presentationml.viewprops+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.calcchain+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.comments+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.connections+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.dialogsheet+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.externallink+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcachedefinition+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcacherecords+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.pivottable+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.querytable+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.revisionheaders+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.revisionlog+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.sharedstrings+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.sheet":{"source":"iana","compressible":false,"extensions":["xlsx"]},"application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.sheetmetadata+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.table+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.tablesinglecells+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.template":{"source":"iana","extensions":["xltx"]},"application/vnd.openxmlformats-officedocument.spreadsheetml.template.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.usernames+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.volatiledependencies+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.theme+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.themeoverride+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.vmldrawing":{"source":"iana"},"application/vnd.openxmlformats-officedocument.wordprocessingml.comments+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.document":{"source":"iana","compressible":false,"extensions":["docx"]},"application/vnd.openxmlformats-officedocument.wordprocessingml.document.glossary+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.document.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.endnotes+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.fonttable+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.footer+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.footnotes+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.numbering+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.settings+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.styles+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.template":{"source":"iana","extensions":["dotx"]},"application/vnd.openxmlformats-officedocument.wordprocessingml.template.main+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-officedocument.wordprocessingml.websettings+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-package.core-properties+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-package.digital-signature-xmlsignature+xml":{"source":"iana","compressible":true},"application/vnd.openxmlformats-package.relationships+xml":{"source":"iana","compressible":true},"application/vnd.oracle.resource+json":{"source":"iana","compressible":true},"application/vnd.orange.indata":{"source":"iana"},"application/vnd.osa.netdeploy":{"source":"iana"},"application/vnd.osgeo.mapguide.package":{"source":"iana","extensions":["mgp"]},"application/vnd.osgi.bundle":{"source":"iana"},"application/vnd.osgi.dp":{"source":"iana","extensions":["dp"]},"application/vnd.osgi.subsystem":{"source":"iana","extensions":["esa"]},"application/vnd.otps.ct-kip+xml":{"source":"iana","compressible":true},"application/vnd.oxli.countgraph":{"source":"iana"},"application/vnd.pagerduty+json":{"source":"iana","compressible":true},"application/vnd.palm":{"source":"iana","extensions":["pdb","pqa","oprc"]},"application/vnd.panoply":{"source":"iana"},"application/vnd.paos.xml":{"source":"iana"},"application/vnd.patentdive":{"source":"iana"},"application/vnd.patientecommsdoc":{"source":"iana"},"application/vnd.pawaafile":{"source":"iana","extensions":["paw"]},"application/vnd.pcos":{"source":"iana"},"application/vnd.pg.format":{"source":"iana","extensions":["str"]},"application/vnd.pg.osasli":{"source":"iana","extensions":["ei6"]},"application/vnd.piaccess.application-licence":{"source":"iana"},"application/vnd.picsel":{"source":"iana","extensions":["efif"]},"application/vnd.pmi.widget":{"source":"iana","extensions":["wg"]},"application/vnd.poc.group-advertisement+xml":{"source":"iana","compressible":true},"application/vnd.pocketlearn":{"source":"iana","extensions":["plf"]},"application/vnd.powerbuilder6":{"source":"iana","extensions":["pbd"]},"application/vnd.powerbuilder6-s":{"source":"iana"},"application/vnd.powerbuilder7":{"source":"iana"},"application/vnd.powerbuilder7-s":{"source":"iana"},"application/vnd.powerbuilder75":{"source":"iana"},"application/vnd.powerbuilder75-s":{"source":"iana"},"application/vnd.preminet":{"source":"iana"},"application/vnd.previewsystems.box":{"source":"iana","extensions":["box"]},"application/vnd.proteus.magazine":{"source":"iana","extensions":["mgz"]},"application/vnd.psfs":{"source":"iana"},"application/vnd.publishare-delta-tree":{"source":"iana","extensions":["qps"]},"application/vnd.pvi.ptid1":{"source":"iana","extensions":["ptid"]},"application/vnd.pwg-multiplexed":{"source":"iana"},"application/vnd.pwg-xhtml-print+xml":{"source":"iana","compressible":true},"application/vnd.qualcomm.brew-app-res":{"source":"iana"},"application/vnd.quarantainenet":{"source":"iana"},"application/vnd.quark.quarkxpress":{"source":"iana","extensions":["qxd","qxt","qwd","qwt","qxl","qxb"]},"application/vnd.quobject-quoxdocument":{"source":"iana"},"application/vnd.radisys.moml+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-conf+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-conn+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-dialog+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-audit-stream+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-conf+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-base+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-fax-detect+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-fax-sendrecv+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-group+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-speech+xml":{"source":"iana","compressible":true},"application/vnd.radisys.msml-dialog-transform+xml":{"source":"iana","compressible":true},"application/vnd.rainstor.data":{"source":"iana"},"application/vnd.rapid":{"source":"iana"},"application/vnd.rar":{"source":"iana"},"application/vnd.realvnc.bed":{"source":"iana","extensions":["bed"]},"application/vnd.recordare.musicxml":{"source":"iana","extensions":["mxl"]},"application/vnd.recordare.musicxml+xml":{"source":"iana","compressible":true,"extensions":["musicxml"]},"application/vnd.renlearn.rlprint":{"source":"iana"},"application/vnd.restful+json":{"source":"iana","compressible":true},"application/vnd.rig.cryptonote":{"source":"iana","extensions":["cryptonote"]},"application/vnd.rim.cod":{"source":"apache","extensions":["cod"]},"application/vnd.rn-realmedia":{"source":"apache","extensions":["rm"]},"application/vnd.rn-realmedia-vbr":{"source":"apache","extensions":["rmvb"]},"application/vnd.route66.link66+xml":{"source":"iana","compressible":true,"extensions":["link66"]},"application/vnd.rs-274x":{"source":"iana"},"application/vnd.ruckus.download":{"source":"iana"},"application/vnd.s3sms":{"source":"iana"},"application/vnd.sailingtracker.track":{"source":"iana","extensions":["st"]},"application/vnd.sbm.cid":{"source":"iana"},"application/vnd.sbm.mid2":{"source":"iana"},"application/vnd.scribus":{"source":"iana"},"application/vnd.sealed.3df":{"source":"iana"},"application/vnd.sealed.csf":{"source":"iana"},"application/vnd.sealed.doc":{"source":"iana"},"application/vnd.sealed.eml":{"source":"iana"},"application/vnd.sealed.mht":{"source":"iana"},"application/vnd.sealed.net":{"source":"iana"},"application/vnd.sealed.ppt":{"source":"iana"},"application/vnd.sealed.tiff":{"source":"iana"},"application/vnd.sealed.xls":{"source":"iana"},"application/vnd.sealedmedia.softseal.html":{"source":"iana"},"application/vnd.sealedmedia.softseal.pdf":{"source":"iana"},"application/vnd.seemail":{"source":"iana","extensions":["see"]},"application/vnd.sema":{"source":"iana","extensions":["sema"]},"application/vnd.semd":{"source":"iana","extensions":["semd"]},"application/vnd.semf":{"source":"iana","extensions":["semf"]},"application/vnd.shade-save-file":{"source":"iana"},"application/vnd.shana.informed.formdata":{"source":"iana","extensions":["ifm"]},"application/vnd.shana.informed.formtemplate":{"source":"iana","extensions":["itp"]},"application/vnd.shana.informed.interchange":{"source":"iana","extensions":["iif"]},"application/vnd.shana.informed.package":{"source":"iana","extensions":["ipk"]},"application/vnd.shootproof+json":{"source":"iana","compressible":true},"application/vnd.shopkick+json":{"source":"iana","compressible":true},"application/vnd.sigrok.session":{"source":"iana"},"application/vnd.simtech-mindmapper":{"source":"iana","extensions":["twd","twds"]},"application/vnd.siren+json":{"source":"iana","compressible":true},"application/vnd.smaf":{"source":"iana","extensions":["mmf"]},"application/vnd.smart.notebook":{"source":"iana"},"application/vnd.smart.teacher":{"source":"iana","extensions":["teacher"]},"application/vnd.software602.filler.form+xml":{"source":"iana","compressible":true},"application/vnd.software602.filler.form-xml-zip":{"source":"iana"},"application/vnd.solent.sdkm+xml":{"source":"iana","compressible":true,"extensions":["sdkm","sdkd"]},"application/vnd.spotfire.dxp":{"source":"iana","extensions":["dxp"]},"application/vnd.spotfire.sfs":{"source":"iana","extensions":["sfs"]},"application/vnd.sqlite3":{"source":"iana"},"application/vnd.sss-cod":{"source":"iana"},"application/vnd.sss-dtf":{"source":"iana"},"application/vnd.sss-ntf":{"source":"iana"},"application/vnd.stardivision.calc":{"source":"apache","extensions":["sdc"]},"application/vnd.stardivision.draw":{"source":"apache","extensions":["sda"]},"application/vnd.stardivision.impress":{"source":"apache","extensions":["sdd"]},"application/vnd.stardivision.math":{"source":"apache","extensions":["smf"]},"application/vnd.stardivision.writer":{"source":"apache","extensions":["sdw","vor"]},"application/vnd.stardivision.writer-global":{"source":"apache","extensions":["sgl"]},"application/vnd.stepmania.package":{"source":"iana","extensions":["smzip"]},"application/vnd.stepmania.stepchart":{"source":"iana","extensions":["sm"]},"application/vnd.street-stream":{"source":"iana"},"application/vnd.sun.wadl+xml":{"source":"iana","compressible":true,"extensions":["wadl"]},"application/vnd.sun.xml.calc":{"source":"apache","extensions":["sxc"]},"application/vnd.sun.xml.calc.template":{"source":"apache","extensions":["stc"]},"application/vnd.sun.xml.draw":{"source":"apache","extensions":["sxd"]},"application/vnd.sun.xml.draw.template":{"source":"apache","extensions":["std"]},"application/vnd.sun.xml.impress":{"source":"apache","extensions":["sxi"]},"application/vnd.sun.xml.impress.template":{"source":"apache","extensions":["sti"]},"application/vnd.sun.xml.math":{"source":"apache","extensions":["sxm"]},"application/vnd.sun.xml.writer":{"source":"apache","extensions":["sxw"]},"application/vnd.sun.xml.writer.global":{"source":"apache","extensions":["sxg"]},"application/vnd.sun.xml.writer.template":{"source":"apache","extensions":["stw"]},"application/vnd.sus-calendar":{"source":"iana","extensions":["sus","susp"]},"application/vnd.svd":{"source":"iana","extensions":["svd"]},"application/vnd.swiftview-ics":{"source":"iana"},"application/vnd.symbian.install":{"source":"apache","extensions":["sis","sisx"]},"application/vnd.syncml+xml":{"source":"iana","compressible":true,"extensions":["xsm"]},"application/vnd.syncml.dm+wbxml":{"source":"iana","extensions":["bdm"]},"application/vnd.syncml.dm+xml":{"source":"iana","compressible":true,"extensions":["xdm"]},"application/vnd.syncml.dm.notification":{"source":"iana"},"application/vnd.syncml.dmddf+wbxml":{"source":"iana"},"application/vnd.syncml.dmddf+xml":{"source":"iana","compressible":true},"application/vnd.syncml.dmtnds+wbxml":{"source":"iana"},"application/vnd.syncml.dmtnds+xml":{"source":"iana","compressible":true},"application/vnd.syncml.ds.notification":{"source":"iana"},"application/vnd.tableschema+json":{"source":"iana","compressible":true},"application/vnd.tao.intent-module-archive":{"source":"iana","extensions":["tao"]},"application/vnd.tcpdump.pcap":{"source":"iana","extensions":["pcap","cap","dmp"]},"application/vnd.think-cell.ppttc+json":{"source":"iana","compressible":true},"application/vnd.tmd.mediaflex.api+xml":{"source":"iana","compressible":true},"application/vnd.tml":{"source":"iana"},"application/vnd.tmobile-livetv":{"source":"iana","extensions":["tmo"]},"application/vnd.tri.onesource":{"source":"iana"},"application/vnd.trid.tpt":{"source":"iana","extensions":["tpt"]},"application/vnd.triscape.mxs":{"source":"iana","extensions":["mxs"]},"application/vnd.trueapp":{"source":"iana","extensions":["tra"]},"application/vnd.truedoc":{"source":"iana"},"application/vnd.ubisoft.webplayer":{"source":"iana"},"application/vnd.ufdl":{"source":"iana","extensions":["ufd","ufdl"]},"application/vnd.uiq.theme":{"source":"iana","extensions":["utz"]},"application/vnd.umajin":{"source":"iana","extensions":["umj"]},"application/vnd.unity":{"source":"iana","extensions":["unityweb"]},"application/vnd.uoml+xml":{"source":"iana","compressible":true,"extensions":["uoml"]},"application/vnd.uplanet.alert":{"source":"iana"},"application/vnd.uplanet.alert-wbxml":{"source":"iana"},"application/vnd.uplanet.bearer-choice":{"source":"iana"},"application/vnd.uplanet.bearer-choice-wbxml":{"source":"iana"},"application/vnd.uplanet.cacheop":{"source":"iana"},"application/vnd.uplanet.cacheop-wbxml":{"source":"iana"},"application/vnd.uplanet.channel":{"source":"iana"},"application/vnd.uplanet.channel-wbxml":{"source":"iana"},"application/vnd.uplanet.list":{"source":"iana"},"application/vnd.uplanet.list-wbxml":{"source":"iana"},"application/vnd.uplanet.listcmd":{"source":"iana"},"application/vnd.uplanet.listcmd-wbxml":{"source":"iana"},"application/vnd.uplanet.signal":{"source":"iana"},"application/vnd.uri-map":{"source":"iana"},"application/vnd.valve.source.material":{"source":"iana"},"application/vnd.vcx":{"source":"iana","extensions":["vcx"]},"application/vnd.vd-study":{"source":"iana"},"application/vnd.vectorworks":{"source":"iana"},"application/vnd.vel+json":{"source":"iana","compressible":true},"application/vnd.verimatrix.vcas":{"source":"iana"},"application/vnd.veryant.thin":{"source":"iana"},"application/vnd.ves.encrypted":{"source":"iana"},"application/vnd.vidsoft.vidconference":{"source":"iana"},"application/vnd.visio":{"source":"iana","extensions":["vsd","vst","vss","vsw"]},"application/vnd.visionary":{"source":"iana","extensions":["vis"]},"application/vnd.vividence.scriptfile":{"source":"iana"},"application/vnd.vsf":{"source":"iana","extensions":["vsf"]},"application/vnd.wap.sic":{"source":"iana"},"application/vnd.wap.slc":{"source":"iana"},"application/vnd.wap.wbxml":{"source":"iana","extensions":["wbxml"]},"application/vnd.wap.wmlc":{"source":"iana","extensions":["wmlc"]},"application/vnd.wap.wmlscriptc":{"source":"iana","extensions":["wmlsc"]},"application/vnd.webturbo":{"source":"iana","extensions":["wtb"]},"application/vnd.wfa.p2p":{"source":"iana"},"application/vnd.wfa.wsc":{"source":"iana"},"application/vnd.windows.devicepairing":{"source":"iana"},"application/vnd.wmc":{"source":"iana"},"application/vnd.wmf.bootstrap":{"source":"iana"},"application/vnd.wolfram.mathematica":{"source":"iana"},"application/vnd.wolfram.mathematica.package":{"source":"iana"},"application/vnd.wolfram.player":{"source":"iana","extensions":["nbp"]},"application/vnd.wordperfect":{"source":"iana","extensions":["wpd"]},"application/vnd.wqd":{"source":"iana","extensions":["wqd"]},"application/vnd.wrq-hp3000-labelled":{"source":"iana"},"application/vnd.wt.stf":{"source":"iana","extensions":["stf"]},"application/vnd.wv.csp+wbxml":{"source":"iana"},"application/vnd.wv.csp+xml":{"source":"iana","compressible":true},"application/vnd.wv.ssp+xml":{"source":"iana","compressible":true},"application/vnd.xacml+json":{"source":"iana","compressible":true},"application/vnd.xara":{"source":"iana","extensions":["xar"]},"application/vnd.xfdl":{"source":"iana","extensions":["xfdl"]},"application/vnd.xfdl.webform":{"source":"iana"},"application/vnd.xmi+xml":{"source":"iana","compressible":true},"application/vnd.xmpie.cpkg":{"source":"iana"},"application/vnd.xmpie.dpkg":{"source":"iana"},"application/vnd.xmpie.plan":{"source":"iana"},"application/vnd.xmpie.ppkg":{"source":"iana"},"application/vnd.xmpie.xlim":{"source":"iana"},"application/vnd.yamaha.hv-dic":{"source":"iana","extensions":["hvd"]},"application/vnd.yamaha.hv-script":{"source":"iana","extensions":["hvs"]},"application/vnd.yamaha.hv-voice":{"source":"iana","extensions":["hvp"]},"application/vnd.yamaha.openscoreformat":{"source":"iana","extensions":["osf"]},"application/vnd.yamaha.openscoreformat.osfpvg+xml":{"source":"iana","compressible":true,"extensions":["osfpvg"]},"application/vnd.yamaha.remote-setup":{"source":"iana"},"application/vnd.yamaha.smaf-audio":{"source":"iana","extensions":["saf"]},"application/vnd.yamaha.smaf-phrase":{"source":"iana","extensions":["spf"]},"application/vnd.yamaha.through-ngn":{"source":"iana"},"application/vnd.yamaha.tunnel-udpencap":{"source":"iana"},"application/vnd.yaoweme":{"source":"iana"},"application/vnd.yellowriver-custom-menu":{"source":"iana","extensions":["cmp"]},"application/vnd.youtube.yt":{"source":"iana"},"application/vnd.zul":{"source":"iana","extensions":["zir","zirz"]},"application/vnd.zzazz.deck+xml":{"source":"iana","compressible":true,"extensions":["zaz"]},"application/voicexml+xml":{"source":"iana","compressible":true,"extensions":["vxml"]},"application/voucher-cms+json":{"source":"iana","compressible":true},"application/vq-rtcpxr":{"source":"iana"},"application/wasm":{"compressible":true,"extensions":["wasm"]},"application/watcherinfo+xml":{"source":"iana","compressible":true},"application/webpush-options+json":{"source":"iana","compressible":true},"application/whoispp-query":{"source":"iana"},"application/whoispp-response":{"source":"iana"},"application/widget":{"source":"iana","extensions":["wgt"]},"application/winhlp":{"source":"apache","extensions":["hlp"]},"application/wita":{"source":"iana"},"application/wordperfect5.1":{"source":"iana"},"application/wsdl+xml":{"source":"iana","compressible":true,"extensions":["wsdl"]},"application/wspolicy+xml":{"source":"iana","compressible":true,"extensions":["wspolicy"]},"application/x-7z-compressed":{"source":"apache","compressible":false,"extensions":["7z"]},"application/x-abiword":{"source":"apache","extensions":["abw"]},"application/x-ace-compressed":{"source":"apache","extensions":["ace"]},"application/x-amf":{"source":"apache"},"application/x-apple-diskimage":{"source":"apache","extensions":["dmg"]},"application/x-arj":{"compressible":false,"extensions":["arj"]},"application/x-authorware-bin":{"source":"apache","extensions":["aab","x32","u32","vox"]},"application/x-authorware-map":{"source":"apache","extensions":["aam"]},"application/x-authorware-seg":{"source":"apache","extensions":["aas"]},"application/x-bcpio":{"source":"apache","extensions":["bcpio"]},"application/x-bdoc":{"compressible":false,"extensions":["bdoc"]},"application/x-bittorrent":{"source":"apache","extensions":["torrent"]},"application/x-blorb":{"source":"apache","extensions":["blb","blorb"]},"application/x-bzip":{"source":"apache","compressible":false,"extensions":["bz"]},"application/x-bzip2":{"source":"apache","compressible":false,"extensions":["bz2","boz"]},"application/x-cbr":{"source":"apache","extensions":["cbr","cba","cbt","cbz","cb7"]},"application/x-cdlink":{"source":"apache","extensions":["vcd"]},"application/x-cfs-compressed":{"source":"apache","extensions":["cfs"]},"application/x-chat":{"source":"apache","extensions":["chat"]},"application/x-chess-pgn":{"source":"apache","extensions":["pgn"]},"application/x-chrome-extension":{"extensions":["crx"]},"application/x-cocoa":{"source":"nginx","extensions":["cco"]},"application/x-compress":{"source":"apache"},"application/x-conference":{"source":"apache","extensions":["nsc"]},"application/x-cpio":{"source":"apache","extensions":["cpio"]},"application/x-csh":{"source":"apache","extensions":["csh"]},"application/x-deb":{"compressible":false},"application/x-debian-package":{"source":"apache","extensions":["deb","udeb"]},"application/x-dgc-compressed":{"source":"apache","extensions":["dgc"]},"application/x-director":{"source":"apache","extensions":["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"]},"application/x-doom":{"source":"apache","extensions":["wad"]},"application/x-dtbncx+xml":{"source":"apache","compressible":true,"extensions":["ncx"]},"application/x-dtbook+xml":{"source":"apache","compressible":true,"extensions":["dtb"]},"application/x-dtbresource+xml":{"source":"apache","compressible":true,"extensions":["res"]},"application/x-dvi":{"source":"apache","compressible":false,"extensions":["dvi"]},"application/x-envoy":{"source":"apache","extensions":["evy"]},"application/x-eva":{"source":"apache","extensions":["eva"]},"application/x-font-bdf":{"source":"apache","extensions":["bdf"]},"application/x-font-dos":{"source":"apache"},"application/x-font-framemaker":{"source":"apache"},"application/x-font-ghostscript":{"source":"apache","extensions":["gsf"]},"application/x-font-libgrx":{"source":"apache"},"application/x-font-linux-psf":{"source":"apache","extensions":["psf"]},"application/x-font-pcf":{"source":"apache","extensions":["pcf"]},"application/x-font-snf":{"source":"apache","extensions":["snf"]},"application/x-font-speedo":{"source":"apache"},"application/x-font-sunos-news":{"source":"apache"},"application/x-font-type1":{"source":"apache","extensions":["pfa","pfb","pfm","afm"]},"application/x-font-vfont":{"source":"apache"},"application/x-freearc":{"source":"apache","extensions":["arc"]},"application/x-futuresplash":{"source":"apache","extensions":["spl"]},"application/x-gca-compressed":{"source":"apache","extensions":["gca"]},"application/x-glulx":{"source":"apache","extensions":["ulx"]},"application/x-gnumeric":{"source":"apache","extensions":["gnumeric"]},"application/x-gramps-xml":{"source":"apache","extensions":["gramps"]},"application/x-gtar":{"source":"apache","extensions":["gtar"]},"application/x-gzip":{"source":"apache"},"application/x-hdf":{"source":"apache","extensions":["hdf"]},"application/x-httpd-php":{"compressible":true,"extensions":["php"]},"application/x-install-instructions":{"source":"apache","extensions":["install"]},"application/x-iso9660-image":{"source":"apache","extensions":["iso"]},"application/x-java-archive-diff":{"source":"nginx","extensions":["jardiff"]},"application/x-java-jnlp-file":{"source":"apache","compressible":false,"extensions":["jnlp"]},"application/x-javascript":{"compressible":true},"application/x-latex":{"source":"apache","compressible":false,"extensions":["latex"]},"application/x-lua-bytecode":{"extensions":["luac"]},"application/x-lzh-compressed":{"source":"apache","extensions":["lzh","lha"]},"application/x-makeself":{"source":"nginx","extensions":["run"]},"application/x-mie":{"source":"apache","extensions":["mie"]},"application/x-mobipocket-ebook":{"source":"apache","extensions":["prc","mobi"]},"application/x-mpegurl":{"compressible":false},"application/x-ms-application":{"source":"apache","extensions":["application"]},"application/x-ms-shortcut":{"source":"apache","extensions":["lnk"]},"application/x-ms-wmd":{"source":"apache","extensions":["wmd"]},"application/x-ms-wmz":{"source":"apache","extensions":["wmz"]},"application/x-ms-xbap":{"source":"apache","extensions":["xbap"]},"application/x-msaccess":{"source":"apache","extensions":["mdb"]},"application/x-msbinder":{"source":"apache","extensions":["obd"]},"application/x-mscardfile":{"source":"apache","extensions":["crd"]},"application/x-msclip":{"source":"apache","extensions":["clp"]},"application/x-msdos-program":{"extensions":["exe"]},"application/x-msdownload":{"source":"apache","extensions":["exe","dll","com","bat","msi"]},"application/x-msmediaview":{"source":"apache","extensions":["mvb","m13","m14"]},"application/x-msmetafile":{"source":"apache","extensions":["wmf","wmz","emf","emz"]},"application/x-msmoney":{"source":"apache","extensions":["mny"]},"application/x-mspublisher":{"source":"apache","extensions":["pub"]},"application/x-msschedule":{"source":"apache","extensions":["scd"]},"application/x-msterminal":{"source":"apache","extensions":["trm"]},"application/x-mswrite":{"source":"apache","extensions":["wri"]},"application/x-netcdf":{"source":"apache","extensions":["nc","cdf"]},"application/x-ns-proxy-autoconfig":{"compressible":true,"extensions":["pac"]},"application/x-nzb":{"source":"apache","extensions":["nzb"]},"application/x-perl":{"source":"nginx","extensions":["pl","pm"]},"application/x-pilot":{"source":"nginx","extensions":["prc","pdb"]},"application/x-pkcs12":{"source":"apache","compressible":false,"extensions":["p12","pfx"]},"application/x-pkcs7-certificates":{"source":"apache","extensions":["p7b","spc"]},"application/x-pkcs7-certreqresp":{"source":"apache","extensions":["p7r"]},"application/x-rar-compressed":{"source":"apache","compressible":false,"extensions":["rar"]},"application/x-redhat-package-manager":{"source":"nginx","extensions":["rpm"]},"application/x-research-info-systems":{"source":"apache","extensions":["ris"]},"application/x-sea":{"source":"nginx","extensions":["sea"]},"application/x-sh":{"source":"apache","compressible":true,"extensions":["sh"]},"application/x-shar":{"source":"apache","extensions":["shar"]},"application/x-shockwave-flash":{"source":"apache","compressible":false,"extensions":["swf"]},"application/x-silverlight-app":{"source":"apache","extensions":["xap"]},"application/x-sql":{"source":"apache","extensions":["sql"]},"application/x-stuffit":{"source":"apache","compressible":false,"extensions":["sit"]},"application/x-stuffitx":{"source":"apache","extensions":["sitx"]},"application/x-subrip":{"source":"apache","extensions":["srt"]},"application/x-sv4cpio":{"source":"apache","extensions":["sv4cpio"]},"application/x-sv4crc":{"source":"apache","extensions":["sv4crc"]},"application/x-t3vm-image":{"source":"apache","extensions":["t3"]},"application/x-tads":{"source":"apache","extensions":["gam"]},"application/x-tar":{"source":"apache","compressible":true,"extensions":["tar"]},"application/x-tcl":{"source":"apache","extensions":["tcl","tk"]},"application/x-tex":{"source":"apache","extensions":["tex"]},"application/x-tex-tfm":{"source":"apache","extensions":["tfm"]},"application/x-texinfo":{"source":"apache","extensions":["texinfo","texi"]},"application/x-tgif":{"source":"apache","extensions":["obj"]},"application/x-ustar":{"source":"apache","extensions":["ustar"]},"application/x-virtualbox-hdd":{"compressible":true,"extensions":["hdd"]},"application/x-virtualbox-ova":{"compressible":true,"extensions":["ova"]},"application/x-virtualbox-ovf":{"compressible":true,"extensions":["ovf"]},"application/x-virtualbox-vbox":{"compressible":true,"extensions":["vbox"]},"application/x-virtualbox-vbox-extpack":{"compressible":false,"extensions":["vbox-extpack"]},"application/x-virtualbox-vdi":{"compressible":true,"extensions":["vdi"]},"application/x-virtualbox-vhd":{"compressible":true,"extensions":["vhd"]},"application/x-virtualbox-vmdk":{"compressible":true,"extensions":["vmdk"]},"application/x-wais-source":{"source":"apache","extensions":["src"]},"application/x-web-app-manifest+json":{"compressible":true,"extensions":["webapp"]},"application/x-www-form-urlencoded":{"source":"iana","compressible":true},"application/x-x509-ca-cert":{"source":"apache","extensions":["der","crt","pem"]},"application/x-xfig":{"source":"apache","extensions":["fig"]},"application/x-xliff+xml":{"source":"apache","compressible":true,"extensions":["xlf"]},"application/x-xpinstall":{"source":"apache","compressible":false,"extensions":["xpi"]},"application/x-xz":{"source":"apache","extensions":["xz"]},"application/x-zmachine":{"source":"apache","extensions":["z1","z2","z3","z4","z5","z6","z7","z8"]},"application/x400-bp":{"source":"iana"},"application/xacml+xml":{"source":"iana","compressible":true},"application/xaml+xml":{"source":"apache","compressible":true,"extensions":["xaml"]},"application/xcap-att+xml":{"source":"iana","compressible":true},"application/xcap-caps+xml":{"source":"iana","compressible":true},"application/xcap-diff+xml":{"source":"iana","compressible":true,"extensions":["xdf"]},"application/xcap-el+xml":{"source":"iana","compressible":true},"application/xcap-error+xml":{"source":"iana","compressible":true},"application/xcap-ns+xml":{"source":"iana","compressible":true},"application/xcon-conference-info+xml":{"source":"iana","compressible":true},"application/xcon-conference-info-diff+xml":{"source":"iana","compressible":true},"application/xenc+xml":{"source":"iana","compressible":true,"extensions":["xenc"]},"application/xhtml+xml":{"source":"iana","compressible":true,"extensions":["xhtml","xht"]},"application/xhtml-voice+xml":{"source":"apache","compressible":true},"application/xliff+xml":{"source":"iana","compressible":true},"application/xml":{"source":"iana","compressible":true,"extensions":["xml","xsl","xsd","rng"]},"application/xml-dtd":{"source":"iana","compressible":true,"extensions":["dtd"]},"application/xml-external-parsed-entity":{"source":"iana"},"application/xml-patch+xml":{"source":"iana","compressible":true},"application/xmpp+xml":{"source":"iana","compressible":true},"application/xop+xml":{"source":"iana","compressible":true,"extensions":["xop"]},"application/xproc+xml":{"source":"apache","compressible":true,"extensions":["xpl"]},"application/xslt+xml":{"source":"iana","compressible":true,"extensions":["xslt"]},"application/xspf+xml":{"source":"apache","compressible":true,"extensions":["xspf"]},"application/xv+xml":{"source":"iana","compressible":true,"extensions":["mxml","xhvml","xvml","xvm"]},"application/yang":{"source":"iana","extensions":["yang"]},"application/yang-data+json":{"source":"iana","compressible":true},"application/yang-data+xml":{"source":"iana","compressible":true},"application/yang-patch+json":{"source":"iana","compressible":true},"application/yang-patch+xml":{"source":"iana","compressible":true},"application/yin+xml":{"source":"iana","compressible":true,"extensions":["yin"]},"application/zip":{"source":"iana","compressible":false,"extensions":["zip"]},"application/zlib":{"source":"iana"},"application/zstd":{"source":"iana"},"audio/1d-interleaved-parityfec":{"source":"iana"},"audio/32kadpcm":{"source":"iana"},"audio/3gpp":{"source":"iana","compressible":false,"extensions":["3gpp"]},"audio/3gpp2":{"source":"iana"},"audio/aac":{"source":"iana"},"audio/ac3":{"source":"iana"},"audio/adpcm":{"source":"apache","extensions":["adp"]},"audio/amr":{"source":"iana"},"audio/amr-wb":{"source":"iana"},"audio/amr-wb+":{"source":"iana"},"audio/aptx":{"source":"iana"},"audio/asc":{"source":"iana"},"audio/atrac-advanced-lossless":{"source":"iana"},"audio/atrac-x":{"source":"iana"},"audio/atrac3":{"source":"iana"},"audio/basic":{"source":"iana","compressible":false,"extensions":["au","snd"]},"audio/bv16":{"source":"iana"},"audio/bv32":{"source":"iana"},"audio/clearmode":{"source":"iana"},"audio/cn":{"source":"iana"},"audio/dat12":{"source":"iana"},"audio/dls":{"source":"iana"},"audio/dsr-es201108":{"source":"iana"},"audio/dsr-es202050":{"source":"iana"},"audio/dsr-es202211":{"source":"iana"},"audio/dsr-es202212":{"source":"iana"},"audio/dv":{"source":"iana"},"audio/dvi4":{"source":"iana"},"audio/eac3":{"source":"iana"},"audio/encaprtp":{"source":"iana"},"audio/evrc":{"source":"iana"},"audio/evrc-qcp":{"source":"iana"},"audio/evrc0":{"source":"iana"},"audio/evrc1":{"source":"iana"},"audio/evrcb":{"source":"iana"},"audio/evrcb0":{"source":"iana"},"audio/evrcb1":{"source":"iana"},"audio/evrcnw":{"source":"iana"},"audio/evrcnw0":{"source":"iana"},"audio/evrcnw1":{"source":"iana"},"audio/evrcwb":{"source":"iana"},"audio/evrcwb0":{"source":"iana"},"audio/evrcwb1":{"source":"iana"},"audio/evs":{"source":"iana"},"audio/flexfec":{"source":"iana"},"audio/fwdred":{"source":"iana"},"audio/g711-0":{"source":"iana"},"audio/g719":{"source":"iana"},"audio/g722":{"source":"iana"},"audio/g7221":{"source":"iana"},"audio/g723":{"source":"iana"},"audio/g726-16":{"source":"iana"},"audio/g726-24":{"source":"iana"},"audio/g726-32":{"source":"iana"},"audio/g726-40":{"source":"iana"},"audio/g728":{"source":"iana"},"audio/g729":{"source":"iana"},"audio/g7291":{"source":"iana"},"audio/g729d":{"source":"iana"},"audio/g729e":{"source":"iana"},"audio/gsm":{"source":"iana"},"audio/gsm-efr":{"source":"iana"},"audio/gsm-hr-08":{"source":"iana"},"audio/ilbc":{"source":"iana"},"audio/ip-mr_v2.5":{"source":"iana"},"audio/isac":{"source":"apache"},"audio/l16":{"source":"iana"},"audio/l20":{"source":"iana"},"audio/l24":{"source":"iana","compressible":false},"audio/l8":{"source":"iana"},"audio/lpc":{"source":"iana"},"audio/melp":{"source":"iana"},"audio/melp1200":{"source":"iana"},"audio/melp2400":{"source":"iana"},"audio/melp600":{"source":"iana"},"audio/midi":{"source":"apache","extensions":["mid","midi","kar","rmi"]},"audio/mobile-xmf":{"source":"iana"},"audio/mp3":{"compressible":false,"extensions":["mp3"]},"audio/mp4":{"source":"iana","compressible":false,"extensions":["m4a","mp4a"]},"audio/mp4a-latm":{"source":"iana"},"audio/mpa":{"source":"iana"},"audio/mpa-robust":{"source":"iana"},"audio/mpeg":{"source":"iana","compressible":false,"extensions":["mpga","mp2","mp2a","mp3","m2a","m3a"]},"audio/mpeg4-generic":{"source":"iana"},"audio/musepack":{"source":"apache"},"audio/ogg":{"source":"iana","compressible":false,"extensions":["oga","ogg","spx"]},"audio/opus":{"source":"iana"},"audio/parityfec":{"source":"iana"},"audio/pcma":{"source":"iana"},"audio/pcma-wb":{"source":"iana"},"audio/pcmu":{"source":"iana"},"audio/pcmu-wb":{"source":"iana"},"audio/prs.sid":{"source":"iana"},"audio/qcelp":{"source":"iana"},"audio/raptorfec":{"source":"iana"},"audio/red":{"source":"iana"},"audio/rtp-enc-aescm128":{"source":"iana"},"audio/rtp-midi":{"source":"iana"},"audio/rtploopback":{"source":"iana"},"audio/rtx":{"source":"iana"},"audio/s3m":{"source":"apache","extensions":["s3m"]},"audio/silk":{"source":"apache","extensions":["sil"]},"audio/smv":{"source":"iana"},"audio/smv-qcp":{"source":"iana"},"audio/smv0":{"source":"iana"},"audio/sp-midi":{"source":"iana"},"audio/speex":{"source":"iana"},"audio/t140c":{"source":"iana"},"audio/t38":{"source":"iana"},"audio/telephone-event":{"source":"iana"},"audio/tetra_acelp":{"source":"iana"},"audio/tone":{"source":"iana"},"audio/uemclip":{"source":"iana"},"audio/ulpfec":{"source":"iana"},"audio/usac":{"source":"iana"},"audio/vdvi":{"source":"iana"},"audio/vmr-wb":{"source":"iana"},"audio/vnd.3gpp.iufp":{"source":"iana"},"audio/vnd.4sb":{"source":"iana"},"audio/vnd.audiokoz":{"source":"iana"},"audio/vnd.celp":{"source":"iana"},"audio/vnd.cisco.nse":{"source":"iana"},"audio/vnd.cmles.radio-events":{"source":"iana"},"audio/vnd.cns.anp1":{"source":"iana"},"audio/vnd.cns.inf1":{"source":"iana"},"audio/vnd.dece.audio":{"source":"iana","extensions":["uva","uvva"]},"audio/vnd.digital-winds":{"source":"iana","extensions":["eol"]},"audio/vnd.dlna.adts":{"source":"iana"},"audio/vnd.dolby.heaac.1":{"source":"iana"},"audio/vnd.dolby.heaac.2":{"source":"iana"},"audio/vnd.dolby.mlp":{"source":"iana"},"audio/vnd.dolby.mps":{"source":"iana"},"audio/vnd.dolby.pl2":{"source":"iana"},"audio/vnd.dolby.pl2x":{"source":"iana"},"audio/vnd.dolby.pl2z":{"source":"iana"},"audio/vnd.dolby.pulse.1":{"source":"iana"},"audio/vnd.dra":{"source":"iana","extensions":["dra"]},"audio/vnd.dts":{"source":"iana","extensions":["dts"]},"audio/vnd.dts.hd":{"source":"iana","extensions":["dtshd"]},"audio/vnd.dts.uhd":{"source":"iana"},"audio/vnd.dvb.file":{"source":"iana"},"audio/vnd.everad.plj":{"source":"iana"},"audio/vnd.hns.audio":{"source":"iana"},"audio/vnd.lucent.voice":{"source":"iana","extensions":["lvp"]},"audio/vnd.ms-playready.media.pya":{"source":"iana","extensions":["pya"]},"audio/vnd.nokia.mobile-xmf":{"source":"iana"},"audio/vnd.nortel.vbk":{"source":"iana"},"audio/vnd.nuera.ecelp4800":{"source":"iana","extensions":["ecelp4800"]},"audio/vnd.nuera.ecelp7470":{"source":"iana","extensions":["ecelp7470"]},"audio/vnd.nuera.ecelp9600":{"source":"iana","extensions":["ecelp9600"]},"audio/vnd.octel.sbc":{"source":"iana"},"audio/vnd.presonus.multitrack":{"source":"iana"},"audio/vnd.qcelp":{"source":"iana"},"audio/vnd.rhetorex.32kadpcm":{"source":"iana"},"audio/vnd.rip":{"source":"iana","extensions":["rip"]},"audio/vnd.rn-realaudio":{"compressible":false},"audio/vnd.sealedmedia.softseal.mpeg":{"source":"iana"},"audio/vnd.vmx.cvsd":{"source":"iana"},"audio/vnd.wave":{"compressible":false},"audio/vorbis":{"source":"iana","compressible":false},"audio/vorbis-config":{"source":"iana"},"audio/wav":{"compressible":false,"extensions":["wav"]},"audio/wave":{"compressible":false,"extensions":["wav"]},"audio/webm":{"source":"apache","compressible":false,"extensions":["weba"]},"audio/x-aac":{"source":"apache","compressible":false,"extensions":["aac"]},"audio/x-aiff":{"source":"apache","extensions":["aif","aiff","aifc"]},"audio/x-caf":{"source":"apache","compressible":false,"extensions":["caf"]},"audio/x-flac":{"source":"apache","extensions":["flac"]},"audio/x-m4a":{"source":"nginx","extensions":["m4a"]},"audio/x-matroska":{"source":"apache","extensions":["mka"]},"audio/x-mpegurl":{"source":"apache","extensions":["m3u"]},"audio/x-ms-wax":{"source":"apache","extensions":["wax"]},"audio/x-ms-wma":{"source":"apache","extensions":["wma"]},"audio/x-pn-realaudio":{"source":"apache","extensions":["ram","ra"]},"audio/x-pn-realaudio-plugin":{"source":"apache","extensions":["rmp"]},"audio/x-realaudio":{"source":"nginx","extensions":["ra"]},"audio/x-tta":{"source":"apache"},"audio/x-wav":{"source":"apache","extensions":["wav"]},"audio/xm":{"source":"apache","extensions":["xm"]},"chemical/x-cdx":{"source":"apache","extensions":["cdx"]},"chemical/x-cif":{"source":"apache","extensions":["cif"]},"chemical/x-cmdf":{"source":"apache","extensions":["cmdf"]},"chemical/x-cml":{"source":"apache","extensions":["cml"]},"chemical/x-csml":{"source":"apache","extensions":["csml"]},"chemical/x-pdb":{"source":"apache"},"chemical/x-xyz":{"source":"apache","extensions":["xyz"]},"font/collection":{"source":"iana","extensions":["ttc"]},"font/otf":{"source":"iana","compressible":true,"extensions":["otf"]},"font/sfnt":{"source":"iana"},"font/ttf":{"source":"iana","compressible":true,"extensions":["ttf"]},"font/woff":{"source":"iana","extensions":["woff"]},"font/woff2":{"source":"iana","extensions":["woff2"]},"image/aces":{"source":"iana","extensions":["exr"]},"image/apng":{"compressible":false,"extensions":["apng"]},"image/avci":{"source":"iana"},"image/avcs":{"source":"iana"},"image/bmp":{"source":"iana","compressible":true,"extensions":["bmp"]},"image/cgm":{"source":"iana","extensions":["cgm"]},"image/dicom-rle":{"source":"iana","extensions":["drle"]},"image/emf":{"source":"iana","extensions":["emf"]},"image/fits":{"source":"iana","extensions":["fits"]},"image/g3fax":{"source":"iana","extensions":["g3"]},"image/gif":{"source":"iana","compressible":false,"extensions":["gif"]},"image/heic":{"source":"iana","extensions":["heic"]},"image/heic-sequence":{"source":"iana","extensions":["heics"]},"image/heif":{"source":"iana","extensions":["heif"]},"image/heif-sequence":{"source":"iana","extensions":["heifs"]},"image/hej2k":{"source":"iana","extensions":["hej2"]},"image/hsj2":{"source":"iana","extensions":["hsj2"]},"image/ief":{"source":"iana","extensions":["ief"]},"image/jls":{"source":"iana","extensions":["jls"]},"image/jp2":{"source":"iana","compressible":false,"extensions":["jp2","jpg2"]},"image/jpeg":{"source":"iana","compressible":false,"extensions":["jpeg","jpg","jpe"]},"image/jph":{"source":"iana","extensions":["jph"]},"image/jphc":{"source":"iana","extensions":["jhc"]},"image/jpm":{"source":"iana","compressible":false,"extensions":["jpm"]},"image/jpx":{"source":"iana","compressible":false,"extensions":["jpx","jpf"]},"image/jxr":{"source":"iana","extensions":["jxr"]},"image/jxra":{"source":"iana","extensions":["jxra"]},"image/jxrs":{"source":"iana","extensions":["jxrs"]},"image/jxs":{"source":"iana","extensions":["jxs"]},"image/jxsc":{"source":"iana","extensions":["jxsc"]},"image/jxsi":{"source":"iana","extensions":["jxsi"]},"image/jxss":{"source":"iana","extensions":["jxss"]},"image/ktx":{"source":"iana","extensions":["ktx"]},"image/naplps":{"source":"iana"},"image/pjpeg":{"compressible":false},"image/png":{"source":"iana","compressible":false,"extensions":["png"]},"image/prs.btif":{"source":"iana","extensions":["btif"]},"image/prs.pti":{"source":"iana","extensions":["pti"]},"image/pwg-raster":{"source":"iana"},"image/sgi":{"source":"apache","extensions":["sgi"]},"image/svg+xml":{"source":"iana","compressible":true,"extensions":["svg","svgz"]},"image/t38":{"source":"iana","extensions":["t38"]},"image/tiff":{"source":"iana","compressible":false,"extensions":["tif","tiff"]},"image/tiff-fx":{"source":"iana","extensions":["tfx"]},"image/vnd.adobe.photoshop":{"source":"iana","compressible":true,"extensions":["psd"]},"image/vnd.airzip.accelerator.azv":{"source":"iana","extensions":["azv"]},"image/vnd.cns.inf2":{"source":"iana"},"image/vnd.dece.graphic":{"source":"iana","extensions":["uvi","uvvi","uvg","uvvg"]},"image/vnd.djvu":{"source":"iana","extensions":["djvu","djv"]},"image/vnd.dvb.subtitle":{"source":"iana","extensions":["sub"]},"image/vnd.dwg":{"source":"iana","extensions":["dwg"]},"image/vnd.dxf":{"source":"iana","extensions":["dxf"]},"image/vnd.fastbidsheet":{"source":"iana","extensions":["fbs"]},"image/vnd.fpx":{"source":"iana","extensions":["fpx"]},"image/vnd.fst":{"source":"iana","extensions":["fst"]},"image/vnd.fujixerox.edmics-mmr":{"source":"iana","extensions":["mmr"]},"image/vnd.fujixerox.edmics-rlc":{"source":"iana","extensions":["rlc"]},"image/vnd.globalgraphics.pgb":{"source":"iana"},"image/vnd.microsoft.icon":{"source":"iana","extensions":["ico"]},"image/vnd.mix":{"source":"iana"},"image/vnd.mozilla.apng":{"source":"iana"},"image/vnd.ms-dds":{"extensions":["dds"]},"image/vnd.ms-modi":{"source":"iana","extensions":["mdi"]},"image/vnd.ms-photo":{"source":"apache","extensions":["wdp"]},"image/vnd.net-fpx":{"source":"iana","extensions":["npx"]},"image/vnd.radiance":{"source":"iana"},"image/vnd.sealed.png":{"source":"iana"},"image/vnd.sealedmedia.softseal.gif":{"source":"iana"},"image/vnd.sealedmedia.softseal.jpg":{"source":"iana"},"image/vnd.svf":{"source":"iana"},"image/vnd.tencent.tap":{"source":"iana","extensions":["tap"]},"image/vnd.valve.source.texture":{"source":"iana","extensions":["vtf"]},"image/vnd.wap.wbmp":{"source":"iana","extensions":["wbmp"]},"image/vnd.xiff":{"source":"iana","extensions":["xif"]},"image/vnd.zbrush.pcx":{"source":"iana","extensions":["pcx"]},"image/webp":{"source":"apache","extensions":["webp"]},"image/wmf":{"source":"iana","extensions":["wmf"]},"image/x-3ds":{"source":"apache","extensions":["3ds"]},"image/x-cmu-raster":{"source":"apache","extensions":["ras"]},"image/x-cmx":{"source":"apache","extensions":["cmx"]},"image/x-freehand":{"source":"apache","extensions":["fh","fhc","fh4","fh5","fh7"]},"image/x-icon":{"source":"apache","compressible":true,"extensions":["ico"]},"image/x-jng":{"source":"nginx","extensions":["jng"]},"image/x-mrsid-image":{"source":"apache","extensions":["sid"]},"image/x-ms-bmp":{"source":"nginx","compressible":true,"extensions":["bmp"]},"image/x-pcx":{"source":"apache","extensions":["pcx"]},"image/x-pict":{"source":"apache","extensions":["pic","pct"]},"image/x-portable-anymap":{"source":"apache","extensions":["pnm"]},"image/x-portable-bitmap":{"source":"apache","extensions":["pbm"]},"image/x-portable-graymap":{"source":"apache","extensions":["pgm"]},"image/x-portable-pixmap":{"source":"apache","extensions":["ppm"]},"image/x-rgb":{"source":"apache","extensions":["rgb"]},"image/x-tga":{"source":"apache","extensions":["tga"]},"image/x-xbitmap":{"source":"apache","extensions":["xbm"]},"image/x-xcf":{"compressible":false},"image/x-xpixmap":{"source":"apache","extensions":["xpm"]},"image/x-xwindowdump":{"source":"apache","extensions":["xwd"]},"message/cpim":{"source":"iana"},"message/delivery-status":{"source":"iana"},"message/disposition-notification":{"source":"iana","extensions":["disposition-notification"]},"message/external-body":{"source":"iana"},"message/feedback-report":{"source":"iana"},"message/global":{"source":"iana","extensions":["u8msg"]},"message/global-delivery-status":{"source":"iana","extensions":["u8dsn"]},"message/global-disposition-notification":{"source":"iana","extensions":["u8mdn"]},"message/global-headers":{"source":"iana","extensions":["u8hdr"]},"message/http":{"source":"iana","compressible":false},"message/imdn+xml":{"source":"iana","compressible":true},"message/news":{"source":"iana"},"message/partial":{"source":"iana","compressible":false},"message/rfc822":{"source":"iana","compressible":true,"extensions":["eml","mime"]},"message/s-http":{"source":"iana"},"message/sip":{"source":"iana"},"message/sipfrag":{"source":"iana"},"message/tracking-status":{"source":"iana"},"message/vnd.si.simp":{"source":"iana"},"message/vnd.wfa.wsc":{"source":"iana","extensions":["wsc"]},"model/3mf":{"source":"iana","extensions":["3mf"]},"model/gltf+json":{"source":"iana","compressible":true,"extensions":["gltf"]},"model/gltf-binary":{"source":"iana","compressible":true,"extensions":["glb"]},"model/iges":{"source":"iana","compressible":false,"extensions":["igs","iges"]},"model/mesh":{"source":"iana","compressible":false,"extensions":["msh","mesh","silo"]},"model/stl":{"source":"iana","extensions":["stl"]},"model/vnd.collada+xml":{"source":"iana","compressible":true,"extensions":["dae"]},"model/vnd.dwf":{"source":"iana","extensions":["dwf"]},"model/vnd.flatland.3dml":{"source":"iana"},"model/vnd.gdl":{"source":"iana","extensions":["gdl"]},"model/vnd.gs-gdl":{"source":"apache"},"model/vnd.gs.gdl":{"source":"iana"},"model/vnd.gtw":{"source":"iana","extensions":["gtw"]},"model/vnd.moml+xml":{"source":"iana","compressible":true},"model/vnd.mts":{"source":"iana","extensions":["mts"]},"model/vnd.opengex":{"source":"iana","extensions":["ogex"]},"model/vnd.parasolid.transmit.binary":{"source":"iana","extensions":["x_b"]},"model/vnd.parasolid.transmit.text":{"source":"iana","extensions":["x_t"]},"model/vnd.rosette.annotated-data-model":{"source":"iana"},"model/vnd.usdz+zip":{"source":"iana","compressible":false,"extensions":["usdz"]},"model/vnd.valve.source.compiled-map":{"source":"iana","extensions":["bsp"]},"model/vnd.vtu":{"source":"iana","extensions":["vtu"]},"model/vrml":{"source":"iana","compressible":false,"extensions":["wrl","vrml"]},"model/x3d+binary":{"source":"apache","compressible":false,"extensions":["x3db","x3dbz"]},"model/x3d+fastinfoset":{"source":"iana","extensions":["x3db"]},"model/x3d+vrml":{"source":"apache","compressible":false,"extensions":["x3dv","x3dvz"]},"model/x3d+xml":{"source":"iana","compressible":true,"extensions":["x3d","x3dz"]},"model/x3d-vrml":{"source":"iana","extensions":["x3dv"]},"multipart/alternative":{"source":"iana","compressible":false},"multipart/appledouble":{"source":"iana"},"multipart/byteranges":{"source":"iana"},"multipart/digest":{"source":"iana"},"multipart/encrypted":{"source":"iana","compressible":false},"multipart/form-data":{"source":"iana","compressible":false},"multipart/header-set":{"source":"iana"},"multipart/mixed":{"source":"iana"},"multipart/multilingual":{"source":"iana"},"multipart/parallel":{"source":"iana"},"multipart/related":{"source":"iana","compressible":false},"multipart/report":{"source":"iana"},"multipart/signed":{"source":"iana","compressible":false},"multipart/vnd.bint.med-plus":{"source":"iana"},"multipart/voice-message":{"source":"iana"},"multipart/x-mixed-replace":{"source":"iana"},"text/1d-interleaved-parityfec":{"source":"iana"},"text/cache-manifest":{"source":"iana","compressible":true,"extensions":["appcache","manifest"]},"text/calendar":{"source":"iana","extensions":["ics","ifb"]},"text/calender":{"compressible":true},"text/cmd":{"compressible":true},"text/coffeescript":{"extensions":["coffee","litcoffee"]},"text/css":{"source":"iana","charset":"UTF-8","compressible":true,"extensions":["css"]},"text/csv":{"source":"iana","compressible":true,"extensions":["csv"]},"text/csv-schema":{"source":"iana"},"text/directory":{"source":"iana"},"text/dns":{"source":"iana"},"text/ecmascript":{"source":"iana"},"text/encaprtp":{"source":"iana"},"text/enriched":{"source":"iana"},"text/flexfec":{"source":"iana"},"text/fwdred":{"source":"iana"},"text/grammar-ref-list":{"source":"iana"},"text/html":{"source":"iana","compressible":true,"extensions":["html","htm","shtml"]},"text/jade":{"extensions":["jade"]},"text/javascript":{"source":"iana","compressible":true},"text/jcr-cnd":{"source":"iana"},"text/jsx":{"compressible":true,"extensions":["jsx"]},"text/less":{"compressible":true,"extensions":["less"]},"text/markdown":{"source":"iana","compressible":true,"extensions":["markdown","md"]},"text/mathml":{"source":"nginx","extensions":["mml"]},"text/mdx":{"compressible":true,"extensions":["mdx"]},"text/mizar":{"source":"iana"},"text/n3":{"source":"iana","compressible":true,"extensions":["n3"]},"text/parameters":{"source":"iana"},"text/parityfec":{"source":"iana"},"text/plain":{"source":"iana","compressible":true,"extensions":["txt","text","conf","def","list","log","in","ini"]},"text/provenance-notation":{"source":"iana"},"text/prs.fallenstein.rst":{"source":"iana"},"text/prs.lines.tag":{"source":"iana","extensions":["dsc"]},"text/prs.prop.logic":{"source":"iana"},"text/raptorfec":{"source":"iana"},"text/red":{"source":"iana"},"text/rfc822-headers":{"source":"iana"},"text/richtext":{"source":"iana","compressible":true,"extensions":["rtx"]},"text/rtf":{"source":"iana","compressible":true,"extensions":["rtf"]},"text/rtp-enc-aescm128":{"source":"iana"},"text/rtploopback":{"source":"iana"},"text/rtx":{"source":"iana"},"text/sgml":{"source":"iana","extensions":["sgml","sgm"]},"text/shex":{"extensions":["shex"]},"text/slim":{"extensions":["slim","slm"]},"text/strings":{"source":"iana"},"text/stylus":{"extensions":["stylus","styl"]},"text/t140":{"source":"iana"},"text/tab-separated-values":{"source":"iana","compressible":true,"extensions":["tsv"]},"text/troff":{"source":"iana","extensions":["t","tr","roff","man","me","ms"]},"text/turtle":{"source":"iana","charset":"UTF-8","extensions":["ttl"]},"text/ulpfec":{"source":"iana"},"text/uri-list":{"source":"iana","compressible":true,"extensions":["uri","uris","urls"]},"text/vcard":{"source":"iana","compressible":true,"extensions":["vcard"]},"text/vnd.a":{"source":"iana"},"text/vnd.abc":{"source":"iana"},"text/vnd.ascii-art":{"source":"iana"},"text/vnd.curl":{"source":"iana","extensions":["curl"]},"text/vnd.curl.dcurl":{"source":"apache","extensions":["dcurl"]},"text/vnd.curl.mcurl":{"source":"apache","extensions":["mcurl"]},"text/vnd.curl.scurl":{"source":"apache","extensions":["scurl"]},"text/vnd.debian.copyright":{"source":"iana"},"text/vnd.dmclientscript":{"source":"iana"},"text/vnd.dvb.subtitle":{"source":"iana","extensions":["sub"]},"text/vnd.esmertec.theme-descriptor":{"source":"iana"},"text/vnd.ficlab.flt":{"source":"iana"},"text/vnd.fly":{"source":"iana","extensions":["fly"]},"text/vnd.fmi.flexstor":{"source":"iana","extensions":["flx"]},"text/vnd.gml":{"source":"iana"},"text/vnd.graphviz":{"source":"iana","extensions":["gv"]},"text/vnd.hgl":{"source":"iana"},"text/vnd.in3d.3dml":{"source":"iana","extensions":["3dml"]},"text/vnd.in3d.spot":{"source":"iana","extensions":["spot"]},"text/vnd.iptc.newsml":{"source":"iana"},"text/vnd.iptc.nitf":{"source":"iana"},"text/vnd.latex-z":{"source":"iana"},"text/vnd.motorola.reflex":{"source":"iana"},"text/vnd.ms-mediapackage":{"source":"iana"},"text/vnd.net2phone.commcenter.command":{"source":"iana"},"text/vnd.radisys.msml-basic-layout":{"source":"iana"},"text/vnd.senx.warpscript":{"source":"iana"},"text/vnd.si.uricatalogue":{"source":"iana"},"text/vnd.sosi":{"source":"iana"},"text/vnd.sun.j2me.app-descriptor":{"source":"iana","extensions":["jad"]},"text/vnd.trolltech.linguist":{"source":"iana"},"text/vnd.wap.si":{"source":"iana"},"text/vnd.wap.sl":{"source":"iana"},"text/vnd.wap.wml":{"source":"iana","extensions":["wml"]},"text/vnd.wap.wmlscript":{"source":"iana","extensions":["wmls"]},"text/vtt":{"charset":"UTF-8","compressible":true,"extensions":["vtt"]},"text/x-asm":{"source":"apache","extensions":["s","asm"]},"text/x-c":{"source":"apache","extensions":["c","cc","cxx","cpp","h","hh","dic"]},"text/x-component":{"source":"nginx","extensions":["htc"]},"text/x-fortran":{"source":"apache","extensions":["f","for","f77","f90"]},"text/x-gwt-rpc":{"compressible":true},"text/x-handlebars-template":{"extensions":["hbs"]},"text/x-java-source":{"source":"apache","extensions":["java"]},"text/x-jquery-tmpl":{"compressible":true},"text/x-lua":{"extensions":["lua"]},"text/x-markdown":{"compressible":true,"extensions":["mkd"]},"text/x-nfo":{"source":"apache","extensions":["nfo"]},"text/x-opml":{"source":"apache","extensions":["opml"]},"text/x-org":{"compressible":true,"extensions":["org"]},"text/x-pascal":{"source":"apache","extensions":["p","pas"]},"text/x-processing":{"compressible":true,"extensions":["pde"]},"text/x-sass":{"extensions":["sass"]},"text/x-scss":{"extensions":["scss"]},"text/x-setext":{"source":"apache","extensions":["etx"]},"text/x-sfv":{"source":"apache","extensions":["sfv"]},"text/x-suse-ymp":{"compressible":true,"extensions":["ymp"]},"text/x-uuencode":{"source":"apache","extensions":["uu"]},"text/x-vcalendar":{"source":"apache","extensions":["vcs"]},"text/x-vcard":{"source":"apache","extensions":["vcf"]},"text/xml":{"source":"iana","compressible":true,"extensions":["xml"]},"text/xml-external-parsed-entity":{"source":"iana"},"text/yaml":{"extensions":["yaml","yml"]},"video/1d-interleaved-parityfec":{"source":"iana"},"video/3gpp":{"source":"iana","extensions":["3gp","3gpp"]},"video/3gpp-tt":{"source":"iana"},"video/3gpp2":{"source":"iana","extensions":["3g2"]},"video/bmpeg":{"source":"iana"},"video/bt656":{"source":"iana"},"video/celb":{"source":"iana"},"video/dv":{"source":"iana"},"video/encaprtp":{"source":"iana"},"video/flexfec":{"source":"iana"},"video/h261":{"source":"iana","extensions":["h261"]},"video/h263":{"source":"iana","extensions":["h263"]},"video/h263-1998":{"source":"iana"},"video/h263-2000":{"source":"iana"},"video/h264":{"source":"iana","extensions":["h264"]},"video/h264-rcdo":{"source":"iana"},"video/h264-svc":{"source":"iana"},"video/h265":{"source":"iana"},"video/iso.segment":{"source":"iana"},"video/jpeg":{"source":"iana","extensions":["jpgv"]},"video/jpeg2000":{"source":"iana"},"video/jpm":{"source":"apache","extensions":["jpm","jpgm"]},"video/mj2":{"source":"iana","extensions":["mj2","mjp2"]},"video/mp1s":{"source":"iana"},"video/mp2p":{"source":"iana"},"video/mp2t":{"source":"iana","extensions":["ts"]},"video/mp4":{"source":"iana","compressible":false,"extensions":["mp4","mp4v","mpg4"]},"video/mp4v-es":{"source":"iana"},"video/mpeg":{"source":"iana","compressible":false,"extensions":["mpeg","mpg","mpe","m1v","m2v"]},"video/mpeg4-generic":{"source":"iana"},"video/mpv":{"source":"iana"},"video/nv":{"source":"iana"},"video/ogg":{"source":"iana","compressible":false,"extensions":["ogv"]},"video/parityfec":{"source":"iana"},"video/pointer":{"source":"iana"},"video/quicktime":{"source":"iana","compressible":false,"extensions":["qt","mov"]},"video/raptorfec":{"source":"iana"},"video/raw":{"source":"iana"},"video/rtp-enc-aescm128":{"source":"iana"},"video/rtploopback":{"source":"iana"},"video/rtx":{"source":"iana"},"video/smpte291":{"source":"iana"},"video/smpte292m":{"source":"iana"},"video/ulpfec":{"source":"iana"},"video/vc1":{"source":"iana"},"video/vc2":{"source":"iana"},"video/vnd.cctv":{"source":"iana"},"video/vnd.dece.hd":{"source":"iana","extensions":["uvh","uvvh"]},"video/vnd.dece.mobile":{"source":"iana","extensions":["uvm","uvvm"]},"video/vnd.dece.mp4":{"source":"iana"},"video/vnd.dece.pd":{"source":"iana","extensions":["uvp","uvvp"]},"video/vnd.dece.sd":{"source":"iana","extensions":["uvs","uvvs"]},"video/vnd.dece.video":{"source":"iana","extensions":["uvv","uvvv"]},"video/vnd.directv.mpeg":{"source":"iana"},"video/vnd.directv.mpeg-tts":{"source":"iana"},"video/vnd.dlna.mpeg-tts":{"source":"iana"},"video/vnd.dvb.file":{"source":"iana","extensions":["dvb"]},"video/vnd.fvt":{"source":"iana","extensions":["fvt"]},"video/vnd.hns.video":{"source":"iana"},"video/vnd.iptvforum.1dparityfec-1010":{"source":"iana"},"video/vnd.iptvforum.1dparityfec-2005":{"source":"iana"},"video/vnd.iptvforum.2dparityfec-1010":{"source":"iana"},"video/vnd.iptvforum.2dparityfec-2005":{"source":"iana"},"video/vnd.iptvforum.ttsavc":{"source":"iana"},"video/vnd.iptvforum.ttsmpeg2":{"source":"iana"},"video/vnd.motorola.video":{"source":"iana"},"video/vnd.motorola.videop":{"source":"iana"},"video/vnd.mpegurl":{"source":"iana","extensions":["mxu","m4u"]},"video/vnd.ms-playready.media.pyv":{"source":"iana","extensions":["pyv"]},"video/vnd.nokia.interleaved-multimedia":{"source":"iana"},"video/vnd.nokia.mp4vr":{"source":"iana"},"video/vnd.nokia.videovoip":{"source":"iana"},"video/vnd.objectvideo":{"source":"iana"},"video/vnd.radgamettools.bink":{"source":"iana"},"video/vnd.radgamettools.smacker":{"source":"iana"},"video/vnd.sealed.mpeg1":{"source":"iana"},"video/vnd.sealed.mpeg4":{"source":"iana"},"video/vnd.sealed.swf":{"source":"iana"},"video/vnd.sealedmedia.softseal.mov":{"source":"iana"},"video/vnd.uvvu.mp4":{"source":"iana","extensions":["uvu","uvvu"]},"video/vnd.vivo":{"source":"iana","extensions":["viv"]},"video/vnd.youtube.yt":{"source":"iana"},"video/vp8":{"source":"iana"},"video/webm":{"source":"apache","compressible":false,"extensions":["webm"]},"video/x-f4v":{"source":"apache","extensions":["f4v"]},"video/x-fli":{"source":"apache","extensions":["fli"]},"video/x-flv":{"source":"apache","compressible":false,"extensions":["flv"]},"video/x-m4v":{"source":"apache","extensions":["m4v"]},"video/x-matroska":{"source":"apache","compressible":false,"extensions":["mkv","mk3d","mks"]},"video/x-mng":{"source":"apache","extensions":["mng"]},"video/x-ms-asf":{"source":"apache","extensions":["asf","asx"]},"video/x-ms-vob":{"source":"apache","extensions":["vob"]},"video/x-ms-wm":{"source":"apache","extensions":["wm"]},"video/x-ms-wmv":{"source":"apache","compressible":false,"extensions":["wmv"]},"video/x-ms-wmx":{"source":"apache","extensions":["wmx"]},"video/x-ms-wvx":{"source":"apache","extensions":["wvx"]},"video/x-msvideo":{"source":"apache","extensions":["avi"]},"video/x-sgi-movie":{"source":"apache","extensions":["movie"]},"video/x-smv":{"source":"apache","extensions":["smv"]},"x-conference/x-cooltalk":{"source":"apache","extensions":["ice"]},"x-shader/x-fragment":{"compressible":true},"x-shader/x-vertex":{"compressible":true}}; - -/***/ }), - -/***/ 920: -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_pattern(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - var $regexp = $isData ? '(new RegExp(' + $schemaValue + '))' : it.usePattern($schema); - out += 'if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || '; - } - out += ' !' + ($regexp) + '.test(' + ($data) + ') ) { '; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('pattern') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { pattern: '; - if ($isData) { - out += '' + ($schemaValue); - } else { - out += '' + (it.util.toQuotedString($schema)); - } - out += ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should match pattern "'; - if ($isData) { - out += '\' + ' + ($schemaValue) + ' + \''; - } else { - out += '' + (it.util.escapeQuotes($schema)); - } - out += '"\' '; - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + (it.util.toQuotedString($schema)); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += '} '; - if ($breakOnError) { - out += ' else { '; - } - return out; -} - - -/***/ }), - -/***/ 922: -/***/ (function(module) { - -"use strict"; - - -var hasOwn = Object.prototype.hasOwnProperty; -var toStr = Object.prototype.toString; -var defineProperty = Object.defineProperty; -var gOPD = Object.getOwnPropertyDescriptor; - -var isArray = function isArray(arr) { - if (typeof Array.isArray === 'function') { - return Array.isArray(arr); - } - - return toStr.call(arr) === '[object Array]'; -}; - -var isPlainObject = function isPlainObject(obj) { - if (!obj || toStr.call(obj) !== '[object Object]') { - return false; - } - - var hasOwnConstructor = hasOwn.call(obj, 'constructor'); - var hasIsPrototypeOf = obj.constructor && obj.constructor.prototype && hasOwn.call(obj.constructor.prototype, 'isPrototypeOf'); - // Not own constructor property must be Object - if (obj.constructor && !hasOwnConstructor && !hasIsPrototypeOf) { - return false; - } - - // Own properties are enumerated firstly, so to speed up, - // if last one is own, then all properties are own. - var key; - for (key in obj) { /**/ } - - return typeof key === 'undefined' || hasOwn.call(obj, key); -}; - -// If name is '__proto__', and Object.defineProperty is available, define __proto__ as an own property on target -var setProperty = function setProperty(target, options) { - if (defineProperty && options.name === '__proto__') { - defineProperty(target, options.name, { - enumerable: true, - configurable: true, - value: options.newValue, - writable: true - }); - } else { - target[options.name] = options.newValue; - } -}; - -// Return undefined instead of __proto__ if '__proto__' is not an own property -var getProperty = function getProperty(obj, name) { - if (name === '__proto__') { - if (!hasOwn.call(obj, name)) { - return void 0; - } else if (gOPD) { - // In early versions of node, obj['__proto__'] is buggy when obj has - // __proto__ as an own property. Object.getOwnPropertyDescriptor() works. - return gOPD(obj, name).value; - } - } - - return obj[name]; -}; - -module.exports = function extend() { - var options, name, src, copy, copyIsArray, clone; - var target = arguments[0]; - var i = 1; - var length = arguments.length; - var deep = false; - - // Handle a deep copy situation - if (typeof target === 'boolean') { - deep = target; - target = arguments[1] || {}; - // skip the boolean and the target - i = 2; - } - if (target == null || (typeof target !== 'object' && typeof target !== 'function')) { - target = {}; - } - - for (; i < length; ++i) { - options = arguments[i]; - // Only deal with non-null/undefined values - if (options != null) { - // Extend the base object - for (name in options) { - src = getProperty(target, name); - copy = getProperty(options, name); - - // Prevent never-ending loop - if (target !== copy) { - // Recurse if we're merging plain objects or arrays - if (deep && copy && (isPlainObject(copy) || (copyIsArray = isArray(copy)))) { - if (copyIsArray) { - copyIsArray = false; - clone = src && isArray(src) ? src : []; - } else { - clone = src && isPlainObject(src) ? src : {}; - } - - // Never move original objects, clone them - setProperty(target, { name: name, newValue: extend(deep, clone, copy) }); - - // Don't bring in undefined values - } else if (typeof copy !== 'undefined') { - setProperty(target, { name: name, newValue: copy }); - } - } - } - } - } - - // Return the modified object - return target; -}; - - -/***/ }), - -/***/ 923: -/***/ (function(module) { - -module.exports = {"$schema":"http://json-schema.org/draft-06/schema#","$id":"http://json-schema.org/draft-06/schema#","title":"Core schema meta-schema","definitions":{"schemaArray":{"type":"array","minItems":1,"items":{"$ref":"#"}},"nonNegativeInteger":{"type":"integer","minimum":0},"nonNegativeIntegerDefault0":{"allOf":[{"$ref":"#/definitions/nonNegativeInteger"},{"default":0}]},"simpleTypes":{"enum":["array","boolean","integer","null","number","object","string"]},"stringArray":{"type":"array","items":{"type":"string"},"uniqueItems":true,"default":[]}},"type":["object","boolean"],"properties":{"$id":{"type":"string","format":"uri-reference"},"$schema":{"type":"string","format":"uri"},"$ref":{"type":"string","format":"uri-reference"},"title":{"type":"string"},"description":{"type":"string"},"default":{},"examples":{"type":"array","items":{}},"multipleOf":{"type":"number","exclusiveMinimum":0},"maximum":{"type":"number"},"exclusiveMaximum":{"type":"number"},"minimum":{"type":"number"},"exclusiveMinimum":{"type":"number"},"maxLength":{"$ref":"#/definitions/nonNegativeInteger"},"minLength":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"pattern":{"type":"string","format":"regex"},"additionalItems":{"$ref":"#"},"items":{"anyOf":[{"$ref":"#"},{"$ref":"#/definitions/schemaArray"}],"default":{}},"maxItems":{"$ref":"#/definitions/nonNegativeInteger"},"minItems":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"uniqueItems":{"type":"boolean","default":false},"contains":{"$ref":"#"},"maxProperties":{"$ref":"#/definitions/nonNegativeInteger"},"minProperties":{"$ref":"#/definitions/nonNegativeIntegerDefault0"},"required":{"$ref":"#/definitions/stringArray"},"additionalProperties":{"$ref":"#"},"definitions":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"properties":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"patternProperties":{"type":"object","additionalProperties":{"$ref":"#"},"default":{}},"dependencies":{"type":"object","additionalProperties":{"anyOf":[{"$ref":"#"},{"$ref":"#/definitions/stringArray"}]}},"propertyNames":{"$ref":"#"},"const":{},"enum":{"type":"array","minItems":1,"uniqueItems":true},"type":{"anyOf":[{"$ref":"#/definitions/simpleTypes"},{"type":"array","items":{"$ref":"#/definitions/simpleTypes"},"minItems":1,"uniqueItems":true}]},"format":{"type":"string"},"allOf":{"$ref":"#/definitions/schemaArray"},"anyOf":{"$ref":"#/definitions/schemaArray"},"oneOf":{"$ref":"#/definitions/schemaArray"},"not":{"$ref":"#"}},"default":{}}; - -/***/ }), - -/***/ 925: -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -var resolve = __webpack_require__(386) - , util = __webpack_require__(435) - , errorClasses = __webpack_require__(702) - , stableStringify = __webpack_require__(516); - -var validateGenerator = __webpack_require__(24); - -/** - * Functions below are used inside compiled validations function - */ - -var ucs2length = util.ucs2length; -var equal = __webpack_require__(58); - -// this error is thrown by async schemas to return validation errors via exception -var ValidationError = errorClasses.Validation; - -module.exports = compile; - - -/** - * Compiles schema to validation function - * @this Ajv - * @param {Object} schema schema object - * @param {Object} root object with information about the root schema for this schema - * @param {Object} localRefs the hash of local references inside the schema (created by resolve.id), used for inline resolution - * @param {String} baseId base ID for IDs in the schema - * @return {Function} validation function - */ -function compile(schema, root, localRefs, baseId) { - /* jshint validthis: true, evil: true */ - /* eslint no-shadow: 0 */ - var self = this - , opts = this._opts - , refVal = [ undefined ] - , refs = {} - , patterns = [] - , patternsHash = {} - , defaults = [] - , defaultsHash = {} - , customRules = []; - - root = root || { schema: schema, refVal: refVal, refs: refs }; - - var c = checkCompiling.call(this, schema, root, baseId); - var compilation = this._compilations[c.index]; - if (c.compiling) return (compilation.callValidate = callValidate); - - var formats = this._formats; - var RULES = this.RULES; - - try { - var v = localCompile(schema, root, localRefs, baseId); - compilation.validate = v; - var cv = compilation.callValidate; - if (cv) { - cv.schema = v.schema; - cv.errors = null; - cv.refs = v.refs; - cv.refVal = v.refVal; - cv.root = v.root; - cv.$async = v.$async; - if (opts.sourceCode) cv.source = v.source; - } - return v; - } finally { - endCompiling.call(this, schema, root, baseId); - } - - /* @this {*} - custom context, see passContext option */ - function callValidate() { - /* jshint validthis: true */ - var validate = compilation.validate; - var result = validate.apply(this, arguments); - callValidate.errors = validate.errors; - return result; - } - - function localCompile(_schema, _root, localRefs, baseId) { - var isRoot = !_root || (_root && _root.schema == _schema); - if (_root.schema != root.schema) - return compile.call(self, _schema, _root, localRefs, baseId); - - var $async = _schema.$async === true; - - var sourceCode = validateGenerator({ - isTop: true, - schema: _schema, - isRoot: isRoot, - baseId: baseId, - root: _root, - schemaPath: '', - errSchemaPath: '#', - errorPath: '""', - MissingRefError: errorClasses.MissingRef, - RULES: RULES, - validate: validateGenerator, - util: util, - resolve: resolve, - resolveRef: resolveRef, - usePattern: usePattern, - useDefault: useDefault, - useCustomRule: useCustomRule, - opts: opts, - formats: formats, - logger: self.logger, - self: self - }); - - sourceCode = vars(refVal, refValCode) + vars(patterns, patternCode) - + vars(defaults, defaultCode) + vars(customRules, customRuleCode) - + sourceCode; - - if (opts.processCode) sourceCode = opts.processCode(sourceCode); - // console.log('\n\n\n *** \n', JSON.stringify(sourceCode)); - var validate; - try { - var makeValidate = new Function( - 'self', - 'RULES', - 'formats', - 'root', - 'refVal', - 'defaults', - 'customRules', - 'equal', - 'ucs2length', - 'ValidationError', - sourceCode - ); - - validate = makeValidate( - self, - RULES, - formats, - root, - refVal, - defaults, - customRules, - equal, - ucs2length, - ValidationError - ); - - refVal[0] = validate; - } catch(e) { - self.logger.error('Error compiling schema, function code:', sourceCode); - throw e; - } - - validate.schema = _schema; - validate.errors = null; - validate.refs = refs; - validate.refVal = refVal; - validate.root = isRoot ? validate : _root; - if ($async) validate.$async = true; - if (opts.sourceCode === true) { - validate.source = { - code: sourceCode, - patterns: patterns, - defaults: defaults - }; - } - - return validate; - } - - function resolveRef(baseId, ref, isRoot) { - ref = resolve.url(baseId, ref); - var refIndex = refs[ref]; - var _refVal, refCode; - if (refIndex !== undefined) { - _refVal = refVal[refIndex]; - refCode = 'refVal[' + refIndex + ']'; - return resolvedRef(_refVal, refCode); - } - if (!isRoot && root.refs) { - var rootRefId = root.refs[ref]; - if (rootRefId !== undefined) { - _refVal = root.refVal[rootRefId]; - refCode = addLocalRef(ref, _refVal); - return resolvedRef(_refVal, refCode); - } - } - - refCode = addLocalRef(ref); - var v = resolve.call(self, localCompile, root, ref); - if (v === undefined) { - var localSchema = localRefs && localRefs[ref]; - if (localSchema) { - v = resolve.inlineRef(localSchema, opts.inlineRefs) - ? localSchema - : compile.call(self, localSchema, root, localRefs, baseId); - } - } - - if (v === undefined) { - removeLocalRef(ref); - } else { - replaceLocalRef(ref, v); - return resolvedRef(v, refCode); - } - } - - function addLocalRef(ref, v) { - var refId = refVal.length; - refVal[refId] = v; - refs[ref] = refId; - return 'refVal' + refId; - } - - function removeLocalRef(ref) { - delete refs[ref]; - } - - function replaceLocalRef(ref, v) { - var refId = refs[ref]; - refVal[refId] = v; - } - - function resolvedRef(refVal, code) { - return typeof refVal == 'object' || typeof refVal == 'boolean' - ? { code: code, schema: refVal, inline: true } - : { code: code, $async: refVal && !!refVal.$async }; - } - - function usePattern(regexStr) { - var index = patternsHash[regexStr]; - if (index === undefined) { - index = patternsHash[regexStr] = patterns.length; - patterns[index] = regexStr; - } - return 'pattern' + index; - } - - function useDefault(value) { - switch (typeof value) { - case 'boolean': - case 'number': - return '' + value; - case 'string': - return util.toQuotedString(value); - case 'object': - if (value === null) return 'null'; - var valueStr = stableStringify(value); - var index = defaultsHash[valueStr]; - if (index === undefined) { - index = defaultsHash[valueStr] = defaults.length; - defaults[index] = value; - } - return 'default' + index; - } - } - - function useCustomRule(rule, schema, parentSchema, it) { - if (self._opts.validateSchema !== false) { - var deps = rule.definition.dependencies; - if (deps && !deps.every(function(keyword) { - return Object.prototype.hasOwnProperty.call(parentSchema, keyword); - })) - throw new Error('parent schema must have all required keywords: ' + deps.join(',')); - - var validateSchema = rule.definition.validateSchema; - if (validateSchema) { - var valid = validateSchema(schema); - if (!valid) { - var message = 'keyword schema is invalid: ' + self.errorsText(validateSchema.errors); - if (self._opts.validateSchema == 'log') self.logger.error(message); - else throw new Error(message); - } - } - } - - var compile = rule.definition.compile - , inline = rule.definition.inline - , macro = rule.definition.macro; - - var validate; - if (compile) { - validate = compile.call(self, schema, parentSchema, it); - } else if (macro) { - validate = macro.call(self, schema, parentSchema, it); - if (opts.validateSchema !== false) self.validateSchema(validate, true); - } else if (inline) { - validate = inline.call(self, it, rule.keyword, schema, parentSchema); - } else { - validate = rule.definition.validate; - if (!validate) return; - } - - if (validate === undefined) - throw new Error('custom keyword "' + rule.keyword + '"failed to compile'); - - var index = customRules.length; - customRules[index] = validate; - - return { - code: 'customRule' + index, - validate: validate - }; - } -} - - -/** - * Checks if the schema is currently compiled - * @this Ajv - * @param {Object} schema schema to compile - * @param {Object} root root object - * @param {String} baseId base schema ID - * @return {Object} object with properties "index" (compilation index) and "compiling" (boolean) - */ -function checkCompiling(schema, root, baseId) { - /* jshint validthis: true */ - var index = compIndex.call(this, schema, root, baseId); - if (index >= 0) return { index: index, compiling: true }; - index = this._compilations.length; - this._compilations[index] = { - schema: schema, - root: root, - baseId: baseId - }; - return { index: index, compiling: false }; -} - - -/** - * Removes the schema from the currently compiled list - * @this Ajv - * @param {Object} schema schema to compile - * @param {Object} root root object - * @param {String} baseId base schema ID - */ -function endCompiling(schema, root, baseId) { - /* jshint validthis: true */ - var i = compIndex.call(this, schema, root, baseId); - if (i >= 0) this._compilations.splice(i, 1); -} - - -/** - * Index of schema compilation in the currently compiled list - * @this Ajv - * @param {Object} schema schema to compile - * @param {Object} root root object - * @param {String} baseId base schema ID - * @return {Integer} compilation index - */ -function compIndex(schema, root, baseId) { - /* jshint validthis: true */ - for (var i=0; i - * - * Licensed under the Apache License, Version 2.0 (the "License"); - * you may not use this file except in compliance with the License. - * You may obtain a copy of the License at - * - * http://www.apache.org/licenses/LICENSE-2.0 - * - * Unless required by applicable law or agreed to in writing, software - * distributed under the License is distributed on an "AS IS" BASIS, - * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. - * See the License for the specific language governing permissions and - * limitations under the License. - */ - -/** - * Module dependencies. - */ - -var crypto = __webpack_require__(417) - , parse = __webpack_require__(835).parse - ; - -/** - * Valid keys. - */ - -var keys = - [ 'acl' - , 'location' - , 'logging' - , 'notification' - , 'partNumber' - , 'policy' - , 'requestPayment' - , 'torrent' - , 'uploadId' - , 'uploads' - , 'versionId' - , 'versioning' - , 'versions' - , 'website' - ] - -/** - * Return an "Authorization" header value with the given `options` - * in the form of "AWS :" - * - * @param {Object} options - * @return {String} - * @api private - */ - -function authorization (options) { - return 'AWS ' + options.key + ':' + sign(options) -} - -module.exports = authorization -module.exports.authorization = authorization - -/** - * Simple HMAC-SHA1 Wrapper - * - * @param {Object} options - * @return {String} - * @api private - */ - -function hmacSha1 (options) { - return crypto.createHmac('sha1', options.secret).update(options.message).digest('base64') -} - -module.exports.hmacSha1 = hmacSha1 - -/** - * Create a base64 sha1 HMAC for `options`. - * - * @param {Object} options - * @return {String} - * @api private - */ - -function sign (options) { - options.message = stringToSign(options) - return hmacSha1(options) -} -module.exports.sign = sign - -/** - * Create a base64 sha1 HMAC for `options`. - * - * Specifically to be used with S3 presigned URLs - * - * @param {Object} options - * @return {String} - * @api private - */ - -function signQuery (options) { - options.message = queryStringToSign(options) - return hmacSha1(options) -} -module.exports.signQuery= signQuery - -/** - * Return a string for sign() with the given `options`. - * - * Spec: - * - * \n - * \n - * \n - * \n - * [headers\n] - * - * - * @param {Object} options - * @return {String} - * @api private - */ - -function stringToSign (options) { - var headers = options.amazonHeaders || '' - if (headers) headers += '\n' - var r = - [ options.verb - , options.md5 - , options.contentType - , options.date ? options.date.toUTCString() : '' - , headers + options.resource - ] - return r.join('\n') -} -module.exports.stringToSign = stringToSign - -/** - * Return a string for sign() with the given `options`, but is meant exclusively - * for S3 presigned URLs - * - * Spec: - * - * \n - * - * - * @param {Object} options - * @return {String} - * @api private - */ - -function queryStringToSign (options){ - return 'GET\n\n\n' + options.date + '\n' + options.resource -} -module.exports.queryStringToSign = queryStringToSign - -/** - * Perform the following: - * - * - ignore non-amazon headers - * - lowercase fields - * - sort lexicographically - * - trim whitespace between ":" - * - join with newline - * - * @param {Object} headers - * @return {String} - * @api private - */ - -function canonicalizeHeaders (headers) { - var buf = [] - , fields = Object.keys(headers) - ; - for (var i = 0, len = fields.length; i < len; ++i) { - var field = fields[i] - , val = headers[field] - , field = field.toLowerCase() - ; - if (0 !== field.indexOf('x-amz')) continue - buf.push(field + ':' + val) - } - return buf.sort().join('\n') -} -module.exports.canonicalizeHeaders = canonicalizeHeaders - -/** - * Perform the following: - * - * - ignore non sub-resources - * - sort lexicographically - * - * @param {String} resource - * @return {String} - * @api private - */ - -function canonicalizeResource (resource) { - var url = parse(resource, true) - , path = url.pathname - , buf = [] - ; - - Object.keys(url.query).forEach(function(key){ - if (!~keys.indexOf(key)) return - var val = '' == url.query[key] ? '' : '=' + encodeURIComponent(url.query[key]) - buf.push(key + val) - }) - - return path + (buf.length ? '?' + buf.sort().join('&') : '') -} -module.exports.canonicalizeResource = canonicalizeResource - - -/***/ }), - -/***/ 936: -/***/ (function(module, __unusedexports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -var Buffer = __webpack_require__(375).Buffer; - -var algInfo = { - 'dsa': { - parts: ['p', 'q', 'g', 'y'], - sizePart: 'p' - }, - 'rsa': { - parts: ['e', 'n'], - sizePart: 'n' - }, - 'ecdsa': { - parts: ['curve', 'Q'], - sizePart: 'Q' - }, - 'ed25519': { - parts: ['A'], - sizePart: 'A' - } -}; -algInfo['curve25519'] = algInfo['ed25519']; - -var algPrivInfo = { - 'dsa': { - parts: ['p', 'q', 'g', 'y', 'x'] - }, - 'rsa': { - parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] - }, - 'ecdsa': { - parts: ['curve', 'Q', 'd'] - }, - 'ed25519': { - parts: ['A', 'k'] - } -}; -algPrivInfo['curve25519'] = algPrivInfo['ed25519']; - -var hashAlgs = { - 'md5': true, - 'sha1': true, - 'sha256': true, - 'sha384': true, - 'sha512': true -}; - -/* - * Taken from - * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf - */ -var curves = { - 'nistp256': { - size: 256, - pkcs8oid: '1.2.840.10045.3.1.7', - p: Buffer.from(('00' + - 'ffffffff 00000001 00000000 00000000' + - '00000000 ffffffff ffffffff ffffffff'). - replace(/ /g, ''), 'hex'), - a: Buffer.from(('00' + - 'FFFFFFFF 00000001 00000000 00000000' + - '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: Buffer.from(( - '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + - '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). - replace(/ /g, ''), 'hex'), - s: Buffer.from(('00' + - 'c49d3608 86e70493 6a6678e1 139d26b7' + - '819f7e90'). - replace(/ /g, ''), 'hex'), - n: Buffer.from(('00' + - 'ffffffff 00000000 ffffffff ffffffff' + - 'bce6faad a7179e84 f3b9cac2 fc632551'). - replace(/ /g, ''), 'hex'), - G: Buffer.from(('04' + - '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + - '77037d81 2deb33a0 f4a13945 d898c296' + - '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + - '2bce3357 6b315ece cbb64068 37bf51f5'). - replace(/ /g, ''), 'hex') - }, - 'nistp384': { - size: 384, - pkcs8oid: '1.3.132.0.34', - p: Buffer.from(('00' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff fffffffe' + - 'ffffffff 00000000 00000000 ffffffff'). - replace(/ /g, ''), 'hex'), - a: Buffer.from(('00' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + - 'FFFFFFFF 00000000 00000000 FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: Buffer.from(( - 'b3312fa7 e23ee7e4 988e056b e3f82d19' + - '181d9c6e fe814112 0314088f 5013875a' + - 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). - replace(/ /g, ''), 'hex'), - s: Buffer.from(('00' + - 'a335926a a319a27a 1d00896a 6773a482' + - '7acdac73'). - replace(/ /g, ''), 'hex'), - n: Buffer.from(('00' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff c7634d81 f4372ddf' + - '581a0db2 48b0a77a ecec196a ccc52973'). - replace(/ /g, ''), 'hex'), - G: Buffer.from(('04' + - 'aa87ca22 be8b0537 8eb1c71e f320ad74' + - '6e1d3b62 8ba79b98 59f741e0 82542a38' + - '5502f25d bf55296c 3a545e38 72760ab7' + - '3617de4a 96262c6f 5d9e98bf 9292dc29' + - 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + - '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). - replace(/ /g, ''), 'hex') - }, - 'nistp521': { - size: 521, - pkcs8oid: '1.3.132.0.35', - p: Buffer.from(( - '01ffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffff').replace(/ /g, ''), 'hex'), - a: Buffer.from(('01FF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: Buffer.from(('51' + - '953eb961 8e1c9a1f 929a21a0 b68540ee' + - 'a2da725b 99b315f3 b8b48991 8ef109e1' + - '56193951 ec7e937b 1652c0bd 3bb1bf07' + - '3573df88 3d2c34f1 ef451fd4 6b503f00'). - replace(/ /g, ''), 'hex'), - s: Buffer.from(('00' + - 'd09e8800 291cb853 96cc6717 393284aa' + - 'a0da64ba').replace(/ /g, ''), 'hex'), - n: Buffer.from(('01ff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff fffffffa' + - '51868783 bf2f966b 7fcc0148 f709a5d0' + - '3bb5c9b8 899c47ae bb6fb71e 91386409'). - replace(/ /g, ''), 'hex'), - G: Buffer.from(('04' + - '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + - '9c648139 053fb521 f828af60 6b4d3dba' + - 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + - '3348b3c1 856a429b f97e7e31 c2e5bd66' + - '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + - '98f54449 579b4468 17afbd17 273e662c' + - '97ee7299 5ef42640 c550b901 3fad0761' + - '353c7086 a272c240 88be9476 9fd16650'). - replace(/ /g, ''), 'hex') - } -}; - -module.exports = { - info: algInfo, - privInfo: algPrivInfo, - hashAlgs: hashAlgs, - curves: curves -}; - - -/***/ }), - -/***/ 947: -/***/ (function(module) { - -// API -module.exports = state; - -/** - * Creates initial state object - * for iteration over list - * - * @param {array|object} list - list to iterate over - * @param {function|null} sortMethod - function to use for keys sort, - * or `null` to keep them as is - * @returns {object} - initial state object - */ -function state(list, sortMethod) -{ - var isNamedList = !Array.isArray(list) - , initState = - { - index : 0, - keyedList: isNamedList || sortMethod ? Object.keys(list) : null, - jobs : {}, - results : isNamedList ? {} : [], - size : isNamedList ? Object.keys(list).length : list.length - } - ; - - if (sortMethod) - { - // sort array keys based on it's values - // sort object's keys just on own merit - initState.keyedList.sort(isNamedList ? sortMethod : function(a, b) - { - return sortMethod(list[a], list[b]); - }); - } - - return initState; -} - - -/***/ }), - -/***/ 948: -/***/ (function(module) { - -module.exports = {"$id":"har.json#","$schema":"http://json-schema.org/draft-06/schema#","type":"object","required":["log"],"properties":{"log":{"$ref":"log.json#"}}}; - -/***/ }), - -/***/ 951: -/***/ (function(module) { - -"use strict"; - -module.exports = function generate_oneOf(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $data = 'data' + ($dataLvl || ''); - var $valid = 'valid' + $lvl; - var $errs = 'errs__' + $lvl; - var $it = it.util.copy(it); - var $closingBraces = ''; - $it.level++; - var $nextValid = 'valid' + $it.level; - var $currentBaseId = $it.baseId, - $prevValid = 'prevValid' + $lvl, - $passingSchemas = 'passingSchemas' + $lvl; - out += 'var ' + ($errs) + ' = errors , ' + ($prevValid) + ' = false , ' + ($valid) + ' = false , ' + ($passingSchemas) + ' = null; '; - var $wasComposite = it.compositeRule; - it.compositeRule = $it.compositeRule = true; - var arr1 = $schema; - if (arr1) { - var $sch, $i = -1, - l1 = arr1.length - 1; - while ($i < l1) { - $sch = arr1[$i += 1]; - if ((it.opts.strictKeywords ? typeof $sch == 'object' && Object.keys($sch).length > 0 : it.util.schemaHasRules($sch, it.RULES.all))) { - $it.schema = $sch; - $it.schemaPath = $schemaPath + '[' + $i + ']'; - $it.errSchemaPath = $errSchemaPath + '/' + $i; - out += ' ' + (it.validate($it)) + ' '; - $it.baseId = $currentBaseId; - } else { - out += ' var ' + ($nextValid) + ' = true; '; - } - if ($i) { - out += ' if (' + ($nextValid) + ' && ' + ($prevValid) + ') { ' + ($valid) + ' = false; ' + ($passingSchemas) + ' = [' + ($passingSchemas) + ', ' + ($i) + ']; } else { '; - $closingBraces += '}'; - } - out += ' if (' + ($nextValid) + ') { ' + ($valid) + ' = ' + ($prevValid) + ' = true; ' + ($passingSchemas) + ' = ' + ($i) + '; }'; - } - } - it.compositeRule = $it.compositeRule = $wasComposite; - out += '' + ($closingBraces) + 'if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ('oneOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { passingSchemas: ' + ($passingSchemas) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should match exactly one schema in oneOf\' '; - } - if (it.opts.verbose) { - out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError(vErrors); '; - } else { - out += ' validate.errors = vErrors; return false; '; - } - } - out += '} else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; }'; - if (it.opts.allErrors) { - out += ' } '; - } - return out; -} - - -/***/ }), - -/***/ 969: -/***/ (function(module) { - -"use strict"; - -module.exports = function generate__limitLength(it, $keyword, $ruleType) { - var out = ' '; - var $lvl = it.level; - var $dataLvl = it.dataLevel; - var $schema = it.schema[$keyword]; - var $schemaPath = it.schemaPath + it.util.getProperty($keyword); - var $errSchemaPath = it.errSchemaPath + '/' + $keyword; - var $breakOnError = !it.opts.allErrors; - var $errorKeyword; - var $data = 'data' + ($dataLvl || ''); - var $isData = it.opts.$data && $schema && $schema.$data, - $schemaValue; - if ($isData) { - out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; '; - $schemaValue = 'schema' + $lvl; - } else { - $schemaValue = $schema; - } - var $op = $keyword == 'maxLength' ? '>' : '<'; - out += 'if ( '; - if ($isData) { - out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || '; - } - if (it.opts.unicode === false) { - out += ' ' + ($data) + '.length '; - } else { - out += ' ucs2length(' + ($data) + ') '; - } - out += ' ' + ($op) + ' ' + ($schemaValue) + ') { '; - var $errorKeyword = $keyword; - var $$outStack = $$outStack || []; - $$outStack.push(out); - out = ''; /* istanbul ignore else */ - if (it.createErrors !== false) { - out += ' { keyword: \'' + ($errorKeyword || '_limitLength') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } '; - if (it.opts.messages !== false) { - out += ' , message: \'should NOT be '; - if ($keyword == 'maxLength') { - out += 'longer'; - } else { - out += 'shorter'; - } - out += ' than '; - if ($isData) { - out += '\' + ' + ($schemaValue) + ' + \''; - } else { - out += '' + ($schema); - } - out += ' characters\' '; - } - if (it.opts.verbose) { - out += ' , schema: '; - if ($isData) { - out += 'validate.schema' + ($schemaPath); - } else { - out += '' + ($schema); - } - out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' '; - } - out += ' } '; - } else { - out += ' {} '; - } - var __err = out; - out = $$outStack.pop(); - if (!it.compositeRule && $breakOnError) { - /* istanbul ignore if */ - if (it.async) { - out += ' throw new ValidationError([' + (__err) + ']); '; - } else { - out += ' validate.errors = [' + (__err) + ']; return false; '; - } - } else { - out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; '; - } - out += '} '; - if ($breakOnError) { - out += ' else { '; - } - return out; -} - - -/***/ }), - -/***/ 970: -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -var metaSchema = __webpack_require__(806); - -module.exports = { - $id: 'https://github.com/epoberezkin/ajv/blob/master/lib/definition_schema.js', - definitions: { - simpleTypes: metaSchema.definitions.simpleTypes - }, - type: 'object', - dependencies: { - schema: ['validate'], - $data: ['validate'], - statements: ['inline'], - valid: {not: {required: ['macro']}} - }, - properties: { - type: metaSchema.properties.type, - schema: {type: 'boolean'}, - statements: {type: 'boolean'}, - dependencies: { - type: 'array', - items: {type: 'string'} - }, - metaSchema: {type: 'object'}, - modifying: {type: 'boolean'}, - valid: {type: 'boolean'}, - $data: {type: 'boolean'}, - async: {type: 'boolean'}, - errors: { - anyOf: [ - {type: 'boolean'}, - {const: 'full'} - ] - } - } -}; - - -/***/ }), - -/***/ 975: -/***/ (function(module) { - -/** - * JSONSchema Validator - Validates JavaScript objects using JSON Schemas - * (http://www.json.com/json-schema-proposal/) - * - * Copyright (c) 2007 Kris Zyp SitePen (www.sitepen.com) - * Licensed under the MIT (MIT-LICENSE.txt) license. -To use the validator call the validate function with an instance object and an optional schema object. -If a schema is provided, it will be used to validate. If the instance object refers to a schema (self-validating), -that schema will be used to validate and the schema parameter is not necessary (if both exist, -both validations will occur). -The validate method will return an array of validation errors. If there are no errors, then an -empty list will be returned. A validation error will have two properties: -"property" which indicates which property had the error -"message" which indicates what the error was - */ -(function (root, factory) { - if (typeof define === 'function' && define.amd) { - // AMD. Register as an anonymous module. - define([], function () { - return factory(); - }); - } else if ( true && module.exports) { - // Node. Does not work with strict CommonJS, but - // only CommonJS-like environments that support module.exports, - // like Node. - module.exports = factory(); - } else { - // Browser globals - root.jsonSchema = factory(); - } -}(this, function () {// setup primitive classes to be JSON Schema types -var exports = validate -exports.Integer = {type:"integer"}; -var primitiveConstructors = { - String: String, - Boolean: Boolean, - Number: Number, - Object: Object, - Array: Array, - Date: Date -} -exports.validate = validate; -function validate(/*Any*/instance,/*Object*/schema) { - // Summary: - // To use the validator call JSONSchema.validate with an instance object and an optional schema object. - // If a schema is provided, it will be used to validate. If the instance object refers to a schema (self-validating), - // that schema will be used to validate and the schema parameter is not necessary (if both exist, - // both validations will occur). - // The validate method will return an object with two properties: - // valid: A boolean indicating if the instance is valid by the schema - // errors: An array of validation errors. If there are no errors, then an - // empty list will be returned. A validation error will have two properties: - // property: which indicates which property had the error - // message: which indicates what the error was - // - return validate(instance, schema, {changing: false});//, coerce: false, existingOnly: false}); - }; -exports.checkPropertyChange = function(/*Any*/value,/*Object*/schema, /*String*/property) { - // Summary: - // The checkPropertyChange method will check to see if an value can legally be in property with the given schema - // This is slightly different than the validate method in that it will fail if the schema is readonly and it will - // not check for self-validation, it is assumed that the passed in value is already internally valid. - // The checkPropertyChange method will return the same object type as validate, see JSONSchema.validate for - // information. - // - return validate(value, schema, {changing: property || "property"}); - }; -var validate = exports._validate = function(/*Any*/instance,/*Object*/schema,/*Object*/options) { - - if (!options) options = {}; - var _changing = options.changing; - - function getType(schema){ - return schema.type || (primitiveConstructors[schema.name] == schema && schema.name.toLowerCase()); - } - var errors = []; - // validate a value against a property definition - function checkProp(value, schema, path,i){ - - var l; - path += path ? typeof i == 'number' ? '[' + i + ']' : typeof i == 'undefined' ? '' : '.' + i : i; - function addError(message){ - errors.push({property:path,message:message}); - } - - if((typeof schema != 'object' || schema instanceof Array) && (path || typeof schema != 'function') && !(schema && getType(schema))){ - if(typeof schema == 'function'){ - if(!(value instanceof schema)){ - addError("is not an instance of the class/constructor " + schema.name); - } - }else if(schema){ - addError("Invalid schema/property definition " + schema); - } - return null; - } - if(_changing && schema.readonly){ - addError("is a readonly field, it can not be changed"); - } - if(schema['extends']){ // if it extends another schema, it must pass that schema as well - checkProp(value,schema['extends'],path,i); - } - // validate a value against a type definition - function checkType(type,value){ - if(type){ - if(typeof type == 'string' && type != 'any' && - (type == 'null' ? value !== null : typeof value != type) && - !(value instanceof Array && type == 'array') && - !(value instanceof Date && type == 'date') && - !(type == 'integer' && value%1===0)){ - return [{property:path,message:(typeof value) + " value found, but a " + type + " is required"}]; - } - if(type instanceof Array){ - var unionErrors=[]; - for(var j = 0; j < type.length; j++){ // a union type - if(!(unionErrors=checkType(type[j],value)).length){ - break; - } - } - if(unionErrors.length){ - return unionErrors; - } - }else if(typeof type == 'object'){ - var priorErrors = errors; - errors = []; - checkProp(value,type,path); - var theseErrors = errors; - errors = priorErrors; - return theseErrors; - } - } - return []; - } - if(value === undefined){ - if(schema.required){ - addError("is missing and it is required"); - } - }else{ - errors = errors.concat(checkType(getType(schema),value)); - if(schema.disallow && !checkType(schema.disallow,value).length){ - addError(" disallowed value was matched"); - } - if(value !== null){ - if(value instanceof Array){ - if(schema.items){ - var itemsIsArray = schema.items instanceof Array; - var propDef = schema.items; - for (i = 0, l = value.length; i < l; i += 1) { - if (itemsIsArray) - propDef = schema.items[i]; - if (options.coerce) - value[i] = options.coerce(value[i], propDef); - errors.concat(checkProp(value[i],propDef,path,i)); - } - } - if(schema.minItems && value.length < schema.minItems){ - addError("There must be a minimum of " + schema.minItems + " in the array"); - } - if(schema.maxItems && value.length > schema.maxItems){ - addError("There must be a maximum of " + schema.maxItems + " in the array"); - } - }else if(schema.properties || schema.additionalProperties){ - errors.concat(checkObj(value, schema.properties, path, schema.additionalProperties)); - } - if(schema.pattern && typeof value == 'string' && !value.match(schema.pattern)){ - addError("does not match the regex pattern " + schema.pattern); - } - if(schema.maxLength && typeof value == 'string' && value.length > schema.maxLength){ - addError("may only be " + schema.maxLength + " characters long"); - } - if(schema.minLength && typeof value == 'string' && value.length < schema.minLength){ - addError("must be at least " + schema.minLength + " characters long"); - } - if(typeof schema.minimum !== undefined && typeof value == typeof schema.minimum && - schema.minimum > value){ - addError("must have a minimum value of " + schema.minimum); - } - if(typeof schema.maximum !== undefined && typeof value == typeof schema.maximum && - schema.maximum < value){ - addError("must have a maximum value of " + schema.maximum); - } - if(schema['enum']){ - var enumer = schema['enum']; - l = enumer.length; - var found; - for(var j = 0; j < l; j++){ - if(enumer[j]===value){ - found=1; - break; - } - } - if(!found){ - addError("does not have a value in the enumeration " + enumer.join(", ")); - } - } - if(typeof schema.maxDecimal == 'number' && - (value.toString().match(new RegExp("\\.[0-9]{" + (schema.maxDecimal + 1) + ",}")))){ - addError("may only have " + schema.maxDecimal + " digits of decimal places"); - } - } - } - return null; - } - // validate an object against a schema - function checkObj(instance,objTypeDef,path,additionalProp){ - - if(typeof objTypeDef =='object'){ - if(typeof instance != 'object' || instance instanceof Array){ - errors.push({property:path,message:"an object is required"}); - } - - for(var i in objTypeDef){ - if(objTypeDef.hasOwnProperty(i)){ - var value = instance[i]; - // skip _not_ specified properties - if (value === undefined && options.existingOnly) continue; - var propDef = objTypeDef[i]; - // set default - if(value === undefined && propDef["default"]){ - value = instance[i] = propDef["default"]; - } - if(options.coerce && i in instance){ - value = instance[i] = options.coerce(value, propDef); - } - checkProp(value,propDef,path,i); - } - } - } - for(i in instance){ - if(instance.hasOwnProperty(i) && !(i.charAt(0) == '_' && i.charAt(1) == '_') && objTypeDef && !objTypeDef[i] && additionalProp===false){ - if (options.filter) { - delete instance[i]; - continue; - } else { - errors.push({property:path,message:(typeof value) + "The property " + i + - " is not defined in the schema and the schema does not allow additional properties"}); - } - } - var requires = objTypeDef && objTypeDef[i] && objTypeDef[i].requires; - if(requires && !(requires in instance)){ - errors.push({property:path,message:"the presence of the property " + i + " requires that " + requires + " also be present"}); - } - value = instance[i]; - if(additionalProp && (!(objTypeDef && typeof objTypeDef == 'object') || !(i in objTypeDef))){ - if(options.coerce){ - value = instance[i] = options.coerce(value, additionalProp); - } - checkProp(value,additionalProp,path,i); - } - if(!_changing && value && value.$schema){ - errors = errors.concat(checkProp(value,value.$schema,path,i)); - } - } - return errors; - } - if(schema){ - checkProp(instance,schema,'',_changing || ''); - } - if(!_changing && instance && instance.$schema){ - checkProp(instance,instance.$schema,'',''); - } - return {valid:!errors.length,errors:errors}; -}; -exports.mustBeValid = function(result){ - // summary: - // This checks to ensure that the result is valid and will throw an appropriate error message if it is not - // result: the result returned from checkPropertyChange or validate - if(!result.valid){ - throw new TypeError(result.errors.map(function(error){return "for property " + error.property + ': ' + error.message;}).join(", \n")); - } -} - -return exports; -})); - - -/***/ }), - -/***/ 988: -/***/ (function(module, __unusedexports, __webpack_require__) { - -"use strict"; - - -var MissingRefError = __webpack_require__(702).MissingRef; - -module.exports = compileAsync; - - -/** - * Creates validating function for passed schema with asynchronous loading of missing schemas. - * `loadSchema` option should be a function that accepts schema uri and returns promise that resolves with the schema. - * @this Ajv - * @param {Object} schema schema object - * @param {Boolean} meta optional true to compile meta-schema; this parameter can be skipped - * @param {Function} callback an optional node-style callback, it is called with 2 parameters: error (or null) and validating function. - * @return {Promise} promise that resolves with a validating function. - */ -function compileAsync(schema, meta, callback) { - /* eslint no-shadow: 0 */ - /* global Promise */ - /* jshint validthis: true */ - var self = this; - if (typeof this._opts.loadSchema != 'function') - throw new Error('options.loadSchema should be a function'); - - if (typeof meta == 'function') { - callback = meta; - meta = undefined; - } - - var p = loadMetaSchemaOf(schema).then(function () { - var schemaObj = self._addSchema(schema, undefined, meta); - return schemaObj.validate || _compileAsync(schemaObj); - }); - - if (callback) { - p.then( - function(v) { callback(null, v); }, - callback - ); - } - - return p; - - - function loadMetaSchemaOf(sch) { - var $schema = sch.$schema; - return $schema && !self.getSchema($schema) - ? compileAsync.call(self, { $ref: $schema }, true) - : Promise.resolve(); - } - - - function _compileAsync(schemaObj) { - try { return self._compile(schemaObj); } - catch(e) { - if (e instanceof MissingRefError) return loadMissingSchema(e); - throw e; - } - - - function loadMissingSchema(e) { - var ref = e.missingSchema; - if (added(ref)) throw new Error('Schema ' + ref + ' is loaded but ' + e.missingRef + ' cannot be resolved'); - - var schemaPromise = self._loadingSchemas[ref]; - if (!schemaPromise) { - schemaPromise = self._loadingSchemas[ref] = self._opts.loadSchema(ref); - schemaPromise.then(removePromise, removePromise); - } - - return schemaPromise.then(function (sch) { - if (!added(ref)) { - return loadMetaSchemaOf(sch).then(function () { - if (!added(ref)) self.addSchema(sch, ref, undefined, meta); - }); - } - }).then(function() { - return _compileAsync(schemaObj); - }); - - function removePromise() { - delete self._loadingSchemas[ref]; - } - - function added(ref) { - return self._refs[ref] || self._schemas[ref]; - } - } - } -} +module.exports = Writer; /***/ }) diff --git a/index.js b/index.js index 46e9404..5655b8c 100644 --- a/index.js +++ b/index.js @@ -9,6 +9,8 @@ try { const token = core.getInput("token"); const flags = core.getInput("flags"); const file = core.getInput("file"); + const env_vars = core.getInput("env_vars"); + fail_ci = core.getInput("fail_ci_if_error").toLowerCase(); if ( @@ -62,6 +64,15 @@ try { options.env.CODECOV_TOKEN = token } + const env_vars_arg = [] + for (let env_var of env_vars.split(",")) { + let env_var_clean = env_var.trim(); + if (env_var_clean) { + options.env[env_var_clean] = process.env[env_var_clean]; + env_vars_arg.push(env_var_clean) + } + } + const execArgs = ["codecov.sh"]; if (file) { execArgs.push( @@ -80,6 +91,12 @@ try { ); } + if (env_vars_arg.length) { + execArgs.push( + "-e", env_vars_arg.join(",") + ); + } + exec.exec("bash", execArgs, options) .catch(err => { if (fail_ci) { @@ -92,7 +109,7 @@ try { }) .then(() => { unlinkFile(); - });; + }); const unlinkFile = () => { fs.unlink("codecov.sh", err => {